--- /dev/null
+HTSWorkflow: Sample Tracker
+Authors:
+ * Brandon W. King
+
+Debian Dependencies:
+ * python-django >= 1.0.x
+ * python-json
--- /dev/null
+from django.contrib import admin
+from samplebc.bcmagic.models import KeywordMap
+
+class KeywordMapAdmin(admin.ModelAdmin):
+ list_display = ('keyword','regex', 'url_template')
+
+admin.site.register(KeywordMap, KeywordMapAdmin)
\ No newline at end of file
--- /dev/null
+from django import forms
+
+class BarcodeMagicForm(forms.Form):
+ magic = forms.CharField(label="Barcode Magic")
+
+ class Media:
+ js = ('js/jquery.timers-1.0.0.js',
+ 'js/magicbc.js')
--- /dev/null
+from django.db import models
+
+class KeywordMap(models.Model):
+ """
+ Mapper object maps keyword|arg1|arg2|...|argN to REST urls
+ """
+ keyword = models.CharField(max_length=64)
+ regex = models.CharField(max_length=1024)
+ url_template = models.TextField()
--- /dev/null
+from django.conf.urls.defaults import *
+
+urlpatterns = patterns('',
+ (r'^json_test/$', 'samplebc.bcmagic.views.json_test'),
+ (r'^magic/$', 'samplebc.bcmagic.views.magic'),
+ (r'^$', 'samplebc.bcmagic.views.index'),
+)
\ No newline at end of file
--- /dev/null
+from django.http import HttpResponse
+from django.template import RequestContext, Template, Context
+from django.shortcuts import render_to_response
+from django.core.exceptions import ObjectDoesNotExist
+
+from samplebc.bcmagic import models
+
+import json
+import re
+
+from samplebc.bcmagic import forms
+
+def index(request):
+ """
+ Display a barcode magic input box
+ """
+ form = forms.BarcodeMagicForm()
+
+ return render_to_response('bcmagic.html', {'bcmagic': form},
+ context_instance=RequestContext(request))
+
+
+def __magic_process(text):
+ """
+ Based on scanned text, check to see if there is map object to use
+ for a useful redirect.
+ """
+ # Split text on |
+ split_text = text.split('|')
+
+ # There should always be at least one | in a valid scan.
+ if len(split_text) <= 1:
+ return {'mode': 'Error',
+ 'status': 'Invalid text: %s' % (text)}
+
+ # Keyword is the first element in the list
+ keyword = split_text[0]
+
+ # Attempt to find a KeywordMap based on keyword
+ try:
+ keymap = models.KeywordMap.objects.get(keyword=keyword)
+ except ObjectDoesNotExist, e:
+ return {'mode': 'Error',
+ 'status': 'Keyword (%s) is not defined' % (keyword)}
+
+ # Remove keyword and only scan the content
+ content = '|'.join(split_text[1:])
+
+ #FIXME: would be faster to cache compiled regex
+ search = re.compile(keymap.regex)
+
+ mo = search.search(content)
+
+ # if the search was invalid
+ if not mo:
+ return {'mode': 'Error',
+ 'status': '(%s) failed to match (%s)' % (keymap.regex, content)}
+
+ t = Template(keymap.url_template)
+ c = Context(mo.groupdict())
+
+ return {'mode': 'redirect',
+ 'url': str(t.render(c)) }
+
+
+
+
+
+def magic(request):
+ """
+ Let the magic begin
+ """
+ d = {}
+
+ if 'text' in request.POST:
+ text = request.POST['text']
+ else:
+ text = None
+
+ #return HttpResponse(json.write(request.POST.items()), 'text/plain')
+ if text is None or text.strip() == '':
+ d['mode'] = 'Error'
+ d['status'] = 'Did not recieve text'
+ return HttpResponse(json.write(d), 'text/plain')
+
+ if text.split('|')[0] == 'url':
+ d['mode'] = 'redirect'
+ d['url'] = text.split('|')[1]
+ else:
+ d = __magic_process(text)
+
+ return HttpResponse(json.write(d), 'text/plain')
+
+
+
+def json_test(request):
+ d = {}
+
+ if 'text' in request.POST:
+ text = request.POST['text']
+ else:
+ text = None
+
+ #return HttpResponse(json.write(request.POST.items()), 'text/plain')
+ if text is None or text.strip() == '':
+ d['mode'] = 'Error'
+ d['status'] = 'Did not recieve text'
+ return HttpResponse(json.write(d), 'text/plain')
+
+ if text.split('|')[0] == 'url':
+ d['mode'] = 'redirect'
+ d['url'] = text.split('|')[1]
+ else:
+ d['msg'] = 'Recieved text: %s' % (text)
+ d['mode'] = 'clear'
+
+ return HttpResponse(json.write(d), 'text/plain')
--- /dev/null
+#!/usr/bin/python
+from django.core.management import execute_manager
+try:
+ import settings # Assumed to be in the same directory.
+except ImportError:
+ import sys
+ sys.stderr.write("Error: Can't find the file 'settings.py' in the directory containing %r. It appears you've customized things.\nYou'll have to run django-admin.py, passing it your settings module.\n(If the file settings.py does indeed exist, it's causing an ImportError somehow.)\n" % __file__)
+ sys.exit(1)
+
+if __name__ == "__main__":
+ execute_manager(settings)
--- /dev/null
+from django.contrib import admin
+from samplebc.samples.models import Owner, Sample, Freezer, Container, SampleType
+
+class OwnerAdmin(admin.ModelAdmin):
+ pass
+
+class SampleAdmin(admin.ModelAdmin):
+ pass
+
+class FreezerAdmin(admin.ModelAdmin):
+ pass
+
+class ContainerAdmin(admin.ModelAdmin):
+ pass
+
+class SampleTypeAdmin(admin.ModelAdmin):
+ pass
+
+
+admin.site.register(Owner, OwnerAdmin)
+admin.site.register(Sample, SampleAdmin)
+admin.site.register(Freezer, FreezerAdmin)
+admin.site.register(Container, ContainerAdmin)
+admin.site.register(SampleType, SampleTypeAdmin)
--- /dev/null
+from samplebc.samples.models import Container, Sample
+import types
+
+def __get_container(string_or_container):
+ """
+ returns a container object given container object or
+ container name string.
+ """
+ if isinstance(string_or_container, Container):
+ return string_or_container
+ elif isinstance(string_or_container, types.StringType):
+ return Container.objects.get(name=string_or_container
+)
+ raise ValueError, 'Invalid type: %s' % (string_or_container)
+
+
+def item_count(string_or_container):
+ """
+ Returns the number of items in a container given container
+ object or string.
+ """
+ container_obj = __get_container(string_or_container)
+ return len(Sample.objects.filter(container__name=container_obj.name))
+
+
+def available_space(string_or_container):
+ """
+ Returns the available space in a container by passing in either
+ the container object or the name of the container.
+ """
+ count = item_count(string_or_container)
+ container_obj = __get_container(string_or_container)
+
+ return (container_obj.max_items - count)
--- /dev/null
+from exceptions import Exception
+
+class NoSpaceAvaliable(Exception):
+ """
+ Thrown when a container contains no more available space.
+ """
+ pass
+
--- /dev/null
+from django import forms
+from samplebc.samples import models
+
+
+class FreezerForm(forms.ModelForm):
+
+ class Meta:
+ model = models.Freezer
+ exclude = ('uuid',)
+
+ class Media:
+ #js = ('js/jquery-1.3.2.js', 'js/uuid.js')
+ pass
+
+
+class ContainerForm(forms.ModelForm):
+
+ class Meta:
+ model = models.Container
+ exclude = ('uuid',)
+
+ class Media:
+ #js = ('js/jquery-1.3.2.js',)
+ pass
+
+
+class SampleForm(forms.ModelForm):
+ assign_container = forms.BooleanField(initial=True, required=False)
+
+ class Meta:
+ model = models.Sample
+ exclude = ('container', 'sampleid')
+
+
+#class CmdMoveSampleForm(forms.Form):
+# sampleid = form.CharField()
+# container_id = form.CharField()
\ No newline at end of file
--- /dev/null
+from django.db import models
+
+# Create your models here.
+
+EXP_TYPES = [('RNASeq', 'RNASeq'),
+ ('ChIPSeq','ChIPSeq'),
+ ('DeNovoSeq','DeNovoSeq'),
+ ('MethylSeq','MethylSeq')]
+FREEZER_BUILDINGS = [('Kerckhoff', 'Kerckhoff')]
+
+
+class Owner(models.Model):
+ name = models.CharField(max_length=32)
+
+ def __unicode__(self):
+ return u'%s' % (self.name)
+
+
+class Freezer(models.Model):
+ name = models.CharField(max_length=256)
+ building = models.CharField(max_length=256, choices=FREEZER_BUILDINGS,
+ default=FREEZER_BUILDINGS[0][0])
+ loc_desc = models.CharField(max_length=256, blank=True, null=True)
+ temperature = models.FloatField(help_text='Celsius')
+
+ uuid = models.CharField(max_length=32, unique=True)
+
+ def __unicode__(self):
+ return u'%s (%s; %sC)' % (self.name, self.building, self.temperature)
+
+ @models.permalink
+ def get_absolute_url(self):
+ return ('samplebc.samples.views.freezer_summary', [str(self.uuid)])
+
+
+class SampleType(models.Model):
+ name = models.CharField(max_length=256)
+
+ def __unicode__(self):
+ return u'%s' % (self.name)
+
+
+class Container(models.Model):
+ name = models.CharField(max_length=256)
+ sample_type = models.ManyToManyField(SampleType)
+ max_items = models.IntegerField()
+ freezer = models.ForeignKey(Freezer)
+
+ uuid = models.CharField(max_length=32, unique=True)
+
+ def __unicode__(self):
+ return u'%s (spc: %s)' % (self.name, self.space_available())
+
+ @models.permalink
+ def get_absolute_url(self):
+ return ('samplebc.samples.views.container_summary', [str(self.uuid)])
+
+ def space_available(self):
+ """
+ returns the space available for the container
+ """
+ return (self.max_items - self.sample_set.count())
+
+
+class Sample(models.Model):
+ name = models.CharField(max_length=256)
+ sampleid = models.CharField(max_length=64, unique=True)
+ sample_type = models.ForeignKey(SampleType)
+ owner = models.ForeignKey(Owner)
+ # Concentration in ng/ul
+ concentration = models.FloatField(help_text='ng/ul', blank=True, null=True)
+ volume = models.FloatField(help_text='ul', blank=True, null=True)
+ container = models.ForeignKey(Container, blank=True, null=True)
+
+ def __unicode__(self):
+ return u's|%s|%s' % (self.sampleid, self.owner.name)
+
+ @models.permalink
+ def get_absolute_url(self):
+ return ('samplebc.samples.views.sample_summary', [str(self.sampleid)])
--- /dev/null
+from django.conf.urls.defaults import *
+
+urlpatterns = patterns('',
+ # Sample URLs
+ (r'^sample/$', 'samplebc.samples.views.sample_index'),
+ (r'^sample/add/$', 'samplebc.samples.views.sample_add'),
+ (r'^sample/homeless/$', 'samplebc.samples.views.sample_homeless'),
+ (r'^sample/(?P<sampleid>\d+)/print/$', 'samplebc.samples.views.sample_print'),
+ (r'^sample/(?P<sampleid>\d+)/$', 'samplebc.samples.views.sample_summary'),
+ (r'^sample/(?P<sampleid>\d+)/edit/$', 'samplebc.samples.views.sample_edit'),
+ (r'^sample/(?P<sampleid>\d+)/assign/$', 'samplebc.samples.views.sample_assign_container'),
+
+ # Container URLs
+ (r'^container/$',
+ 'samplebc.samples.views.container_index'),
+ (r'^container/add/$',
+ 'samplebc.samples.views.container_add'),
+ (r'^container/(?P<container_id>[a-fA-F0-9]+)/edit/$',
+ 'samplebc.samples.views.container_edit'),
+ (r'^container/(?P<container_id>[a-fA-F0-9]+)/$',
+ 'samplebc.samples.views.container_summary'),
+
+ # Freezer URLs
+ (r'^freezer/$',
+ 'samplebc.samples.views.freezer_index'),
+ (r'^freezer/add/$',
+ 'samplebc.samples.views.freezer_add'),
+ (r'^freezer/(?P<freezer_id>[a-fA-F0-9]+)/edit/$',
+ 'samplebc.samples.views.freezer_edit'),
+ (r'^freezer/(?P<freezer_id>[a-fA-F0-9]+)/$',
+ 'samplebc.samples.views.freezer_summary')
+
+
+)
--- /dev/null
+import uuid
+import random
+
+from samplebc.samples import models
+from samplebc.samples import errors
+
+def get_uuid():
+ """
+ Returns hex version of uuid
+ """
+ return uuid.uuid1().hex
+
+
+def get_sampleid():
+ """
+ Returns a sample id
+ """
+ return "%06d" % (random.randint(1,9999))
+
+
+def assign_to_container(sample):
+ """
+ Choose a container to place sample into.
+ """
+ container_list = sample.sample_type.container_set.all()
+ available_list = [ container for container in container_list if container.space_available() > 0 ]
+
+ if len(available_list) == 0:
+ raise errors.NoSpaceAvaliable("No container with available space for sample type (%s)" \
+ % (sample.sample_type.name))
+
+ #FIXME: Need to choose a container in a more logical way... for now, take the first one.
+ container = available_list[0]
+ sample.container = container
+
+ return
--- /dev/null
+from django.http import HttpResponse, HttpResponseRedirect
+from samplebc.samples import models
+from django.core.exceptions import ObjectDoesNotExist
+from django.template import Context, Template, RequestContext
+from django.template.loader import get_template
+from django.shortcuts import render_to_response
+
+from django.utils.safestring import mark_safe
+
+from samplebc.samples.forms import FreezerForm, ContainerForm, SampleForm
+from samplebc.samples.models import Freezer, Container, Sample
+from samplebc.samples.util import get_uuid, get_sampleid, assign_to_container
+from samplebc.samples.errors import NoSpaceAvaliable
+from samplebc import settings
+
+# Barcode Magic!
+from samplebc.bcmagic.forms import BarcodeMagicForm
+
+
+import random
+import ftplib
+import StringIO
+
+
+################################################
+# Util functions
+################################################
+
+
+def print_zpl(zpl_text):
+ """
+ Sends zpl_text to printer
+ """
+ ftp = ftplib.FTP(host='131.215.54.194', user='blank', passwd='')
+ ftp.login()
+ ftp.storlines("STOR printme.txt", StringIO.StringIO(zpl_text))
+
+
+def __center_line(line, width):
+ spaces_to_add = width - len(line)
+
+ front_half = spaces_to_add / 2
+ back_half = spaces_to_add - front_half
+
+ return (' ' * front_half) + line + (' ' * back_half)
+
+
+
+
+################################################
+# Container
+################################################
+
+def container_index(request):
+ """
+ Returns an index of available to containers
+ """
+ container_list = Container.objects.all()
+ c = Context({'title': 'Container Index',
+ 'container_list': container_list})
+ t = get_template('container_index.html')
+
+ return render_to_response('app.html', {
+ 'app_name': "HTSW-SampleTracker",
+ 'page_name': 'Container Index',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'container',
+ 'body': t.render(c)
+ })
+
+
+
+
+def container_summary(request, container_id):
+ """
+ Returns details of a container
+ """
+ # Retrieve container by UUID
+ try:
+ container = models.Container.objects.get(uuid=container_id)
+ except ObjectDoesNotExist, e:
+ msg = "Container (%s) does not exist." % (container_id)
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Container Summary',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'container',
+ 'body': msg
+ })
+
+ # Retrieve samples from container
+ sample_list = container.sample_set.all()
+
+ # Prepare a Sample Index of Contained Samples
+ cs = Context({'title': 'Contained Samples',
+ 'sample_list': sample_list})
+ ts = get_template('sample_index.html')
+
+ # Render prepared samples into container summary
+ cc = Context({'container': container,
+ 'rendered_samples': ts.render(cs) })
+ tc = get_template('container_summary.html')
+
+ # Render container summary to app html
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Container Summary',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'container',
+ 'body': tc.render(cc)
+ })
+
+
+def container_add(request):
+ """
+ Form for adding a container.
+ """
+ # If user submitted the Container form.
+ if request.method == 'POST':
+ # Fill in ContainerForm with POSTed data.
+ form = ContainerForm(request.POST)
+
+ # If the form is valid, process it.
+ if form.is_valid():
+ # Create new Container object from form data
+ c_obj = form.save(commit=False)
+ # Added UUID
+ c_obj.uuid = get_uuid()
+ # Save to DB.
+ c_obj.save()
+ # Save the many to many link data.
+ form.save_m2m()
+ return container_summary(request, c_obj.uuid)
+ else:
+ # If users first visit, create empty form.
+ form = ContainerForm()
+
+ # Load form template
+ c = Context({'form': form,
+ 'action_url': '/samples/container/add/'})
+ t = get_template('generic_form.html')
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Container Add',
+ 'media': form.media,
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'container',
+ 'body': t.render(c)
+ })
+
+def container_edit(request, container_id):
+ """
+ Allow editing of a container
+ """
+ try:
+ container = models.Container.objects.get(uuid=container_id)
+ except ObjectDoesNotExist, e:
+ msg = "Container (%s) cannot be edited as it does not exist." % (container_id)
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Container Edit',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'container',
+ 'body': msg
+ })
+
+ # If user submitted the container form.
+ if request.method == 'POST':
+ # Fill in ContainerForm with POSTed data.
+ form = ContainerForm(request.POST, instance=container)
+
+ # If the form is valid, process it.
+ if form.is_valid():
+ # Save Container object from form data
+ c_obj = form.save(commit=True)
+ # Save many2many changes as well
+ #form.save_m2m() #Not needed when form.save(commit=True)
+
+ return container_summary(request, c_obj.uuid)
+ else:
+ # If users first visit, create form from Container instance.
+ form = ContainerForm(instance=container)
+
+ # Load form template
+ c = Context({'form': form,
+ 'action_url': '%sedit/' % (container.get_absolute_url())})
+ t = get_template('generic_form.html')
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Container Edit',
+ 'media': form.media,
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'container',
+ 'body': t.render(c)
+ })
+
+
+
+################################################
+# Freezer
+################################################
+
+def freezer_index(request):
+ """
+ Returns an index of available freezers
+ """
+ freezer_list = Freezer.objects.all()
+ c = Context({'freezer_list': freezer_list})
+ t = get_template('freezer_index.html')
+
+ return render_to_response('app.html', {
+ 'app_name': "HTSW-SampleTracker",
+ 'page_name': 'Freezer Index',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'freezer',
+ 'body': t.render(c)
+ })
+
+
+def freezer_summary(request, freezer_id):
+ """
+ Returns summary of freezer_id
+ """
+ # Retrieve freezer by UUID
+ try:
+ freezer = models.Freezer.objects.get(uuid=freezer_id)
+ except ObjectDoesNotExist, e:
+ msg = "Freezer (%s) does not exist." % (freezer_id)
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Freezer Summary',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'freezer',
+ 'body': msg
+ })
+
+ # List of contained containers
+ container_list = freezer.container_set.all()
+
+
+ # Render prepared container index into freezer summary
+ cf = Context({'freezer': freezer })
+ tf = get_template('freezer_summary.html')
+
+ # Render Freezer summary to app html
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Freezer Summary',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'freezer',
+ 'body': tf.render(cf)
+ })
+
+
+def freezer_add(request):
+ """
+ Allows you to add a new freezer.
+ """
+ # If user submitted the freezer form.
+ if request.method == 'POST':
+ # Fill in FreezerForm with POSTed data.
+ form = FreezerForm(request.POST)
+
+ # If the form is valid, process it.
+ if form.is_valid():
+ # Create new Freezer object from form data
+ f_obj = form.save(commit=False)
+ # Added UUID
+ f_obj.uuid = get_uuid()
+ # Save to DB.
+ f_obj.save()
+ return freezer_summary(request, f_obj.uuid)
+ else:
+ # If users first visit, create empty form.
+ form = FreezerForm()
+
+ # Load form template
+ c = Context({'form': form,
+ 'action_url': '/samples/freezer/add/'})
+ t = get_template('generic_form.html')
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Freezer Add',
+ 'media': form.media,
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'freezer',
+ 'body': t.render(c)
+ })
+
+
+def freezer_edit(request, freezer_id):
+ """
+ Allow editing of a freezer
+ """
+ try:
+ freezer = models.Freezer.objects.get(uuid=freezer_id)
+ except ObjectDoesNotExist, e:
+ msg = "Freezer (%s) cannot be edited as it does not exist." % (freezer_id)
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Freezer Summary',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'freezer',
+ 'body': msg
+ })
+
+ # If user submitted the freezer form.
+ if request.method == 'POST':
+ # Fill in FreezerForm with POSTed data.
+ form = FreezerForm(request.POST, instance=freezer)
+
+ # If the form is valid, process it.
+ if form.is_valid():
+ # Save Freezer object from form data
+ f_obj = form.save(commit=True)
+
+ return freezer_summary(request, f_obj.uuid)
+ else:
+ # If users first visit, create form from freezer instance.
+ form = FreezerForm(instance=freezer)
+
+ # Load form template
+ c = Context({'form': form,
+ 'action_url': '%sedit/' % (freezer.get_absolute_url())})
+ t = get_template('generic_form.html')
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Freezer Edit',
+ 'media': form.media,
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'freezer',
+ 'body': t.render(c)
+ })
+
+
+
+################################################
+# Samples
+################################################
+
+def sample_index(request):
+ """
+ return a list of samples and what we can do with them.
+ """
+ sample_list = models.Sample.objects.all()
+
+ # Load form template
+ c = Context({'title': 'Sample Index',
+ 'sample_list': sample_list})
+ t = get_template('sample_index.html')
+ #html.append('%s <a href="/samples/sample/%s/print">(print)</a>' \
+ # % (sample, sample.sampleid))
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Samples Index',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': t.render(c)
+ })
+
+
+def sample_homeless(request):
+ """
+ Returns an index of homeless samples
+ """
+ sample_list = Sample.objects.filter(container=None)
+ c = Context({'title': 'Homeless Samples',
+ 'sample_list': sample_list})
+ t = get_template('sample_homeless.html')
+
+ return render_to_response('app.html', {
+ 'app_name': "HTSW-SampleTracker",
+ 'page_name': 'Homeless Samples',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': t.render(c)
+ })
+
+
+def sample_add(request):
+ """
+ Allow adding of a new sample
+ """
+ ASSIGNED_CONTAINER = False
+
+ # If user submitted the sample form.
+ if request.method == 'POST':
+ # Fill in SampleForm with POSTed data.
+ form = SampleForm(request.POST)
+
+ # If the form is valid, process it.
+ if form.is_valid():
+ # Create new Sample object from form data
+ s_obj = form.save(commit=False)
+
+ # Add sample ID
+ s_obj.sampleid = get_sampleid()
+
+ # If the user wants us to assign a container.
+ if form.cleaned_data['assign_container']:
+ # Choose container
+ try:
+ assign_to_container(s_obj)
+ ASSIGNED_CONTAINER = True
+ except NoSpaceAvaliable, e:
+ #return HttpResponse("<b>Error:</b> %s<br /><i>You will need to prepare a new container before continuing.</i>" \
+ # % (e))
+ ASSIGNED_CONTAINER = False
+
+ # Save to DB.
+ s_obj.save()
+
+ if not ASSIGNED_CONTAINER:
+ msg = "NOTE: Sample is homeless"
+ return sample_summary(request, s_obj.sampleid, msg=msg)
+
+
+ msg = "Sample created."
+ return sample_summary(request, s_obj.sampleid, msg=msg)
+ else:
+ # If users first visit, create empty form.
+ form = SampleForm()
+
+ # Load form template
+ c = Context({'form': form,
+ 'action_url': '/samples/sample/add/'})
+ t = get_template('generic_form.html')
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Sample Add',
+ 'media': form.media,
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': t.render(c)
+ })
+
+
+def sample_edit(request, sampleid):
+ """
+ Allow editing of a sample
+ """
+ try:
+ sample = models.Sample.objects.get(sampleid=sampleid)
+ except ObjectDoesNotExist, e:
+ msg = "Sample (%s) cannot be edited as it does not exist." % (sampleid)
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Sample Edit',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': msg
+ })
+
+ # If user submitted the sample form.
+ if request.method == 'POST':
+ # Fill in SampleForm with POSTed data.
+ form = SampleForm(request.POST, instance=sample)
+
+ # If the form is valid, process it.
+ if form.is_valid():
+ # Save Sample object from form data
+ s_obj = form.save(commit=True)
+
+ msg = "Sample Update Saved"
+ return sample_summary(request, s_obj.sampleid, msg)
+ else:
+ # If users first visit, create form from sample instance.
+ form = SampleForm(instance=sample)
+
+ # Load form template
+ c = Context({'form': form,
+ 'action_url': '%sedit/' % (sample.get_absolute_url())})
+ t = get_template('generic_form.html')
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Sample Edit',
+ 'media': form.media,
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': t.render(c)
+ })
+
+
+def sample_assign_container(request, sampleid):
+ """
+ Assigns sample to container using the assign to container algorithm
+ """
+
+ sample = Sample.objects.get(sampleid=sampleid)
+
+ try:
+ assign_to_container(sample)
+ except NoSpaceAvaliable, e:
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Sample Assign',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': mark_safe("<b>Error:</b> %s<br /><i>You will need to prepare a new container before continuing.</i>" \
+ % (e))
+ })
+
+ sample.save()
+
+ body = 'Sample (<a href="%s">%s</a>) assigned to container (<a href="%s">%s</a>)' \
+ % (sample.get_absolute_url(), str(sample), sample.container.get_absolute_url(), str(sample.container))
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Sample Assign',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': mark_safe(body),
+ })
+
+
+def sample_summary(request, sampleid, msg=None):
+ """
+ Display a summary of a given sample
+ """
+ try:
+ sample = models.Sample.objects.get(sampleid=sampleid)
+ except ObjectDoesNotExist, e:
+ msg = "Sample (%s) does not exist." % (sampleid)
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Sample Summary',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': msg
+ })
+
+ c = Context({'sample': sample,
+ 'msg': msg,})
+ t = get_template('sample_summary.html')
+
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'Sample Summary',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': t.render(c)
+ })
+
+
+def sample_print(request, sampleid):
+ """
+ prints a sample!
+ """
+
+ try:
+ sample = models.Sample.objects.get(sampleid=sampleid)
+ except ObjectDoesNotExist:
+ return HttpResponse('Sample (%s) does not exist!' % (sampleid))
+
+ params = {}
+ params['fullid'] = str(sample)
+ params['sampleid'] = __center_line("s|%s" % (sample.sampleid), 16)
+ params['line1'] = __center_line(sample.name[0:10], 10)
+ params['line2'] = __center_line(sample.name[10:25], 14)
+ params['line3'] = __center_line('ExpType %s' % (sample.sample_type.name[0:8]), 15)
+ params['slot_num'] = random.randint(1,81)
+
+ c = Context(params)
+ t = get_template('half_inch_samples.txt')
+ print_zpl(t.render(c))
+
+ return HttpResponse('print command for sample %s sent.' % (sample.sampleid))
+
+
+################################################
+# Barcode Magic Commands
+################################################
+
+def cmd_move_sample(request):
+ """
+ Moves a sample to a target container
+ """
+ return render_to_response('app.html', {
+ 'app_name': settings.HTSW_ST_APPNAME,
+ 'page_name': 'CMD: Move Sample',
+ 'media': '',
+ 'bcmagic': BarcodeMagicForm(),
+ 'select': 'samples',
+ 'body': ""
+ })
\ No newline at end of file
--- /dev/null
+# Django settings for samplebc project.
+
+import os
+
+DEBUG = True
+TEMPLATE_DEBUG = DEBUG
+
+ADMINS = (
+ # ('Your Name', 'your_email@domain.com'),
+)
+
+MANAGERS = ADMINS
+
+DATABASE_ENGINE = 'sqlite3' # 'postgresql_psycopg2', 'postgresql', 'mysql', 'sqlite3' or 'oracle'.
+DATABASE_NAME = os.path.abspath('../sample.db') # Or path to database file if using sqlite3.
+DATABASE_USER = '' # Not used with sqlite3.
+DATABASE_PASSWORD = '' # Not used with sqlite3.
+DATABASE_HOST = '' # Set to empty string for localhost. Not used with sqlite3.
+DATABASE_PORT = '' # Set to empty string for default. Not used with sqlite3.
+
+# Local time zone for this installation. Choices can be found here:
+# http://en.wikipedia.org/wiki/List_of_tz_zones_by_name
+# although not all choices may be available on all operating systems.
+# If running in a Windows environment this must be set to the same as your
+# system time zone.
+TIME_ZONE = 'America/Los_Angeles'
+
+# Language code for this installation. All choices can be found here:
+# http://www.i18nguy.com/unicode/language-identifiers.html
+LANGUAGE_CODE = 'en-us'
+
+SITE_ID = 1
+
+# If you set this to False, Django will make some optimizations so as not
+# to load the internationalization machinery.
+USE_I18N = True
+
+# Absolute path to the directory that holds media.
+# Example: "/home/media/media.lawrence.com/"
+MEDIA_ROOT = '/home/king/proj/barcodes/sampletracker/www'
+
+# URL that handles the media served from MEDIA_ROOT. Make sure to use a
+# trailing slash if there is a path component (optional in other cases).
+# Examples: "http://media.lawrence.com", "http://example.com/media/"
+MEDIA_URL = 'http://localhost:8000/static/'
+
+# URL prefix for admin media -- CSS, JavaScript and images. Make sure to use a
+# trailing slash.
+# Examples: "http://foo.com/media/", "/media/".
+ADMIN_MEDIA_PREFIX = '/media/'
+
+# Make this unique, and don't share it with anybody.
+SECRET_KEY = 'tcn2-(c4(qw5%(_06w!7p4aiqyp!gs(*#fw9h&#y=2j3#k3*fm'
+
+# List of callables that know how to import templates from various sources.
+TEMPLATE_LOADERS = (
+ 'django.template.loaders.filesystem.load_template_source',
+ 'django.template.loaders.app_directories.load_template_source',
+# 'django.template.loaders.eggs.load_template_source',
+)
+
+
+MIDDLEWARE_CLASSES = (
+ 'django.middleware.common.CommonMiddleware',
+ 'django.contrib.sessions.middleware.SessionMiddleware',
+ 'django.contrib.auth.middleware.AuthenticationMiddleware',
+)
+
+ROOT_URLCONF = 'samplebc.urls'
+
+TEMPLATE_DIRS = (
+ # Put strings here, like "/home/html/django_templates" or "C:/www/django/templates".
+ # Always use forward slashes, even on Windows.
+ # Don't forget to use absolute paths, not relative paths.
+ os.path.abspath('../templates')
+)
+
+INSTALLED_APPS = (
+ 'django.contrib.auth',
+ 'django.contrib.contenttypes',
+ 'django.contrib.sessions',
+ 'django.contrib.sites',
+ 'django.contrib.admin',
+ 'samplebc.samples',
+ 'samplebc.bcmagic'
+)
+
+
+#########################
+# App Specific Settings
+
+HTSW_ST_APPNAME = 'HTSW-SampleTracker'
\ No newline at end of file
--- /dev/null
+from django.conf.urls.defaults import *
+import os
+
+# Uncomment the next two lines to enable the admin:
+from django.contrib import admin
+admin.autodiscover()
+
+urlpatterns = patterns('',
+ # Example:
+ # (r'^samplebc/', include('samplebc.foo.urls')),
+
+ # Uncomment the admin/doc line below and add 'django.contrib.admindocs'
+ # to INSTALLED_APPS to enable admin documentation:
+ # (r'^admin/doc/', include('django.contrib.admindocs.urls')),
+
+ # Uncomment the next line to enable the admin:
+ (r'^admin/(.*)', admin.site.root),
+ (r'^static/(?P<path>.*)$', 'django.views.static.serve',
+ {'document_root': os.path.abspath('../www')}),
+
+ (r'^bcmagic/', include('samplebc.bcmagic.urls')),
+ (r'^samples/', include('samplebc.samples.urls'))
+)
+
--- /dev/null
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN">
+<html lang="en">
+<head>
+ <title>{{ app_name }} - {{ page_name }}</title>
+ <link type="text/css" rel="stylesheet" href="/static/theme/ui.all.css" />
+ <link type="text/css" rel="stylesheet" href="/static/css/app.css" />
+ <script type="text/javascript" src="/static/js/jquery-1.3.2.js"></script>
+ <script type="text/javascript" src="/static/js/jquery-ui-personalized-1.6rc6.js"></script>
+ <script type="text/javascript" src="/static/js/menu.js"></script>
+ {{ media }}
+ {{ bcmagic.media }}
+ {% if select %}
+ <script type="text/javascript">
+ $(document).ready(function(){
+ select_menu('{{ select }}');
+ });
+ </script>
+ {% endif %}
+</head>
+<body>
+ <div id="left_bar" class="left_bar">
+ <div id="accordion">
+ <div>
+ <h3><a href="#">Freezers</a></h3>
+ <div>
+ <a href="/samples/freezer/">Index</a><br />
+ <a href="/samples/freezer/add/">Add</a><br />
+ </div>
+ </div>
+ <div>
+ <h3><a href="#">Containers</a></h3>
+ <div>
+ <a href="/samples/container/">Index</a><br />
+ <a href="/samples/container/add/">Add</a><br />
+ </div>
+ </div>
+ <div>
+ <h3><a href="#">Samples</a></h3>
+ <div>
+ <a href="/samples/sample/">Index</a>
+ <a href="/samples/sample/homeless/">Homeless</a>
+ <a href="/samples/sample/add/">Add</a>
+ </div>
+ </div>
+ </div>
+ <br />
+ {% include "magic.html" %}
+ </div>
+ <div id="main" class="main">
+ {{ body }}
+ </div>
+</body>
+</html>
--- /dev/null
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN">
+<html lang="en">
+<head>
+ <title>Barcode Magic (BCM)</title>
+ {{ bcmagic.media }}
+</head>
+<body>
+ {% include "magic.html" %}
+</body>
+</html>
--- /dev/null
+<h3>{{ title }}</h3>
+<table border="1" cellpadding="0" cellspacing="0">
+ <tr>
+ <td><b>Name</b></td>
+ <td><b>Type(s)</b></td>
+ <td><b>Max Items</b></td>
+ <td><b>Freezer</b></td>
+ <td><b>Sample Count</b></td>
+ <td><b>Space Available</b></td>
+ </tr>
+ {% for container in container_list %}
+ <tr>
+ <td><a href="{{ container.get_absolute_url }}">{{ container.name }}</a></td>
+ <td>
+ {{ container.sample_type.all|join:", " }}
+ </td>
+ <td>{{ container.max_items }}</td>
+ <td>{{ container.freezer }}</td>
+ <td>{{ container.sample_set.count }}</td>
+ <td>{{ container.space_available }}</td>
+ </tr>
+ {% endfor %}
+</table>
--- /dev/null
+<h3>Container Summary</h3>
+
+[ <a href="{{ container.get_absolute_url }}edit/">Edit</a> ]<br />
+<br />
+
+<b>Name:</b> {{ container.name }}<br />
+<b>Freezer:</b> <a href="{{ container.freezer.get_absolute_url }}">{{ container.freezer.name }}</a><br />
+<br />
+<b>uuid:</b> {{ container.uuid }}<br />
+<br />
+<b>Allowed Sample Types:</b><br />
+{{ container.sample_type.all|join:", " }}<br />
+<br />
+<b>Max Samples:</b> {{ container.max_items }}<br />
+<b>Sample Count:</b> {{ container.sample_set.count }}<br />
+<b>Space Available:</b> {{ container.space_available }}<br />
+<br />
+
+{{ rendered_samples }}
+
+
--- /dev/null
+<h3>Freezer Index</h3>
+<table border="1" cellpadding="0" cellspacing="0">
+ <tr>
+ <td><b>Name</b></td>
+ <td><b>Building</b></td>
+ <td><b>Location Desc.</b></td>
+ <td><b>Temperature</b></td>
+ <td><b>Containers</b></td>
+ </tr>
+ {% for freezer in freezer_list %}
+ <tr>
+ <td><a href="{{ freezer.get_absolute_url }}">{{ freezer.name }}</a></td>
+ <td>{{ freezer.building }}</td>
+ <td>{{ freezer.loc_desc }}</td>
+ <td>{{ freezer.temperature }}C</td>
+ <td>{{ freezer.container_set.all|length }}</td>
+ </tr>
+ {% endfor %}
+</table>
--- /dev/null
+<h3>Freezer Summary</h3>
+
+[ <a href="{{ freezer.get_absolute_url }}edit/">Edit</a> ]<br />
+<br />
+
+<b>Name:</b> {{ freezer.name }}<br />
+<b>Temp. (C):</b> {{ freezer.temperature }}<br />
+<br />
+<b>Building:</b> {{ freezer.building }}<br />
+<b>Loc. Desc.:</b> {{ freezer.loc_desc }}<br />
+<br />
+<b>uuid:</b> {{ freezer.uuid }}<br />
+
+<h3>Containers in Freezer</h3>
+<table border="1" cellpadding="0" cellspacing="0">
+ <tr>
+ <td><b>Name</b></td>
+ <td><b>Type(s)</b></td>
+ <td><b>Max Items</b></td>
+ <td><b>Sample Count</b></td>
+ <td><b>Space Available</b></td>
+ </tr>
+ {% for container in freezer.container_set.all %}
+ <tr>
+ <td><a href="{{ container.get_absolute_url }}">{{ container.name }}</a></td>
+ <td>
+ {{ container.sample_type.all|join:", " }}
+ </td>
+ <td>{{ container.max_items }}</td>
+ <td>{{ container.sample_set.count }}</td>
+ <td>{{ container.space_available }}</td>
+ </tr>
+ {% endfor %}
+</table>
+
+
--- /dev/null
+<form action="{{ action_url }}" method="POST">
+{{ form.as_p }}
+<input type="submit" value="Submit" />
+</form>
+
--- /dev/null
+^FX=========================
+^FX 1/2" Tube Label
+^FX=========================
+
+^XA
+^FX-------------------------
+^FX Sample ID
+^FX-------------------------
+^FO105,167
+^CF0,24^FD{{ sampleid }}^FS
+
+^FX-------------------------
+^FX Content
+^FX-------------------------
+
+^FX Line 1 (max_length=10)
+^FO135,113
+^CF0,16^FD{{ line1 }}^FS
+
+^FX Line 2 (max_length=14)
+^FO120,131
+^CF0,16^FD{{ line2 }}^FS
+
+^FX Line 3 (max_length=15)
+^FO115,149
+^CF0,16^FD{{ line3 }}^FS
+
+^FX-------------------------
+^FX Slot #
+^FX
+^FX (75 - (54 / 2)) / 2 == 24
+^FX x_center = (175 + 30 + 24)
+^FX x = x_center - 24 + 4
+^FX y = x_center - 24 + 4 - (28/2)
+^FX-------------------------
+^FO209,195
+^CF0,28^FD{{ slot_num }}^FS
+
+^FX-------------------------
+^FX Circle - Temp
+^FX-------------------------
+^FX FO100,100
+^FX GC150,1^FS
+
+^FX-------------------------
+^FX Datamatrix Barcode
+^FX
+^FX h=w=<#col>*3
+^FX upper_left_coords=(175-(w/2), 250-6-h)
+^FX-------------------------
+^FO148,188
+^BXN,3,200
+^FD{{ fullid }}^FS
+
+^FX-------------------------
+^FX End Label
+^FX-------------------------
+^XZ
--- /dev/null
+<div id="bcm_msg"></div>
+{{ bcmagic }}<br />
+<div id="bcm_status"></div>
--- /dev/null
+<h3>{{ title }}</h3>
+<table border="1" cellpadding="0" cellspacing="0">
+ <tr>
+ <td><b>Name</b></td>
+ <td><b>SampleID</b></td>
+ <td><b>SampleType</b></td>
+ <td><b>Owner</b></td>
+ <td><b>Container</b></td>
+ </tr>
+ {% for sample in sample_list %}
+ <tr>
+ <td><a href="{{ sample.get_absolute_url }}">{{ sample.name }}</a></td>
+ <td>
+ {{ sample.sampleid }}
+ </td>
+ <td>{{ sample.sample_type.name }}</td>
+ <td>{{ sample.owner.name }}</td>
+ <td><a href="{{ sample.get_absolute_url }}assign/">Auto-assign</a></td>
+ </tr>
+ {% endfor %}
+</table>
--- /dev/null
+<h3>{{ title }}</h3>
+<table border="1" cellpadding="0" cellspacing="0">
+ <tr>
+ <td><b>Name</b></td>
+ <td><b>SampleID</b></td>
+ <td><b>SampleType</b></td>
+ <td><b>Owner</b></td>
+ <td><b>Conc.</b></td>
+ <td><b>Vol.</b></td>
+ <td><b>Container</b></td>
+ </tr>
+ {% for sample in sample_list %}
+ <tr>
+ <td><a href="{{ sample.get_absolute_url }}">{{ sample.name }}</a></td>
+ <td>
+ {{ sample.sampleid }}
+ </td>
+ <td>{{ sample.sample_type.name }}</td>
+ <td>{{ sample.owner.name }}</td>
+ <td>{{ sample.concentration }}</td>
+ <td>{{ sample.volume }}</td>
+ {% if sample.container %}
+ <td><a href="{{ sample.container.get_absolute_url }}">{{ sample.container }}</a></td>
+ {% else %}
+ <td><a href="{{ sample.get_absolute_url }}assign/">auto-assign</a></td>
+ {% endif %}
+ </tr>
+ {% endfor %}
+</table>
--- /dev/null
+<h2>Sample Summary</h2>
+
+[ <a href="{{ sample.get_absolute_url }}edit/">Edit</a> | <a href="{{ sample.get_absolute_url }}print/">Print Label</a> ]<br />
+
+{% if msg %}
+<div class="msg">
+ {{ msg }}
+</div>
+{% endif %}
+
+<br />
+<b>Name:</b> {{ sample.name }}<br />
+<b>SampleID:</b> {{ sample.sampleid }}<br />
+<b>Type:</b> {{ sample.sample_type.name }}<br />
+<b>Owner:</b> {{ sample.owner.name }}<br />
+<br />
+<b>Concentration (ug/ml):</b> {{ sample.concentration }}<br />
+<b>Volume (ml):</b> {{ sample.volume }}<br />
+<br />
+<b>Freezer:</b> <a href="{{ sample.container.freezer.get_absolute_url }}">{{ sample.container.freezer.name }}</a><br />
+<b>Container:</b> <a href="{{ sample.container.get_absolute_url }}">{{ sample.container.name }}</a><br />
\ No newline at end of file
--- /dev/null
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN">
+<html lang="en">
+<head>
+ <title>Hello World!</title>
+ <script type="text/javascript" src="/static/js/jquery-1.3.2.js"></script>
+ <script type="text/javascript" src="/static/js/jquery.timers-1.0.0.js"></script>
+ <script type="text/javascript" src="/static/js/magicbc.js"></script>
+</head>
+<body>
+ <div id="msg"></div>
+ Magic: <input id="magic" type="text" name="magic" size="52" /><br />
+ <div id="status"></div>
+</body>
+</html>
--- /dev/null
+#left_bar {
+ position: absolute;
+ top: 5px;
+ left: 5px;
+ width: 172px;
+ height: auto;
+ min-height: 600px;
+
+
+}
+
+#main {
+ position: relative;
+ /* background: #BBBBFF; */
+ width:auto;
+ min-width:120px;
+ padding: 10px;
+ margin:0px 0px 0px 175px;
+ min-height:600px;
+}
+
+div.msg {
+ color: white;
+ background: #880000;
+}
\ No newline at end of file
--- /dev/null
+/* Arabic Translation for jQuery UI date picker plugin. */\r
+/* Khaled Al Horani -- koko.dw@gmail.com */\r
+/* خالد الحوراني -- koko.dw@gmail.com */\r
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */\r
+jQuery(function($){\r
+ $.datepicker.regional['ar'] = {\r
+ closeText: 'إغلاق',\r
+ prevText: '<السابق',\r
+ nextText: 'التالي>',\r
+ currentText: 'اليوم',\r
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',\r
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],\r
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],\r
+ dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],\r
+ dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],\r
+ dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['ar']);\r
+});/* Bulgarian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Stoyan Kyosev (http://svest.org). */\r
+jQuery(function($){\r
+ $.datepicker.regional['bg'] = {\r
+ closeText: 'затвори',\r
+ prevText: '<назад',\r
+ nextText: 'напред>',\r
+ nextBigText: '>>',\r
+ currentText: 'днес',\r
+ monthNames: ['Януари','Февруари','Март','Април','Май','Юни',\r
+ 'Юли','Август','Септември','Октомври','Ноември','Декември'],\r
+ monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',\r
+ 'Юли','Авг','Сеп','Окт','Нов','Дек'],\r
+ dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],\r
+ dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],\r
+ dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['bg']);\r
+});\r
+/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */\r
+/* Writers: (joan.leon@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ca'] = {\r
+ closeText: 'Tancar',\r
+ prevText: '<Ant',\r
+ nextText: 'Seg>',\r
+ currentText: 'Avui',\r
+ monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',\r
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],\r
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',\r
+ 'Jul','Ago','Set','Oct','Nov','Des'],\r
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],\r
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],\r
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],\r
+ dateFormat: 'mm/dd/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ca']);\r
+});/* Czech initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Tomas Muller (tomas@tomas-muller.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['cs'] = {\r
+ closeText: 'Zavřít',\r
+ prevText: '<Dříve',\r
+ nextText: 'Později>',\r
+ currentText: 'Nyní',\r
+ monthNames: ['leden','únor','březen','duben','květen','červen',\r
+ 'červenec','srpen','září','říjen','listopad','prosinec'],\r
+ monthNamesShort: ['led','úno','bře','dub','kvě','čer',\r
+ 'čvc','srp','zář','říj','lis','pro'],\r
+ dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],\r
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],\r
+ dayNamesMin: ['ne','po','út','st','čt','pá','so'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['cs']);\r
+});\r
+/* Danish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Jan Christensen ( deletestuff@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['da'] = {\r
+ closeText: 'Luk',\r
+ prevText: '<Forrige',\r
+ nextText: 'Næste>',\r
+ currentText: 'Idag',\r
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',\r
+ 'Juli','August','September','Oktober','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],\r
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],\r
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],\r
+ dateFormat: 'dd-mm-yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['da']);\r
+});\r
+/* German initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Milian Wolff (mail@milianw.de). */\r
+jQuery(function($){\r
+ $.datepicker.regional['de'] = {\r
+ closeText: 'schließen',\r
+ prevText: '<zurück',\r
+ nextText: 'Vor>',\r
+ currentText: 'heute',\r
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',\r
+ 'Juli','August','September','Oktober','November','Dezember'],\r
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],\r
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],\r
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],\r
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['de']);\r
+});\r
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */\r
+jQuery(function($){\r
+ $.datepicker.regional['el'] = {\r
+ closeText: 'Κλείσιμο',\r
+ prevText: 'Προηγούμενος',\r
+ nextText: 'Επόμενος',\r
+ currentText: 'Τρέχων Μήνας',\r
+ monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',\r
+ 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],\r
+ monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',\r
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],\r
+ dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],\r
+ dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],\r
+ dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['el']);\r
+});/* Esperanto initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Olivier M. (olivierweb@ifrance.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['eo'] = {\r
+ closeText: 'Fermi',\r
+ prevText: '<Anta',\r
+ nextText: 'Sekv>',\r
+ currentText: 'Nuna',\r
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',\r
+ 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Aŭg','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],\r
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],\r
+ dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['eo']);\r
+});\r
+/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */\r
+/* Traducido por Vester (xvester@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['es'] = {\r
+ closeText: 'Cerrar',\r
+ prevText: '<Ant',\r
+ nextText: 'Sig>',\r
+ currentText: 'Hoy',\r
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',\r
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],\r
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',\r
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],\r
+ dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],\r
+ dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],\r
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['es']);\r
+});/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */\r
+/* Javad Mowlanezhad -- jmowla@gmail.com */\r
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */\r
+jQuery(function($) {\r
+ $.datepicker.regional['fa'] = {\r
+ closeText: 'بستن',\r
+ prevText: '<قبلي',\r
+ nextText: 'بعدي>',\r
+ currentText: 'امروز',\r
+ monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',\r
+ 'مهر','آبان','آذر','دي','بهمن','اسفند'],\r
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],\r
+ dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],\r
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],\r
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],\r
+ dateFormat: 'yy/mm/dd', firstDay: 6,\r
+ isRTL: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['fa']);\r
+});/* Finnish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['fi'] = {\r
+ closeText: 'Sulje',\r
+ prevText: '«Edellinen',\r
+ nextText: 'Seuraava»',\r
+ currentText: 'Tänään',\r
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',\r
+ 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],\r
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',\r
+ 'Heinä','Elo','Syys','Loka','Marras','Joulu'],\r
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],\r
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],\r
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['fi']);\r
+});\r
+/* French initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['fr'] = {\r
+ closeText: 'Fermer',\r
+ prevText: '<Préc',\r
+ nextText: 'Suiv>',\r
+ currentText: 'Courant',\r
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',\r
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],\r
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',\r
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],\r
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],\r
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],\r
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['fr']);\r
+});/* Hebrew initialisation for the UI Datepicker extension. */\r
+/* Written by Amir Hardon (ahardon at gmail dot com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['he'] = {\r
+ closeText: 'סגור',\r
+ prevText: '<הקודם',\r
+ nextText: 'הבא>',\r
+ currentText: 'היום',\r
+ monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',\r
+ 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],\r
+ monthNamesShort: ['1','2','3','4','5','6',\r
+ '7','8','9','10','11','12'],\r
+ dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],\r
+ dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],\r
+ dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['he']);\r
+});\r
+/* Croatian i18n for the jQuery UI date picker plugin. */\r
+/* Written by Vjekoslav Nesek. */\r
+jQuery(function($){\r
+ $.datepicker.regional['hr'] = {\r
+ closeText: 'Zatvori',\r
+ prevText: '<',\r
+ nextText: '>',\r
+ currentText: 'Danas',\r
+ monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani',\r
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],\r
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',\r
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],\r
+ dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],\r
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],\r
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],\r
+ dateFormat: 'dd.mm.yy.', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['hr']);\r
+});/* Hungarian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */\r
+jQuery(function($){\r
+ $.datepicker.regional['hu'] = {\r
+ closeText: 'bezárás',\r
+ prevText: '« vissza',\r
+ nextText: 'előre »',\r
+ currentText: 'ma',\r
+ monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',\r
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],\r
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',\r
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],\r
+ dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],\r
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],\r
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['hu']);\r
+});\r
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/\r
+jQuery(function($){\r
+ $.datepicker.regional['hy'] = {\r
+ closeText: 'Փակել',\r
+ prevText: '<Նախ.',\r
+ nextText: 'Հաջ.>',\r
+ currentText: 'Այսօր',\r
+ monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',\r
+ 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],\r
+ monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',\r
+ 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],\r
+ dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],\r
+ dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],\r
+ dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['hy']);\r
+});/* Indonesian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Deden Fathurahman (dedenf@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['id'] = {\r
+ closeText: 'Tutup',\r
+ prevText: '<mundur',\r
+ nextText: 'maju>',\r
+ currentText: 'hari ini',\r
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',\r
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',\r
+ 'Jul','Agus','Sep','Okt','Nop','Des'],\r
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],\r
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],\r
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['id']);\r
+});/* Icelandic initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */\r
+jQuery(function($){\r
+ $.datepicker.regional['is'] = {\r
+ closeText: 'Loka',\r
+ prevText: '< Fyrri',\r
+ nextText: 'Næsti >',\r
+ currentText: 'Í dag',\r
+ monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',\r
+ 'Júlí','Ágúst','September','Október','Nóvember','Desember'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',\r
+ 'Júl','Ágú','Sep','Okt','Nóv','Des'],\r
+ dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],\r
+ dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],\r
+ dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['is']);\r
+});/* Italian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Apaella (apaella@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['it'] = {\r
+ closeText: 'Chiudi',\r
+ prevText: '<Prec',\r
+ nextText: 'Succ>',\r
+ currentText: 'Oggi',\r
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',\r
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],\r
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',\r
+ 'Lug','Ago','Set','Ott','Nov','Dic'],\r
+ dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],\r
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],\r
+ dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['it']);\r
+});\r
+/* Japanese initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Kentaro SATO (kentaro@ranvis.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ja'] = {\r
+ closeText: '閉じる',\r
+ prevText: '<前',\r
+ nextText: '次>',\r
+ currentText: '今日',\r
+ monthNames: ['1月','2月','3月','4月','5月','6月',\r
+ '7月','8月','9月','10月','11月','12月'],\r
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',\r
+ '7月','8月','9月','10月','11月','12月'],\r
+ dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],\r
+ dayNamesShort: ['日','月','火','水','木','金','土'],\r
+ dayNamesMin: ['日','月','火','水','木','金','土'],\r
+ dateFormat: 'yy/mm/dd', firstDay: 0,\r
+ isRTL: false,\r
+ showMonthAfterYear: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['ja']);\r
+});/* Korean initialisation for the jQuery calendar extension. */\r
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ko'] = {\r
+ closeText: '닫기',\r
+ prevText: '이전달',\r
+ nextText: '다음달',\r
+ currentText: '오늘',\r
+ monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',\r
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],\r
+ monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',\r
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],\r
+ dayNames: ['일','월','화','수','목','금','토'],\r
+ dayNamesShort: ['일','월','화','수','목','금','토'],\r
+ dayNamesMin: ['일','월','화','수','목','금','토'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ko']);\r
+});/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* @author Arturas Paleicikas <arturas@avalon.lt> */\r
+jQuery(function($){\r
+ $.datepicker.regional['lt'] = {\r
+ closeText: 'Uždaryti',\r
+ prevText: '<Atgal',\r
+ nextText: 'Pirmyn>',\r
+ currentText: 'Šiandien',\r
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',\r
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],\r
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',\r
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],\r
+ dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],\r
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],\r
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['lt']);\r
+});/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */\r
+jQuery(function($){\r
+ $.datepicker.regional['lv'] = {\r
+ closeText: 'Aizvērt',\r
+ prevText: 'Iepr',\r
+ nextText: 'Nāka',\r
+ currentText: 'Šodien',\r
+ monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',\r
+ 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',\r
+ 'Jūl','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],\r
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],\r
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],\r
+ dateFormat: 'dd-mm-yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['lv']);\r
+});/* Malaysian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ms'] = {\r
+ closeText: 'Tutup',\r
+ prevText: '<Sebelum',\r
+ nextText: 'Selepas>',\r
+ currentText: 'hari ini',\r
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',\r
+ 'Julai','Ogos','September','Oktober','November','Disember'],\r
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',\r
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],\r
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],\r
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],\r
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ms']);\r
+});/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */\r
+jQuery(function($){\r
+ $.datepicker.regional.nl = {\r
+ closeText: 'Sluiten',\r
+ prevText: '←',\r
+ nextText: '→',\r
+ currentText: 'Vandaag',\r
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',\r
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],\r
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',\r
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],\r
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],\r
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],\r
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional.nl);\r
+});/* Norwegian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['no'] = {\r
+ closeText: 'Lukk',\r
+ prevText: '«Forrige',\r
+ nextText: 'Neste»',\r
+ currentText: 'I dag',\r
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',\r
+ 'Juli','August','September','Oktober','November','Desember'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Des'],\r
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],\r
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],\r
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['no']);\r
+});\r
+/* Polish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['pl'] = {\r
+ closeText: 'Zamknij',\r
+ prevText: '<Poprzedni',\r
+ nextText: 'Następny>',\r
+ currentText: 'Dziś',\r
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',\r
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],\r
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',\r
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],\r
+ dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'],\r
+ dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],\r
+ dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['pl']);\r
+});\r
+/* Brazilian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['pt-BR'] = {\r
+ closeText: 'Fechar',\r
+ prevText: '<Anterior',\r
+ nextText: 'Próximo>',\r
+ currentText: 'Hoje',\r
+ monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',\r
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],\r
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',\r
+ 'Jul','Ago','Set','Out','Nov','Dez'],\r
+ dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],\r
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],\r
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);\r
+});/* Romanian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Edmond L. (ll_edmond@walla.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ro'] = {\r
+ closeText: 'Inchide',\r
+ prevText: '<Anterior',\r
+ nextText: 'Urmator>',\r
+ currentText: 'Azi',\r
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Junie',\r
+ 'Julie','August','Septembrie','Octobrie','Noiembrie','Decembrie'],\r
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Jun',\r
+ 'Jul', 'Aug', 'Sep', 'Oct', 'Noi', 'Dec'],\r
+ dayNames: ['Duminica', 'Luni', 'Marti', 'Miercuri', 'Joi', 'Vineri', 'Sambata'],\r
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sam'],\r
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sa'],\r
+ dateFormat: 'mm/dd/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ro']);\r
+});\r
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Andrew Stromnov (stromnov@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ru'] = {\r
+ closeText: 'Закрыть',\r
+ prevText: '<Пред',\r
+ nextText: 'След>',\r
+ currentText: 'Сегодня',\r
+ monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',\r
+ 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],\r
+ monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',\r
+ 'Июл','Авг','Сен','Окт','Ноя','Дек'],\r
+ dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],\r
+ dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],\r
+ dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ru']);\r
+});/* Slovak initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Vojtech Rinik (vojto@hmm.sk). */\r
+jQuery(function($){\r
+ $.datepicker.regional['sk'] = {\r
+ closeText: 'Zavrieť',\r
+ prevText: '<Predchádzajúci',\r
+ nextText: 'Nasledujúci>',\r
+ currentText: 'Dnes',\r
+ monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',\r
+ 'Júl','August','September','Október','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',\r
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],\r
+ dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],\r
+ dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sk']);\r
+});\r
+/* Slovenian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Jaka Jancar (jaka@kubje.org). */\r
+/* c = č, s = š z = ž C = Č S = Š Z = Ž */\r
+jQuery(function($){\r
+ $.datepicker.regional['sl'] = {\r
+ closeText: 'Zapri',\r
+ prevText: '<Prejšnji',\r
+ nextText: 'Naslednji>',\r
+ currentText: 'Trenutni',\r
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',\r
+ 'Julij','Avgust','September','Oktober','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],\r
+ dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],\r
+ dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sl']);\r
+});\r
+/* Albanian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Flakron Bytyqi (flakron@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['sq'] = {\r
+ closeText: 'mbylle',\r
+ prevText: '<mbrapa',\r
+ nextText: 'Përpara>',\r
+ currentText: 'sot',\r
+ monthNames: ['Janar','Shkurt','Mars','Pril','Maj','Qershor',\r
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],\r
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',\r
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],\r
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],\r
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],\r
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sq']);\r
+});\r
+/* Swedish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */\r
+jQuery(function($){\r
+ $.datepicker.regional['sv'] = {\r
+ closeText: 'Stäng',\r
+ prevText: '«Förra',\r
+ nextText: 'Nästa»',\r
+ currentText: 'Idag',\r
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',\r
+ 'Juli','Augusti','September','Oktober','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],\r
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],\r
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sv']);\r
+});\r
+/* Thai initialisation for the jQuery UI date picker plugin. */\r
+/* Written by pipo (pipo@sixhead.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['th'] = {\r
+ closeText: 'ปิด',\r
+ prevText: '« ย้อน',\r
+ nextText: 'ถัดไป »',\r
+ currentText: 'วันนี้',\r
+ monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',\r
+ 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],\r
+ monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',\r
+ 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],\r
+ dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],\r
+ dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],\r
+ dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['th']);\r
+});/* Turkish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['tr'] = {\r
+ closeText: 'kapat',\r
+ prevText: '<geri',\r
+ nextText: 'ileri>',\r
+ currentText: 'bugün',\r
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',\r
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],\r
+ monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',\r
+ 'Tem','Ağu','Eyl','Eki','Kas','Ara'],\r
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],\r
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],\r
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['tr']);\r
+});/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['uk'] = {\r
+ closeText: 'Закрити',\r
+ prevText: '<',\r
+ nextText: '>',\r
+ currentText: 'Сьогодні',\r
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',\r
+ 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],\r
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',\r
+ 'Лип','Сер','Вер','Жов','Лис','Гру'],\r
+ dayNames: ['неділя','понеділок','вівторок','середа','четвер','пятниця','суббота'],\r
+ dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],\r
+ dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['uk']);\r
+});/* Chinese initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Cloudream (cloudream@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['zh-CN'] = {\r
+ closeText: '关闭',\r
+ prevText: '<上月',\r
+ nextText: '下月>',\r
+ currentText: '今天',\r
+ monthNames: ['一月','二月','三月','四月','五月','六月',\r
+ '七月','八月','九月','十月','十一月','十二月'],\r
+ monthNamesShort: ['一','二','三','四','五','六',\r
+ '七','八','九','十','十一','十二'],\r
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],\r
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],\r
+ dayNamesMin: ['日','一','二','三','四','五','六'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);\r
+});\r
+/* Chinese initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Ressol (ressol@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['zh-TW'] = {\r
+ closeText: '關閉',\r
+ prevText: '<上月',\r
+ nextText: '下月>',\r
+ currentText: '今天',\r
+ monthNames: ['一月','二月','三月','四月','五月','六月',\r
+ '七月','八月','九月','十月','十一月','十二月'],\r
+ monthNamesShort: ['一','二','三','四','五','六',\r
+ '七','八','九','十','十一','十二'],\r
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],\r
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],\r
+ dayNamesMin: ['日','一','二','三','四','五','六'],\r
+ dateFormat: 'yy/mm/dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);\r
+});\r
--- /dev/null
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Al Horani -- koko.dw@gmail.com */
+/* خالد الحوراني -- koko.dw@gmail.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+ $.datepicker.regional['ar'] = {
+ closeText: 'إغلاق',
+ prevText: '<السابق',
+ nextText: 'التالي>',
+ currentText: 'اليوم',
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
+ dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: true};
+ $.datepicker.setDefaults($.datepicker.regional['ar']);
+});
\ No newline at end of file
--- /dev/null
+/* Bulgarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Stoyan Kyosev (http://svest.org). */
+jQuery(function($){
+ $.datepicker.regional['bg'] = {
+ closeText: 'затвори',
+ prevText: '<назад',
+ nextText: 'напред>',
+ nextBigText: '>>',
+ currentText: 'днес',
+ monthNames: ['Януари','Февруари','Март','Април','Май','Юни',
+ 'Юли','Август','Септември','Октомври','Ноември','Декември'],
+ monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',
+ 'Юли','Авг','Сеп','Окт','Нов','Дек'],
+ dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],
+ dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],
+ dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['bg']);
+});
--- /dev/null
+/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */
+/* Writers: (joan.leon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ca'] = {
+ closeText: 'Tancar',
+ prevText: '<Ant',
+ nextText: 'Seg>',
+ currentText: 'Avui',
+ monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Oct','Nov','Des'],
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
+ dateFormat: 'mm/dd/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ca']);
+});
\ No newline at end of file
--- /dev/null
+/* Czech initialisation for the jQuery UI date picker plugin. */
+/* Written by Tomas Muller (tomas@tomas-muller.net). */
+jQuery(function($){
+ $.datepicker.regional['cs'] = {
+ closeText: 'Zavřít',
+ prevText: '<Dříve',
+ nextText: 'Později>',
+ currentText: 'Nyní',
+ monthNames: ['leden','únor','březen','duben','květen','červen',
+ 'červenec','srpen','září','říjen','listopad','prosinec'],
+ monthNamesShort: ['led','úno','bře','dub','kvě','čer',
+ 'čvc','srp','zář','říj','lis','pro'],
+ dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],
+ dayNamesMin: ['ne','po','út','st','čt','pá','so'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['cs']);
+});
--- /dev/null
+/* Danish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jan Christensen ( deletestuff@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['da'] = {
+ closeText: 'Luk',
+ prevText: '<Forrige',
+ nextText: 'Næste>',
+ currentText: 'Idag',
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
+ 'Juli','August','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ dateFormat: 'dd-mm-yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['da']);
+});
--- /dev/null
+/* German initialisation for the jQuery UI date picker plugin. */
+/* Written by Milian Wolff (mail@milianw.de). */
+jQuery(function($){
+ $.datepicker.regional['de'] = {
+ closeText: 'schließen',
+ prevText: '<zurück',
+ nextText: 'Vor>',
+ currentText: 'heute',
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Dezember'],
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['de']);
+});
--- /dev/null
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */
+jQuery(function($){
+ $.datepicker.regional['el'] = {
+ closeText: 'Κλείσιμο',
+ prevText: 'Προηγούμενος',
+ nextText: 'Επόμενος',
+ currentText: 'Τρέχων Μήνας',
+ monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',
+ 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],
+ monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],
+ dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],
+ dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],
+ dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['el']);
+});
\ No newline at end of file
--- /dev/null
+/* Esperanto initialisation for the jQuery UI date picker plugin. */
+/* Written by Olivier M. (olivierweb@ifrance.com). */
+jQuery(function($){
+ $.datepicker.regional['eo'] = {
+ closeText: 'Fermi',
+ prevText: '<Anta',
+ nextText: 'Sekv>',
+ currentText: 'Nuna',
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
+ 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aŭg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['eo']);
+});
--- /dev/null
+/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */
+/* Traducido por Vester (xvester@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['es'] = {
+ closeText: 'Cerrar',
+ prevText: '<Ant',
+ nextText: 'Sig>',
+ currentText: 'Hoy',
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],
+ dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],
+ dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['es']);
+});
\ No newline at end of file
--- /dev/null
+/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
+/* Javad Mowlanezhad -- jmowla@gmail.com */
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
+jQuery(function($) {
+ $.datepicker.regional['fa'] = {
+ closeText: 'بستن',
+ prevText: '<قبلي',
+ nextText: 'بعدي>',
+ currentText: 'امروز',
+ monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
+ 'مهر','آبان','آذر','دي','بهمن','اسفند'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
+ dateFormat: 'yy/mm/dd', firstDay: 6,
+ isRTL: true};
+ $.datepicker.setDefaults($.datepicker.regional['fa']);
+});
\ No newline at end of file
--- /dev/null
+/* Finnish initialisation for the jQuery UI date picker plugin. */
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['fi'] = {
+ closeText: 'Sulje',
+ prevText: '«Edellinen',
+ nextText: 'Seuraava»',
+ currentText: 'Tänään',
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',
+ 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',
+ 'Heinä','Elo','Syys','Loka','Marras','Joulu'],
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['fi']);
+});
--- /dev/null
+/* French initialisation for the jQuery UI date picker plugin. */
+/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */
+jQuery(function($){
+ $.datepicker.regional['fr'] = {
+ closeText: 'Fermer',
+ prevText: '<Préc',
+ nextText: 'Suiv>',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['fr']);
+});
\ No newline at end of file
--- /dev/null
+/* Hebrew initialisation for the UI Datepicker extension. */
+/* Written by Amir Hardon (ahardon at gmail dot com). */
+jQuery(function($){
+ $.datepicker.regional['he'] = {
+ closeText: 'סגור',
+ prevText: '<הקודם',
+ nextText: 'הבא>',
+ currentText: 'היום',
+ monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',
+ 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],
+ monthNamesShort: ['1','2','3','4','5','6',
+ '7','8','9','10','11','12'],
+ dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],
+ dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: true};
+ $.datepicker.setDefaults($.datepicker.regional['he']);
+});
--- /dev/null
+/* Croatian i18n for the jQuery UI date picker plugin. */
+/* Written by Vjekoslav Nesek. */
+jQuery(function($){
+ $.datepicker.regional['hr'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani',
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],
+ dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ dateFormat: 'dd.mm.yy.', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['hr']);
+});
\ No newline at end of file
--- /dev/null
+/* Hungarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */
+jQuery(function($){
+ $.datepicker.regional['hu'] = {
+ closeText: 'bezárás',
+ prevText: '« vissza',
+ nextText: 'előre »',
+ currentText: 'ma',
+ monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
+ dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['hu']);
+});
--- /dev/null
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
+jQuery(function($){
+ $.datepicker.regional['hy'] = {
+ closeText: 'Փակել',
+ prevText: '<Նախ.',
+ nextText: 'Հաջ.>',
+ currentText: 'Այսօր',
+ monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',
+ 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],
+ monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',
+ 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],
+ dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],
+ dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['hy']);
+});
\ No newline at end of file
--- /dev/null
+/* Indonesian initialisation for the jQuery UI date picker plugin. */
+/* Written by Deden Fathurahman (dedenf@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['id'] = {
+ closeText: 'Tutup',
+ prevText: '<mundur',
+ nextText: 'maju>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Agus','Sep','Okt','Nop','Des'],
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['id']);
+});
\ No newline at end of file
--- /dev/null
+/* Icelandic initialisation for the jQuery UI date picker plugin. */
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */
+jQuery(function($){
+ $.datepicker.regional['is'] = {
+ closeText: 'Loka',
+ prevText: '< Fyrri',
+ nextText: 'Næsti >',
+ currentText: 'Í dag',
+ monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',
+ 'Júlí','Ágúst','September','Október','Nóvember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',
+ 'Júl','Ágú','Sep','Okt','Nóv','Des'],
+ dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],
+ dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],
+ dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['is']);
+});
\ No newline at end of file
--- /dev/null
+/* Italian initialisation for the jQuery UI date picker plugin. */
+/* Written by Apaella (apaella@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['it'] = {
+ closeText: 'Chiudi',
+ prevText: '<Prec',
+ nextText: 'Succ>',
+ currentText: 'Oggi',
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
+ 'Lug','Ago','Set','Ott','Nov','Dic'],
+ dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
+ dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['it']);
+});
--- /dev/null
+/* Japanese initialisation for the jQuery UI date picker plugin. */
+/* Written by Kentaro SATO (kentaro@ranvis.com). */
+jQuery(function($){
+ $.datepicker.regional['ja'] = {
+ closeText: '閉じる',
+ prevText: '<前',
+ nextText: '次>',
+ currentText: '今日',
+ monthNames: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],
+ dayNamesShort: ['日','月','火','水','木','金','土'],
+ dayNamesMin: ['日','月','火','水','木','金','土'],
+ dateFormat: 'yy/mm/dd', firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true};
+ $.datepicker.setDefaults($.datepicker.regional['ja']);
+});
\ No newline at end of file
--- /dev/null
+/* Korean initialisation for the jQuery calendar extension. */
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ko'] = {
+ closeText: '닫기',
+ prevText: '이전달',
+ nextText: '다음달',
+ currentText: '오늘',
+ monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ dayNames: ['일','월','화','수','목','금','토'],
+ dayNamesShort: ['일','월','화','수','목','금','토'],
+ dayNamesMin: ['일','월','화','수','목','금','토'],
+ dateFormat: 'yy-mm-dd', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ko']);
+});
\ No newline at end of file
--- /dev/null
+/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas@avalon.lt> */
+jQuery(function($){
+ $.datepicker.regional['lt'] = {
+ closeText: 'Uždaryti',
+ prevText: '<Atgal',
+ nextText: 'Pirmyn>',
+ currentText: 'Šiandien',
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],
+ dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['lt']);
+});
\ No newline at end of file
--- /dev/null
+/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
+jQuery(function($){
+ $.datepicker.regional['lv'] = {
+ closeText: 'Aizvērt',
+ prevText: 'Iepr',
+ nextText: 'Nāka',
+ currentText: 'Šodien',
+ monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',
+ 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',
+ 'Jūl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
+ dateFormat: 'dd-mm-yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['lv']);
+});
\ No newline at end of file
--- /dev/null
+/* Malaysian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
+jQuery(function($){
+ $.datepicker.regional['ms'] = {
+ closeText: 'Tutup',
+ prevText: '<Sebelum',
+ nextText: 'Selepas>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
+ 'Julai','Ogos','September','Oktober','November','Disember'],
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ms']);
+});
\ No newline at end of file
--- /dev/null
+/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+ $.datepicker.regional.nl = {
+ closeText: 'Sluiten',
+ prevText: '←',
+ nextText: '→',
+ currentText: 'Vandaag',
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional.nl);
+});
\ No newline at end of file
--- /dev/null
+/* Norwegian initialisation for the jQuery UI date picker plugin. */
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['no'] = {
+ closeText: 'Lukk',
+ prevText: '«Forrige',
+ nextText: 'Neste»',
+ currentText: 'I dag',
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ dateFormat: 'yy-mm-dd', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['no']);
+});
--- /dev/null
+/* Polish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pl'] = {
+ closeText: 'Zamknij',
+ prevText: '<Poprzedni',
+ nextText: 'Następny>',
+ currentText: 'Dziś',
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],
+ dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'],
+ dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],
+ dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['pl']);
+});
--- /dev/null
+/* Brazilian initialisation for the jQuery UI date picker plugin. */
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pt-BR'] = {
+ closeText: 'Fechar',
+ prevText: '<Anterior',
+ nextText: 'Próximo>',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);
+});
\ No newline at end of file
--- /dev/null
+/* Romanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Edmond L. (ll_edmond@walla.com). */
+jQuery(function($){
+ $.datepicker.regional['ro'] = {
+ closeText: 'Inchide',
+ prevText: '<Anterior',
+ nextText: 'Urmator>',
+ currentText: 'Azi',
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Junie',
+ 'Julie','August','Septembrie','Octobrie','Noiembrie','Decembrie'],
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Oct', 'Noi', 'Dec'],
+ dayNames: ['Duminica', 'Luni', 'Marti', 'Miercuri', 'Joi', 'Vineri', 'Sambata'],
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sam'],
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sa'],
+ dateFormat: 'mm/dd/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ro']);
+});
--- /dev/null
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Andrew Stromnov (stromnov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ru'] = {
+ closeText: 'Закрыть',
+ prevText: '<Пред',
+ nextText: 'След>',
+ currentText: 'Сегодня',
+ monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',
+ 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],
+ monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',
+ 'Июл','Авг','Сен','Окт','Ноя','Дек'],
+ dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],
+ dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ru']);
+});
\ No newline at end of file
--- /dev/null
+/* Slovak initialisation for the jQuery UI date picker plugin. */
+/* Written by Vojtech Rinik (vojto@hmm.sk). */
+jQuery(function($){
+ $.datepicker.regional['sk'] = {
+ closeText: 'Zavrieť',
+ prevText: '<Predchádzajúci',
+ nextText: 'Nasledujúci>',
+ currentText: 'Dnes',
+ monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',
+ 'Júl','August','September','Október','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],
+ dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],
+ dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],
+ dateFormat: 'dd.mm.yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sk']);
+});
--- /dev/null
+/* Slovenian initialisation for the jQuery UI date picker plugin. */
+/* Written by Jaka Jancar (jaka@kubje.org). */
+/* c = č, s = š z = ž C = Č S = Š Z = Ž */
+jQuery(function($){
+ $.datepicker.regional['sl'] = {
+ closeText: 'Zapri',
+ prevText: '<Prejšnji',
+ nextText: 'Naslednji>',
+ currentText: 'Trenutni',
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
+ 'Julij','Avgust','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],
+ dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],
+ dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sl']);
+});
--- /dev/null
+/* Albanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Flakron Bytyqi (flakron@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['sq'] = {
+ closeText: 'mbylle',
+ prevText: '<mbrapa',
+ nextText: 'Përpara>',
+ currentText: 'sot',
+ monthNames: ['Janar','Shkurt','Mars','Pril','Maj','Qershor',
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sq']);
+});
--- /dev/null
+/* Swedish initialisation for the jQuery UI date picker plugin. */
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */
+jQuery(function($){
+ $.datepicker.regional['sv'] = {
+ closeText: 'Stäng',
+ prevText: '«Förra',
+ nextText: 'Nästa»',
+ currentText: 'Idag',
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
+ 'Juli','Augusti','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sv']);
+});
--- /dev/null
+/* Thai initialisation for the jQuery UI date picker plugin. */
+/* Written by pipo (pipo@sixhead.com). */
+jQuery(function($){
+ $.datepicker.regional['th'] = {
+ closeText: 'ปิด',
+ prevText: '« ย้อน',
+ nextText: 'ถัดไป »',
+ currentText: 'วันนี้',
+ monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
+ 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],
+ monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
+ 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],
+ dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],
+ dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['th']);
+});
\ No newline at end of file
--- /dev/null
+/* Turkish initialisation for the jQuery UI date picker plugin. */
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
+jQuery(function($){
+ $.datepicker.regional['tr'] = {
+ closeText: 'kapat',
+ prevText: '<geri',
+ nextText: 'ileri>',
+ currentText: 'bugün',
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
+ monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',
+ 'Tem','Ağu','Eyl','Eki','Kas','Ara'],
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['tr']);
+});
\ No newline at end of file
--- /dev/null
+/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['uk'] = {
+ closeText: 'Закрити',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Сьогодні',
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
+ 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
+ 'Лип','Сер','Вер','Жов','Лис','Гру'],
+ dayNames: ['неділя','понеділок','вівторок','середа','четвер','пятниця','суббота'],
+ dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['uk']);
+});
\ No newline at end of file
--- /dev/null
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Cloudream (cloudream@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-CN'] = {
+ closeText: '关闭',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);
+});
--- /dev/null
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Ressol (ressol@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-TW'] = {
+ closeText: '關閉',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ dateFormat: 'yy/mm/dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);
+});
--- /dev/null
+/*!
+ * jQuery JavaScript Library v1.3.2
+ * http://jquery.com/
+ *
+ * Copyright (c) 2009 John Resig
+ * Dual licensed under the MIT and GPL licenses.
+ * http://docs.jquery.com/License
+ *
+ * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009)
+ * Revision: 6246
+ */
+(function(){
+
+var
+ // Will speed up references to window, and allows munging its name.
+ window = this,
+ // Will speed up references to undefined, and allows munging its name.
+ undefined,
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+ // Map over the $ in case of overwrite
+ _$ = window.$,
+
+ jQuery = window.jQuery = window.$ = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init( selector, context );
+ },
+
+ // A simple way to check for HTML strings or ID strings
+ // (both of which we optimize for)
+ quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,
+ // Is it a simple selector
+ isSimple = /^.[^:#\[\.,]*$/;
+
+jQuery.fn = jQuery.prototype = {
+ init: function( selector, context ) {
+ // Make sure that a selection was provided
+ selector = selector || document;
+
+ // Handle $(DOMElement)
+ if ( selector.nodeType ) {
+ this[0] = selector;
+ this.length = 1;
+ this.context = selector;
+ return this;
+ }
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ // Are we dealing with HTML string or an ID?
+ var match = quickExpr.exec( selector );
+
+ // Verify a match, and that no context was specified for #id
+ if ( match && (match[1] || !context) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[1] )
+ selector = jQuery.clean( [ match[1] ], context );
+
+ // HANDLE: $("#id")
+ else {
+ var elem = document.getElementById( match[3] );
+
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem && elem.id != match[3] )
+ return jQuery().find( selector );
+
+ // Otherwise, we inject the element directly into the jQuery object
+ var ret = jQuery( elem || [] );
+ ret.context = document;
+ ret.selector = selector;
+ return ret;
+ }
+
+ // HANDLE: $(expr, [context])
+ // (which is just equivalent to: $(content).find(expr)
+ } else
+ return jQuery( context ).find( selector );
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( jQuery.isFunction( selector ) )
+ return jQuery( document ).ready( selector );
+
+ // Make sure that old selector state is passed along
+ if ( selector.selector && selector.context ) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return this.setArray(jQuery.isArray( selector ) ?
+ selector :
+ jQuery.makeArray(selector));
+ },
+
+ // Start with an empty selector
+ selector: "",
+
+ // The current version of jQuery being used
+ jquery: "1.3.2",
+
+ // The number of elements contained in the matched element set
+ size: function() {
+ return this.length;
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+ return num === undefined ?
+
+ // Return a 'clean' array
+ Array.prototype.slice.call( this ) :
+
+ // Return just the object
+ this[ num ];
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems, name, selector ) {
+ // Build a new jQuery matched element set
+ var ret = jQuery( elems );
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+
+ ret.context = this.context;
+
+ if ( name === "find" )
+ ret.selector = this.selector + (this.selector ? " " : "") + selector;
+ else if ( name )
+ ret.selector = this.selector + "." + name + "(" + selector + ")";
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Force the current matched set of elements to become
+ // the specified array of elements (destroying the stack in the process)
+ // You should use pushStack() in order to do this, but maintain the stack
+ setArray: function( elems ) {
+ // Resetting the length to 0, then using the native Array push
+ // is a super-fast way to populate an object with array-like properties
+ this.length = 0;
+ Array.prototype.push.apply( this, elems );
+
+ return this;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function( callback, args ) {
+ return jQuery.each( this, callback, args );
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem && elem.jquery ? elem[0] : elem
+ , this );
+ },
+
+ attr: function( name, value, type ) {
+ var options = name;
+
+ // Look for the case where we're accessing a style value
+ if ( typeof name === "string" )
+ if ( value === undefined )
+ return this[0] && jQuery[ type || "attr" ]( this[0], name );
+
+ else {
+ options = {};
+ options[ name ] = value;
+ }
+
+ // Check to see if we're setting style values
+ return this.each(function(i){
+ // Set all the styles
+ for ( name in options )
+ jQuery.attr(
+ type ?
+ this.style :
+ this,
+ name, jQuery.prop( this, options[ name ], type, i, name )
+ );
+ });
+ },
+
+ css: function( key, value ) {
+ // ignore negative width and height values
+ if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 )
+ value = undefined;
+ return this.attr( key, value, "curCSS" );
+ },
+
+ text: function( text ) {
+ if ( typeof text !== "object" && text != null )
+ return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+
+ var ret = "";
+
+ jQuery.each( text || this, function(){
+ jQuery.each( this.childNodes, function(){
+ if ( this.nodeType != 8 )
+ ret += this.nodeType != 1 ?
+ this.nodeValue :
+ jQuery.fn.text( [ this ] );
+ });
+ });
+
+ return ret;
+ },
+
+ wrapAll: function( html ) {
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).clone();
+
+ if ( this[0].parentNode )
+ wrap.insertBefore( this[0] );
+
+ wrap.map(function(){
+ var elem = this;
+
+ while ( elem.firstChild )
+ elem = elem.firstChild;
+
+ return elem;
+ }).append(this);
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ return this.each(function(){
+ jQuery( this ).contents().wrapAll( html );
+ });
+ },
+
+ wrap: function( html ) {
+ return this.each(function(){
+ jQuery( this ).wrapAll( html );
+ });
+ },
+
+ append: function() {
+ return this.domManip(arguments, true, function(elem){
+ if (this.nodeType == 1)
+ this.appendChild( elem );
+ });
+ },
+
+ prepend: function() {
+ return this.domManip(arguments, true, function(elem){
+ if (this.nodeType == 1)
+ this.insertBefore( elem, this.firstChild );
+ });
+ },
+
+ before: function() {
+ return this.domManip(arguments, false, function(elem){
+ this.parentNode.insertBefore( elem, this );
+ });
+ },
+
+ after: function() {
+ return this.domManip(arguments, false, function(elem){
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ });
+ },
+
+ end: function() {
+ return this.prevObject || jQuery( [] );
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: [].push,
+ sort: [].sort,
+ splice: [].splice,
+
+ find: function( selector ) {
+ if ( this.length === 1 ) {
+ var ret = this.pushStack( [], "find", selector );
+ ret.length = 0;
+ jQuery.find( selector, this[0], ret );
+ return ret;
+ } else {
+ return this.pushStack( jQuery.unique(jQuery.map(this, function(elem){
+ return jQuery.find( selector, elem );
+ })), "find", selector );
+ }
+ },
+
+ clone: function( events ) {
+ // Do the clone
+ var ret = this.map(function(){
+ if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
+ // IE copies events bound via attachEvent when
+ // using cloneNode. Calling detachEvent on the
+ // clone will also remove the events from the orignal
+ // In order to get around this, we use innerHTML.
+ // Unfortunately, this means some modifications to
+ // attributes in IE that are actually only stored
+ // as properties will not be copied (such as the
+ // the name attribute on an input).
+ var html = this.outerHTML;
+ if ( !html ) {
+ var div = this.ownerDocument.createElement("div");
+ div.appendChild( this.cloneNode(true) );
+ html = div.innerHTML;
+ }
+
+ return jQuery.clean([html.replace(/ jQuery\d+="(?:\d+|null)"/g, "").replace(/^\s*/, "")])[0];
+ } else
+ return this.cloneNode(true);
+ });
+
+ // Copy the events from the original to the clone
+ if ( events === true ) {
+ var orig = this.find("*").andSelf(), i = 0;
+
+ ret.find("*").andSelf().each(function(){
+ if ( this.nodeName !== orig[i].nodeName )
+ return;
+
+ var events = jQuery.data( orig[i], "events" );
+
+ for ( var type in events ) {
+ for ( var handler in events[ type ] ) {
+ jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data );
+ }
+ }
+
+ i++;
+ });
+ }
+
+ // Return the cloned set
+ return ret;
+ },
+
+ filter: function( selector ) {
+ return this.pushStack(
+ jQuery.isFunction( selector ) &&
+ jQuery.grep(this, function(elem, i){
+ return selector.call( elem, i );
+ }) ||
+
+ jQuery.multiFilter( selector, jQuery.grep(this, function(elem){
+ return elem.nodeType === 1;
+ }) ), "filter", selector );
+ },
+
+ closest: function( selector ) {
+ var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null,
+ closer = 0;
+
+ return this.map(function(){
+ var cur = this;
+ while ( cur && cur.ownerDocument ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) ) {
+ jQuery.data(cur, "closest", closer);
+ return cur;
+ }
+ cur = cur.parentNode;
+ closer++;
+ }
+ });
+ },
+
+ not: function( selector ) {
+ if ( typeof selector === "string" )
+ // test special case where just one selector is passed in
+ if ( isSimple.test( selector ) )
+ return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector );
+ else
+ selector = jQuery.multiFilter( selector, this );
+
+ var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType;
+ return this.filter(function() {
+ return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector;
+ });
+ },
+
+ add: function( selector ) {
+ return this.pushStack( jQuery.unique( jQuery.merge(
+ this.get(),
+ typeof selector === "string" ?
+ jQuery( selector ) :
+ jQuery.makeArray( selector )
+ )));
+ },
+
+ is: function( selector ) {
+ return !!selector && jQuery.multiFilter( selector, this ).length > 0;
+ },
+
+ hasClass: function( selector ) {
+ return !!selector && this.is( "." + selector );
+ },
+
+ val: function( value ) {
+ if ( value === undefined ) {
+ var elem = this[0];
+
+ if ( elem ) {
+ if( jQuery.nodeName( elem, 'option' ) )
+ return (elem.attributes.value || {}).specified ? elem.value : elem.text;
+
+ // We need to handle select boxes special
+ if ( jQuery.nodeName( elem, "select" ) ) {
+ var index = elem.selectedIndex,
+ values = [],
+ options = elem.options,
+ one = elem.type == "select-one";
+
+ // Nothing was selected
+ if ( index < 0 )
+ return null;
+
+ // Loop through all the selected options
+ for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+ var option = options[ i ];
+
+ if ( option.selected ) {
+ // Get the specifc value for the option
+ value = jQuery(option).val();
+
+ // We don't need an array for one selects
+ if ( one )
+ return value;
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ return values;
+ }
+
+ // Everything else, we just grab the value
+ return (elem.value || "").replace(/\r/g, "");
+
+ }
+
+ return undefined;
+ }
+
+ if ( typeof value === "number" )
+ value += '';
+
+ return this.each(function(){
+ if ( this.nodeType != 1 )
+ return;
+
+ if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) )
+ this.checked = (jQuery.inArray(this.value, value) >= 0 ||
+ jQuery.inArray(this.name, value) >= 0);
+
+ else if ( jQuery.nodeName( this, "select" ) ) {
+ var values = jQuery.makeArray(value);
+
+ jQuery( "option", this ).each(function(){
+ this.selected = (jQuery.inArray( this.value, values ) >= 0 ||
+ jQuery.inArray( this.text, values ) >= 0);
+ });
+
+ if ( !values.length )
+ this.selectedIndex = -1;
+
+ } else
+ this.value = value;
+ });
+ },
+
+ html: function( value ) {
+ return value === undefined ?
+ (this[0] ?
+ this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g, "") :
+ null) :
+ this.empty().append( value );
+ },
+
+ replaceWith: function( value ) {
+ return this.after( value ).remove();
+ },
+
+ eq: function( i ) {
+ return this.slice( i, +i + 1 );
+ },
+
+ slice: function() {
+ return this.pushStack( Array.prototype.slice.apply( this, arguments ),
+ "slice", Array.prototype.slice.call(arguments).join(",") );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function(elem, i){
+ return callback.call( elem, i, elem );
+ }));
+ },
+
+ andSelf: function() {
+ return this.add( this.prevObject );
+ },
+
+ domManip: function( args, table, callback ) {
+ if ( this[0] ) {
+ var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(),
+ scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ),
+ first = fragment.firstChild;
+
+ if ( first )
+ for ( var i = 0, l = this.length; i < l; i++ )
+ callback.call( root(this[i], first), this.length > 1 || i > 0 ?
+ fragment.cloneNode(true) : fragment );
+
+ if ( scripts )
+ jQuery.each( scripts, evalScript );
+ }
+
+ return this;
+
+ function root( elem, cur ) {
+ return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ?
+ (elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+ elem;
+ }
+ }
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+function evalScript( i, elem ) {
+ if ( elem.src )
+ jQuery.ajax({
+ url: elem.src,
+ async: false,
+ dataType: "script"
+ });
+
+ else
+ jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
+
+ if ( elem.parentNode )
+ elem.parentNode.removeChild( elem );
+}
+
+function now(){
+ return +new Date;
+}
+
+jQuery.extend = jQuery.fn.extend = function() {
+ // copy reference to target object
+ var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) )
+ target = {};
+
+ // extend jQuery itself if only one argument is passed
+ if ( length == i ) {
+ target = this;
+ --i;
+ }
+
+ for ( ; i < length; i++ )
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null )
+ // Extend the base object
+ for ( var name in options ) {
+ var src = target[ name ], copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy )
+ continue;
+
+ // Recurse if we're merging object values
+ if ( deep && copy && typeof copy === "object" && !copy.nodeType )
+ target[ name ] = jQuery.extend( deep,
+ // Never move original objects, clone them
+ src || ( copy.length != null ? [ ] : { } )
+ , copy );
+
+ // Don't bring in undefined values
+ else if ( copy !== undefined )
+ target[ name ] = copy;
+
+ }
+
+ // Return the modified object
+ return target;
+};
+
+// exclude the following css properties to add px
+var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
+ // cache defaultView
+ defaultView = document.defaultView || {},
+ toString = Object.prototype.toString;
+
+jQuery.extend({
+ noConflict: function( deep ) {
+ window.$ = _$;
+
+ if ( deep )
+ window.jQuery = _jQuery;
+
+ return jQuery;
+ },
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return toString.call(obj) === "[object Function]";
+ },
+
+ isArray: function( obj ) {
+ return toString.call(obj) === "[object Array]";
+ },
+
+ // check if an element is in a (or is an) XML document
+ isXMLDoc: function( elem ) {
+ return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" ||
+ !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument );
+ },
+
+ // Evalulates a script in a global context
+ globalEval: function( data ) {
+ if ( data && /\S/.test(data) ) {
+ // Inspired by code by Andrea Giammarchi
+ // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
+ var head = document.getElementsByTagName("head")[0] || document.documentElement,
+ script = document.createElement("script");
+
+ script.type = "text/javascript";
+ if ( jQuery.support.scriptEval )
+ script.appendChild( document.createTextNode( data ) );
+ else
+ script.text = data;
+
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // This arises when a base node is used (#2709).
+ head.insertBefore( script, head.firstChild );
+ head.removeChild( script );
+ }
+ },
+
+ nodeName: function( elem, name ) {
+ return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase();
+ },
+
+ // args is for internal usage only
+ each: function( object, callback, args ) {
+ var name, i = 0, length = object.length;
+
+ if ( args ) {
+ if ( length === undefined ) {
+ for ( name in object )
+ if ( callback.apply( object[ name ], args ) === false )
+ break;
+ } else
+ for ( ; i < length; )
+ if ( callback.apply( object[ i++ ], args ) === false )
+ break;
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if ( length === undefined ) {
+ for ( name in object )
+ if ( callback.call( object[ name ], name, object[ name ] ) === false )
+ break;
+ } else
+ for ( var value = object[0];
+ i < length && callback.call( value, i, value ) !== false; value = object[++i] ){}
+ }
+
+ return object;
+ },
+
+ prop: function( elem, value, type, i, name ) {
+ // Handle executable functions
+ if ( jQuery.isFunction( value ) )
+ value = value.call( elem, i );
+
+ // Handle passing in a number to a CSS property
+ return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ?
+ value + "px" :
+ value;
+ },
+
+ className: {
+ // internal only, use addClass("class")
+ add: function( elem, classNames ) {
+ jQuery.each((classNames || "").split(/\s+/), function(i, className){
+ if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) )
+ elem.className += (elem.className ? " " : "") + className;
+ });
+ },
+
+ // internal only, use removeClass("class")
+ remove: function( elem, classNames ) {
+ if (elem.nodeType == 1)
+ elem.className = classNames !== undefined ?
+ jQuery.grep(elem.className.split(/\s+/), function(className){
+ return !jQuery.className.has( classNames, className );
+ }).join(" ") :
+ "";
+ },
+
+ // internal only, use hasClass("class")
+ has: function( elem, className ) {
+ return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1;
+ }
+ },
+
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback ) {
+ var old = {};
+ // Remember the old values, and insert the new ones
+ for ( var name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ callback.call( elem );
+
+ // Revert the old values
+ for ( var name in options )
+ elem.style[ name ] = old[ name ];
+ },
+
+ css: function( elem, name, force, extra ) {
+ if ( name == "width" || name == "height" ) {
+ var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ];
+
+ function getWH() {
+ val = name == "width" ? elem.offsetWidth : elem.offsetHeight;
+
+ if ( extra === "border" )
+ return;
+
+ jQuery.each( which, function() {
+ if ( !extra )
+ val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
+ if ( extra === "margin" )
+ val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0;
+ else
+ val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
+ });
+ }
+
+ if ( elem.offsetWidth !== 0 )
+ getWH();
+ else
+ jQuery.swap( elem, props, getWH );
+
+ return Math.max(0, Math.round(val));
+ }
+
+ return jQuery.curCSS( elem, name, force );
+ },
+
+ curCSS: function( elem, name, force ) {
+ var ret, style = elem.style;
+
+ // We need to handle opacity special in IE
+ if ( name == "opacity" && !jQuery.support.opacity ) {
+ ret = jQuery.attr( style, "opacity" );
+
+ return ret == "" ?
+ "1" :
+ ret;
+ }
+
+ // Make sure we're using the right name for getting the float value
+ if ( name.match( /float/i ) )
+ name = styleFloat;
+
+ if ( !force && style && style[ name ] )
+ ret = style[ name ];
+
+ else if ( defaultView.getComputedStyle ) {
+
+ // Only "float" is needed here
+ if ( name.match( /float/i ) )
+ name = "float";
+
+ name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase();
+
+ var computedStyle = defaultView.getComputedStyle( elem, null );
+
+ if ( computedStyle )
+ ret = computedStyle.getPropertyValue( name );
+
+ // We should always get a number back from opacity
+ if ( name == "opacity" && ret == "" )
+ ret = "1";
+
+ } else if ( elem.currentStyle ) {
+ var camelCase = name.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+
+ ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) {
+ // Remember the original values
+ var left = style.left, rsLeft = elem.runtimeStyle.left;
+
+ // Put in the new values to get a computed value out
+ elem.runtimeStyle.left = elem.currentStyle.left;
+ style.left = ret || 0;
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ elem.runtimeStyle.left = rsLeft;
+ }
+ }
+
+ return ret;
+ },
+
+ clean: function( elems, context, fragment ) {
+ context = context || document;
+
+ // !context.createElement fails in IE with an error but returns typeof 'object'
+ if ( typeof context.createElement === "undefined" )
+ context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+
+ // If a single string is passed in and it's a single tag
+ // just do a createElement and skip the rest
+ if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) {
+ var match = /^<(\w+)\s*\/?>$/.exec(elems[0]);
+ if ( match )
+ return [ context.createElement( match[1] ) ];
+ }
+
+ var ret = [], scripts = [], div = context.createElement("div");
+
+ jQuery.each(elems, function(i, elem){
+ if ( typeof elem === "number" )
+ elem += '';
+
+ if ( !elem )
+ return;
+
+ // Convert html string into DOM nodes
+ if ( typeof elem === "string" ) {
+ // Fix "XHTML"-style tags in all browsers
+ elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){
+ return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ?
+ all :
+ front + "></" + tag + ">";
+ });
+
+ // Trim whitespace, otherwise indexOf won't work as expected
+ var tags = elem.replace(/^\s+/, "").substring(0, 10).toLowerCase();
+
+ var wrap =
+ // option or optgroup
+ !tags.indexOf("<opt") &&
+ [ 1, "<select multiple='multiple'>", "</select>" ] ||
+
+ !tags.indexOf("<leg") &&
+ [ 1, "<fieldset>", "</fieldset>" ] ||
+
+ tags.match(/^<(thead|tbody|tfoot|colg|cap)/) &&
+ [ 1, "<table>", "</table>" ] ||
+
+ !tags.indexOf("<tr") &&
+ [ 2, "<table><tbody>", "</tbody></table>" ] ||
+
+ // <thead> matched above
+ (!tags.indexOf("<td") || !tags.indexOf("<th")) &&
+ [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ] ||
+
+ !tags.indexOf("<col") &&
+ [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ] ||
+
+ // IE can't serialize <link> and <script> tags normally
+ !jQuery.support.htmlSerialize &&
+ [ 1, "div<div>", "</div>" ] ||
+
+ [ 0, "", "" ];
+
+ // Go to html and back, then peel off extra wrappers
+ div.innerHTML = wrap[1] + elem + wrap[2];
+
+ // Move to the right depth
+ while ( wrap[0]-- )
+ div = div.lastChild;
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ var hasBody = /<tbody/i.test(elem),
+ tbody = !tags.indexOf("<table") && !hasBody ?
+ div.firstChild && div.firstChild.childNodes :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] == "<table>" && !hasBody ?
+ div.childNodes :
+ [];
+
+ for ( var j = tbody.length - 1; j >= 0 ; --j )
+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length )
+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
+
+ }
+
+ // IE completely kills leading whitespace when innerHTML is used
+ if ( !jQuery.support.leadingWhitespace && /^\s/.test( elem ) )
+ div.insertBefore( context.createTextNode( elem.match(/^\s*/)[0] ), div.firstChild );
+
+ elem = jQuery.makeArray( div.childNodes );
+ }
+
+ if ( elem.nodeType )
+ ret.push( elem );
+ else
+ ret = jQuery.merge( ret, elem );
+
+ });
+
+ if ( fragment ) {
+ for ( var i = 0; ret[i]; i++ ) {
+ if ( jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+ scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+ } else {
+ if ( ret[i].nodeType === 1 )
+ ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
+ fragment.appendChild( ret[i] );
+ }
+ }
+
+ return scripts;
+ }
+
+ return ret;
+ },
+
+ attr: function( elem, name, value ) {
+ // don't set attributes on text and comment nodes
+ if (!elem || elem.nodeType == 3 || elem.nodeType == 8)
+ return undefined;
+
+ var notxml = !jQuery.isXMLDoc( elem ),
+ // Whether we are setting (or getting)
+ set = value !== undefined;
+
+ // Try to normalize/fix the name
+ name = notxml && jQuery.props[ name ] || name;
+
+ // Only do all the following if this is a node (faster for style)
+ // IE elem.getAttribute passes even for style
+ if ( elem.tagName ) {
+
+ // These attributes require special treatment
+ var special = /href|src|style/.test( name );
+
+ // Safari mis-reports the default selected property of a hidden option
+ // Accessing the parent's selectedIndex property fixes it
+ if ( name == "selected" && elem.parentNode )
+ elem.parentNode.selectedIndex;
+
+ // If applicable, access the attribute via the DOM 0 way
+ if ( name in elem && notxml && !special ) {
+ if ( set ){
+ // We can't allow the type property to be changed (since it causes problems in IE)
+ if ( name == "type" && jQuery.nodeName( elem, "input" ) && elem.parentNode )
+ throw "type property can't be changed";
+
+ elem[ name ] = value;
+ }
+
+ // browsers index elements by id/name on forms, give priority to attributes.
+ if( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) )
+ return elem.getAttributeNode( name ).nodeValue;
+
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ if ( name == "tabIndex" ) {
+ var attributeNode = elem.getAttributeNode( "tabIndex" );
+ return attributeNode && attributeNode.specified
+ ? attributeNode.value
+ : elem.nodeName.match(/(button|input|object|select|textarea)/i)
+ ? 0
+ : elem.nodeName.match(/^(a|area)$/i) && elem.href
+ ? 0
+ : undefined;
+ }
+
+ return elem[ name ];
+ }
+
+ if ( !jQuery.support.style && notxml && name == "style" )
+ return jQuery.attr( elem.style, "cssText", value );
+
+ if ( set )
+ // convert the value to a string (all browsers do this but IE) see #1070
+ elem.setAttribute( name, "" + value );
+
+ var attr = !jQuery.support.hrefNormalized && notxml && special
+ // Some attributes require a special call on IE
+ ? elem.getAttribute( name, 2 )
+ : elem.getAttribute( name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return attr === null ? undefined : attr;
+ }
+
+ // elem is actually elem.style ... set the style
+
+ // IE uses filters for opacity
+ if ( !jQuery.support.opacity && name == "opacity" ) {
+ if ( set ) {
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ elem.zoom = 1;
+
+ // Set the alpha filter to set the opacity
+ elem.filter = (elem.filter || "").replace( /alpha\([^)]*\)/, "" ) +
+ (parseInt( value ) + '' == "NaN" ? "" : "alpha(opacity=" + value * 100 + ")");
+ }
+
+ return elem.filter && elem.filter.indexOf("opacity=") >= 0 ?
+ (parseFloat( elem.filter.match(/opacity=([^)]*)/)[1] ) / 100) + '':
+ "";
+ }
+
+ name = name.replace(/-([a-z])/ig, function(all, letter){
+ return letter.toUpperCase();
+ });
+
+ if ( set )
+ elem[ name ] = value;
+
+ return elem[ name ];
+ },
+
+ trim: function( text ) {
+ return (text || "").replace( /^\s+|\s+$/g, "" );
+ },
+
+ makeArray: function( array ) {
+ var ret = [];
+
+ if( array != null ){
+ var i = array.length;
+ // The window, strings (and functions) also have 'length'
+ if( i == null || typeof array === "string" || jQuery.isFunction(array) || array.setInterval )
+ ret[0] = array;
+ else
+ while( i )
+ ret[--i] = array[i];
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, array ) {
+ for ( var i = 0, length = array.length; i < length; i++ )
+ // Use === because on IE, window == document
+ if ( array[ i ] === elem )
+ return i;
+
+ return -1;
+ },
+
+ merge: function( first, second ) {
+ // We have to loop this way because IE & Opera overwrite the length
+ // expando of getElementsByTagName
+ var i = 0, elem, pos = first.length;
+ // Also, we need to make sure that the correct elements are being returned
+ // (IE returns comment nodes in a '*' query)
+ if ( !jQuery.support.getAll ) {
+ while ( (elem = second[ i++ ]) != null )
+ if ( elem.nodeType != 8 )
+ first[ pos++ ] = elem;
+
+ } else
+ while ( (elem = second[ i++ ]) != null )
+ first[ pos++ ] = elem;
+
+ return first;
+ },
+
+ unique: function( array ) {
+ var ret = [], done = {};
+
+ try {
+
+ for ( var i = 0, length = array.length; i < length; i++ ) {
+ var id = jQuery.data( array[ i ] );
+
+ if ( !done[ id ] ) {
+ done[ id ] = true;
+ ret.push( array[ i ] );
+ }
+ }
+
+ } catch( e ) {
+ ret = array;
+ }
+
+ return ret;
+ },
+
+ grep: function( elems, callback, inv ) {
+ var ret = [];
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( var i = 0, length = elems.length; i < length; i++ )
+ if ( !inv != !callback( elems[ i ], i ) )
+ ret.push( elems[ i ] );
+
+ return ret;
+ },
+
+ map: function( elems, callback ) {
+ var ret = [];
+
+ // Go through the array, translating each of the items to their
+ // new value (or values).
+ for ( var i = 0, length = elems.length; i < length; i++ ) {
+ var value = callback( elems[ i ], i );
+
+ if ( value != null )
+ ret[ ret.length ] = value;
+ }
+
+ return ret.concat.apply( [], ret );
+ }
+});
+
+// Use of jQuery.browser is deprecated.
+// It's included for backwards compatibility and plugins,
+// although they should work to migrate away.
+
+var userAgent = navigator.userAgent.toLowerCase();
+
+// Figure out what browser is being used
+jQuery.browser = {
+ version: (userAgent.match( /.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/ ) || [0,'0'])[1],
+ safari: /webkit/.test( userAgent ),
+ opera: /opera/.test( userAgent ),
+ msie: /msie/.test( userAgent ) && !/opera/.test( userAgent ),
+ mozilla: /mozilla/.test( userAgent ) && !/(compatible|webkit)/.test( userAgent )
+};
+
+jQuery.each({
+ parent: function(elem){return elem.parentNode;},
+ parents: function(elem){return jQuery.dir(elem,"parentNode");},
+ next: function(elem){return jQuery.nth(elem,2,"nextSibling");},
+ prev: function(elem){return jQuery.nth(elem,2,"previousSibling");},
+ nextAll: function(elem){return jQuery.dir(elem,"nextSibling");},
+ prevAll: function(elem){return jQuery.dir(elem,"previousSibling");},
+ siblings: function(elem){return jQuery.sibling(elem.parentNode.firstChild,elem);},
+ children: function(elem){return jQuery.sibling(elem.firstChild);},
+ contents: function(elem){return jQuery.nodeName(elem,"iframe")?elem.contentDocument||elem.contentWindow.document:jQuery.makeArray(elem.childNodes);}
+}, function(name, fn){
+ jQuery.fn[ name ] = function( selector ) {
+ var ret = jQuery.map( this, fn );
+
+ if ( selector && typeof selector == "string" )
+ ret = jQuery.multiFilter( selector, ret );
+
+ return this.pushStack( jQuery.unique( ret ), name, selector );
+ };
+});
+
+jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function(name, original){
+ jQuery.fn[ name ] = function( selector ) {
+ var ret = [], insert = jQuery( selector );
+
+ for ( var i = 0, l = insert.length; i < l; i++ ) {
+ var elems = (i > 0 ? this.clone(true) : this).get();
+ jQuery.fn[ original ].apply( jQuery(insert[i]), elems );
+ ret = ret.concat( elems );
+ }
+
+ return this.pushStack( ret, name, selector );
+ };
+});
+
+jQuery.each({
+ removeAttr: function( name ) {
+ jQuery.attr( this, name, "" );
+ if (this.nodeType == 1)
+ this.removeAttribute( name );
+ },
+
+ addClass: function( classNames ) {
+ jQuery.className.add( this, classNames );
+ },
+
+ removeClass: function( classNames ) {
+ jQuery.className.remove( this, classNames );
+ },
+
+ toggleClass: function( classNames, state ) {
+ if( typeof state !== "boolean" )
+ state = !jQuery.className.has( this, classNames );
+ jQuery.className[ state ? "add" : "remove" ]( this, classNames );
+ },
+
+ remove: function( selector ) {
+ if ( !selector || jQuery.filter( selector, [ this ] ).length ) {
+ // Prevent memory leaks
+ jQuery( "*", this ).add([this]).each(function(){
+ jQuery.event.remove(this);
+ jQuery.removeData(this);
+ });
+ if (this.parentNode)
+ this.parentNode.removeChild( this );
+ }
+ },
+
+ empty: function() {
+ // Remove element nodes and prevent memory leaks
+ jQuery(this).children().remove();
+
+ // Remove any remaining nodes
+ while ( this.firstChild )
+ this.removeChild( this.firstChild );
+ }
+}, function(name, fn){
+ jQuery.fn[ name ] = function(){
+ return this.each( fn, arguments );
+ };
+});
+
+// Helper function used by the dimensions and offset modules
+function num(elem, prop) {
+ return elem[0] && parseInt( jQuery.curCSS(elem[0], prop, true), 10 ) || 0;
+}
+var expando = "jQuery" + now(), uuid = 0, windowData = {};\r
+\r
+jQuery.extend({\r
+ cache: {},\r
+\r
+ data: function( elem, name, data ) {\r
+ elem = elem == window ?\r
+ windowData :\r
+ elem;\r
+\r
+ var id = elem[ expando ];\r
+\r
+ // Compute a unique ID for the element\r
+ if ( !id )\r
+ id = elem[ expando ] = ++uuid;\r
+\r
+ // Only generate the data cache if we're\r
+ // trying to access or manipulate it\r
+ if ( name && !jQuery.cache[ id ] )\r
+ jQuery.cache[ id ] = {};\r
+\r
+ // Prevent overriding the named cache with undefined values\r
+ if ( data !== undefined )\r
+ jQuery.cache[ id ][ name ] = data;\r
+\r
+ // Return the named cache data, or the ID for the element\r
+ return name ?\r
+ jQuery.cache[ id ][ name ] :\r
+ id;\r
+ },\r
+\r
+ removeData: function( elem, name ) {\r
+ elem = elem == window ?\r
+ windowData :\r
+ elem;\r
+\r
+ var id = elem[ expando ];\r
+\r
+ // If we want to remove a specific section of the element's data\r
+ if ( name ) {\r
+ if ( jQuery.cache[ id ] ) {\r
+ // Remove the section of cache data\r
+ delete jQuery.cache[ id ][ name ];\r
+\r
+ // If we've removed all the data, remove the element's cache\r
+ name = "";\r
+\r
+ for ( name in jQuery.cache[ id ] )\r
+ break;\r
+\r
+ if ( !name )\r
+ jQuery.removeData( elem );\r
+ }\r
+\r
+ // Otherwise, we want to remove all of the element's data\r
+ } else {\r
+ // Clean up the element expando\r
+ try {\r
+ delete elem[ expando ];\r
+ } catch(e){\r
+ // IE has trouble directly removing the expando\r
+ // but it's ok with using removeAttribute\r
+ if ( elem.removeAttribute )\r
+ elem.removeAttribute( expando );\r
+ }\r
+\r
+ // Completely remove the data cache\r
+ delete jQuery.cache[ id ];\r
+ }\r
+ },\r
+ queue: function( elem, type, data ) {\r
+ if ( elem ){\r
+ \r
+ type = (type || "fx") + "queue";\r
+ \r
+ var q = jQuery.data( elem, type );\r
+ \r
+ if ( !q || jQuery.isArray(data) )\r
+ q = jQuery.data( elem, type, jQuery.makeArray(data) );\r
+ else if( data )\r
+ q.push( data );\r
+ \r
+ }\r
+ return q;\r
+ },\r
+\r
+ dequeue: function( elem, type ){\r
+ var queue = jQuery.queue( elem, type ),\r
+ fn = queue.shift();\r
+ \r
+ if( !type || type === "fx" )\r
+ fn = queue[0];\r
+ \r
+ if( fn !== undefined )\r
+ fn.call(elem);\r
+ }\r
+});\r
+\r
+jQuery.fn.extend({\r
+ data: function( key, value ){\r
+ var parts = key.split(".");\r
+ parts[1] = parts[1] ? "." + parts[1] : "";\r
+\r
+ if ( value === undefined ) {\r
+ var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);\r
+\r
+ if ( data === undefined && this.length )\r
+ data = jQuery.data( this[0], key );\r
+\r
+ return data === undefined && parts[1] ?\r
+ this.data( parts[0] ) :\r
+ data;\r
+ } else\r
+ return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function(){\r
+ jQuery.data( this, key, value );\r
+ });\r
+ },\r
+\r
+ removeData: function( key ){\r
+ return this.each(function(){\r
+ jQuery.removeData( this, key );\r
+ });\r
+ },\r
+ queue: function(type, data){\r
+ if ( typeof type !== "string" ) {\r
+ data = type;\r
+ type = "fx";\r
+ }\r
+\r
+ if ( data === undefined )\r
+ return jQuery.queue( this[0], type );\r
+\r
+ return this.each(function(){\r
+ var queue = jQuery.queue( this, type, data );\r
+ \r
+ if( type == "fx" && queue.length == 1 )\r
+ queue[0].call(this);\r
+ });\r
+ },\r
+ dequeue: function(type){\r
+ return this.each(function(){\r
+ jQuery.dequeue( this, type );\r
+ });\r
+ }\r
+});/*!
+ * Sizzle CSS Selector Engine - v0.9.3
+ * Copyright 2009, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,
+ done = 0,
+ toString = Object.prototype.toString;
+
+var Sizzle = function(selector, context, results, seed) {
+ results = results || [];
+ context = context || document;
+
+ if ( context.nodeType !== 1 && context.nodeType !== 9 )
+ return [];
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ var parts = [], m, set, checkSet, check, mode, extra, prune = true;
+
+ // Reset the position of the chunker regexp (start from head)
+ chunker.lastIndex = 0;
+
+ while ( (m = chunker.exec(selector)) !== null ) {
+ parts.push( m[1] );
+
+ if ( m[2] ) {
+ extra = RegExp.rightContext;
+ break;
+ }
+ }
+
+ if ( parts.length > 1 && origPOS.exec( selector ) ) {
+ if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+ set = posProcess( parts[0] + parts[1], context );
+ } else {
+ set = Expr.relative[ parts[0] ] ?
+ [ context ] :
+ Sizzle( parts.shift(), context );
+
+ while ( parts.length ) {
+ selector = parts.shift();
+
+ if ( Expr.relative[ selector ] )
+ selector += parts.shift();
+
+ set = posProcess( selector, set );
+ }
+ }
+ } else {
+ var ret = seed ?
+ { expr: parts.pop(), set: makeArray(seed) } :
+ Sizzle.find( parts.pop(), parts.length === 1 && context.parentNode ? context.parentNode : context, isXML(context) );
+ set = Sizzle.filter( ret.expr, ret.set );
+
+ if ( parts.length > 0 ) {
+ checkSet = makeArray(set);
+ } else {
+ prune = false;
+ }
+
+ while ( parts.length ) {
+ var cur = parts.pop(), pop = cur;
+
+ if ( !Expr.relative[ cur ] ) {
+ cur = "";
+ } else {
+ pop = parts.pop();
+ }
+
+ if ( pop == null ) {
+ pop = context;
+ }
+
+ Expr.relative[ cur ]( checkSet, pop, isXML(context) );
+ }
+ }
+
+ if ( !checkSet ) {
+ checkSet = set;
+ }
+
+ if ( !checkSet ) {
+ throw "Syntax error, unrecognized expression: " + (cur || selector);
+ }
+
+ if ( toString.call(checkSet) === "[object Array]" ) {
+ if ( !prune ) {
+ results.push.apply( results, checkSet );
+ } else if ( context.nodeType === 1 ) {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+ results.push( set[i] );
+ }
+ }
+ } else {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+ results.push( set[i] );
+ }
+ }
+ }
+ } else {
+ makeArray( checkSet, results );
+ }
+
+ if ( extra ) {
+ Sizzle( extra, context, results, seed );
+
+ if ( sortOrder ) {
+ hasDuplicate = false;
+ results.sort(sortOrder);
+
+ if ( hasDuplicate ) {
+ for ( var i = 1; i < results.length; i++ ) {
+ if ( results[i] === results[i-1] ) {
+ results.splice(i--, 1);
+ }
+ }
+ }
+ }
+ }
+
+ return results;
+};
+
+Sizzle.matches = function(expr, set){
+ return Sizzle(expr, null, null, set);
+};
+
+Sizzle.find = function(expr, context, isXML){
+ var set, match;
+
+ if ( !expr ) {
+ return [];
+ }
+
+ for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
+ var type = Expr.order[i], match;
+
+ if ( (match = Expr.match[ type ].exec( expr )) ) {
+ var left = RegExp.leftContext;
+
+ if ( left.substr( left.length - 1 ) !== "\\" ) {
+ match[1] = (match[1] || "").replace(/\\/g, "");
+ set = Expr.find[ type ]( match, context, isXML );
+ if ( set != null ) {
+ expr = expr.replace( Expr.match[ type ], "" );
+ break;
+ }
+ }
+ }
+ }
+
+ if ( !set ) {
+ set = context.getElementsByTagName("*");
+ }
+
+ return {set: set, expr: expr};
+};
+
+Sizzle.filter = function(expr, set, inplace, not){
+ var old = expr, result = [], curLoop = set, match, anyFound,
+ isXMLFilter = set && set[0] && isXML(set[0]);
+
+ while ( expr && set.length ) {
+ for ( var type in Expr.filter ) {
+ if ( (match = Expr.match[ type ].exec( expr )) != null ) {
+ var filter = Expr.filter[ type ], found, item;
+ anyFound = false;
+
+ if ( curLoop == result ) {
+ result = [];
+ }
+
+ if ( Expr.preFilter[ type ] ) {
+ match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+
+ if ( !match ) {
+ anyFound = found = true;
+ } else if ( match === true ) {
+ continue;
+ }
+ }
+
+ if ( match ) {
+ for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
+ if ( item ) {
+ found = filter( item, match, i, curLoop );
+ var pass = not ^ !!found;
+
+ if ( inplace && found != null ) {
+ if ( pass ) {
+ anyFound = true;
+ } else {
+ curLoop[i] = false;
+ }
+ } else if ( pass ) {
+ result.push( item );
+ anyFound = true;
+ }
+ }
+ }
+ }
+
+ if ( found !== undefined ) {
+ if ( !inplace ) {
+ curLoop = result;
+ }
+
+ expr = expr.replace( Expr.match[ type ], "" );
+
+ if ( !anyFound ) {
+ return [];
+ }
+
+ break;
+ }
+ }
+ }
+
+ // Improper expression
+ if ( expr == old ) {
+ if ( anyFound == null ) {
+ throw "Syntax error, unrecognized expression: " + expr;
+ } else {
+ break;
+ }
+ }
+
+ old = expr;
+ }
+
+ return curLoop;
+};
+
+var Expr = Sizzle.selectors = {
+ order: [ "ID", "NAME", "TAG" ],
+ match: {
+ ID: /#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,
+ CLASS: /\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,
+ NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/,
+ ATTR: /\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
+ TAG: /^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/,
+ CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,
+ POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,
+ PSEUDO: /:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/
+ },
+ attrMap: {
+ "class": "className",
+ "for": "htmlFor"
+ },
+ attrHandle: {
+ href: function(elem){
+ return elem.getAttribute("href");
+ }
+ },
+ relative: {
+ "+": function(checkSet, part, isXML){
+ var isPartStr = typeof part === "string",
+ isTag = isPartStr && !/\W/.test(part),
+ isPartStrNotTag = isPartStr && !isTag;
+
+ if ( isTag && !isXML ) {
+ part = part.toUpperCase();
+ }
+
+ for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
+ if ( (elem = checkSet[i]) ) {
+ while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+
+ checkSet[i] = isPartStrNotTag || elem && elem.nodeName === part ?
+ elem || false :
+ elem === part;
+ }
+ }
+
+ if ( isPartStrNotTag ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ },
+ ">": function(checkSet, part, isXML){
+ var isPartStr = typeof part === "string";
+
+ if ( isPartStr && !/\W/.test(part) ) {
+ part = isXML ? part : part.toUpperCase();
+
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ var parent = elem.parentNode;
+ checkSet[i] = parent.nodeName === part ? parent : false;
+ }
+ }
+ } else {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ checkSet[i] = isPartStr ?
+ elem.parentNode :
+ elem.parentNode === part;
+ }
+ }
+
+ if ( isPartStr ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ }
+ },
+ "": function(checkSet, part, isXML){
+ var doneName = done++, checkFn = dirCheck;
+
+ if ( !part.match(/\W/) ) {
+ var nodeCheck = part = isXML ? part : part.toUpperCase();
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML);
+ },
+ "~": function(checkSet, part, isXML){
+ var doneName = done++, checkFn = dirCheck;
+
+ if ( typeof part === "string" && !part.match(/\W/) ) {
+ var nodeCheck = part = isXML ? part : part.toUpperCase();
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML);
+ }
+ },
+ find: {
+ ID: function(match, context, isXML){
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+ return m ? [m] : [];
+ }
+ },
+ NAME: function(match, context, isXML){
+ if ( typeof context.getElementsByName !== "undefined" ) {
+ var ret = [], results = context.getElementsByName(match[1]);
+
+ for ( var i = 0, l = results.length; i < l; i++ ) {
+ if ( results[i].getAttribute("name") === match[1] ) {
+ ret.push( results[i] );
+ }
+ }
+
+ return ret.length === 0 ? null : ret;
+ }
+ },
+ TAG: function(match, context){
+ return context.getElementsByTagName(match[1]);
+ }
+ },
+ preFilter: {
+ CLASS: function(match, curLoop, inplace, result, not, isXML){
+ match = " " + match[1].replace(/\\/g, "") + " ";
+
+ if ( isXML ) {
+ return match;
+ }
+
+ for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
+ if ( elem ) {
+ if ( not ^ (elem.className && (" " + elem.className + " ").indexOf(match) >= 0) ) {
+ if ( !inplace )
+ result.push( elem );
+ } else if ( inplace ) {
+ curLoop[i] = false;
+ }
+ }
+ }
+
+ return false;
+ },
+ ID: function(match){
+ return match[1].replace(/\\/g, "");
+ },
+ TAG: function(match, curLoop){
+ for ( var i = 0; curLoop[i] === false; i++ ){}
+ return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase();
+ },
+ CHILD: function(match){
+ if ( match[1] == "nth" ) {
+ // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+ var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
+ match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" ||
+ !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+ // calculate the numbers (first)n+(last) including if they are negative
+ match[2] = (test[1] + (test[2] || 1)) - 0;
+ match[3] = test[3] - 0;
+ }
+
+ // TODO: Move to normal caching system
+ match[0] = done++;
+
+ return match;
+ },
+ ATTR: function(match, curLoop, inplace, result, not, isXML){
+ var name = match[1].replace(/\\/g, "");
+
+ if ( !isXML && Expr.attrMap[name] ) {
+ match[1] = Expr.attrMap[name];
+ }
+
+ if ( match[2] === "~=" ) {
+ match[4] = " " + match[4] + " ";
+ }
+
+ return match;
+ },
+ PSEUDO: function(match, curLoop, inplace, result, not){
+ if ( match[1] === "not" ) {
+ // If we're dealing with a complex expression, or a simple one
+ if ( match[3].match(chunker).length > 1 || /^\w/.test(match[3]) ) {
+ match[3] = Sizzle(match[3], null, null, curLoop);
+ } else {
+ var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+ if ( !inplace ) {
+ result.push.apply( result, ret );
+ }
+ return false;
+ }
+ } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
+ return true;
+ }
+
+ return match;
+ },
+ POS: function(match){
+ match.unshift( true );
+ return match;
+ }
+ },
+ filters: {
+ enabled: function(elem){
+ return elem.disabled === false && elem.type !== "hidden";
+ },
+ disabled: function(elem){
+ return elem.disabled === true;
+ },
+ checked: function(elem){
+ return elem.checked === true;
+ },
+ selected: function(elem){
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ elem.parentNode.selectedIndex;
+ return elem.selected === true;
+ },
+ parent: function(elem){
+ return !!elem.firstChild;
+ },
+ empty: function(elem){
+ return !elem.firstChild;
+ },
+ has: function(elem, i, match){
+ return !!Sizzle( match[3], elem ).length;
+ },
+ header: function(elem){
+ return /h\d/i.test( elem.nodeName );
+ },
+ text: function(elem){
+ return "text" === elem.type;
+ },
+ radio: function(elem){
+ return "radio" === elem.type;
+ },
+ checkbox: function(elem){
+ return "checkbox" === elem.type;
+ },
+ file: function(elem){
+ return "file" === elem.type;
+ },
+ password: function(elem){
+ return "password" === elem.type;
+ },
+ submit: function(elem){
+ return "submit" === elem.type;
+ },
+ image: function(elem){
+ return "image" === elem.type;
+ },
+ reset: function(elem){
+ return "reset" === elem.type;
+ },
+ button: function(elem){
+ return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON";
+ },
+ input: function(elem){
+ return /input|select|textarea|button/i.test(elem.nodeName);
+ }
+ },
+ setFilters: {
+ first: function(elem, i){
+ return i === 0;
+ },
+ last: function(elem, i, match, array){
+ return i === array.length - 1;
+ },
+ even: function(elem, i){
+ return i % 2 === 0;
+ },
+ odd: function(elem, i){
+ return i % 2 === 1;
+ },
+ lt: function(elem, i, match){
+ return i < match[3] - 0;
+ },
+ gt: function(elem, i, match){
+ return i > match[3] - 0;
+ },
+ nth: function(elem, i, match){
+ return match[3] - 0 == i;
+ },
+ eq: function(elem, i, match){
+ return match[3] - 0 == i;
+ }
+ },
+ filter: {
+ PSEUDO: function(elem, match, i, array){
+ var name = match[1], filter = Expr.filters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+ } else if ( name === "contains" ) {
+ return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0;
+ } else if ( name === "not" ) {
+ var not = match[3];
+
+ for ( var i = 0, l = not.length; i < l; i++ ) {
+ if ( not[i] === elem ) {
+ return false;
+ }
+ }
+
+ return true;
+ }
+ },
+ CHILD: function(elem, match){
+ var type = match[1], node = elem;
+ switch (type) {
+ case 'only':
+ case 'first':
+ while (node = node.previousSibling) {
+ if ( node.nodeType === 1 ) return false;
+ }
+ if ( type == 'first') return true;
+ node = elem;
+ case 'last':
+ while (node = node.nextSibling) {
+ if ( node.nodeType === 1 ) return false;
+ }
+ return true;
+ case 'nth':
+ var first = match[2], last = match[3];
+
+ if ( first == 1 && last == 0 ) {
+ return true;
+ }
+
+ var doneName = match[0],
+ parent = elem.parentNode;
+
+ if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
+ var count = 0;
+ for ( node = parent.firstChild; node; node = node.nextSibling ) {
+ if ( node.nodeType === 1 ) {
+ node.nodeIndex = ++count;
+ }
+ }
+ parent.sizcache = doneName;
+ }
+
+ var diff = elem.nodeIndex - last;
+ if ( first == 0 ) {
+ return diff == 0;
+ } else {
+ return ( diff % first == 0 && diff / first >= 0 );
+ }
+ }
+ },
+ ID: function(elem, match){
+ return elem.nodeType === 1 && elem.getAttribute("id") === match;
+ },
+ TAG: function(elem, match){
+ return (match === "*" && elem.nodeType === 1) || elem.nodeName === match;
+ },
+ CLASS: function(elem, match){
+ return (" " + (elem.className || elem.getAttribute("class")) + " ")
+ .indexOf( match ) > -1;
+ },
+ ATTR: function(elem, match){
+ var name = match[1],
+ result = Expr.attrHandle[ name ] ?
+ Expr.attrHandle[ name ]( elem ) :
+ elem[ name ] != null ?
+ elem[ name ] :
+ elem.getAttribute( name ),
+ value = result + "",
+ type = match[2],
+ check = match[4];
+
+ return result == null ?
+ type === "!=" :
+ type === "=" ?
+ value === check :
+ type === "*=" ?
+ value.indexOf(check) >= 0 :
+ type === "~=" ?
+ (" " + value + " ").indexOf(check) >= 0 :
+ !check ?
+ value && result !== false :
+ type === "!=" ?
+ value != check :
+ type === "^=" ?
+ value.indexOf(check) === 0 :
+ type === "$=" ?
+ value.substr(value.length - check.length) === check :
+ type === "|=" ?
+ value === check || value.substr(0, check.length + 1) === check + "-" :
+ false;
+ },
+ POS: function(elem, match, i, array){
+ var name = match[2], filter = Expr.setFilters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+ }
+ }
+ }
+};
+
+var origPOS = Expr.match.POS;
+
+for ( var type in Expr.match ) {
+ Expr.match[ type ] = RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
+}
+
+var makeArray = function(array, results) {
+ array = Array.prototype.slice.call( array );
+
+ if ( results ) {
+ results.push.apply( results, array );
+ return results;
+ }
+
+ return array;
+};
+
+// Perform a simple check to determine if the browser is capable of
+// converting a NodeList to an array using builtin methods.
+try {
+ Array.prototype.slice.call( document.documentElement.childNodes );
+
+// Provide a fallback method if it does not work
+} catch(e){
+ makeArray = function(array, results) {
+ var ret = results || [];
+
+ if ( toString.call(array) === "[object Array]" ) {
+ Array.prototype.push.apply( ret, array );
+ } else {
+ if ( typeof array.length === "number" ) {
+ for ( var i = 0, l = array.length; i < l; i++ ) {
+ ret.push( array[i] );
+ }
+ } else {
+ for ( var i = 0; array[i]; i++ ) {
+ ret.push( array[i] );
+ }
+ }
+ }
+
+ return ret;
+ };
+}
+
+var sortOrder;
+
+if ( document.documentElement.compareDocumentPosition ) {
+ sortOrder = function( a, b ) {
+ var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1;
+ if ( ret === 0 ) {
+ hasDuplicate = true;
+ }
+ return ret;
+ };
+} else if ( "sourceIndex" in document.documentElement ) {
+ sortOrder = function( a, b ) {
+ var ret = a.sourceIndex - b.sourceIndex;
+ if ( ret === 0 ) {
+ hasDuplicate = true;
+ }
+ return ret;
+ };
+} else if ( document.createRange ) {
+ sortOrder = function( a, b ) {
+ var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange();
+ aRange.selectNode(a);
+ aRange.collapse(true);
+ bRange.selectNode(b);
+ bRange.collapse(true);
+ var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange);
+ if ( ret === 0 ) {
+ hasDuplicate = true;
+ }
+ return ret;
+ };
+}
+
+// Check to see if the browser returns elements by name when
+// querying by getElementById (and provide a workaround)
+(function(){
+ // We're going to inject a fake input element with a specified name
+ var form = document.createElement("form"),
+ id = "script" + (new Date).getTime();
+ form.innerHTML = "<input name='" + id + "'/>";
+
+ // Inject it into the root element, check its status, and remove it quickly
+ var root = document.documentElement;
+ root.insertBefore( form, root.firstChild );
+
+ // The workaround has to do additional checks after a getElementById
+ // Which slows things down for other browsers (hence the branching)
+ if ( !!document.getElementById( id ) ) {
+ Expr.find.ID = function(match, context, isXML){
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+ return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : [];
+ }
+ };
+
+ Expr.filter.ID = function(elem, match){
+ var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+ return elem.nodeType === 1 && node && node.nodeValue === match;
+ };
+ }
+
+ root.removeChild( form );
+})();
+
+(function(){
+ // Check to see if the browser returns only elements
+ // when doing getElementsByTagName("*")
+
+ // Create a fake element
+ var div = document.createElement("div");
+ div.appendChild( document.createComment("") );
+
+ // Make sure no comments are found
+ if ( div.getElementsByTagName("*").length > 0 ) {
+ Expr.find.TAG = function(match, context){
+ var results = context.getElementsByTagName(match[1]);
+
+ // Filter out possible comments
+ if ( match[1] === "*" ) {
+ var tmp = [];
+
+ for ( var i = 0; results[i]; i++ ) {
+ if ( results[i].nodeType === 1 ) {
+ tmp.push( results[i] );
+ }
+ }
+
+ results = tmp;
+ }
+
+ return results;
+ };
+ }
+
+ // Check to see if an attribute returns normalized href attributes
+ div.innerHTML = "<a href='#'></a>";
+ if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
+ div.firstChild.getAttribute("href") !== "#" ) {
+ Expr.attrHandle.href = function(elem){
+ return elem.getAttribute("href", 2);
+ };
+ }
+})();
+
+if ( document.querySelectorAll ) (function(){
+ var oldSizzle = Sizzle, div = document.createElement("div");
+ div.innerHTML = "<p class='TEST'></p>";
+
+ // Safari can't handle uppercase or unicode characters when
+ // in quirks mode.
+ if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+ return;
+ }
+
+ Sizzle = function(query, context, extra, seed){
+ context = context || document;
+
+ // Only use querySelectorAll on non-XML documents
+ // (ID selectors don't work in non-HTML documents)
+ if ( !seed && context.nodeType === 9 && !isXML(context) ) {
+ try {
+ return makeArray( context.querySelectorAll(query), extra );
+ } catch(e){}
+ }
+
+ return oldSizzle(query, context, extra, seed);
+ };
+
+ Sizzle.find = oldSizzle.find;
+ Sizzle.filter = oldSizzle.filter;
+ Sizzle.selectors = oldSizzle.selectors;
+ Sizzle.matches = oldSizzle.matches;
+})();
+
+if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) (function(){
+ var div = document.createElement("div");
+ div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+
+ // Opera can't find a second classname (in 9.6)
+ if ( div.getElementsByClassName("e").length === 0 )
+ return;
+
+ // Safari caches class attributes, doesn't catch changes (in 3.2)
+ div.lastChild.className = "e";
+
+ if ( div.getElementsByClassName("e").length === 1 )
+ return;
+
+ Expr.order.splice(1, 0, "CLASS");
+ Expr.find.CLASS = function(match, context, isXML) {
+ if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
+ return context.getElementsByClassName(match[1]);
+ }
+ };
+})();
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ var sibDir = dir == "previousSibling" && !isXML;
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ if ( sibDir && elem.nodeType === 1 ){
+ elem.sizcache = doneName;
+ elem.sizset = i;
+ }
+ elem = elem[dir];
+ var match = false;
+
+ while ( elem ) {
+ if ( elem.sizcache === doneName ) {
+ match = checkSet[elem.sizset];
+ break;
+ }
+
+ if ( elem.nodeType === 1 && !isXML ){
+ elem.sizcache = doneName;
+ elem.sizset = i;
+ }
+
+ if ( elem.nodeName === cur ) {
+ match = elem;
+ break;
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ var sibDir = dir == "previousSibling" && !isXML;
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+ if ( elem ) {
+ if ( sibDir && elem.nodeType === 1 ) {
+ elem.sizcache = doneName;
+ elem.sizset = i;
+ }
+ elem = elem[dir];
+ var match = false;
+
+ while ( elem ) {
+ if ( elem.sizcache === doneName ) {
+ match = checkSet[elem.sizset];
+ break;
+ }
+
+ if ( elem.nodeType === 1 ) {
+ if ( !isXML ) {
+ elem.sizcache = doneName;
+ elem.sizset = i;
+ }
+ if ( typeof cur !== "string" ) {
+ if ( elem === cur ) {
+ match = true;
+ break;
+ }
+
+ } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+ match = elem;
+ break;
+ }
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+var contains = document.compareDocumentPosition ? function(a, b){
+ return a.compareDocumentPosition(b) & 16;
+} : function(a, b){
+ return a !== b && (a.contains ? a.contains(b) : true);
+};
+
+var isXML = function(elem){
+ return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" ||
+ !!elem.ownerDocument && isXML( elem.ownerDocument );
+};
+
+var posProcess = function(selector, context){
+ var tmpSet = [], later = "", match,
+ root = context.nodeType ? [context] : context;
+
+ // Position selectors must be done after the filter
+ // And so must :not(positional) so we move all PSEUDOs to the end
+ while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+ later += match[0];
+ selector = selector.replace( Expr.match.PSEUDO, "" );
+ }
+
+ selector = Expr.relative[selector] ? selector + "*" : selector;
+
+ for ( var i = 0, l = root.length; i < l; i++ ) {
+ Sizzle( selector, root[i], tmpSet );
+ }
+
+ return Sizzle.filter( later, tmpSet );
+};
+
+// EXPOSE
+jQuery.find = Sizzle;
+jQuery.filter = Sizzle.filter;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.filters;
+
+Sizzle.selectors.filters.hidden = function(elem){
+ return elem.offsetWidth === 0 || elem.offsetHeight === 0;
+};
+
+Sizzle.selectors.filters.visible = function(elem){
+ return elem.offsetWidth > 0 || elem.offsetHeight > 0;
+};
+
+Sizzle.selectors.filters.animated = function(elem){
+ return jQuery.grep(jQuery.timers, function(fn){
+ return elem === fn.elem;
+ }).length;
+};
+
+jQuery.multiFilter = function( expr, elems, not ) {
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return Sizzle.matches(expr, elems);
+};
+
+jQuery.dir = function( elem, dir ){
+ var matched = [], cur = elem[dir];
+ while ( cur && cur != document ) {
+ if ( cur.nodeType == 1 )
+ matched.push( cur );
+ cur = cur[dir];
+ }
+ return matched;
+};
+
+jQuery.nth = function(cur, result, dir, elem){
+ result = result || 1;
+ var num = 0;
+
+ for ( ; cur; cur = cur[dir] )
+ if ( cur.nodeType == 1 && ++num == result )
+ break;
+
+ return cur;
+};
+
+jQuery.sibling = function(n, elem){
+ var r = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType == 1 && n != elem )
+ r.push( n );
+ }
+
+ return r;
+};
+
+return;
+
+window.Sizzle = Sizzle;
+
+})();
+/*
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code originated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+
+ // Bind an event to an element
+ // Original by Dean Edwards
+ add: function(elem, types, handler, data) {
+ if ( elem.nodeType == 3 || elem.nodeType == 8 )
+ return;
+
+ // For whatever reason, IE has trouble passing the window object
+ // around, causing it to be cloned in the process
+ if ( elem.setInterval && elem != window )
+ elem = window;
+
+ // Make sure that the function being executed has a unique ID
+ if ( !handler.guid )
+ handler.guid = this.guid++;
+
+ // if data is passed, bind to handler
+ if ( data !== undefined ) {
+ // Create temporary function pointer to original handler
+ var fn = handler;
+
+ // Create unique handler function, wrapped around original handler
+ handler = this.proxy( fn );
+
+ // Store data in unique handler
+ handler.data = data;
+ }
+
+ // Init the element's event structure
+ var events = jQuery.data(elem, "events") || jQuery.data(elem, "events", {}),
+ handle = jQuery.data(elem, "handle") || jQuery.data(elem, "handle", function(){
+ // Handle the second event of a trigger and when
+ // an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
+ jQuery.event.handle.apply(arguments.callee.elem, arguments) :
+ undefined;
+ });
+ // Add elem as a property of the handle function
+ // This is to prevent a memory leak with non-native
+ // event in IE.
+ handle.elem = elem;
+
+ // Handle multiple events separated by a space
+ // jQuery(...).bind("mouseover mouseout", fn);
+ jQuery.each(types.split(/\s+/), function(index, type) {
+ // Namespaced event handlers
+ var namespaces = type.split(".");
+ type = namespaces.shift();
+ handler.type = namespaces.slice().sort().join(".");
+
+ // Get the current list of functions bound to this event
+ var handlers = events[type];
+
+ if ( jQuery.event.specialAll[type] )
+ jQuery.event.specialAll[type].setup.call(elem, data, namespaces);
+
+ // Init the event handler queue
+ if (!handlers) {
+ handlers = events[type] = {};
+
+ // Check for a special event handler
+ // Only use addEventListener/attachEvent if the special
+ // events handler returns false
+ if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) {
+ // Bind the global event handler to the element
+ if (elem.addEventListener)
+ elem.addEventListener(type, handle, false);
+ else if (elem.attachEvent)
+ elem.attachEvent("on" + type, handle);
+ }
+ }
+
+ // Add the function to the element's handler list
+ handlers[handler.guid] = handler;
+
+ // Keep track of which events have been used, for global triggering
+ jQuery.event.global[type] = true;
+ });
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ guid: 1,
+ global: {},
+
+ // Detach an event or set of events from an element
+ remove: function(elem, types, handler) {
+ // don't do events on text and comment nodes
+ if ( elem.nodeType == 3 || elem.nodeType == 8 )
+ return;
+
+ var events = jQuery.data(elem, "events"), ret, index;
+
+ if ( events ) {
+ // Unbind all events for the element
+ if ( types === undefined || (typeof types === "string" && types.charAt(0) == ".") )
+ for ( var type in events )
+ this.remove( elem, type + (types || "") );
+ else {
+ // types is actually an event object here
+ if ( types.type ) {
+ handler = types.handler;
+ types = types.type;
+ }
+
+ // Handle multiple events seperated by a space
+ // jQuery(...).unbind("mouseover mouseout", fn);
+ jQuery.each(types.split(/\s+/), function(index, type){
+ // Namespaced event handlers
+ var namespaces = type.split(".");
+ type = namespaces.shift();
+ var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)");
+
+ if ( events[type] ) {
+ // remove the given handler for the given type
+ if ( handler )
+ delete events[type][handler.guid];
+
+ // remove all handlers for the given type
+ else
+ for ( var handle in events[type] )
+ // Handle the removal of namespaced events
+ if ( namespace.test(events[type][handle].type) )
+ delete events[type][handle];
+
+ if ( jQuery.event.specialAll[type] )
+ jQuery.event.specialAll[type].teardown.call(elem, namespaces);
+
+ // remove generic event handler if no more handlers exist
+ for ( ret in events[type] ) break;
+ if ( !ret ) {
+ if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) {
+ if (elem.removeEventListener)
+ elem.removeEventListener(type, jQuery.data(elem, "handle"), false);
+ else if (elem.detachEvent)
+ elem.detachEvent("on" + type, jQuery.data(elem, "handle"));
+ }
+ ret = null;
+ delete events[type];
+ }
+ }
+ });
+ }
+
+ // Remove the expando if it's no longer used
+ for ( ret in events ) break;
+ if ( !ret ) {
+ var handle = jQuery.data( elem, "handle" );
+ if ( handle ) handle.elem = null;
+ jQuery.removeData( elem, "events" );
+ jQuery.removeData( elem, "handle" );
+ }
+ }
+ },
+
+ // bubbling is internal
+ trigger: function( event, data, elem, bubbling ) {
+ // Event object or event type
+ var type = event.type || event;
+
+ if( !bubbling ){
+ event = typeof event === "object" ?
+ // jQuery.Event object
+ event[expando] ? event :
+ // Object literal
+ jQuery.extend( jQuery.Event(type), event ) :
+ // Just the event type (string)
+ jQuery.Event(type);
+
+ if ( type.indexOf("!") >= 0 ) {
+ event.type = type = type.slice(0, -1);
+ event.exclusive = true;
+ }
+
+ // Handle a global trigger
+ if ( !elem ) {
+ // Don't bubble custom events when global (to avoid too much overhead)
+ event.stopPropagation();
+ // Only trigger if we've ever bound an event for it
+ if ( this.global[type] )
+ jQuery.each( jQuery.cache, function(){
+ if ( this.events && this.events[type] )
+ jQuery.event.trigger( event, data, this.handle.elem );
+ });
+ }
+
+ // Handle triggering a single element
+
+ // don't do events on text and comment nodes
+ if ( !elem || elem.nodeType == 3 || elem.nodeType == 8 )
+ return undefined;
+
+ // Clean up in case it is reused
+ event.result = undefined;
+ event.target = elem;
+
+ // Clone the incoming data, if any
+ data = jQuery.makeArray(data);
+ data.unshift( event );
+ }
+
+ event.currentTarget = elem;
+
+ // Trigger the event, it is assumed that "handle" is a function
+ var handle = jQuery.data(elem, "handle");
+ if ( handle )
+ handle.apply( elem, data );
+
+ // Handle triggering native .onfoo handlers (and on links since we don't call .click() for links)
+ if ( (!elem[type] || (jQuery.nodeName(elem, 'a') && type == "click")) && elem["on"+type] && elem["on"+type].apply( elem, data ) === false )
+ event.result = false;
+
+ // Trigger the native events (except for clicks on links)
+ if ( !bubbling && elem[type] && !event.isDefaultPrevented() && !(jQuery.nodeName(elem, 'a') && type == "click") ) {
+ this.triggered = true;
+ try {
+ elem[ type ]();
+ // prevent IE from throwing an error for some hidden elements
+ } catch (e) {}
+ }
+
+ this.triggered = false;
+
+ if ( !event.isPropagationStopped() ) {
+ var parent = elem.parentNode || elem.ownerDocument;
+ if ( parent )
+ jQuery.event.trigger(event, data, parent, true);
+ }
+ },
+
+ handle: function(event) {
+ // returned undefined or false
+ var all, handlers;
+
+ event = arguments[0] = jQuery.event.fix( event || window.event );
+ event.currentTarget = this;
+
+ // Namespaced event handlers
+ var namespaces = event.type.split(".");
+ event.type = namespaces.shift();
+
+ // Cache this now, all = true means, any handler
+ all = !namespaces.length && !event.exclusive;
+
+ var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)");
+
+ handlers = ( jQuery.data(this, "events") || {} )[event.type];
+
+ for ( var j in handlers ) {
+ var handler = handlers[j];
+
+ // Filter the functions by class
+ if ( all || namespace.test(handler.type) ) {
+ // Pass in a reference to the handler function itself
+ // So that we can later remove it
+ event.handler = handler;
+ event.data = handler.data;
+
+ var ret = handler.apply(this, arguments);
+
+ if( ret !== undefined ){
+ event.result = ret;
+ if ( ret === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+
+ if( event.isImmediatePropagationStopped() )
+ break;
+
+ }
+ }
+ },
+
+ props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+
+ fix: function(event) {
+ if ( event[expando] )
+ return event;
+
+ // store a copy of the original event object
+ // and "clone" to set read-only properties
+ var originalEvent = event;
+ event = jQuery.Event( originalEvent );
+
+ for ( var i = this.props.length, prop; i; ){
+ prop = this.props[ --i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Fix target property, if necessary
+ if ( !event.target )
+ event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+
+ // check if target is a textnode (safari)
+ if ( event.target.nodeType == 3 )
+ event.target = event.target.parentNode;
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && event.fromElement )
+ event.relatedTarget = event.fromElement == event.target ? event.toElement : event.fromElement;
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && event.clientX != null ) {
+ var doc = document.documentElement, body = document.body;
+ event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc.clientLeft || 0);
+ event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc.clientTop || 0);
+ }
+
+ // Add which for key events
+ if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) )
+ event.which = event.charCode || event.keyCode;
+
+ // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+ if ( !event.metaKey && event.ctrlKey )
+ event.metaKey = event.ctrlKey;
+
+ // Add which for click: 1 == left; 2 == middle; 3 == right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && event.button )
+ event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+
+ return event;
+ },
+
+ proxy: function( fn, proxy ){
+ proxy = proxy || function(){ return fn.apply(this, arguments); };
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || proxy.guid || this.guid++;
+ // So proxy can be declared as an argument
+ return proxy;
+ },
+
+ special: {
+ ready: {
+ // Make sure the ready event is setup
+ setup: bindReady,
+ teardown: function() {}
+ }
+ },
+
+ specialAll: {
+ live: {
+ setup: function( selector, namespaces ){
+ jQuery.event.add( this, namespaces[0], liveHandler );
+ },
+ teardown: function( namespaces ){
+ if ( namespaces.length ) {
+ var remove = 0, name = RegExp("(^|\\.)" + namespaces[0] + "(\\.|$)");
+
+ jQuery.each( (jQuery.data(this, "events").live || {}), function(){
+ if ( name.test(this.type) )
+ remove++;
+ });
+
+ if ( remove < 1 )
+ jQuery.event.remove( this, namespaces[0], liveHandler );
+ }
+ }
+ }
+ }
+};
+
+jQuery.Event = function( src ){
+ // Allow instantiation without the 'new' keyword
+ if( !this.preventDefault )
+ return new jQuery.Event(src);
+
+ // Event object
+ if( src && src.type ){
+ this.originalEvent = src;
+ this.type = src.type;
+ // Event type
+ }else
+ this.type = src;
+
+ // timeStamp is buggy for some events on Firefox(#3843)
+ // So we won't rely on the native value
+ this.timeStamp = now();
+
+ // Mark it as fixed
+ this[expando] = true;
+};
+
+function returnFalse(){
+ return false;
+}
+function returnTrue(){
+ return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ preventDefault: function() {
+ this.isDefaultPrevented = returnTrue;
+
+ var e = this.originalEvent;
+ if( !e )
+ return;
+ // if preventDefault exists run it on the original event
+ if (e.preventDefault)
+ e.preventDefault();
+ // otherwise set the returnValue property of the original event to false (IE)
+ e.returnValue = false;
+ },
+ stopPropagation: function() {
+ this.isPropagationStopped = returnTrue;
+
+ var e = this.originalEvent;
+ if( !e )
+ return;
+ // if stopPropagation exists run it on the original event
+ if (e.stopPropagation)
+ e.stopPropagation();
+ // otherwise set the cancelBubble property of the original event to true (IE)
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation:function(){
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ },
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse
+};
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function(event) {
+ // Check if mouse(over|out) are still within the same parent element
+ var parent = event.relatedTarget;
+ // Traverse up the tree
+ while ( parent && parent != this )
+ try { parent = parent.parentNode; }
+ catch(e) { parent = this; }
+
+ if( parent != this ){
+ // set the correct event type
+ event.type = event.data;
+ // handle event if we actually just moused on to a non sub-element
+ jQuery.event.handle.apply( this, arguments );
+ }
+};
+
+jQuery.each({
+ mouseover: 'mouseenter',
+ mouseout: 'mouseleave'
+}, function( orig, fix ){
+ jQuery.event.special[ fix ] = {
+ setup: function(){
+ jQuery.event.add( this, orig, withinElement, fix );
+ },
+ teardown: function(){
+ jQuery.event.remove( this, orig, withinElement );
+ }
+ };
+});
+
+jQuery.fn.extend({
+ bind: function( type, data, fn ) {
+ return type == "unload" ? this.one(type, data, fn) : this.each(function(){
+ jQuery.event.add( this, type, fn || data, fn && data );
+ });
+ },
+
+ one: function( type, data, fn ) {
+ var one = jQuery.event.proxy( fn || data, function(event) {
+ jQuery(this).unbind(event, one);
+ return (fn || data).apply( this, arguments );
+ });
+ return this.each(function(){
+ jQuery.event.add( this, type, one, fn && data);
+ });
+ },
+
+ unbind: function( type, fn ) {
+ return this.each(function(){
+ jQuery.event.remove( this, type, fn );
+ });
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function(){
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+
+ triggerHandler: function( type, data ) {
+ if( this[0] ){
+ var event = jQuery.Event(type);
+ event.preventDefault();
+ event.stopPropagation();
+ jQuery.event.trigger( event, data, this[0] );
+ return event.result;
+ }
+ },
+
+ toggle: function( fn ) {
+ // Save reference to arguments for access in closure
+ var args = arguments, i = 1;
+
+ // link all the functions, so any of them can unbind this click handler
+ while( i < args.length )
+ jQuery.event.proxy( fn, args[i++] );
+
+ return this.click( jQuery.event.proxy( fn, function(event) {
+ // Figure out which function to execute
+ this.lastToggle = ( this.lastToggle || 0 ) % i;
+
+ // Make sure that clicks stop
+ event.preventDefault();
+
+ // and execute the function
+ return args[ this.lastToggle++ ].apply( this, arguments ) || false;
+ }));
+ },
+
+ hover: function(fnOver, fnOut) {
+ return this.mouseenter(fnOver).mouseleave(fnOut);
+ },
+
+ ready: function(fn) {
+ // Attach the listeners
+ bindReady();
+
+ // If the DOM is already ready
+ if ( jQuery.isReady )
+ // Execute the function immediately
+ fn.call( document, jQuery );
+
+ // Otherwise, remember the function for later
+ else
+ // Add the function to the wait list
+ jQuery.readyList.push( fn );
+
+ return this;
+ },
+
+ live: function( type, fn ){
+ var proxy = jQuery.event.proxy( fn );
+ proxy.guid += this.selector + type;
+
+ jQuery(document).bind( liveConvert(type, this.selector), this.selector, proxy );
+
+ return this;
+ },
+
+ die: function( type, fn ){
+ jQuery(document).unbind( liveConvert(type, this.selector), fn ? { guid: fn.guid + this.selector + type } : null );
+ return this;
+ }
+});
+
+function liveHandler( event ){
+ var check = RegExp("(^|\\.)" + event.type + "(\\.|$)"),
+ stop = true,
+ elems = [];
+
+ jQuery.each(jQuery.data(this, "events").live || [], function(i, fn){
+ if ( check.test(fn.type) ) {
+ var elem = jQuery(event.target).closest(fn.data)[0];
+ if ( elem )
+ elems.push({ elem: elem, fn: fn });
+ }
+ });
+
+ elems.sort(function(a,b) {
+ return jQuery.data(a.elem, "closest") - jQuery.data(b.elem, "closest");
+ });
+
+ jQuery.each(elems, function(){
+ if ( this.fn.call(this.elem, event, this.fn.data) === false )
+ return (stop = false);
+ });
+
+ return stop;
+}
+
+function liveConvert(type, selector){
+ return ["live", type, selector.replace(/\./g, "`").replace(/ /g, "|")].join(".");
+}
+
+jQuery.extend({
+ isReady: false,
+ readyList: [],
+ // Handle when the DOM is ready
+ ready: function() {
+ // Make sure that the DOM is not already loaded
+ if ( !jQuery.isReady ) {
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If there are functions bound, to execute
+ if ( jQuery.readyList ) {
+ // Execute all of them
+ jQuery.each( jQuery.readyList, function(){
+ this.call( document, jQuery );
+ });
+
+ // Reset the list of functions
+ jQuery.readyList = null;
+ }
+
+ // Trigger any bound ready events
+ jQuery(document).triggerHandler("ready");
+ }
+ }
+});
+
+var readyBound = false;
+
+function bindReady(){
+ if ( readyBound ) return;
+ readyBound = true;
+
+ // Mozilla, Opera and webkit nightlies currently support this event
+ if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", function(){
+ document.removeEventListener( "DOMContentLoaded", arguments.callee, false );
+ jQuery.ready();
+ }, false );
+
+ // If IE event model is used
+ } else if ( document.attachEvent ) {
+ // ensure firing before onload,
+ // maybe late but safe also for iframes
+ document.attachEvent("onreadystatechange", function(){
+ if ( document.readyState === "complete" ) {
+ document.detachEvent( "onreadystatechange", arguments.callee );
+ jQuery.ready();
+ }
+ });
+
+ // If IE and not an iframe
+ // continually check to see if the document is ready
+ if ( document.documentElement.doScroll && window == window.top ) (function(){
+ if ( jQuery.isReady ) return;
+
+ try {
+ // If IE is used, use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ document.documentElement.doScroll("left");
+ } catch( error ) {
+ setTimeout( arguments.callee, 0 );
+ return;
+ }
+
+ // and execute any waiting functions
+ jQuery.ready();
+ })();
+ }
+
+ // A fallback to window.onload, that will always work
+ jQuery.event.add( window, "load", jQuery.ready );
+}
+
+jQuery.each( ("blur,focus,load,resize,scroll,unload,click,dblclick," +
+ "mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave," +
+ "change,select,submit,keydown,keypress,keyup,error").split(","), function(i, name){
+
+ // Handle event binding
+ jQuery.fn[name] = function(fn){
+ return fn ? this.bind(name, fn) : this.trigger(name);
+ };
+});
+
+// Prevent memory leaks in IE
+// And prevent errors on refresh with events like mouseover in other browsers
+// Window isn't included so as not to unbind existing unload events
+jQuery( window ).bind( 'unload', function(){
+ for ( var id in jQuery.cache )
+ // Skip the window
+ if ( id != 1 && jQuery.cache[ id ].handle )
+ jQuery.event.remove( jQuery.cache[ id ].handle.elem );
+});
+(function(){
+
+ jQuery.support = {};
+
+ var root = document.documentElement,
+ script = document.createElement("script"),
+ div = document.createElement("div"),
+ id = "script" + (new Date).getTime();
+
+ div.style.display = "none";
+ div.innerHTML = ' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>';
+
+ var all = div.getElementsByTagName("*"),
+ a = div.getElementsByTagName("a")[0];
+
+ // Can't get basic test support
+ if ( !all || !all.length || !a ) {
+ return;
+ }
+
+ jQuery.support = {
+ // IE strips leading whitespace when .innerHTML is used
+ leadingWhitespace: div.firstChild.nodeType == 3,
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ tbody: !div.getElementsByTagName("tbody").length,
+
+ // Make sure that you can get all elements in an <object> element
+ // IE 7 always returns no results
+ objectAll: !!div.getElementsByTagName("object")[0]
+ .getElementsByTagName("*").length,
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ htmlSerialize: !!div.getElementsByTagName("link").length,
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText insted)
+ style: /red/.test( a.getAttribute("style") ),
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ hrefNormalized: a.getAttribute("href") === "/a",
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ opacity: a.style.opacity === "0.5",
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ cssFloat: !!a.style.cssFloat,
+
+ // Will be defined later
+ scriptEval: false,
+ noCloneEvent: true,
+ boxModel: null
+ };
+
+ script.type = "text/javascript";
+ try {
+ script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
+ } catch(e){}
+
+ root.insertBefore( script, root.firstChild );
+
+ // Make sure that the execution of code works by injecting a script
+ // tag with appendChild/createTextNode
+ // (IE doesn't support this, fails, and uses .text instead)
+ if ( window[ id ] ) {
+ jQuery.support.scriptEval = true;
+ delete window[ id ];
+ }
+
+ root.removeChild( script );
+
+ if ( div.attachEvent && div.fireEvent ) {
+ div.attachEvent("onclick", function(){
+ // Cloning a node shouldn't copy over any
+ // bound event handlers (IE does this)
+ jQuery.support.noCloneEvent = false;
+ div.detachEvent("onclick", arguments.callee);
+ });
+ div.cloneNode(true).fireEvent("onclick");
+ }
+
+ // Figure out if the W3C box model works as expected
+ // document.body must exist before we can do this
+ jQuery(function(){
+ var div = document.createElement("div");
+ div.style.width = div.style.paddingLeft = "1px";
+
+ document.body.appendChild( div );
+ jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
+ document.body.removeChild( div ).style.display = 'none';
+ });
+})();
+
+var styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat";
+
+jQuery.props = {
+ "for": "htmlFor",
+ "class": "className",
+ "float": styleFloat,
+ cssFloat: styleFloat,
+ styleFloat: styleFloat,
+ readonly: "readOnly",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ rowspan: "rowSpan",
+ tabindex: "tabIndex"
+};
+jQuery.fn.extend({
+ // Keep a copy of the old load
+ _load: jQuery.fn.load,
+
+ load: function( url, params, callback ) {
+ if ( typeof url !== "string" )
+ return this._load( url );
+
+ var off = url.indexOf(" ");
+ if ( off >= 0 ) {
+ var selector = url.slice(off, url.length);
+ url = url.slice(0, off);
+ }
+
+ // Default to a GET request
+ var type = "GET";
+
+ // If the second parameter was provided
+ if ( params )
+ // If it's a function
+ if ( jQuery.isFunction( params ) ) {
+ // We assume that it's the callback
+ callback = params;
+ params = null;
+
+ // Otherwise, build a param string
+ } else if( typeof params === "object" ) {
+ params = jQuery.param( params );
+ type = "POST";
+ }
+
+ var self = this;
+
+ // Request the remote document
+ jQuery.ajax({
+ url: url,
+ type: type,
+ dataType: "html",
+ data: params,
+ complete: function(res, status){
+ // If successful, inject the HTML into all the matched elements
+ if ( status == "success" || status == "notmodified" )
+ // See if a selector was specified
+ self.html( selector ?
+ // Create a dummy div to hold the results
+ jQuery("<div/>")
+ // inject the contents of the document in, removing the scripts
+ // to avoid any 'Permission Denied' errors in IE
+ .append(res.responseText.replace(/<script(.|\s)*?\/script>/g, ""))
+
+ // Locate the specified elements
+ .find(selector) :
+
+ // If not, just inject the full result
+ res.responseText );
+
+ if( callback )
+ self.each( callback, [res.responseText, status, res] );
+ }
+ });
+ return this;
+ },
+
+ serialize: function() {
+ return jQuery.param(this.serializeArray());
+ },
+ serializeArray: function() {
+ return this.map(function(){
+ return this.elements ? jQuery.makeArray(this.elements) : this;
+ })
+ .filter(function(){
+ return this.name && !this.disabled &&
+ (this.checked || /select|textarea/i.test(this.nodeName) ||
+ /text|hidden|password|search/i.test(this.type));
+ })
+ .map(function(i, elem){
+ var val = jQuery(this).val();
+ return val == null ? null :
+ jQuery.isArray(val) ?
+ jQuery.map( val, function(val, i){
+ return {name: elem.name, value: val};
+ }) :
+ {name: elem.name, value: val};
+ }).get();
+ }
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","), function(i,o){
+ jQuery.fn[o] = function(f){
+ return this.bind(o, f);
+ };
+});
+
+var jsc = now();
+
+jQuery.extend({
+
+ get: function( url, data, callback, type ) {
+ // shift arguments if data argument was ommited
+ if ( jQuery.isFunction( data ) ) {
+ callback = data;
+ data = null;
+ }
+
+ return jQuery.ajax({
+ type: "GET",
+ url: url,
+ data: data,
+ success: callback,
+ dataType: type
+ });
+ },
+
+ getScript: function( url, callback ) {
+ return jQuery.get(url, null, callback, "script");
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get(url, data, callback, "json");
+ },
+
+ post: function( url, data, callback, type ) {
+ if ( jQuery.isFunction( data ) ) {
+ callback = data;
+ data = {};
+ }
+
+ return jQuery.ajax({
+ type: "POST",
+ url: url,
+ data: data,
+ success: callback,
+ dataType: type
+ });
+ },
+
+ ajaxSetup: function( settings ) {
+ jQuery.extend( jQuery.ajaxSettings, settings );
+ },
+
+ ajaxSettings: {
+ url: location.href,
+ global: true,
+ type: "GET",
+ contentType: "application/x-www-form-urlencoded",
+ processData: true,
+ async: true,
+ /*
+ timeout: 0,
+ data: null,
+ username: null,
+ password: null,
+ */
+ // Create the request object; Microsoft failed to properly
+ // implement the XMLHttpRequest in IE7, so we use the ActiveXObject when it is available
+ // This function can be overriden by calling jQuery.ajaxSetup
+ xhr:function(){
+ return window.ActiveXObject ? new ActiveXObject("Microsoft.XMLHTTP") : new XMLHttpRequest();
+ },
+ accepts: {
+ xml: "application/xml, text/xml",
+ html: "text/html",
+ script: "text/javascript, application/javascript",
+ json: "application/json, text/javascript",
+ text: "text/plain",
+ _default: "*/*"
+ }
+ },
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+
+ ajax: function( s ) {
+ // Extend the settings, but re-extend 's' so that it can be
+ // checked again later (in the test suite, specifically)
+ s = jQuery.extend(true, s, jQuery.extend(true, {}, jQuery.ajaxSettings, s));
+
+ var jsonp, jsre = /=\?(&|$)/g, status, data,
+ type = s.type.toUpperCase();
+
+ // convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" )
+ s.data = jQuery.param(s.data);
+
+ // Handle JSONP Parameter Callbacks
+ if ( s.dataType == "jsonp" ) {
+ if ( type == "GET" ) {
+ if ( !s.url.match(jsre) )
+ s.url += (s.url.match(/\?/) ? "&" : "?") + (s.jsonp || "callback") + "=?";
+ } else if ( !s.data || !s.data.match(jsre) )
+ s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?";
+ s.dataType = "json";
+ }
+
+ // Build temporary JSONP function
+ if ( s.dataType == "json" && (s.data && s.data.match(jsre) || s.url.match(jsre)) ) {
+ jsonp = "jsonp" + jsc++;
+
+ // Replace the =? sequence both in the query string and the data
+ if ( s.data )
+ s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
+ s.url = s.url.replace(jsre, "=" + jsonp + "$1");
+
+ // We need to make sure
+ // that a JSONP style response is executed properly
+ s.dataType = "script";
+
+ // Handle JSONP-style loading
+ window[ jsonp ] = function(tmp){
+ data = tmp;
+ success();
+ complete();
+ // Garbage collect
+ window[ jsonp ] = undefined;
+ try{ delete window[ jsonp ]; } catch(e){}
+ if ( head )
+ head.removeChild( script );
+ };
+ }
+
+ if ( s.dataType == "script" && s.cache == null )
+ s.cache = false;
+
+ if ( s.cache === false && type == "GET" ) {
+ var ts = now();
+ // try replacing _= if it is there
+ var ret = s.url.replace(/(\?|&)_=.*?(&|$)/, "$1_=" + ts + "$2");
+ // if nothing was replaced, add timestamp to the end
+ s.url = ret + ((ret == s.url) ? (s.url.match(/\?/) ? "&" : "?") + "_=" + ts : "");
+ }
+
+ // If data is available, append data to url for get requests
+ if ( s.data && type == "GET" ) {
+ s.url += (s.url.match(/\?/) ? "&" : "?") + s.data;
+
+ // IE likes to send both get and post data, prevent this
+ s.data = null;
+ }
+
+ // Watch for a new set of requests
+ if ( s.global && ! jQuery.active++ )
+ jQuery.event.trigger( "ajaxStart" );
+
+ // Matches an absolute URL, and saves the domain
+ var parts = /^(\w+:)?\/\/([^\/?#]+)/.exec( s.url );
+
+ // If we're requesting a remote document
+ // and trying to load JSON or Script with a GET
+ if ( s.dataType == "script" && type == "GET" && parts
+ && ( parts[1] && parts[1] != location.protocol || parts[2] != location.host )){
+
+ var head = document.getElementsByTagName("head")[0];
+ var script = document.createElement("script");
+ script.src = s.url;
+ if (s.scriptCharset)
+ script.charset = s.scriptCharset;
+
+ // Handle Script loading
+ if ( !jsonp ) {
+ var done = false;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function(){
+ if ( !done && (!this.readyState ||
+ this.readyState == "loaded" || this.readyState == "complete") ) {
+ done = true;
+ success();
+ complete();
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+ head.removeChild( script );
+ }
+ };
+ }
+
+ head.appendChild(script);
+
+ // We handle everything using the script element injection
+ return undefined;
+ }
+
+ var requestDone = false;
+
+ // Create the request object
+ var xhr = s.xhr();
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if( s.username )
+ xhr.open(type, s.url, s.async, s.username, s.password);
+ else
+ xhr.open(type, s.url, s.async);
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ // Set the correct header, if data is being sent
+ if ( s.data )
+ xhr.setRequestHeader("Content-Type", s.contentType);
+
+ // Set the If-Modified-Since header, if ifModified mode.
+ if ( s.ifModified )
+ xhr.setRequestHeader("If-Modified-Since",
+ jQuery.lastModified[s.url] || "Thu, 01 Jan 1970 00:00:00 GMT" );
+
+ // Set header so the called script knows that it's an XMLHttpRequest
+ xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+
+ // Set the Accepts header for the server, depending on the dataType
+ xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
+ s.accepts[ s.dataType ] + ", */*" :
+ s.accepts._default );
+ } catch(e){}
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && s.beforeSend(xhr, s) === false ) {
+ // Handle the global AJAX counter
+ if ( s.global && ! --jQuery.active )
+ jQuery.event.trigger( "ajaxStop" );
+ // close opended socket
+ xhr.abort();
+ return false;
+ }
+
+ if ( s.global )
+ jQuery.event.trigger("ajaxSend", [xhr, s]);
+
+ // Wait for a response to come back
+ var onreadystatechange = function(isTimeout){
+ // The request was aborted, clear the interval and decrement jQuery.active
+ if (xhr.readyState == 0) {
+ if (ival) {
+ // clear poll interval
+ clearInterval(ival);
+ ival = null;
+ // Handle the global AJAX counter
+ if ( s.global && ! --jQuery.active )
+ jQuery.event.trigger( "ajaxStop" );
+ }
+ // The transfer is complete and the data is available, or the request timed out
+ } else if ( !requestDone && xhr && (xhr.readyState == 4 || isTimeout == "timeout") ) {
+ requestDone = true;
+
+ // clear poll interval
+ if (ival) {
+ clearInterval(ival);
+ ival = null;
+ }
+
+ status = isTimeout == "timeout" ? "timeout" :
+ !jQuery.httpSuccess( xhr ) ? "error" :
+ s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? "notmodified" :
+ "success";
+
+ if ( status == "success" ) {
+ // Watch for, and catch, XML document parse errors
+ try {
+ // process the data (runs the xml through httpData regardless of callback)
+ data = jQuery.httpData( xhr, s.dataType, s );
+ } catch(e) {
+ status = "parsererror";
+ }
+ }
+
+ // Make sure that the request was successful or notmodified
+ if ( status == "success" ) {
+ // Cache Last-Modified header, if ifModified mode.
+ var modRes;
+ try {
+ modRes = xhr.getResponseHeader("Last-Modified");
+ } catch(e) {} // swallow exception thrown by FF if header is not available
+
+ if ( s.ifModified && modRes )
+ jQuery.lastModified[s.url] = modRes;
+
+ // JSONP handles its own success callback
+ if ( !jsonp )
+ success();
+ } else
+ jQuery.handleError(s, xhr, status);
+
+ // Fire the complete handlers
+ complete();
+
+ if ( isTimeout )
+ xhr.abort();
+
+ // Stop memory leaks
+ if ( s.async )
+ xhr = null;
+ }
+ };
+
+ if ( s.async ) {
+ // don't attach the handler to the request, just poll it instead
+ var ival = setInterval(onreadystatechange, 13);
+
+ // Timeout checker
+ if ( s.timeout > 0 )
+ setTimeout(function(){
+ // Check to see if the request is still happening
+ if ( xhr && !requestDone )
+ onreadystatechange( "timeout" );
+ }, s.timeout);
+ }
+
+ // Send the data
+ try {
+ xhr.send(s.data);
+ } catch(e) {
+ jQuery.handleError(s, xhr, null, e);
+ }
+
+ // firefox 1.5 doesn't fire statechange for sync requests
+ if ( !s.async )
+ onreadystatechange();
+
+ function success(){
+ // If a local callback was specified, fire it and pass it the data
+ if ( s.success )
+ s.success( data, status );
+
+ // Fire the global callback
+ if ( s.global )
+ jQuery.event.trigger( "ajaxSuccess", [xhr, s] );
+ }
+
+ function complete(){
+ // Process result
+ if ( s.complete )
+ s.complete(xhr, status);
+
+ // The request was completed
+ if ( s.global )
+ jQuery.event.trigger( "ajaxComplete", [xhr, s] );
+
+ // Handle the global AJAX counter
+ if ( s.global && ! --jQuery.active )
+ jQuery.event.trigger( "ajaxStop" );
+ }
+
+ // return XMLHttpRequest to allow aborting the request etc.
+ return xhr;
+ },
+
+ handleError: function( s, xhr, status, e ) {
+ // If a local callback was specified, fire it
+ if ( s.error ) s.error( xhr, status, e );
+
+ // Fire the global callback
+ if ( s.global )
+ jQuery.event.trigger( "ajaxError", [xhr, s, e] );
+ },
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Determines if an XMLHttpRequest was successful or not
+ httpSuccess: function( xhr ) {
+ try {
+ // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
+ return !xhr.status && location.protocol == "file:" ||
+ ( xhr.status >= 200 && xhr.status < 300 ) || xhr.status == 304 || xhr.status == 1223;
+ } catch(e){}
+ return false;
+ },
+
+ // Determines if an XMLHttpRequest returns NotModified
+ httpNotModified: function( xhr, url ) {
+ try {
+ var xhrRes = xhr.getResponseHeader("Last-Modified");
+
+ // Firefox always returns 200. check Last-Modified date
+ return xhr.status == 304 || xhrRes == jQuery.lastModified[url];
+ } catch(e){}
+ return false;
+ },
+
+ httpData: function( xhr, type, s ) {
+ var ct = xhr.getResponseHeader("content-type"),
+ xml = type == "xml" || !type && ct && ct.indexOf("xml") >= 0,
+ data = xml ? xhr.responseXML : xhr.responseText;
+
+ if ( xml && data.documentElement.tagName == "parsererror" )
+ throw "parsererror";
+
+ // Allow a pre-filtering function to sanitize the response
+ // s != null is checked to keep backwards compatibility
+ if( s && s.dataFilter )
+ data = s.dataFilter( data, type );
+
+ // The filter can actually parse the response
+ if( typeof data === "string" ){
+
+ // If the type is "script", eval it in global context
+ if ( type == "script" )
+ jQuery.globalEval( data );
+
+ // Get the JavaScript object, if JSON is used.
+ if ( type == "json" )
+ data = window["eval"]("(" + data + ")");
+ }
+
+ return data;
+ },
+
+ // Serialize an array of form elements or a set of
+ // key/values into a query string
+ param: function( a ) {
+ var s = [ ];
+
+ function add( key, value ){
+ s[ s.length ] = encodeURIComponent(key) + '=' + encodeURIComponent(value);
+ };
+
+ // If an array was passed in, assume that it is an array
+ // of form elements
+ if ( jQuery.isArray(a) || a.jquery )
+ // Serialize the form elements
+ jQuery.each( a, function(){
+ add( this.name, this.value );
+ });
+
+ // Otherwise, assume that it's an object of key/value pairs
+ else
+ // Serialize the key/values
+ for ( var j in a )
+ // If the value is an array then the key names need to be repeated
+ if ( jQuery.isArray(a[j]) )
+ jQuery.each( a[j], function(){
+ add( j, this );
+ });
+ else
+ add( j, jQuery.isFunction(a[j]) ? a[j]() : a[j] );
+
+ // Return the resulting serialization
+ return s.join("&").replace(/%20/g, "+");
+ }
+
+});
+var elemdisplay = {},
+ timerId,
+ fxAttrs = [
+ // height animations
+ [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
+ // width animations
+ [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
+ // opacity animations
+ [ "opacity" ]
+ ];
+
+function genFx( type, num ){
+ var obj = {};
+ jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function(){
+ obj[ this ] = type;
+ });
+ return obj;
+}
+
+jQuery.fn.extend({
+ show: function(speed,callback){
+ if ( speed ) {
+ return this.animate( genFx("show", 3), speed, callback);
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ){
+ var old = jQuery.data(this[i], "olddisplay");
+
+ this[i].style.display = old || "";
+
+ if ( jQuery.css(this[i], "display") === "none" ) {
+ var tagName = this[i].tagName, display;
+
+ if ( elemdisplay[ tagName ] ) {
+ display = elemdisplay[ tagName ];
+ } else {
+ var elem = jQuery("<" + tagName + " />").appendTo("body");
+
+ display = elem.css("display");
+ if ( display === "none" )
+ display = "block";
+
+ elem.remove();
+
+ elemdisplay[ tagName ] = display;
+ }
+
+ jQuery.data(this[i], "olddisplay", display);
+ }
+ }
+
+ // Set the display of the elements in a second loop
+ // to avoid the constant reflow
+ for ( var i = 0, l = this.length; i < l; i++ ){
+ this[i].style.display = jQuery.data(this[i], "olddisplay") || "";
+ }
+
+ return this;
+ }
+ },
+
+ hide: function(speed,callback){
+ if ( speed ) {
+ return this.animate( genFx("hide", 3), speed, callback);
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ){
+ var old = jQuery.data(this[i], "olddisplay");
+ if ( !old && old !== "none" )
+ jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display"));
+ }
+
+ // Set the display of the elements in a second loop
+ // to avoid the constant reflow
+ for ( var i = 0, l = this.length; i < l; i++ ){
+ this[i].style.display = "none";
+ }
+
+ return this;
+ }
+ },
+
+ // Save the old toggle function
+ _toggle: jQuery.fn.toggle,
+
+ toggle: function( fn, fn2 ){
+ var bool = typeof fn === "boolean";
+
+ return jQuery.isFunction(fn) && jQuery.isFunction(fn2) ?
+ this._toggle.apply( this, arguments ) :
+ fn == null || bool ?
+ this.each(function(){
+ var state = bool ? fn : jQuery(this).is(":hidden");
+ jQuery(this)[ state ? "show" : "hide" ]();
+ }) :
+ this.animate(genFx("toggle", 3), fn, fn2);
+ },
+
+ fadeTo: function(speed,to,callback){
+ return this.animate({opacity: to}, speed, callback);
+ },
+
+ animate: function( prop, speed, easing, callback ) {
+ var optall = jQuery.speed(speed, easing, callback);
+
+ return this[ optall.queue === false ? "each" : "queue" ](function(){
+
+ var opt = jQuery.extend({}, optall), p,
+ hidden = this.nodeType == 1 && jQuery(this).is(":hidden"),
+ self = this;
+
+ for ( p in prop ) {
+ if ( prop[p] == "hide" && hidden || prop[p] == "show" && !hidden )
+ return opt.complete.call(this);
+
+ if ( ( p == "height" || p == "width" ) && this.style ) {
+ // Store display property
+ opt.display = jQuery.css(this, "display");
+
+ // Make sure that nothing sneaks out
+ opt.overflow = this.style.overflow;
+ }
+ }
+
+ if ( opt.overflow != null )
+ this.style.overflow = "hidden";
+
+ opt.curAnim = jQuery.extend({}, prop);
+
+ jQuery.each( prop, function(name, val){
+ var e = new jQuery.fx( self, opt, name );
+
+ if ( /toggle|show|hide/.test(val) )
+ e[ val == "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+ else {
+ var parts = val.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),
+ start = e.cur(true) || 0;
+
+ if ( parts ) {
+ var end = parseFloat(parts[2]),
+ unit = parts[3] || "px";
+
+ // We need to compute starting value
+ if ( unit != "px" ) {
+ self.style[ name ] = (end || 1) + unit;
+ start = ((end || 1) / e.cur(true)) * start;
+ self.style[ name ] = start + unit;
+ }
+
+ // If a +=/-= token was provided, we're doing a relative animation
+ if ( parts[1] )
+ end = ((parts[1] == "-=" ? -1 : 1) * end) + start;
+
+ e.custom( start, end, unit );
+ } else
+ e.custom( start, val, "" );
+ }
+ });
+
+ // For JS strict compliance
+ return true;
+ });
+ },
+
+ stop: function(clearQueue, gotoEnd){
+ var timers = jQuery.timers;
+
+ if (clearQueue)
+ this.queue([]);
+
+ this.each(function(){
+ // go in reverse order so anything added to the queue during the loop is ignored
+ for ( var i = timers.length - 1; i >= 0; i-- )
+ if ( timers[i].elem == this ) {
+ if (gotoEnd)
+ // force the next step to be the last
+ timers[i](true);
+ timers.splice(i, 1);
+ }
+ });
+
+ // start the next in the queue if the last step wasn't forced
+ if (!gotoEnd)
+ this.dequeue();
+
+ return this;
+ }
+
+});
+
+// Generate shortcuts for custom animations
+jQuery.each({
+ slideDown: genFx("show", 1),
+ slideUp: genFx("hide", 1),
+ slideToggle: genFx("toggle", 1),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" }
+}, function( name, props ){
+ jQuery.fn[ name ] = function( speed, callback ){
+ return this.animate( props, speed, callback );
+ };
+});
+
+jQuery.extend({
+
+ speed: function(speed, easing, fn) {
+ var opt = typeof speed === "object" ? speed : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default;
+
+ // Queueing
+ opt.old = opt.complete;
+ opt.complete = function(){
+ if ( opt.queue !== false )
+ jQuery(this).dequeue();
+ if ( jQuery.isFunction( opt.old ) )
+ opt.old.call( this );
+ };
+
+ return opt;
+ },
+
+ easing: {
+ linear: function( p, n, firstNum, diff ) {
+ return firstNum + diff * p;
+ },
+ swing: function( p, n, firstNum, diff ) {
+ return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
+ }
+ },
+
+ timers: [],
+
+ fx: function( elem, options, prop ){
+ this.options = options;
+ this.elem = elem;
+ this.prop = prop;
+
+ if ( !options.orig )
+ options.orig = {};
+ }
+
+});
+
+jQuery.fx.prototype = {
+
+ // Simple function for setting a style value
+ update: function(){
+ if ( this.options.step )
+ this.options.step.call( this.elem, this.now, this );
+
+ (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
+
+ // Set display property to block for height/width animations
+ if ( ( this.prop == "height" || this.prop == "width" ) && this.elem.style )
+ this.elem.style.display = "block";
+ },
+
+ // Get the current size
+ cur: function(force){
+ if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) )
+ return this.elem[ this.prop ];
+
+ var r = parseFloat(jQuery.css(this.elem, this.prop, force));
+ return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0;
+ },
+
+ // Start an animation from one number to another
+ custom: function(from, to, unit){
+ this.startTime = now();
+ this.start = from;
+ this.end = to;
+ this.unit = unit || this.unit || "px";
+ this.now = this.start;
+ this.pos = this.state = 0;
+
+ var self = this;
+ function t(gotoEnd){
+ return self.step(gotoEnd);
+ }
+
+ t.elem = this.elem;
+
+ if ( t() && jQuery.timers.push(t) && !timerId ) {
+ timerId = setInterval(function(){
+ var timers = jQuery.timers;
+
+ for ( var i = 0; i < timers.length; i++ )
+ if ( !timers[i]() )
+ timers.splice(i--, 1);
+
+ if ( !timers.length ) {
+ clearInterval( timerId );
+ timerId = undefined;
+ }
+ }, 13);
+ }
+ },
+
+ // Simple 'show' function
+ show: function(){
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+ this.options.show = true;
+
+ // Begin the animation
+ // Make sure that we start at a small width/height to avoid any
+ // flash of content
+ this.custom(this.prop == "width" || this.prop == "height" ? 1 : 0, this.cur());
+
+ // Start by showing the element
+ jQuery(this.elem).show();
+ },
+
+ // Simple 'hide' function
+ hide: function(){
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+ this.options.hide = true;
+
+ // Begin the animation
+ this.custom(this.cur(), 0);
+ },
+
+ // Each step of an animation
+ step: function(gotoEnd){
+ var t = now();
+
+ if ( gotoEnd || t >= this.options.duration + this.startTime ) {
+ this.now = this.end;
+ this.pos = this.state = 1;
+ this.update();
+
+ this.options.curAnim[ this.prop ] = true;
+
+ var done = true;
+ for ( var i in this.options.curAnim )
+ if ( this.options.curAnim[i] !== true )
+ done = false;
+
+ if ( done ) {
+ if ( this.options.display != null ) {
+ // Reset the overflow
+ this.elem.style.overflow = this.options.overflow;
+
+ // Reset the display
+ this.elem.style.display = this.options.display;
+ if ( jQuery.css(this.elem, "display") == "none" )
+ this.elem.style.display = "block";
+ }
+
+ // Hide the element if the "hide" operation was done
+ if ( this.options.hide )
+ jQuery(this.elem).hide();
+
+ // Reset the properties, if the item has been hidden or shown
+ if ( this.options.hide || this.options.show )
+ for ( var p in this.options.curAnim )
+ jQuery.attr(this.elem.style, p, this.options.orig[p]);
+
+ // Execute the complete function
+ this.options.complete.call( this.elem );
+ }
+
+ return false;
+ } else {
+ var n = t - this.startTime;
+ this.state = n / this.options.duration;
+
+ // Perform the easing function, defaults to swing
+ this.pos = jQuery.easing[this.options.easing || (jQuery.easing.swing ? "swing" : "linear")](this.state, n, 0, 1, this.options.duration);
+ this.now = this.start + ((this.end - this.start) * this.pos);
+
+ // Perform the next step of the animation
+ this.update();
+ }
+
+ return true;
+ }
+
+};
+
+jQuery.extend( jQuery.fx, {
+ speeds:{
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+ },
+ step: {
+
+ opacity: function(fx){
+ jQuery.attr(fx.elem.style, "opacity", fx.now);
+ },
+
+ _default: function(fx){
+ if ( fx.elem.style && fx.elem.style[ fx.prop ] != null )
+ fx.elem.style[ fx.prop ] = fx.now + fx.unit;
+ else
+ fx.elem[ fx.prop ] = fx.now;
+ }
+ }
+});
+if ( document.documentElement["getBoundingClientRect"] )
+ jQuery.fn.offset = function() {
+ if ( !this[0] ) return { top: 0, left: 0 };
+ if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] );
+ var box = this[0].getBoundingClientRect(), doc = this[0].ownerDocument, body = doc.body, docElem = doc.documentElement,
+ clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0,
+ top = box.top + (self.pageYOffset || jQuery.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop,
+ left = box.left + (self.pageXOffset || jQuery.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft;
+ return { top: top, left: left };
+ };
+else
+ jQuery.fn.offset = function() {
+ if ( !this[0] ) return { top: 0, left: 0 };
+ if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] );
+ jQuery.offset.initialized || jQuery.offset.initialize();
+
+ var elem = this[0], offsetParent = elem.offsetParent, prevOffsetParent = elem,
+ doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement,
+ body = doc.body, defaultView = doc.defaultView,
+ prevComputedStyle = defaultView.getComputedStyle(elem, null),
+ top = elem.offsetTop, left = elem.offsetLeft;
+
+ while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
+ computedStyle = defaultView.getComputedStyle(elem, null);
+ top -= elem.scrollTop, left -= elem.scrollLeft;
+ if ( elem === offsetParent ) {
+ top += elem.offsetTop, left += elem.offsetLeft;
+ if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.tagName)) )
+ top += parseInt( computedStyle.borderTopWidth, 10) || 0,
+ left += parseInt( computedStyle.borderLeftWidth, 10) || 0;
+ prevOffsetParent = offsetParent, offsetParent = elem.offsetParent;
+ }
+ if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" )
+ top += parseInt( computedStyle.borderTopWidth, 10) || 0,
+ left += parseInt( computedStyle.borderLeftWidth, 10) || 0;
+ prevComputedStyle = computedStyle;
+ }
+
+ if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" )
+ top += body.offsetTop,
+ left += body.offsetLeft;
+
+ if ( prevComputedStyle.position === "fixed" )
+ top += Math.max(docElem.scrollTop, body.scrollTop),
+ left += Math.max(docElem.scrollLeft, body.scrollLeft);
+
+ return { top: top, left: left };
+ };
+
+jQuery.offset = {
+ initialize: function() {
+ if ( this.initialized ) return;
+ var body = document.body, container = document.createElement('div'), innerDiv, checkDiv, table, td, rules, prop, bodyMarginTop = body.style.marginTop,
+ html = '<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';
+
+ rules = { position: 'absolute', top: 0, left: 0, margin: 0, border: 0, width: '1px', height: '1px', visibility: 'hidden' };
+ for ( prop in rules ) container.style[prop] = rules[prop];
+
+ container.innerHTML = html;
+ body.insertBefore(container, body.firstChild);
+ innerDiv = container.firstChild, checkDiv = innerDiv.firstChild, td = innerDiv.nextSibling.firstChild.firstChild;
+
+ this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
+ this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
+
+ innerDiv.style.overflow = 'hidden', innerDiv.style.position = 'relative';
+ this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
+
+ body.style.marginTop = '1px';
+ this.doesNotIncludeMarginInBodyOffset = (body.offsetTop === 0);
+ body.style.marginTop = bodyMarginTop;
+
+ body.removeChild(container);
+ this.initialized = true;
+ },
+
+ bodyOffset: function(body) {
+ jQuery.offset.initialized || jQuery.offset.initialize();
+ var top = body.offsetTop, left = body.offsetLeft;
+ if ( jQuery.offset.doesNotIncludeMarginInBodyOffset )
+ top += parseInt( jQuery.curCSS(body, 'marginTop', true), 10 ) || 0,
+ left += parseInt( jQuery.curCSS(body, 'marginLeft', true), 10 ) || 0;
+ return { top: top, left: left };
+ }
+};
+
+
+jQuery.fn.extend({
+ position: function() {
+ var left = 0, top = 0, results;
+
+ if ( this[0] ) {
+ // Get *real* offsetParent
+ var offsetParent = this.offsetParent(),
+
+ // Get correct offsets
+ offset = this.offset(),
+ parentOffset = /^body|html$/i.test(offsetParent[0].tagName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+ // Subtract element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ offset.top -= num( this, 'marginTop' );
+ offset.left -= num( this, 'marginLeft' );
+
+ // Add offsetParent borders
+ parentOffset.top += num( offsetParent, 'borderTopWidth' );
+ parentOffset.left += num( offsetParent, 'borderLeftWidth' );
+
+ // Subtract the two offsets
+ results = {
+ top: offset.top - parentOffset.top,
+ left: offset.left - parentOffset.left
+ };
+ }
+
+ return results;
+ },
+
+ offsetParent: function() {
+ var offsetParent = this[0].offsetParent || document.body;
+ while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && jQuery.css(offsetParent, 'position') == 'static') )
+ offsetParent = offsetParent.offsetParent;
+ return jQuery(offsetParent);
+ }
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( ['Left', 'Top'], function(i, name) {
+ var method = 'scroll' + name;
+
+ jQuery.fn[ method ] = function(val) {
+ if (!this[0]) return null;
+
+ return val !== undefined ?
+
+ // Set the scroll offset
+ this.each(function() {
+ this == window || this == document ?
+ window.scrollTo(
+ !i ? val : jQuery(window).scrollLeft(),
+ i ? val : jQuery(window).scrollTop()
+ ) :
+ this[ method ] = val;
+ }) :
+
+ // Return the scroll offset
+ this[0] == window || this[0] == document ?
+ self[ i ? 'pageYOffset' : 'pageXOffset' ] ||
+ jQuery.boxModel && document.documentElement[ method ] ||
+ document.body[ method ] :
+ this[0][ method ];
+ };
+});
+// Create innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function(i, name){
+
+ var tl = i ? "Left" : "Top", // top or left
+ br = i ? "Right" : "Bottom", // bottom or right
+ lower = name.toLowerCase();
+
+ // innerHeight and innerWidth
+ jQuery.fn["inner" + name] = function(){
+ return this[0] ?
+ jQuery.css( this[0], lower, false, "padding" ) :
+ null;
+ };
+
+ // outerHeight and outerWidth
+ jQuery.fn["outer" + name] = function(margin) {
+ return this[0] ?
+ jQuery.css( this[0], lower, false, margin ? "margin" : "border" ) :
+ null;
+ };
+
+ var type = name.toLowerCase();
+
+ jQuery.fn[ type ] = function( size ) {
+ // Get window width or height
+ return this[0] == window ?
+ // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+ document.compatMode == "CSS1Compat" && document.documentElement[ "client" + name ] ||
+ document.body[ "client" + name ] :
+
+ // Get document width or height
+ this[0] == document ?
+ // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+ Math.max(
+ document.documentElement["client" + name],
+ document.body["scroll" + name], document.documentElement["scroll" + name],
+ document.body["offset" + name], document.documentElement["offset" + name]
+ ) :
+
+ // Get or set width or height on the element
+ size === undefined ?
+ // Get width or height on the element
+ (this.length ? jQuery.css( this[0], type ) : null) :
+
+ // Set the width or height on the element (default to pixels if value is unitless)
+ this.css( type, typeof size === "string" ? size : size + "px" );
+ };
+
+});
+})();
--- /dev/null
+/*
+ * jQuery JavaScript Library v1.3.2
+ * http://jquery.com/
+ *
+ * Copyright (c) 2009 John Resig
+ * Dual licensed under the MIT and GPL licenses.
+ * http://docs.jquery.com/License
+ *
+ * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009)
+ * Revision: 6246
+ */
+(function(){var l=this,g,y=l.jQuery,p=l.$,o=l.jQuery=l.$=function(E,F){return new o.fn.init(E,F)},D=/^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,f=/^.[^:#\[\.,]*$/;o.fn=o.prototype={init:function(E,H){E=E||document;if(E.nodeType){this[0]=E;this.length=1;this.context=E;return this}if(typeof E==="string"){var G=D.exec(E);if(G&&(G[1]||!H)){if(G[1]){E=o.clean([G[1]],H)}else{var I=document.getElementById(G[3]);if(I&&I.id!=G[3]){return o().find(E)}var F=o(I||[]);F.context=document;F.selector=E;return F}}else{return o(H).find(E)}}else{if(o.isFunction(E)){return o(document).ready(E)}}if(E.selector&&E.context){this.selector=E.selector;this.context=E.context}return this.setArray(o.isArray(E)?E:o.makeArray(E))},selector:"",jquery:"1.3.2",size:function(){return this.length},get:function(E){return E===g?Array.prototype.slice.call(this):this[E]},pushStack:function(F,H,E){var G=o(F);G.prevObject=this;G.context=this.context;if(H==="find"){G.selector=this.selector+(this.selector?" ":"")+E}else{if(H){G.selector=this.selector+"."+H+"("+E+")"}}return G},setArray:function(E){this.length=0;Array.prototype.push.apply(this,E);return this},each:function(F,E){return o.each(this,F,E)},index:function(E){return o.inArray(E&&E.jquery?E[0]:E,this)},attr:function(F,H,G){var E=F;if(typeof F==="string"){if(H===g){return this[0]&&o[G||"attr"](this[0],F)}else{E={};E[F]=H}}return this.each(function(I){for(F in E){o.attr(G?this.style:this,F,o.prop(this,E[F],G,I,F))}})},css:function(E,F){if((E=="width"||E=="height")&&parseFloat(F)<0){F=g}return this.attr(E,F,"curCSS")},text:function(F){if(typeof F!=="object"&&F!=null){return this.empty().append((this[0]&&this[0].ownerDocument||document).createTextNode(F))}var E="";o.each(F||this,function(){o.each(this.childNodes,function(){if(this.nodeType!=8){E+=this.nodeType!=1?this.nodeValue:o.fn.text([this])}})});return E},wrapAll:function(E){if(this[0]){var F=o(E,this[0].ownerDocument).clone();if(this[0].parentNode){F.insertBefore(this[0])}F.map(function(){var G=this;while(G.firstChild){G=G.firstChild}return G}).append(this)}return this},wrapInner:function(E){return this.each(function(){o(this).contents().wrapAll(E)})},wrap:function(E){return this.each(function(){o(this).wrapAll(E)})},append:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.appendChild(E)}})},prepend:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.insertBefore(E,this.firstChild)}})},before:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this)})},after:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this.nextSibling)})},end:function(){return this.prevObject||o([])},push:[].push,sort:[].sort,splice:[].splice,find:function(E){if(this.length===1){var F=this.pushStack([],"find",E);F.length=0;o.find(E,this[0],F);return F}else{return this.pushStack(o.unique(o.map(this,function(G){return o.find(E,G)})),"find",E)}},clone:function(G){var E=this.map(function(){if(!o.support.noCloneEvent&&!o.isXMLDoc(this)){var I=this.outerHTML;if(!I){var J=this.ownerDocument.createElement("div");J.appendChild(this.cloneNode(true));I=J.innerHTML}return o.clean([I.replace(/ jQuery\d+="(?:\d+|null)"/g,"").replace(/^\s*/,"")])[0]}else{return this.cloneNode(true)}});if(G===true){var H=this.find("*").andSelf(),F=0;E.find("*").andSelf().each(function(){if(this.nodeName!==H[F].nodeName){return}var I=o.data(H[F],"events");for(var K in I){for(var J in I[K]){o.event.add(this,K,I[K][J],I[K][J].data)}}F++})}return E},filter:function(E){return this.pushStack(o.isFunction(E)&&o.grep(this,function(G,F){return E.call(G,F)})||o.multiFilter(E,o.grep(this,function(F){return F.nodeType===1})),"filter",E)},closest:function(E){var G=o.expr.match.POS.test(E)?o(E):null,F=0;return this.map(function(){var H=this;while(H&&H.ownerDocument){if(G?G.index(H)>-1:o(H).is(E)){o.data(H,"closest",F);return H}H=H.parentNode;F++}})},not:function(E){if(typeof E==="string"){if(f.test(E)){return this.pushStack(o.multiFilter(E,this,true),"not",E)}else{E=o.multiFilter(E,this)}}var F=E.length&&E[E.length-1]!==g&&!E.nodeType;return this.filter(function(){return F?o.inArray(this,E)<0:this!=E})},add:function(E){return this.pushStack(o.unique(o.merge(this.get(),typeof E==="string"?o(E):o.makeArray(E))))},is:function(E){return !!E&&o.multiFilter(E,this).length>0},hasClass:function(E){return !!E&&this.is("."+E)},val:function(K){if(K===g){var E=this[0];if(E){if(o.nodeName(E,"option")){return(E.attributes.value||{}).specified?E.value:E.text}if(o.nodeName(E,"select")){var I=E.selectedIndex,L=[],M=E.options,H=E.type=="select-one";if(I<0){return null}for(var F=H?I:0,J=H?I+1:M.length;F<J;F++){var G=M[F];if(G.selected){K=o(G).val();if(H){return K}L.push(K)}}return L}return(E.value||"").replace(/\r/g,"")}return g}if(typeof K==="number"){K+=""}return this.each(function(){if(this.nodeType!=1){return}if(o.isArray(K)&&/radio|checkbox/.test(this.type)){this.checked=(o.inArray(this.value,K)>=0||o.inArray(this.name,K)>=0)}else{if(o.nodeName(this,"select")){var N=o.makeArray(K);o("option",this).each(function(){this.selected=(o.inArray(this.value,N)>=0||o.inArray(this.text,N)>=0)});if(!N.length){this.selectedIndex=-1}}else{this.value=K}}})},html:function(E){return E===g?(this[0]?this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g,""):null):this.empty().append(E)},replaceWith:function(E){return this.after(E).remove()},eq:function(E){return this.slice(E,+E+1)},slice:function(){return this.pushStack(Array.prototype.slice.apply(this,arguments),"slice",Array.prototype.slice.call(arguments).join(","))},map:function(E){return this.pushStack(o.map(this,function(G,F){return E.call(G,F,G)}))},andSelf:function(){return this.add(this.prevObject)},domManip:function(J,M,L){if(this[0]){var I=(this[0].ownerDocument||this[0]).createDocumentFragment(),F=o.clean(J,(this[0].ownerDocument||this[0]),I),H=I.firstChild;if(H){for(var G=0,E=this.length;G<E;G++){L.call(K(this[G],H),this.length>1||G>0?I.cloneNode(true):I)}}if(F){o.each(F,z)}}return this;function K(N,O){return M&&o.nodeName(N,"table")&&o.nodeName(O,"tr")?(N.getElementsByTagName("tbody")[0]||N.appendChild(N.ownerDocument.createElement("tbody"))):N}}};o.fn.init.prototype=o.fn;function z(E,F){if(F.src){o.ajax({url:F.src,async:false,dataType:"script"})}else{o.globalEval(F.text||F.textContent||F.innerHTML||"")}if(F.parentNode){F.parentNode.removeChild(F)}}function e(){return +new Date}o.extend=o.fn.extend=function(){var J=arguments[0]||{},H=1,I=arguments.length,E=false,G;if(typeof J==="boolean"){E=J;J=arguments[1]||{};H=2}if(typeof J!=="object"&&!o.isFunction(J)){J={}}if(I==H){J=this;--H}for(;H<I;H++){if((G=arguments[H])!=null){for(var F in G){var K=J[F],L=G[F];if(J===L){continue}if(E&&L&&typeof L==="object"&&!L.nodeType){J[F]=o.extend(E,K||(L.length!=null?[]:{}),L)}else{if(L!==g){J[F]=L}}}}}return J};var b=/z-?index|font-?weight|opacity|zoom|line-?height/i,q=document.defaultView||{},s=Object.prototype.toString;o.extend({noConflict:function(E){l.$=p;if(E){l.jQuery=y}return o},isFunction:function(E){return s.call(E)==="[object Function]"},isArray:function(E){return s.call(E)==="[object Array]"},isXMLDoc:function(E){return E.nodeType===9&&E.documentElement.nodeName!=="HTML"||!!E.ownerDocument&&o.isXMLDoc(E.ownerDocument)},globalEval:function(G){if(G&&/\S/.test(G)){var F=document.getElementsByTagName("head")[0]||document.documentElement,E=document.createElement("script");E.type="text/javascript";if(o.support.scriptEval){E.appendChild(document.createTextNode(G))}else{E.text=G}F.insertBefore(E,F.firstChild);F.removeChild(E)}},nodeName:function(F,E){return F.nodeName&&F.nodeName.toUpperCase()==E.toUpperCase()},each:function(G,K,F){var E,H=0,I=G.length;if(F){if(I===g){for(E in G){if(K.apply(G[E],F)===false){break}}}else{for(;H<I;){if(K.apply(G[H++],F)===false){break}}}}else{if(I===g){for(E in G){if(K.call(G[E],E,G[E])===false){break}}}else{for(var J=G[0];H<I&&K.call(J,H,J)!==false;J=G[++H]){}}}return G},prop:function(H,I,G,F,E){if(o.isFunction(I)){I=I.call(H,F)}return typeof I==="number"&&G=="curCSS"&&!b.test(E)?I+"px":I},className:{add:function(E,F){o.each((F||"").split(/\s+/),function(G,H){if(E.nodeType==1&&!o.className.has(E.className,H)){E.className+=(E.className?" ":"")+H}})},remove:function(E,F){if(E.nodeType==1){E.className=F!==g?o.grep(E.className.split(/\s+/),function(G){return !o.className.has(F,G)}).join(" "):""}},has:function(F,E){return F&&o.inArray(E,(F.className||F).toString().split(/\s+/))>-1}},swap:function(H,G,I){var E={};for(var F in G){E[F]=H.style[F];H.style[F]=G[F]}I.call(H);for(var F in G){H.style[F]=E[F]}},css:function(H,F,J,E){if(F=="width"||F=="height"){var L,G={position:"absolute",visibility:"hidden",display:"block"},K=F=="width"?["Left","Right"]:["Top","Bottom"];function I(){L=F=="width"?H.offsetWidth:H.offsetHeight;if(E==="border"){return}o.each(K,function(){if(!E){L-=parseFloat(o.curCSS(H,"padding"+this,true))||0}if(E==="margin"){L+=parseFloat(o.curCSS(H,"margin"+this,true))||0}else{L-=parseFloat(o.curCSS(H,"border"+this+"Width",true))||0}})}if(H.offsetWidth!==0){I()}else{o.swap(H,G,I)}return Math.max(0,Math.round(L))}return o.curCSS(H,F,J)},curCSS:function(I,F,G){var L,E=I.style;if(F=="opacity"&&!o.support.opacity){L=o.attr(E,"opacity");return L==""?"1":L}if(F.match(/float/i)){F=w}if(!G&&E&&E[F]){L=E[F]}else{if(q.getComputedStyle){if(F.match(/float/i)){F="float"}F=F.replace(/([A-Z])/g,"-$1").toLowerCase();var M=q.getComputedStyle(I,null);if(M){L=M.getPropertyValue(F)}if(F=="opacity"&&L==""){L="1"}}else{if(I.currentStyle){var J=F.replace(/\-(\w)/g,function(N,O){return O.toUpperCase()});L=I.currentStyle[F]||I.currentStyle[J];if(!/^\d+(px)?$/i.test(L)&&/^\d/.test(L)){var H=E.left,K=I.runtimeStyle.left;I.runtimeStyle.left=I.currentStyle.left;E.left=L||0;L=E.pixelLeft+"px";E.left=H;I.runtimeStyle.left=K}}}}return L},clean:function(F,K,I){K=K||document;if(typeof K.createElement==="undefined"){K=K.ownerDocument||K[0]&&K[0].ownerDocument||document}if(!I&&F.length===1&&typeof F[0]==="string"){var H=/^<(\w+)\s*\/?>$/.exec(F[0]);if(H){return[K.createElement(H[1])]}}var G=[],E=[],L=K.createElement("div");o.each(F,function(P,S){if(typeof S==="number"){S+=""}if(!S){return}if(typeof S==="string"){S=S.replace(/(<(\w+)[^>]*?)\/>/g,function(U,V,T){return T.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i)?U:V+"></"+T+">"});var O=S.replace(/^\s+/,"").substring(0,10).toLowerCase();var Q=!O.indexOf("<opt")&&[1,"<select multiple='multiple'>","</select>"]||!O.indexOf("<leg")&&[1,"<fieldset>","</fieldset>"]||O.match(/^<(thead|tbody|tfoot|colg|cap)/)&&[1,"<table>","</table>"]||!O.indexOf("<tr")&&[2,"<table><tbody>","</tbody></table>"]||(!O.indexOf("<td")||!O.indexOf("<th"))&&[3,"<table><tbody><tr>","</tr></tbody></table>"]||!O.indexOf("<col")&&[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"]||!o.support.htmlSerialize&&[1,"div<div>","</div>"]||[0,"",""];L.innerHTML=Q[1]+S+Q[2];while(Q[0]--){L=L.lastChild}if(!o.support.tbody){var R=/<tbody/i.test(S),N=!O.indexOf("<table")&&!R?L.firstChild&&L.firstChild.childNodes:Q[1]=="<table>"&&!R?L.childNodes:[];for(var M=N.length-1;M>=0;--M){if(o.nodeName(N[M],"tbody")&&!N[M].childNodes.length){N[M].parentNode.removeChild(N[M])}}}if(!o.support.leadingWhitespace&&/^\s/.test(S)){L.insertBefore(K.createTextNode(S.match(/^\s*/)[0]),L.firstChild)}S=o.makeArray(L.childNodes)}if(S.nodeType){G.push(S)}else{G=o.merge(G,S)}});if(I){for(var J=0;G[J];J++){if(o.nodeName(G[J],"script")&&(!G[J].type||G[J].type.toLowerCase()==="text/javascript")){E.push(G[J].parentNode?G[J].parentNode.removeChild(G[J]):G[J])}else{if(G[J].nodeType===1){G.splice.apply(G,[J+1,0].concat(o.makeArray(G[J].getElementsByTagName("script"))))}I.appendChild(G[J])}}return E}return G},attr:function(J,G,K){if(!J||J.nodeType==3||J.nodeType==8){return g}var H=!o.isXMLDoc(J),L=K!==g;G=H&&o.props[G]||G;if(J.tagName){var F=/href|src|style/.test(G);if(G=="selected"&&J.parentNode){J.parentNode.selectedIndex}if(G in J&&H&&!F){if(L){if(G=="type"&&o.nodeName(J,"input")&&J.parentNode){throw"type property can't be changed"}J[G]=K}if(o.nodeName(J,"form")&&J.getAttributeNode(G)){return J.getAttributeNode(G).nodeValue}if(G=="tabIndex"){var I=J.getAttributeNode("tabIndex");return I&&I.specified?I.value:J.nodeName.match(/(button|input|object|select|textarea)/i)?0:J.nodeName.match(/^(a|area)$/i)&&J.href?0:g}return J[G]}if(!o.support.style&&H&&G=="style"){return o.attr(J.style,"cssText",K)}if(L){J.setAttribute(G,""+K)}var E=!o.support.hrefNormalized&&H&&F?J.getAttribute(G,2):J.getAttribute(G);return E===null?g:E}if(!o.support.opacity&&G=="opacity"){if(L){J.zoom=1;J.filter=(J.filter||"").replace(/alpha\([^)]*\)/,"")+(parseInt(K)+""=="NaN"?"":"alpha(opacity="+K*100+")")}return J.filter&&J.filter.indexOf("opacity=")>=0?(parseFloat(J.filter.match(/opacity=([^)]*)/)[1])/100)+"":""}G=G.replace(/-([a-z])/ig,function(M,N){return N.toUpperCase()});if(L){J[G]=K}return J[G]},trim:function(E){return(E||"").replace(/^\s+|\s+$/g,"")},makeArray:function(G){var E=[];if(G!=null){var F=G.length;if(F==null||typeof G==="string"||o.isFunction(G)||G.setInterval){E[0]=G}else{while(F){E[--F]=G[F]}}}return E},inArray:function(G,H){for(var E=0,F=H.length;E<F;E++){if(H[E]===G){return E}}return -1},merge:function(H,E){var F=0,G,I=H.length;if(!o.support.getAll){while((G=E[F++])!=null){if(G.nodeType!=8){H[I++]=G}}}else{while((G=E[F++])!=null){H[I++]=G}}return H},unique:function(K){var F=[],E={};try{for(var G=0,H=K.length;G<H;G++){var J=o.data(K[G]);if(!E[J]){E[J]=true;F.push(K[G])}}}catch(I){F=K}return F},grep:function(F,J,E){var G=[];for(var H=0,I=F.length;H<I;H++){if(!E!=!J(F[H],H)){G.push(F[H])}}return G},map:function(E,J){var F=[];for(var G=0,H=E.length;G<H;G++){var I=J(E[G],G);if(I!=null){F[F.length]=I}}return F.concat.apply([],F)}});var C=navigator.userAgent.toLowerCase();o.browser={version:(C.match(/.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/)||[0,"0"])[1],safari:/webkit/.test(C),opera:/opera/.test(C),msie:/msie/.test(C)&&!/opera/.test(C),mozilla:/mozilla/.test(C)&&!/(compatible|webkit)/.test(C)};o.each({parent:function(E){return E.parentNode},parents:function(E){return o.dir(E,"parentNode")},next:function(E){return o.nth(E,2,"nextSibling")},prev:function(E){return o.nth(E,2,"previousSibling")},nextAll:function(E){return o.dir(E,"nextSibling")},prevAll:function(E){return o.dir(E,"previousSibling")},siblings:function(E){return o.sibling(E.parentNode.firstChild,E)},children:function(E){return o.sibling(E.firstChild)},contents:function(E){return o.nodeName(E,"iframe")?E.contentDocument||E.contentWindow.document:o.makeArray(E.childNodes)}},function(E,F){o.fn[E]=function(G){var H=o.map(this,F);if(G&&typeof G=="string"){H=o.multiFilter(G,H)}return this.pushStack(o.unique(H),E,G)}});o.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(E,F){o.fn[E]=function(G){var J=[],L=o(G);for(var K=0,H=L.length;K<H;K++){var I=(K>0?this.clone(true):this).get();o.fn[F].apply(o(L[K]),I);J=J.concat(I)}return this.pushStack(J,E,G)}});o.each({removeAttr:function(E){o.attr(this,E,"");if(this.nodeType==1){this.removeAttribute(E)}},addClass:function(E){o.className.add(this,E)},removeClass:function(E){o.className.remove(this,E)},toggleClass:function(F,E){if(typeof E!=="boolean"){E=!o.className.has(this,F)}o.className[E?"add":"remove"](this,F)},remove:function(E){if(!E||o.filter(E,[this]).length){o("*",this).add([this]).each(function(){o.event.remove(this);o.removeData(this)});if(this.parentNode){this.parentNode.removeChild(this)}}},empty:function(){o(this).children().remove();while(this.firstChild){this.removeChild(this.firstChild)}}},function(E,F){o.fn[E]=function(){return this.each(F,arguments)}});function j(E,F){return E[0]&&parseInt(o.curCSS(E[0],F,true),10)||0}var h="jQuery"+e(),v=0,A={};o.extend({cache:{},data:function(F,E,G){F=F==l?A:F;var H=F[h];if(!H){H=F[h]=++v}if(E&&!o.cache[H]){o.cache[H]={}}if(G!==g){o.cache[H][E]=G}return E?o.cache[H][E]:H},removeData:function(F,E){F=F==l?A:F;var H=F[h];if(E){if(o.cache[H]){delete o.cache[H][E];E="";for(E in o.cache[H]){break}if(!E){o.removeData(F)}}}else{try{delete F[h]}catch(G){if(F.removeAttribute){F.removeAttribute(h)}}delete o.cache[H]}},queue:function(F,E,H){if(F){E=(E||"fx")+"queue";var G=o.data(F,E);if(!G||o.isArray(H)){G=o.data(F,E,o.makeArray(H))}else{if(H){G.push(H)}}}return G},dequeue:function(H,G){var E=o.queue(H,G),F=E.shift();if(!G||G==="fx"){F=E[0]}if(F!==g){F.call(H)}}});o.fn.extend({data:function(E,G){var H=E.split(".");H[1]=H[1]?"."+H[1]:"";if(G===g){var F=this.triggerHandler("getData"+H[1]+"!",[H[0]]);if(F===g&&this.length){F=o.data(this[0],E)}return F===g&&H[1]?this.data(H[0]):F}else{return this.trigger("setData"+H[1]+"!",[H[0],G]).each(function(){o.data(this,E,G)})}},removeData:function(E){return this.each(function(){o.removeData(this,E)})},queue:function(E,F){if(typeof E!=="string"){F=E;E="fx"}if(F===g){return o.queue(this[0],E)}return this.each(function(){var G=o.queue(this,E,F);if(E=="fx"&&G.length==1){G[0].call(this)}})},dequeue:function(E){return this.each(function(){o.dequeue(this,E)})}});
+/*
+ * Sizzle CSS Selector Engine - v0.9.3
+ * Copyright 2009, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){var R=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,L=0,H=Object.prototype.toString;var F=function(Y,U,ab,ac){ab=ab||[];U=U||document;if(U.nodeType!==1&&U.nodeType!==9){return[]}if(!Y||typeof Y!=="string"){return ab}var Z=[],W,af,ai,T,ad,V,X=true;R.lastIndex=0;while((W=R.exec(Y))!==null){Z.push(W[1]);if(W[2]){V=RegExp.rightContext;break}}if(Z.length>1&&M.exec(Y)){if(Z.length===2&&I.relative[Z[0]]){af=J(Z[0]+Z[1],U)}else{af=I.relative[Z[0]]?[U]:F(Z.shift(),U);while(Z.length){Y=Z.shift();if(I.relative[Y]){Y+=Z.shift()}af=J(Y,af)}}}else{var ae=ac?{expr:Z.pop(),set:E(ac)}:F.find(Z.pop(),Z.length===1&&U.parentNode?U.parentNode:U,Q(U));af=F.filter(ae.expr,ae.set);if(Z.length>0){ai=E(af)}else{X=false}while(Z.length){var ah=Z.pop(),ag=ah;if(!I.relative[ah]){ah=""}else{ag=Z.pop()}if(ag==null){ag=U}I.relative[ah](ai,ag,Q(U))}}if(!ai){ai=af}if(!ai){throw"Syntax error, unrecognized expression: "+(ah||Y)}if(H.call(ai)==="[object Array]"){if(!X){ab.push.apply(ab,ai)}else{if(U.nodeType===1){for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&(ai[aa]===true||ai[aa].nodeType===1&&K(U,ai[aa]))){ab.push(af[aa])}}}else{for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&ai[aa].nodeType===1){ab.push(af[aa])}}}}}else{E(ai,ab)}if(V){F(V,U,ab,ac);if(G){hasDuplicate=false;ab.sort(G);if(hasDuplicate){for(var aa=1;aa<ab.length;aa++){if(ab[aa]===ab[aa-1]){ab.splice(aa--,1)}}}}}return ab};F.matches=function(T,U){return F(T,null,null,U)};F.find=function(aa,T,ab){var Z,X;if(!aa){return[]}for(var W=0,V=I.order.length;W<V;W++){var Y=I.order[W],X;if((X=I.match[Y].exec(aa))){var U=RegExp.leftContext;if(U.substr(U.length-1)!=="\\"){X[1]=(X[1]||"").replace(/\\/g,"");Z=I.find[Y](X,T,ab);if(Z!=null){aa=aa.replace(I.match[Y],"");break}}}}if(!Z){Z=T.getElementsByTagName("*")}return{set:Z,expr:aa}};F.filter=function(ad,ac,ag,W){var V=ad,ai=[],aa=ac,Y,T,Z=ac&&ac[0]&&Q(ac[0]);while(ad&&ac.length){for(var ab in I.filter){if((Y=I.match[ab].exec(ad))!=null){var U=I.filter[ab],ah,af;T=false;if(aa==ai){ai=[]}if(I.preFilter[ab]){Y=I.preFilter[ab](Y,aa,ag,ai,W,Z);if(!Y){T=ah=true}else{if(Y===true){continue}}}if(Y){for(var X=0;(af=aa[X])!=null;X++){if(af){ah=U(af,Y,X,aa);var ae=W^!!ah;if(ag&&ah!=null){if(ae){T=true}else{aa[X]=false}}else{if(ae){ai.push(af);T=true}}}}}if(ah!==g){if(!ag){aa=ai}ad=ad.replace(I.match[ab],"");if(!T){return[]}break}}}if(ad==V){if(T==null){throw"Syntax error, unrecognized expression: "+ad}else{break}}V=ad}return aa};var I=F.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(T){return T.getAttribute("href")}},relative:{"+":function(aa,T,Z){var X=typeof T==="string",ab=X&&!/\W/.test(T),Y=X&&!ab;if(ab&&!Z){T=T.toUpperCase()}for(var W=0,V=aa.length,U;W<V;W++){if((U=aa[W])){while((U=U.previousSibling)&&U.nodeType!==1){}aa[W]=Y||U&&U.nodeName===T?U||false:U===T}}if(Y){F.filter(T,aa,true)}},">":function(Z,U,aa){var X=typeof U==="string";if(X&&!/\W/.test(U)){U=aa?U:U.toUpperCase();for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){var W=Y.parentNode;Z[V]=W.nodeName===U?W:false}}}else{for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){Z[V]=X?Y.parentNode:Y.parentNode===U}}if(X){F.filter(U,Z,true)}}},"":function(W,U,Y){var V=L++,T=S;if(!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("parentNode",U,V,W,X,Y)},"~":function(W,U,Y){var V=L++,T=S;if(typeof U==="string"&&!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("previousSibling",U,V,W,X,Y)}},find:{ID:function(U,V,W){if(typeof V.getElementById!=="undefined"&&!W){var T=V.getElementById(U[1]);return T?[T]:[]}},NAME:function(V,Y,Z){if(typeof Y.getElementsByName!=="undefined"){var U=[],X=Y.getElementsByName(V[1]);for(var W=0,T=X.length;W<T;W++){if(X[W].getAttribute("name")===V[1]){U.push(X[W])}}return U.length===0?null:U}},TAG:function(T,U){return U.getElementsByTagName(T[1])}},preFilter:{CLASS:function(W,U,V,T,Z,aa){W=" "+W[1].replace(/\\/g,"")+" ";if(aa){return W}for(var X=0,Y;(Y=U[X])!=null;X++){if(Y){if(Z^(Y.className&&(" "+Y.className+" ").indexOf(W)>=0)){if(!V){T.push(Y)}}else{if(V){U[X]=false}}}}return false},ID:function(T){return T[1].replace(/\\/g,"")},TAG:function(U,T){for(var V=0;T[V]===false;V++){}return T[V]&&Q(T[V])?U[1]:U[1].toUpperCase()},CHILD:function(T){if(T[1]=="nth"){var U=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(T[2]=="even"&&"2n"||T[2]=="odd"&&"2n+1"||!/\D/.test(T[2])&&"0n+"+T[2]||T[2]);T[2]=(U[1]+(U[2]||1))-0;T[3]=U[3]-0}T[0]=L++;return T},ATTR:function(X,U,V,T,Y,Z){var W=X[1].replace(/\\/g,"");if(!Z&&I.attrMap[W]){X[1]=I.attrMap[W]}if(X[2]==="~="){X[4]=" "+X[4]+" "}return X},PSEUDO:function(X,U,V,T,Y){if(X[1]==="not"){if(X[3].match(R).length>1||/^\w/.test(X[3])){X[3]=F(X[3],null,null,U)}else{var W=F.filter(X[3],U,V,true^Y);if(!V){T.push.apply(T,W)}return false}}else{if(I.match.POS.test(X[0])||I.match.CHILD.test(X[0])){return true}}return X},POS:function(T){T.unshift(true);return T}},filters:{enabled:function(T){return T.disabled===false&&T.type!=="hidden"},disabled:function(T){return T.disabled===true},checked:function(T){return T.checked===true},selected:function(T){T.parentNode.selectedIndex;return T.selected===true},parent:function(T){return !!T.firstChild},empty:function(T){return !T.firstChild},has:function(V,U,T){return !!F(T[3],V).length},header:function(T){return/h\d/i.test(T.nodeName)},text:function(T){return"text"===T.type},radio:function(T){return"radio"===T.type},checkbox:function(T){return"checkbox"===T.type},file:function(T){return"file"===T.type},password:function(T){return"password"===T.type},submit:function(T){return"submit"===T.type},image:function(T){return"image"===T.type},reset:function(T){return"reset"===T.type},button:function(T){return"button"===T.type||T.nodeName.toUpperCase()==="BUTTON"},input:function(T){return/input|select|textarea|button/i.test(T.nodeName)}},setFilters:{first:function(U,T){return T===0},last:function(V,U,T,W){return U===W.length-1},even:function(U,T){return T%2===0},odd:function(U,T){return T%2===1},lt:function(V,U,T){return U<T[3]-0},gt:function(V,U,T){return U>T[3]-0},nth:function(V,U,T){return T[3]-0==U},eq:function(V,U,T){return T[3]-0==U}},filter:{PSEUDO:function(Z,V,W,aa){var U=V[1],X=I.filters[U];if(X){return X(Z,W,V,aa)}else{if(U==="contains"){return(Z.textContent||Z.innerText||"").indexOf(V[3])>=0}else{if(U==="not"){var Y=V[3];for(var W=0,T=Y.length;W<T;W++){if(Y[W]===Z){return false}}return true}}}},CHILD:function(T,W){var Z=W[1],U=T;switch(Z){case"only":case"first":while(U=U.previousSibling){if(U.nodeType===1){return false}}if(Z=="first"){return true}U=T;case"last":while(U=U.nextSibling){if(U.nodeType===1){return false}}return true;case"nth":var V=W[2],ac=W[3];if(V==1&&ac==0){return true}var Y=W[0],ab=T.parentNode;if(ab&&(ab.sizcache!==Y||!T.nodeIndex)){var X=0;for(U=ab.firstChild;U;U=U.nextSibling){if(U.nodeType===1){U.nodeIndex=++X}}ab.sizcache=Y}var aa=T.nodeIndex-ac;if(V==0){return aa==0}else{return(aa%V==0&&aa/V>=0)}}},ID:function(U,T){return U.nodeType===1&&U.getAttribute("id")===T},TAG:function(U,T){return(T==="*"&&U.nodeType===1)||U.nodeName===T},CLASS:function(U,T){return(" "+(U.className||U.getAttribute("class"))+" ").indexOf(T)>-1},ATTR:function(Y,W){var V=W[1],T=I.attrHandle[V]?I.attrHandle[V](Y):Y[V]!=null?Y[V]:Y.getAttribute(V),Z=T+"",X=W[2],U=W[4];return T==null?X==="!=":X==="="?Z===U:X==="*="?Z.indexOf(U)>=0:X==="~="?(" "+Z+" ").indexOf(U)>=0:!U?Z&&T!==false:X==="!="?Z!=U:X==="^="?Z.indexOf(U)===0:X==="$="?Z.substr(Z.length-U.length)===U:X==="|="?Z===U||Z.substr(0,U.length+1)===U+"-":false},POS:function(X,U,V,Y){var T=U[2],W=I.setFilters[T];if(W){return W(X,V,U,Y)}}}};var M=I.match.POS;for(var O in I.match){I.match[O]=RegExp(I.match[O].source+/(?![^\[]*\])(?![^\(]*\))/.source)}var E=function(U,T){U=Array.prototype.slice.call(U);if(T){T.push.apply(T,U);return T}return U};try{Array.prototype.slice.call(document.documentElement.childNodes)}catch(N){E=function(X,W){var U=W||[];if(H.call(X)==="[object Array]"){Array.prototype.push.apply(U,X)}else{if(typeof X.length==="number"){for(var V=0,T=X.length;V<T;V++){U.push(X[V])}}else{for(var V=0;X[V];V++){U.push(X[V])}}}return U}}var G;if(document.documentElement.compareDocumentPosition){G=function(U,T){var V=U.compareDocumentPosition(T)&4?-1:U===T?0:1;if(V===0){hasDuplicate=true}return V}}else{if("sourceIndex" in document.documentElement){G=function(U,T){var V=U.sourceIndex-T.sourceIndex;if(V===0){hasDuplicate=true}return V}}else{if(document.createRange){G=function(W,U){var V=W.ownerDocument.createRange(),T=U.ownerDocument.createRange();V.selectNode(W);V.collapse(true);T.selectNode(U);T.collapse(true);var X=V.compareBoundaryPoints(Range.START_TO_END,T);if(X===0){hasDuplicate=true}return X}}}}(function(){var U=document.createElement("form"),V="script"+(new Date).getTime();U.innerHTML="<input name='"+V+"'/>";var T=document.documentElement;T.insertBefore(U,T.firstChild);if(!!document.getElementById(V)){I.find.ID=function(X,Y,Z){if(typeof Y.getElementById!=="undefined"&&!Z){var W=Y.getElementById(X[1]);return W?W.id===X[1]||typeof W.getAttributeNode!=="undefined"&&W.getAttributeNode("id").nodeValue===X[1]?[W]:g:[]}};I.filter.ID=function(Y,W){var X=typeof Y.getAttributeNode!=="undefined"&&Y.getAttributeNode("id");return Y.nodeType===1&&X&&X.nodeValue===W}}T.removeChild(U)})();(function(){var T=document.createElement("div");T.appendChild(document.createComment(""));if(T.getElementsByTagName("*").length>0){I.find.TAG=function(U,Y){var X=Y.getElementsByTagName(U[1]);if(U[1]==="*"){var W=[];for(var V=0;X[V];V++){if(X[V].nodeType===1){W.push(X[V])}}X=W}return X}}T.innerHTML="<a href='#'></a>";if(T.firstChild&&typeof T.firstChild.getAttribute!=="undefined"&&T.firstChild.getAttribute("href")!=="#"){I.attrHandle.href=function(U){return U.getAttribute("href",2)}}})();if(document.querySelectorAll){(function(){var T=F,U=document.createElement("div");U.innerHTML="<p class='TEST'></p>";if(U.querySelectorAll&&U.querySelectorAll(".TEST").length===0){return}F=function(Y,X,V,W){X=X||document;if(!W&&X.nodeType===9&&!Q(X)){try{return E(X.querySelectorAll(Y),V)}catch(Z){}}return T(Y,X,V,W)};F.find=T.find;F.filter=T.filter;F.selectors=T.selectors;F.matches=T.matches})()}if(document.getElementsByClassName&&document.documentElement.getElementsByClassName){(function(){var T=document.createElement("div");T.innerHTML="<div class='test e'></div><div class='test'></div>";if(T.getElementsByClassName("e").length===0){return}T.lastChild.className="e";if(T.getElementsByClassName("e").length===1){return}I.order.splice(1,0,"CLASS");I.find.CLASS=function(U,V,W){if(typeof V.getElementsByClassName!=="undefined"&&!W){return V.getElementsByClassName(U[1])}}})()}function P(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1&&!ac){T.sizcache=Y;T.sizset=W}if(T.nodeName===Z){X=T;break}T=T[U]}ad[W]=X}}}function S(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1){if(!ac){T.sizcache=Y;T.sizset=W}if(typeof Z!=="string"){if(T===Z){X=true;break}}else{if(F.filter(Z,[T]).length>0){X=T;break}}}T=T[U]}ad[W]=X}}}var K=document.compareDocumentPosition?function(U,T){return U.compareDocumentPosition(T)&16}:function(U,T){return U!==T&&(U.contains?U.contains(T):true)};var Q=function(T){return T.nodeType===9&&T.documentElement.nodeName!=="HTML"||!!T.ownerDocument&&Q(T.ownerDocument)};var J=function(T,aa){var W=[],X="",Y,V=aa.nodeType?[aa]:aa;while((Y=I.match.PSEUDO.exec(T))){X+=Y[0];T=T.replace(I.match.PSEUDO,"")}T=I.relative[T]?T+"*":T;for(var Z=0,U=V.length;Z<U;Z++){F(T,V[Z],W)}return F.filter(X,W)};o.find=F;o.filter=F.filter;o.expr=F.selectors;o.expr[":"]=o.expr.filters;F.selectors.filters.hidden=function(T){return T.offsetWidth===0||T.offsetHeight===0};F.selectors.filters.visible=function(T){return T.offsetWidth>0||T.offsetHeight>0};F.selectors.filters.animated=function(T){return o.grep(o.timers,function(U){return T===U.elem}).length};o.multiFilter=function(V,T,U){if(U){V=":not("+V+")"}return F.matches(V,T)};o.dir=function(V,U){var T=[],W=V[U];while(W&&W!=document){if(W.nodeType==1){T.push(W)}W=W[U]}return T};o.nth=function(X,T,V,W){T=T||1;var U=0;for(;X;X=X[V]){if(X.nodeType==1&&++U==T){break}}return X};o.sibling=function(V,U){var T=[];for(;V;V=V.nextSibling){if(V.nodeType==1&&V!=U){T.push(V)}}return T};return;l.Sizzle=F})();o.event={add:function(I,F,H,K){if(I.nodeType==3||I.nodeType==8){return}if(I.setInterval&&I!=l){I=l}if(!H.guid){H.guid=this.guid++}if(K!==g){var G=H;H=this.proxy(G);H.data=K}var E=o.data(I,"events")||o.data(I,"events",{}),J=o.data(I,"handle")||o.data(I,"handle",function(){return typeof o!=="undefined"&&!o.event.triggered?o.event.handle.apply(arguments.callee.elem,arguments):g});J.elem=I;o.each(F.split(/\s+/),function(M,N){var O=N.split(".");N=O.shift();H.type=O.slice().sort().join(".");var L=E[N];if(o.event.specialAll[N]){o.event.specialAll[N].setup.call(I,K,O)}if(!L){L=E[N]={};if(!o.event.special[N]||o.event.special[N].setup.call(I,K,O)===false){if(I.addEventListener){I.addEventListener(N,J,false)}else{if(I.attachEvent){I.attachEvent("on"+N,J)}}}}L[H.guid]=H;o.event.global[N]=true});I=null},guid:1,global:{},remove:function(K,H,J){if(K.nodeType==3||K.nodeType==8){return}var G=o.data(K,"events"),F,E;if(G){if(H===g||(typeof H==="string"&&H.charAt(0)==".")){for(var I in G){this.remove(K,I+(H||""))}}else{if(H.type){J=H.handler;H=H.type}o.each(H.split(/\s+/),function(M,O){var Q=O.split(".");O=Q.shift();var N=RegExp("(^|\\.)"+Q.slice().sort().join(".*\\.")+"(\\.|$)");if(G[O]){if(J){delete G[O][J.guid]}else{for(var P in G[O]){if(N.test(G[O][P].type)){delete G[O][P]}}}if(o.event.specialAll[O]){o.event.specialAll[O].teardown.call(K,Q)}for(F in G[O]){break}if(!F){if(!o.event.special[O]||o.event.special[O].teardown.call(K,Q)===false){if(K.removeEventListener){K.removeEventListener(O,o.data(K,"handle"),false)}else{if(K.detachEvent){K.detachEvent("on"+O,o.data(K,"handle"))}}}F=null;delete G[O]}}})}for(F in G){break}if(!F){var L=o.data(K,"handle");if(L){L.elem=null}o.removeData(K,"events");o.removeData(K,"handle")}}},trigger:function(I,K,H,E){var G=I.type||I;if(!E){I=typeof I==="object"?I[h]?I:o.extend(o.Event(G),I):o.Event(G);if(G.indexOf("!")>=0){I.type=G=G.slice(0,-1);I.exclusive=true}if(!H){I.stopPropagation();if(this.global[G]){o.each(o.cache,function(){if(this.events&&this.events[G]){o.event.trigger(I,K,this.handle.elem)}})}}if(!H||H.nodeType==3||H.nodeType==8){return g}I.result=g;I.target=H;K=o.makeArray(K);K.unshift(I)}I.currentTarget=H;var J=o.data(H,"handle");if(J){J.apply(H,K)}if((!H[G]||(o.nodeName(H,"a")&&G=="click"))&&H["on"+G]&&H["on"+G].apply(H,K)===false){I.result=false}if(!E&&H[G]&&!I.isDefaultPrevented()&&!(o.nodeName(H,"a")&&G=="click")){this.triggered=true;try{H[G]()}catch(L){}}this.triggered=false;if(!I.isPropagationStopped()){var F=H.parentNode||H.ownerDocument;if(F){o.event.trigger(I,K,F,true)}}},handle:function(K){var J,E;K=arguments[0]=o.event.fix(K||l.event);K.currentTarget=this;var L=K.type.split(".");K.type=L.shift();J=!L.length&&!K.exclusive;var I=RegExp("(^|\\.)"+L.slice().sort().join(".*\\.")+"(\\.|$)");E=(o.data(this,"events")||{})[K.type];for(var G in E){var H=E[G];if(J||I.test(H.type)){K.handler=H;K.data=H.data;var F=H.apply(this,arguments);if(F!==g){K.result=F;if(F===false){K.preventDefault();K.stopPropagation()}}if(K.isImmediatePropagationStopped()){break}}}},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(H){if(H[h]){return H}var F=H;H=o.Event(F);for(var G=this.props.length,J;G;){J=this.props[--G];H[J]=F[J]}if(!H.target){H.target=H.srcElement||document}if(H.target.nodeType==3){H.target=H.target.parentNode}if(!H.relatedTarget&&H.fromElement){H.relatedTarget=H.fromElement==H.target?H.toElement:H.fromElement}if(H.pageX==null&&H.clientX!=null){var I=document.documentElement,E=document.body;H.pageX=H.clientX+(I&&I.scrollLeft||E&&E.scrollLeft||0)-(I.clientLeft||0);H.pageY=H.clientY+(I&&I.scrollTop||E&&E.scrollTop||0)-(I.clientTop||0)}if(!H.which&&((H.charCode||H.charCode===0)?H.charCode:H.keyCode)){H.which=H.charCode||H.keyCode}if(!H.metaKey&&H.ctrlKey){H.metaKey=H.ctrlKey}if(!H.which&&H.button){H.which=(H.button&1?1:(H.button&2?3:(H.button&4?2:0)))}return H},proxy:function(F,E){E=E||function(){return F.apply(this,arguments)};E.guid=F.guid=F.guid||E.guid||this.guid++;return E},special:{ready:{setup:B,teardown:function(){}}},specialAll:{live:{setup:function(E,F){o.event.add(this,F[0],c)},teardown:function(G){if(G.length){var E=0,F=RegExp("(^|\\.)"+G[0]+"(\\.|$)");o.each((o.data(this,"events").live||{}),function(){if(F.test(this.type)){E++}});if(E<1){o.event.remove(this,G[0],c)}}}}}};o.Event=function(E){if(!this.preventDefault){return new o.Event(E)}if(E&&E.type){this.originalEvent=E;this.type=E.type}else{this.type=E}this.timeStamp=e();this[h]=true};function k(){return false}function u(){return true}o.Event.prototype={preventDefault:function(){this.isDefaultPrevented=u;var E=this.originalEvent;if(!E){return}if(E.preventDefault){E.preventDefault()}E.returnValue=false},stopPropagation:function(){this.isPropagationStopped=u;var E=this.originalEvent;if(!E){return}if(E.stopPropagation){E.stopPropagation()}E.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=u;this.stopPropagation()},isDefaultPrevented:k,isPropagationStopped:k,isImmediatePropagationStopped:k};var a=function(F){var E=F.relatedTarget;while(E&&E!=this){try{E=E.parentNode}catch(G){E=this}}if(E!=this){F.type=F.data;o.event.handle.apply(this,arguments)}};o.each({mouseover:"mouseenter",mouseout:"mouseleave"},function(F,E){o.event.special[E]={setup:function(){o.event.add(this,F,a,E)},teardown:function(){o.event.remove(this,F,a)}}});o.fn.extend({bind:function(F,G,E){return F=="unload"?this.one(F,G,E):this.each(function(){o.event.add(this,F,E||G,E&&G)})},one:function(G,H,F){var E=o.event.proxy(F||H,function(I){o(this).unbind(I,E);return(F||H).apply(this,arguments)});return this.each(function(){o.event.add(this,G,E,F&&H)})},unbind:function(F,E){return this.each(function(){o.event.remove(this,F,E)})},trigger:function(E,F){return this.each(function(){o.event.trigger(E,F,this)})},triggerHandler:function(E,G){if(this[0]){var F=o.Event(E);F.preventDefault();F.stopPropagation();o.event.trigger(F,G,this[0]);return F.result}},toggle:function(G){var E=arguments,F=1;while(F<E.length){o.event.proxy(G,E[F++])}return this.click(o.event.proxy(G,function(H){this.lastToggle=(this.lastToggle||0)%F;H.preventDefault();return E[this.lastToggle++].apply(this,arguments)||false}))},hover:function(E,F){return this.mouseenter(E).mouseleave(F)},ready:function(E){B();if(o.isReady){E.call(document,o)}else{o.readyList.push(E)}return this},live:function(G,F){var E=o.event.proxy(F);E.guid+=this.selector+G;o(document).bind(i(G,this.selector),this.selector,E);return this},die:function(F,E){o(document).unbind(i(F,this.selector),E?{guid:E.guid+this.selector+F}:null);return this}});function c(H){var E=RegExp("(^|\\.)"+H.type+"(\\.|$)"),G=true,F=[];o.each(o.data(this,"events").live||[],function(I,J){if(E.test(J.type)){var K=o(H.target).closest(J.data)[0];if(K){F.push({elem:K,fn:J})}}});F.sort(function(J,I){return o.data(J.elem,"closest")-o.data(I.elem,"closest")});o.each(F,function(){if(this.fn.call(this.elem,H,this.fn.data)===false){return(G=false)}});return G}function i(F,E){return["live",F,E.replace(/\./g,"`").replace(/ /g,"|")].join(".")}o.extend({isReady:false,readyList:[],ready:function(){if(!o.isReady){o.isReady=true;if(o.readyList){o.each(o.readyList,function(){this.call(document,o)});o.readyList=null}o(document).triggerHandler("ready")}}});var x=false;function B(){if(x){return}x=true;if(document.addEventListener){document.addEventListener("DOMContentLoaded",function(){document.removeEventListener("DOMContentLoaded",arguments.callee,false);o.ready()},false)}else{if(document.attachEvent){document.attachEvent("onreadystatechange",function(){if(document.readyState==="complete"){document.detachEvent("onreadystatechange",arguments.callee);o.ready()}});if(document.documentElement.doScroll&&l==l.top){(function(){if(o.isReady){return}try{document.documentElement.doScroll("left")}catch(E){setTimeout(arguments.callee,0);return}o.ready()})()}}}o.event.add(l,"load",o.ready)}o.each(("blur,focus,load,resize,scroll,unload,click,dblclick,mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave,change,select,submit,keydown,keypress,keyup,error").split(","),function(F,E){o.fn[E]=function(G){return G?this.bind(E,G):this.trigger(E)}});o(l).bind("unload",function(){for(var E in o.cache){if(E!=1&&o.cache[E].handle){o.event.remove(o.cache[E].handle.elem)}}});(function(){o.support={};var F=document.documentElement,G=document.createElement("script"),K=document.createElement("div"),J="script"+(new Date).getTime();K.style.display="none";K.innerHTML=' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>';var H=K.getElementsByTagName("*"),E=K.getElementsByTagName("a")[0];if(!H||!H.length||!E){return}o.support={leadingWhitespace:K.firstChild.nodeType==3,tbody:!K.getElementsByTagName("tbody").length,objectAll:!!K.getElementsByTagName("object")[0].getElementsByTagName("*").length,htmlSerialize:!!K.getElementsByTagName("link").length,style:/red/.test(E.getAttribute("style")),hrefNormalized:E.getAttribute("href")==="/a",opacity:E.style.opacity==="0.5",cssFloat:!!E.style.cssFloat,scriptEval:false,noCloneEvent:true,boxModel:null};G.type="text/javascript";try{G.appendChild(document.createTextNode("window."+J+"=1;"))}catch(I){}F.insertBefore(G,F.firstChild);if(l[J]){o.support.scriptEval=true;delete l[J]}F.removeChild(G);if(K.attachEvent&&K.fireEvent){K.attachEvent("onclick",function(){o.support.noCloneEvent=false;K.detachEvent("onclick",arguments.callee)});K.cloneNode(true).fireEvent("onclick")}o(function(){var L=document.createElement("div");L.style.width=L.style.paddingLeft="1px";document.body.appendChild(L);o.boxModel=o.support.boxModel=L.offsetWidth===2;document.body.removeChild(L).style.display="none"})})();var w=o.support.cssFloat?"cssFloat":"styleFloat";o.props={"for":"htmlFor","class":"className","float":w,cssFloat:w,styleFloat:w,readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",tabindex:"tabIndex"};o.fn.extend({_load:o.fn.load,load:function(G,J,K){if(typeof G!=="string"){return this._load(G)}var I=G.indexOf(" ");if(I>=0){var E=G.slice(I,G.length);G=G.slice(0,I)}var H="GET";if(J){if(o.isFunction(J)){K=J;J=null}else{if(typeof J==="object"){J=o.param(J);H="POST"}}}var F=this;o.ajax({url:G,type:H,dataType:"html",data:J,complete:function(M,L){if(L=="success"||L=="notmodified"){F.html(E?o("<div/>").append(M.responseText.replace(/<script(.|\s)*?\/script>/g,"")).find(E):M.responseText)}if(K){F.each(K,[M.responseText,L,M])}}});return this},serialize:function(){return o.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?o.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||/select|textarea/i.test(this.nodeName)||/text|hidden|password|search/i.test(this.type))}).map(function(E,F){var G=o(this).val();return G==null?null:o.isArray(G)?o.map(G,function(I,H){return{name:F.name,value:I}}):{name:F.name,value:G}}).get()}});o.each("ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","),function(E,F){o.fn[F]=function(G){return this.bind(F,G)}});var r=e();o.extend({get:function(E,G,H,F){if(o.isFunction(G)){H=G;G=null}return o.ajax({type:"GET",url:E,data:G,success:H,dataType:F})},getScript:function(E,F){return o.get(E,null,F,"script")},getJSON:function(E,F,G){return o.get(E,F,G,"json")},post:function(E,G,H,F){if(o.isFunction(G)){H=G;G={}}return o.ajax({type:"POST",url:E,data:G,success:H,dataType:F})},ajaxSetup:function(E){o.extend(o.ajaxSettings,E)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return l.ActiveXObject?new ActiveXObject("Microsoft.XMLHTTP"):new XMLHttpRequest()},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},ajax:function(M){M=o.extend(true,M,o.extend(true,{},o.ajaxSettings,M));var W,F=/=\?(&|$)/g,R,V,G=M.type.toUpperCase();if(M.data&&M.processData&&typeof M.data!=="string"){M.data=o.param(M.data)}if(M.dataType=="jsonp"){if(G=="GET"){if(!M.url.match(F)){M.url+=(M.url.match(/\?/)?"&":"?")+(M.jsonp||"callback")+"=?"}}else{if(!M.data||!M.data.match(F)){M.data=(M.data?M.data+"&":"")+(M.jsonp||"callback")+"=?"}}M.dataType="json"}if(M.dataType=="json"&&(M.data&&M.data.match(F)||M.url.match(F))){W="jsonp"+r++;if(M.data){M.data=(M.data+"").replace(F,"="+W+"$1")}M.url=M.url.replace(F,"="+W+"$1");M.dataType="script";l[W]=function(X){V=X;I();L();l[W]=g;try{delete l[W]}catch(Y){}if(H){H.removeChild(T)}}}if(M.dataType=="script"&&M.cache==null){M.cache=false}if(M.cache===false&&G=="GET"){var E=e();var U=M.url.replace(/(\?|&)_=.*?(&|$)/,"$1_="+E+"$2");M.url=U+((U==M.url)?(M.url.match(/\?/)?"&":"?")+"_="+E:"")}if(M.data&&G=="GET"){M.url+=(M.url.match(/\?/)?"&":"?")+M.data;M.data=null}if(M.global&&!o.active++){o.event.trigger("ajaxStart")}var Q=/^(\w+:)?\/\/([^\/?#]+)/.exec(M.url);if(M.dataType=="script"&&G=="GET"&&Q&&(Q[1]&&Q[1]!=location.protocol||Q[2]!=location.host)){var H=document.getElementsByTagName("head")[0];var T=document.createElement("script");T.src=M.url;if(M.scriptCharset){T.charset=M.scriptCharset}if(!W){var O=false;T.onload=T.onreadystatechange=function(){if(!O&&(!this.readyState||this.readyState=="loaded"||this.readyState=="complete")){O=true;I();L();T.onload=T.onreadystatechange=null;H.removeChild(T)}}}H.appendChild(T);return g}var K=false;var J=M.xhr();if(M.username){J.open(G,M.url,M.async,M.username,M.password)}else{J.open(G,M.url,M.async)}try{if(M.data){J.setRequestHeader("Content-Type",M.contentType)}if(M.ifModified){J.setRequestHeader("If-Modified-Since",o.lastModified[M.url]||"Thu, 01 Jan 1970 00:00:00 GMT")}J.setRequestHeader("X-Requested-With","XMLHttpRequest");J.setRequestHeader("Accept",M.dataType&&M.accepts[M.dataType]?M.accepts[M.dataType]+", */*":M.accepts._default)}catch(S){}if(M.beforeSend&&M.beforeSend(J,M)===false){if(M.global&&!--o.active){o.event.trigger("ajaxStop")}J.abort();return false}if(M.global){o.event.trigger("ajaxSend",[J,M])}var N=function(X){if(J.readyState==0){if(P){clearInterval(P);P=null;if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}}else{if(!K&&J&&(J.readyState==4||X=="timeout")){K=true;if(P){clearInterval(P);P=null}R=X=="timeout"?"timeout":!o.httpSuccess(J)?"error":M.ifModified&&o.httpNotModified(J,M.url)?"notmodified":"success";if(R=="success"){try{V=o.httpData(J,M.dataType,M)}catch(Z){R="parsererror"}}if(R=="success"){var Y;try{Y=J.getResponseHeader("Last-Modified")}catch(Z){}if(M.ifModified&&Y){o.lastModified[M.url]=Y}if(!W){I()}}else{o.handleError(M,J,R)}L();if(X){J.abort()}if(M.async){J=null}}}};if(M.async){var P=setInterval(N,13);if(M.timeout>0){setTimeout(function(){if(J&&!K){N("timeout")}},M.timeout)}}try{J.send(M.data)}catch(S){o.handleError(M,J,null,S)}if(!M.async){N()}function I(){if(M.success){M.success(V,R)}if(M.global){o.event.trigger("ajaxSuccess",[J,M])}}function L(){if(M.complete){M.complete(J,R)}if(M.global){o.event.trigger("ajaxComplete",[J,M])}if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}return J},handleError:function(F,H,E,G){if(F.error){F.error(H,E,G)}if(F.global){o.event.trigger("ajaxError",[H,F,G])}},active:0,httpSuccess:function(F){try{return !F.status&&location.protocol=="file:"||(F.status>=200&&F.status<300)||F.status==304||F.status==1223}catch(E){}return false},httpNotModified:function(G,E){try{var H=G.getResponseHeader("Last-Modified");return G.status==304||H==o.lastModified[E]}catch(F){}return false},httpData:function(J,H,G){var F=J.getResponseHeader("content-type"),E=H=="xml"||!H&&F&&F.indexOf("xml")>=0,I=E?J.responseXML:J.responseText;if(E&&I.documentElement.tagName=="parsererror"){throw"parsererror"}if(G&&G.dataFilter){I=G.dataFilter(I,H)}if(typeof I==="string"){if(H=="script"){o.globalEval(I)}if(H=="json"){I=l["eval"]("("+I+")")}}return I},param:function(E){var G=[];function H(I,J){G[G.length]=encodeURIComponent(I)+"="+encodeURIComponent(J)}if(o.isArray(E)||E.jquery){o.each(E,function(){H(this.name,this.value)})}else{for(var F in E){if(o.isArray(E[F])){o.each(E[F],function(){H(F,this)})}else{H(F,o.isFunction(E[F])?E[F]():E[F])}}}return G.join("&").replace(/%20/g,"+")}});var m={},n,d=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];function t(F,E){var G={};o.each(d.concat.apply([],d.slice(0,E)),function(){G[this]=F});return G}o.fn.extend({show:function(J,L){if(J){return this.animate(t("show",3),J,L)}else{for(var H=0,F=this.length;H<F;H++){var E=o.data(this[H],"olddisplay");this[H].style.display=E||"";if(o.css(this[H],"display")==="none"){var G=this[H].tagName,K;if(m[G]){K=m[G]}else{var I=o("<"+G+" />").appendTo("body");K=I.css("display");if(K==="none"){K="block"}I.remove();m[G]=K}o.data(this[H],"olddisplay",K)}}for(var H=0,F=this.length;H<F;H++){this[H].style.display=o.data(this[H],"olddisplay")||""}return this}},hide:function(H,I){if(H){return this.animate(t("hide",3),H,I)}else{for(var G=0,F=this.length;G<F;G++){var E=o.data(this[G],"olddisplay");if(!E&&E!=="none"){o.data(this[G],"olddisplay",o.css(this[G],"display"))}}for(var G=0,F=this.length;G<F;G++){this[G].style.display="none"}return this}},_toggle:o.fn.toggle,toggle:function(G,F){var E=typeof G==="boolean";return o.isFunction(G)&&o.isFunction(F)?this._toggle.apply(this,arguments):G==null||E?this.each(function(){var H=E?G:o(this).is(":hidden");o(this)[H?"show":"hide"]()}):this.animate(t("toggle",3),G,F)},fadeTo:function(E,G,F){return this.animate({opacity:G},E,F)},animate:function(I,F,H,G){var E=o.speed(F,H,G);return this[E.queue===false?"each":"queue"](function(){var K=o.extend({},E),M,L=this.nodeType==1&&o(this).is(":hidden"),J=this;for(M in I){if(I[M]=="hide"&&L||I[M]=="show"&&!L){return K.complete.call(this)}if((M=="height"||M=="width")&&this.style){K.display=o.css(this,"display");K.overflow=this.style.overflow}}if(K.overflow!=null){this.style.overflow="hidden"}K.curAnim=o.extend({},I);o.each(I,function(O,S){var R=new o.fx(J,K,O);if(/toggle|show|hide/.test(S)){R[S=="toggle"?L?"show":"hide":S](I)}else{var Q=S.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),T=R.cur(true)||0;if(Q){var N=parseFloat(Q[2]),P=Q[3]||"px";if(P!="px"){J.style[O]=(N||1)+P;T=((N||1)/R.cur(true))*T;J.style[O]=T+P}if(Q[1]){N=((Q[1]=="-="?-1:1)*N)+T}R.custom(T,N,P)}else{R.custom(T,S,"")}}});return true})},stop:function(F,E){var G=o.timers;if(F){this.queue([])}this.each(function(){for(var H=G.length-1;H>=0;H--){if(G[H].elem==this){if(E){G[H](true)}G.splice(H,1)}}});if(!E){this.dequeue()}return this}});o.each({slideDown:t("show",1),slideUp:t("hide",1),slideToggle:t("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(E,F){o.fn[E]=function(G,H){return this.animate(F,G,H)}});o.extend({speed:function(G,H,F){var E=typeof G==="object"?G:{complete:F||!F&&H||o.isFunction(G)&&G,duration:G,easing:F&&H||H&&!o.isFunction(H)&&H};E.duration=o.fx.off?0:typeof E.duration==="number"?E.duration:o.fx.speeds[E.duration]||o.fx.speeds._default;E.old=E.complete;E.complete=function(){if(E.queue!==false){o(this).dequeue()}if(o.isFunction(E.old)){E.old.call(this)}};return E},easing:{linear:function(G,H,E,F){return E+F*G},swing:function(G,H,E,F){return((-Math.cos(G*Math.PI)/2)+0.5)*F+E}},timers:[],fx:function(F,E,G){this.options=E;this.elem=F;this.prop=G;if(!E.orig){E.orig={}}}});o.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(o.fx.step[this.prop]||o.fx.step._default)(this);if((this.prop=="height"||this.prop=="width")&&this.elem.style){this.elem.style.display="block"}},cur:function(F){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var E=parseFloat(o.css(this.elem,this.prop,F));return E&&E>-10000?E:parseFloat(o.curCSS(this.elem,this.prop))||0},custom:function(I,H,G){this.startTime=e();this.start=I;this.end=H;this.unit=G||this.unit||"px";this.now=this.start;this.pos=this.state=0;var E=this;function F(J){return E.step(J)}F.elem=this.elem;if(F()&&o.timers.push(F)&&!n){n=setInterval(function(){var K=o.timers;for(var J=0;J<K.length;J++){if(!K[J]()){K.splice(J--,1)}}if(!K.length){clearInterval(n);n=g}},13)}},show:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.show=true;this.custom(this.prop=="width"||this.prop=="height"?1:0,this.cur());o(this.elem).show()},hide:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(H){var G=e();if(H||G>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;var E=true;for(var F in this.options.curAnim){if(this.options.curAnim[F]!==true){E=false}}if(E){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;this.elem.style.display=this.options.display;if(o.css(this.elem,"display")=="none"){this.elem.style.display="block"}}if(this.options.hide){o(this.elem).hide()}if(this.options.hide||this.options.show){for(var I in this.options.curAnim){o.attr(this.elem.style,I,this.options.orig[I])}}this.options.complete.call(this.elem)}return false}else{var J=G-this.startTime;this.state=J/this.options.duration;this.pos=o.easing[this.options.easing||(o.easing.swing?"swing":"linear")](this.state,J,0,1,this.options.duration);this.now=this.start+((this.end-this.start)*this.pos);this.update()}return true}};o.extend(o.fx,{speeds:{slow:600,fast:200,_default:400},step:{opacity:function(E){o.attr(E.elem.style,"opacity",E.now)},_default:function(E){if(E.elem.style&&E.elem.style[E.prop]!=null){E.elem.style[E.prop]=E.now+E.unit}else{E.elem[E.prop]=E.now}}}});if(document.documentElement.getBoundingClientRect){o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}var G=this[0].getBoundingClientRect(),J=this[0].ownerDocument,F=J.body,E=J.documentElement,L=E.clientTop||F.clientTop||0,K=E.clientLeft||F.clientLeft||0,I=G.top+(self.pageYOffset||o.boxModel&&E.scrollTop||F.scrollTop)-L,H=G.left+(self.pageXOffset||o.boxModel&&E.scrollLeft||F.scrollLeft)-K;return{top:I,left:H}}}else{o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}o.offset.initialized||o.offset.initialize();var J=this[0],G=J.offsetParent,F=J,O=J.ownerDocument,M,H=O.documentElement,K=O.body,L=O.defaultView,E=L.getComputedStyle(J,null),N=J.offsetTop,I=J.offsetLeft;while((J=J.parentNode)&&J!==K&&J!==H){M=L.getComputedStyle(J,null);N-=J.scrollTop,I-=J.scrollLeft;if(J===G){N+=J.offsetTop,I+=J.offsetLeft;if(o.offset.doesNotAddBorder&&!(o.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(J.tagName))){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}F=G,G=J.offsetParent}if(o.offset.subtractsBorderForOverflowNotVisible&&M.overflow!=="visible"){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}E=M}if(E.position==="relative"||E.position==="static"){N+=K.offsetTop,I+=K.offsetLeft}if(E.position==="fixed"){N+=Math.max(H.scrollTop,K.scrollTop),I+=Math.max(H.scrollLeft,K.scrollLeft)}return{top:N,left:I}}}o.offset={initialize:function(){if(this.initialized){return}var L=document.body,F=document.createElement("div"),H,G,N,I,M,E,J=L.style.marginTop,K='<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';M={position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"};for(E in M){F.style[E]=M[E]}F.innerHTML=K;L.insertBefore(F,L.firstChild);H=F.firstChild,G=H.firstChild,I=H.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(G.offsetTop!==5);this.doesAddBorderForTableAndCells=(I.offsetTop===5);H.style.overflow="hidden",H.style.position="relative";this.subtractsBorderForOverflowNotVisible=(G.offsetTop===-5);L.style.marginTop="1px";this.doesNotIncludeMarginInBodyOffset=(L.offsetTop===0);L.style.marginTop=J;L.removeChild(F);this.initialized=true},bodyOffset:function(E){o.offset.initialized||o.offset.initialize();var G=E.offsetTop,F=E.offsetLeft;if(o.offset.doesNotIncludeMarginInBodyOffset){G+=parseInt(o.curCSS(E,"marginTop",true),10)||0,F+=parseInt(o.curCSS(E,"marginLeft",true),10)||0}return{top:G,left:F}}};o.fn.extend({position:function(){var I=0,H=0,F;if(this[0]){var G=this.offsetParent(),J=this.offset(),E=/^body|html$/i.test(G[0].tagName)?{top:0,left:0}:G.offset();J.top-=j(this,"marginTop");J.left-=j(this,"marginLeft");E.top+=j(G,"borderTopWidth");E.left+=j(G,"borderLeftWidth");F={top:J.top-E.top,left:J.left-E.left}}return F},offsetParent:function(){var E=this[0].offsetParent||document.body;while(E&&(!/^body|html$/i.test(E.tagName)&&o.css(E,"position")=="static")){E=E.offsetParent}return o(E)}});o.each(["Left","Top"],function(F,E){var G="scroll"+E;o.fn[G]=function(H){if(!this[0]){return null}return H!==g?this.each(function(){this==l||this==document?l.scrollTo(!F?H:o(l).scrollLeft(),F?H:o(l).scrollTop()):this[G]=H}):this[0]==l||this[0]==document?self[F?"pageYOffset":"pageXOffset"]||o.boxModel&&document.documentElement[G]||document.body[G]:this[0][G]}});o.each(["Height","Width"],function(I,G){var E=I?"Left":"Top",H=I?"Right":"Bottom",F=G.toLowerCase();o.fn["inner"+G]=function(){return this[0]?o.css(this[0],F,false,"padding"):null};o.fn["outer"+G]=function(K){return this[0]?o.css(this[0],F,false,K?"margin":"border"):null};var J=G.toLowerCase();o.fn[J]=function(K){return this[0]==l?document.compatMode=="CSS1Compat"&&document.documentElement["client"+G]||document.body["client"+G]:this[0]==document?Math.max(document.documentElement["client"+G],document.body["scroll"+G],document.documentElement["scroll"+G],document.body["offset"+G],document.documentElement["offset"+G]):K===g?(this.length?o.css(this[0],J):null):this.css(J,typeof K==="string"?K:K+"px")}})})();
\ No newline at end of file
--- /dev/null
+/*
+ * jQuery UI 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;(function($) {
+
+var _remove = $.fn.remove,
+ isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.6rc6",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ cssCache: {},
+ css: function(name) {
+ if ($.ui.cssCache[name]) { return $.ui.cssCache[name]; }
+ var tmp = $('<div class="ui-gen"></div>').addClass(name).css({position:'absolute', top:'-5000px', left:'-5000px', display:'block'}).appendTo('body');
+
+ //if (!$.browser.safari)
+ //tmp.appendTo('body');
+
+ //Opera and Safari set width and height to 0px instead of auto
+ //Safari returns rgba(0,0,0,0) when bgcolor is not set
+ $.ui.cssCache[name] = !!(
+ (!(/auto|default/).test(tmp.css('cursor')) || (/^[1-9]/).test(tmp.css('height')) || (/^[1-9]/).test(tmp.css('width')) ||
+ !(/none/).test(tmp.css('backgroundImage')) || !(/transparent|rgba\(0, 0, 0, 0\)/).test(tmp.css('backgroundColor')))
+ );
+ try { $('body').get(0).removeChild(tmp.get(0)); } catch(e){}
+ return $.ui.cssCache[name];
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+// WAI-ARIA normalization
+if (isFF2) {
+ var attr = $.attr,
+ removeAttr = $.fn.removeAttr,
+ ariaNS = "http://www.w3.org/2005/07/aaa",
+ ariaState = /^aria-/,
+ ariaRole = /^wairole:/;
+
+ $.attr = function(elem, name, value) {
+ var set = value !== undefined;
+
+ return (name == 'role'
+ ? (set
+ ? attr.call(this, elem, name, "wairole:" + value)
+ : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
+ : (ariaState.test(name)
+ ? (set
+ ? elem.setAttributeNS(ariaNS,
+ name.replace(ariaState, "aaa:"), value)
+ : attr.call(this, elem, name.replace(ariaState, "aaa:")))
+ : attr.apply(this, arguments)));
+ };
+
+ $.fn.removeAttr = function(name) {
+ return (ariaState.test(name)
+ ? this.each(function() {
+ this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
+ }) : removeAttr.call(this, name));
+ };
+}
+
+//jQuery plugins
+$.fn.extend({
+ remove: function() {
+ // Safari has a native remove event which actually removes DOM elements,
+ // so we have to use triggerHandler instead of trigger (#3037).
+ $("*", this).add(this).each(function() {
+ $(this).triggerHandler("remove");
+ });
+ return _remove.apply(this, arguments );
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '')
+ .unbind('selectstart.ui');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none')
+ .bind('selectstart.ui', function() { return false; });
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+
+// $.widget is a factory to create jQuery plugins
+// taking some boilerplate code out of the plugin code
+function getter(namespace, plugin, method, args) {
+ function getMethods(type) {
+ var methods = $[namespace][plugin][type] || [];
+ return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
+ }
+
+ var methods = getMethods('getter');
+ if (args.length == 1 && typeof args[0] == 'string') {
+ methods = methods.concat(getMethods('getterSetter'));
+ }
+ return ($.inArray(method, methods) != -1);
+}
+
+$.widget = function(name, prototype) {
+ var namespace = name.split(".")[0];
+ name = name.split(".")[1];
+
+ // create plugin method
+ $.fn[name] = function(options) {
+ var isMethodCall = (typeof options == 'string'),
+ args = Array.prototype.slice.call(arguments, 1);
+
+ // prevent calls to internal methods
+ if (isMethodCall && options.substring(0, 1) == '_') {
+ return this;
+ }
+
+ // handle getter methods
+ if (isMethodCall && getter(namespace, name, options, args)) {
+ var instance = $.data(this[0], name);
+ return (instance ? instance[options].apply(instance, args)
+ : undefined);
+ }
+
+ // handle initialization and non-getter methods
+ return this.each(function() {
+ var instance = $.data(this, name);
+
+ // constructor
+ (!instance && !isMethodCall &&
+ $.data(this, name, new $[namespace][name](this, options))._init());
+
+ // method call
+ (instance && isMethodCall && $.isFunction(instance[options]) &&
+ instance[options].apply(instance, args));
+ });
+ };
+
+ // create widget constructor
+ $[namespace] = $[namespace] || {};
+ $[namespace][name] = function(element, options) {
+ var self = this;
+
+ this.namespace = namespace;
+ this.widgetName = name;
+ this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
+ this.widgetBaseClass = namespace + '-' + name;
+
+ this.options = $.extend({},
+ $.widget.defaults,
+ $[namespace][name].defaults,
+ $.metadata && $.metadata.get(element)[name],
+ options);
+
+ this.element = $(element)
+ .bind('setData.' + name, function(event, key, value) {
+ if (event.target == element) {
+ return self._setData(key, value);
+ }
+ })
+ .bind('getData.' + name, function(event, key) {
+ if (event.target == element) {
+ return self._getData(key);
+ }
+ })
+ .bind('remove', function() {
+ return self.destroy();
+ });
+ };
+
+ // add widget prototype
+ $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
+
+ // TODO: merge getter and getterSetter properties from widget prototype
+ // and plugin prototype
+ $[namespace][name].getterSetter = 'option';
+};
+
+$.widget.prototype = {
+ _init: function() {},
+ destroy: function() {
+ this.element.removeData(this.widgetName)
+ .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
+ .removeAttr('aria-disabled');
+ },
+
+ option: function(key, value) {
+ var options = key,
+ self = this;
+
+ if (typeof key == "string") {
+ if (value === undefined) {
+ return this._getData(key);
+ }
+ options = {};
+ options[key] = value;
+ }
+
+ $.each(options, function(key, value) {
+ self._setData(key, value);
+ });
+ },
+ _getData: function(key) {
+ return this.options[key];
+ },
+ _setData: function(key, value) {
+ this.options[key] = value;
+
+ if (key == 'disabled') {
+ this.element
+ [value ? 'addClass' : 'removeClass'](
+ this.widgetBaseClass + '-disabled' + ' ' +
+ this.namespace + '-state-disabled')
+ .attr("aria-disabled", value);
+ }
+ },
+
+ enable: function() {
+ this._setData('disabled', false);
+ },
+ disable: function() {
+ this._setData('disabled', true);
+ },
+
+ _trigger: function(type, event, data) {
+ var callback = this.options[type],
+ eventName = (type == this.widgetEventPrefix
+ ? type : this.widgetEventPrefix + type);
+
+ event = $.Event(event);
+ event.type = eventName;
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if (event.originalEvent) {
+ for (var i = $.event.props.length, prop; i;) {
+ prop = $.event.props[--i];
+ event[prop] = event.originalEvent[prop];
+ }
+ }
+
+ this.element.trigger(event, data);
+
+ return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
+ || event.isDefaultPrevented());
+ }
+};
+
+$.widget.defaults = {
+ disabled: false
+};
+
+
+/** Mouse Interaction Plugin **/
+
+$.ui.mouse = {
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ return false;
+ }
+ });
+
+ // Prevent text selection in IE
+ if ($.browser.msie) {
+ this._mouseUnselectable = this.element.attr('unselectable');
+ this.element.attr('unselectable', 'on');
+ }
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+
+ // Restore text selection in IE
+ ($.browser.msie
+ && this.element.attr('unselectable', this._mouseUnselectable));
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = true;
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+};
+
+$.ui.mouse.defaults = {
+ cancel: null,
+ distance: 1,
+ delay: 0
+};
+
+})(jQuery);
+/*
+ * jQuery UI Draggable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.cssNamespace && this.element.addClass(this.options.cssNamespace+"-draggable"));
+ (this.options.disabled && this.element.addClass(this.options.cssNamespace+'-draggable-disabled'));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element.removeData("draggable").unbind(".draggable").removeClass(this.options.cssNamespace+'-draggable '+this.options.cssNamespace+'-draggable-dragging '+this.options.cssNamespace+'-draggable-disabled');
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (this.helper || o.disabled || $(event.target).is('.'+this.options.cssNamespace+'-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Call plugins and callbacks
+ this._trigger("start", event);
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass(o.cssNamespace+"-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ this._trigger('drag', event, ui);
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ self._trigger("stop", event);
+ self._clear();
+ });
+ } else {
+ this._trigger("stop", event);
+ this._clear();
+ }
+
+ return false;
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body && $.browser.mozilla) //Ugly FF3 fix
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass(this.options.cssNamespace+"-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ absolutePosition: this.positionAbs, //deprecated
+ offset: this.positionAbs
+ };
+ }
+
+}));
+
+$.extend($.ui.draggable, {
+ version: "1.6rc6",
+ eventPrefix: "drag",
+ defaults: {
+ appendTo: "parent",
+ axis: false,
+ cancel: ":input,option",
+ connectToSortable: false,
+ containment: false,
+ cssNamespace: "ui",
+ cursor: "default",
+ cursorAt: false,
+ delay: 0,
+ distance: 1,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ }
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ // 'this' points to a string, and should therefore resolved as query, but instead, if the string is assigned to a variable, it loops through the strings properties,
+ // so we have to append '' to make it anonymous again
+ $(typeof this == 'string' ? this+'': this).each(function() {
+ if($.data(this, 'sortable')) {
+ var sortable = $.data(this, 'sortable');
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, inst);
+ }
+ });
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable");
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, inst);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ if(checkPos.call(inst, this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ this.instance.fromOutside = inst; //Little hack so receive/update callbacks work
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+ this.instance.options.revert = false; //No revert here
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.absolutePosition.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.absolutePosition.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
+ });
+
+ $(group).each(function(i) {
+ this.style.zIndex = o.stack.min + i;
+ });
+
+ this[0].style.zIndex = o.stack.min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Droppable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ */
+(function($) {
+
+$.widget("ui.droppable", {
+
+ _init: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
+ $.ui.ddmanager.droppables[this.options.scope].push(this);
+
+ (this.options.cssNamespace && this.element.addClass(this.options.cssNamespace+"-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass(this.options.cssNamespace+"-droppable "+this.options.cssNamespace+"-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+ },
+
+ _setData: function(key, value) {
+
+ if(key == 'accept') {
+ this.options.accept = value && $.isFunction(value) ? value : function(d) {
+ return d.is(accept);
+ };
+ } else {
+ $.widget.prototype._setData.apply(this, arguments);
+ }
+
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not("."+draggable.options.cssNamespace+"-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
+ childrenIntersection = true; return false;
+ }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ absolutePosition: c.positionAbs, //deprecated
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.6rc6",
+ eventPrefix: 'drop',
+ defaults: {
+ accept: '*',
+ activeClass: false,
+ cssNamespace: 'ui',
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ }
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l < x1 && x2 < r
+ && t < y1 && y2 < b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+
+ $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ }
+};
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ proportionallyResize: o.proportionallyResize ? [o.proportionallyResize] : [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent();
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ if ($.browser.safari && o.preventDefault) this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this.proportionallyResize.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ if (o.transparent)
+ this.handles[i].css({ opacity: 0 });
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ if (!o.transparent)
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element);
+
+ if (o.disableSelection)
+ this._handles.disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ this.wrapper.parent().append(
+ this.originalElement.css({
+ position: this.wrapper.css('position'),
+ width: this.wrapper.outerWidth(),
+ height: this.wrapper.outerHeight(),
+ top: this.wrapper.css('top'),
+ left: this.wrapper.css('left')
+ })
+ ).end().remove();
+ }
+
+ _destroy(this.originalElement);
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var handle = false;
+ for(var i in this.handles) {
+ if($(this.handles[i])[0] == event.target) handle = true;
+ }
+
+ return this.options.disabled || !!handle;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ if (o.preserveCursor) {
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+ }
+
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this.proportionallyResize.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this.proportionallyResize, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ if (o.preserveCursor)
+ $('body').css('cursor', 'auto');
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (data.left) this.position.left = data.left;
+ if (data.top) this.position.top = data.top;
+ if (data.height) this.size.height = data.height;
+ if (data.width) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10))
+ };
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this.proportionallyResize.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this.proportionallyResize.length; i++) {
+
+ var prel = this.proportionallyResize[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper.appendTo("body");
+
+ if (o.disableSelection)
+ this.helper.disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+}));
+
+$.extend($.ui.resizable, {
+ version: "1.6rc6",
+ eventPrefix: "resize",
+ defaults: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ cancel: ":input,option",
+ containment: false,
+ delay: 0,
+ disableSelection: true,
+ distance: 1,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ preserveCursor: true,
+ preventDefault: true,
+ proportionallyResize: false,
+ transparent: false,
+ zIndex: 1000
+ }
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = o.proportionallyResize, ista = pr && (/textarea/i).test(pr.get(0).nodeName),
+ soffseth = ista && $.ui.hasScroll(pr.get(0), 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr) pr.css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = o._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, pr = o.proportionallyResize, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+})(jQuery);
+/*
+ * jQuery UI Selectable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $(document.createElement('div'))
+ .css({border:'1px dotted black'})
+ .addClass("ui-selectable-helper");
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $('body').append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "z-index": 100,
+ "position": "absolute",
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
+ selectee.unselecting = false;
+ selectee.selecting = true;
+ selectee.selected = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+}));
+
+$.extend($.ui.selectable, {
+ version: "1.6rc6",
+ defaults: {
+ appendTo: 'body',
+ autoRefresh: true,
+ cancel: ":input,option",
+ delay: 0,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Sortable 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
+ _init: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ (this.options.cssNamespace && this.element.addClass(this.options.cssNamespace+"-sortable"));
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are floating
+ this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass(this.options.cssNamespace+"-sortable "+this.options.cssNamespace+"-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass(o.cssNamespace+'-sortable-helper');
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this.options.sortIndicator.call(this, event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp();
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass(this.options.cssNamespace+"-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+
+ return true;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+
+ if(this.options.connectWith && connected) {
+ var connectWith = this.options.connectWith.constructor == String ? [this.options.connectWith] : this.options.connectWith;
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not("."+inst.options.cssNamespace+"-sortable-helper"), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not("."+this.options.cssNamespace+"-sortable-helper"), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+
+ if(this.options.connectWith) {
+ for (var i = this.options.connectWith.length - 1; i >= 0; i--){
+ var cur = $(this.options.connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
+ continue;
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ if (this.options.accurateIntersection) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+ else {
+ item.width = t[0].offsetWidth;
+ item.height = t[0].offsetHeight;
+ }
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" "+self.options.cssNamespace+"-sortable-placeholder")
+ .removeClass(self.options.cssNamespace+'-sortable-helper')[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+ if(!this.containers[i].containerCache.over) {
+
+ if(this.currentContainer != this.containers[i]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[i].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ continue;
+
+ this.currentContainer = this.containers[i];
+ itemWithLeastDistance ? this.options.sortIndicator.call(this, event, itemWithLeastDistance, null, true) : this.options.sortIndicator.call(this, event, null, this.containers[i].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[i]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ }
+
+ this.containers[i]._trigger("over", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 1;
+ }
+ } else {
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ };
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body && $.browser.mozilla) //Ugly FF3 fix
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ //We first have to update the dom position of the actual currentItem
+ if(!this._noFinalSort) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass(this.options.cssNamespace+"-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not("."+this.options.cssNamespace+"-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedCursor); //Reset cursor
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ absolutePosition: self.positionAbs, //deprecated
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+}));
+
+$.extend($.ui.sortable, {
+ getter: "serialize toArray",
+ version: "1.6rc6",
+ defaults: {
+ accurateIntersection: true,
+ appendTo: "parent",
+ cancel: ":input,option",
+ connectWith: false,
+ cssNamespace: 'ui',
+ delay: 0,
+ distance: 1,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ placeholder: false,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ sortIndicator: $.ui.sortable.prototype._rearrange,
+ tolerance: "intersect",
+ zIndex: 1000
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Accordion 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.accordion", {
+
+ _init: function() {
+
+ var o = this.options, self = this;
+ this.running = 0;
+
+ if ( o.navigation ) {
+ var current = this.element.find("a").filter(o.navigationFilter);
+ if ( current.length ) {
+ if ( current.filter(o.header).length ) {
+ this.active = current;
+ } else {
+ this.active = current.parent().parent().prev();
+ current.addClass("ui-accordion-content-active");
+ }
+ }
+ }
+
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+
+ this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+ .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+ .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); });
+
+ this.headers
+ .next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+
+ this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+ this.active.next().addClass('ui-accordion-content-active');
+
+ //Append icon elements
+ $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+ this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+
+ // IE7-/Win - Extra vertical space in lists fixed
+ if ($.browser.msie) {
+ this.element.find('a').css('zoom', '1');
+ }
+
+ this.resize();
+
+ //ARIA
+ this.element.attr('role','tablist');
+
+ this.headers
+ .attr('role','tab')
+ .bind('keydown', function(event) { return self._keydown(event); })
+ .next()
+ .attr('role','tabpanel');
+
+ this.headers
+ .not(this.active || "")
+ .attr('aria-expanded','false')
+ .attr("tabIndex", "-1")
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr('tabIndex','0');
+ } else {
+ this.active
+ .attr('aria-expanded','true')
+ .attr('tabIndex', '0');
+ }
+
+ // only need links in taborder for Safari
+ if (!$.browser.safari)
+ this.headers.find('a').attr('tabIndex','-1');
+
+ if (o.event) {
+ this.element.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event); });
+ }
+
+ },
+
+ destroy: function() {
+
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role")
+ .unbind('.accordion')
+ .removeData('accordion');
+
+ this.headers
+ .unbind(".accordion")
+ .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+ .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
+
+ this.headers.find("a").removeAttr("tabindex");
+ this.headers.children(".ui-icon").remove();
+ this.headers.next().removeClass("ui-accordion-content ui-accordion-content-active");
+
+ },
+
+ _keydown: function(event) {
+
+ var o = this.options, keyCode = $.ui.keyCode;
+
+ if (o.disabled || event.altKey || event.ctrlKey)
+ return;
+
+ var length = this.headers.length;
+ var currentIndex = this.headers.index(event.target);
+ var toFocus = false;
+
+ switch(event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[(currentIndex + 1) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[(currentIndex - 1 + length) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ return this._clickHandler({ target: event.target });
+ }
+
+ if (toFocus) {
+ $(event.target).attr('tabIndex','-1');
+ $(toFocus).attr('tabIndex','0');
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+
+ },
+
+ resize: function() {
+
+ var o = this.options, maxHeight;
+
+ if (o.fillSpace) {
+
+ if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+ maxHeight = this.element.parent().height();
+ if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+
+ this.headers.each(function() {
+ maxHeight -= $(this).outerHeight();
+ });
+
+ var maxPadding = 0;
+ this.headers.next().each(function() {
+ maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
+ }).height(maxHeight - maxPadding)
+ .css('overflow', 'auto');
+
+ } else if ( o.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next().each(function() {
+ maxHeight = Math.max(maxHeight, $(this).outerHeight());
+ }).height(maxHeight);
+ }
+
+ },
+
+ activate: function(index) {
+ // call clickHandler with custom event
+ this._clickHandler({ target: this._findActive(index)[0] });
+ },
+
+ _findActive: function(selector) {
+ return selector
+ ? typeof selector == "number"
+ ? this.headers.filter(":eq(" + selector + ")")
+ : this.headers.not(this.headers.not(selector))
+ : selector === false
+ ? $([])
+ : this.headers.filter(":eq(0)");
+ },
+
+ _clickHandler: function(event) {
+
+ var o = this.options;
+ if (o.disabled) return false;
+
+ // called only when using activate(false) to close all parts programmatically
+ if (!event.target && !o.alwaysOpen) {
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ var toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: $([]),
+ oldHeader: o.active,
+ newContent: $([]),
+ oldContent: toHide
+ },
+ toShow = (this.active = $([]));
+ this._toggle(toShow, toHide, data);
+ return false;
+ }
+
+ // get the click target
+ var clicked = $(event.target);
+
+ // due to the event delegation model, we have to check if one
+ // of the parent elements is our actual header, and find that
+ // otherwise stick with the initial target
+ clicked = $( clicked.parents(o.header)[0] || clicked );
+ var clickedIsActive = clicked[0] == this.active[0];
+
+ // if animations are still active, or the active header is the target, ignore click
+ if (this.running || (o.alwaysOpen && clickedIsActive)) {
+ return false;
+ }
+ if (!clicked.is(o.header)) {
+ return;
+ }
+
+ // switch classes
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ if (!clickedIsActive) {
+ clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+ .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+ clicked.next().addClass('ui-accordion-content-active');
+ }
+
+ // find elements to show and hide
+ var toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: clickedIsActive && !o.alwaysOpen ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && !o.alwaysOpen ? $([]) : toShow.find('> *'),
+ oldContent: toHide.find('> *')
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle(toShow, toHide, data, clickedIsActive, down);
+
+ return false;
+
+ },
+
+ _toggle: function(toShow, toHide, data, clickedIsActive, down) {
+
+ var o = this.options, self = this;
+
+ this.toShow = toShow;
+ this.toHide = toHide;
+ this.data = data;
+
+ var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+
+ // trigger changestart event
+ this._trigger("changestart", null, this.data);
+
+ // count elements to animate
+ this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if (o.animated) {
+
+ var animOptions = {};
+
+ if ( !o.alwaysOpen && clickedIsActive ) {
+ animOptions = {
+ toShow: $([]),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ }
+
+ if (!o.proxied) {
+ o.proxied = o.animated;
+ }
+
+ if (!o.proxiedDuration) {
+ o.proxiedDuration = o.duration;
+ }
+
+ o.animated = $.isFunction(o.proxied) ?
+ o.proxied(animOptions) : o.proxied;
+
+ o.duration = $.isFunction(o.proxiedDuration) ?
+ o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = o.duration,
+ easing = o.animated;
+
+ if (!animations[easing]) {
+ animations[easing] = function(options) {
+ this.slide(options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[easing](animOptions);
+
+ } else {
+
+ if (!o.alwaysOpen && clickedIsActive) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete(true);
+
+ }
+
+ toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1");
+ toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+ },
+
+ _completed: function(cancel) {
+
+ var o = this.options;
+
+ this.running = cancel ? 0 : --this.running;
+ if (this.running) return;
+
+ if (o.clearStyle) {
+ this.toShow.add(this.toHide).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ this._trigger('change', null, this.data);
+ }
+
+});
+
+
+$.extend($.ui.accordion, {
+ version: "1.6rc6",
+ defaults: {
+ active: null,
+ autoHeight: true,
+ alwaysOpen: true,
+ animated: 'slide',
+ clearStyle: false,
+ event: "click",
+ fillSpace: false,
+ header: "a",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() == location.href.toLowerCase();
+ }
+ },
+ animations: {
+ slide: function(options, additions) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions);
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({height: "show"}, options);
+ return;
+ }
+ var hideHeight = options.toHide.height(),
+ showHeight = options.toShow.height(),
+ difference = showHeight / hideHeight,
+ overflow = options.toShow.css('overflow'),
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ];
+ $.each(fxAttrs, function(i, prop) {
+ hideProps[prop] = 'hide';
+ showProps[prop] = parseFloat(options.toShow.css(prop));
+ });
+ options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+ options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+ step: function(now, settings) {
+ // if the alwaysOpen option is set to false, we may not have
+ // a content pane to show
+ if (!options.toShow[0]) { return; }
+
+ var percentDone = settings.start != settings.end
+ ? (settings.now - settings.start) / (settings.end - settings.start)
+ : 0,
+ current = percentDone * showProps[settings.prop];
+ if ($.browser.msie || $.browser.opera) {
+ current = Math.ceil(current);
+ }
+ options.toShow[0].style[settings.prop] = current + 'px';
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css("height", "auto");
+ }
+ options.toShow.css({overflow: overflow});
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function(options) {
+ this.slide(options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ },
+ easeslide: function(options) {
+ this.slide(options, {
+ easing: "easeinout",
+ duration: 700
+ });
+ }
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Dialog 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ * ui.resizable.js
+ */
+(function($) {
+
+var setDataSwitch = {
+ dragStart: "start.draggable",
+ drag: "drag.draggable",
+ dragStop: "stop.draggable",
+ maxHeight: "maxHeight.resizable",
+ minHeight: "minHeight.resizable",
+ maxWidth: "maxWidth.resizable",
+ minWidth: "minWidth.resizable",
+ resizeStart: "start.resizable",
+ resize: "drag.resizable",
+ resizeStop: "stop.resizable"
+};
+
+$.widget("ui.dialog", {
+
+ _init: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = this.options,
+
+ title = options.title || this.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(this.element),
+
+ uiDialog = (this.uiDialog = $('<div/>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ' +
+ options.dialogClass
+ )
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ (options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(event);
+ }),
+
+ uiDialogContent = this.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"/>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .mousedown(function(ev) {
+ ev.stopPropagation();
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span/>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ (options.draggable && $.fn.draggable && this._makeDraggable());
+ (options.resizable && $.fn.resizable && this._makeResizable());
+
+ this._createButtons(options.buttons);
+ this._isOpen = false;
+
+ (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
+ (options.autoOpen && this.open());
+
+ },
+
+ destroy: function() {
+ (this.overlay && this.overlay.destroy());
+ (this.shadow && this._destroyShadow());
+ this.uiDialog.hide();
+ this.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ this.uiDialog.remove();
+
+ (this.originalTitle && this.element.attr('title', this.originalTitle));
+ },
+
+ close: function(event) {
+ if (false === this._trigger('beforeclose', event)) {
+ return;
+ }
+
+ (this.overlay && this.overlay.destroy());
+ (this.shadow && this._destroyShadow());
+ this.uiDialog
+ .hide(this.options.hide)
+ .unbind('keypress.ui-dialog');
+
+ this._trigger('close', event);
+ $.ui.dialog.overlay.resize();
+
+ this._isOpen = false;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+
+ if ((this.options.modal && !force)
+ || (!this.options.stack && !this.options.modal)) {
+ return this._trigger('focus', event);
+ }
+
+ var maxZ = this.options.zIndex, options = this.options;
+ $('.ui-dialog:visible').each(function() {
+ maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10) || options.zIndex);
+ });
+ (this.overlay && this.overlay.$el.css('z-index', ++maxZ));
+ (this.shadow && this.shadow.css('z-index', ++maxZ));
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
+ this.uiDialog.css('z-index', ++maxZ);
+ this.element.attr(saveScroll);
+ this._trigger('focus', event);
+ },
+
+ open: function(event) {
+ if (this._isOpen) { return; }
+
+ var options = this.options,
+ uiDialog = this.uiDialog;
+
+ this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
+ (uiDialog.next().length && uiDialog.appendTo('body'));
+ this._size();
+ this._position(options.position);
+ uiDialog.show(options.show);
+ this.moveToTop(true, event);
+
+ // prevent tabbing out of modal dialogs
+ (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode != $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first')[0],
+ last = tabbables.filter(':last')[0];
+
+ if (event.target == last && !event.shiftKey) {
+ setTimeout(function() {
+ first.focus();
+ }, 1);
+ } else if (event.target == first && event.shiftKey) {
+ setTimeout(function() {
+ last.focus();
+ }, 1);
+ }
+ }));
+
+ // set focus to the first tabbable element in:
+ // - content area
+ // - button pane
+ // - title bar
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-titlebar :tabbable:first'))
+ .filter(':first')
+ .focus();
+
+ if(options.shadow)
+ this._createShadow();
+
+ this._trigger('open', event);
+ this._isOpen = true;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ this.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ (typeof buttons == 'object' && buttons !== null &&
+ $.each(buttons, function() { return !(hasButtons = true); }));
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ $('<button type="button"></button>')
+ .addClass(
+ 'ui-state-default ' +
+ 'ui-corner-all'
+ )
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .hover(
+ function() {
+ $(this).addClass('ui-state-hover');
+ },
+ function() {
+ $(this).removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ $(this).addClass('ui-state-focus');
+ })
+ .blur(function() {
+ $(this).removeClass('ui-state-focus');
+ })
+ .appendTo(uiDialogButtonPane);
+ });
+ uiDialogButtonPane.appendTo(this.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = this.options;
+
+ this.uiDialog.draggable({
+ cancel: '.ui-dialog-content',
+ helper: options.dragHelper,
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function() {
+ (options.dragStart && options.dragStart.apply(self.element[0], arguments));
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.hide();
+ },
+ drag: function() {
+ (options.drag && options.drag.apply(self.element[0], arguments));
+ self._refreshShadow(1);
+ },
+ stop: function() {
+ (options.dragStop && options.dragStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.show();
+ self._refreshShadow();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = this.options,
+ resizeHandles = typeof handles == 'string'
+ ? handles
+ : 'n,e,s,w,se,sw,ne,nw';
+
+ this.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ alsoResize: this.element,
+ helper: options.resizeHelper,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: options.minHeight,
+ start: function() {
+ (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.hide();
+ },
+ resize: function() {
+ (options.resize && options.resize.apply(self.element[0], arguments));
+ self._refreshShadow(1);
+ },
+ handles: resizeHandles,
+ stop: function() {
+ (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ if($.browser.msie && $.browser.version < 7 && self.shadow) self.shadow.show();
+ self._refreshShadow();
+ }
+ })
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _position: function(pos) {
+ var wnd = $(window), doc = $(document),
+ pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
+ minTop = pTop;
+
+ if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
+ pos = [
+ pos == 'right' || pos == 'left' ? pos : 'center',
+ pos == 'top' || pos == 'bottom' ? pos : 'middle'
+ ];
+ }
+ if (pos.constructor != Array) {
+ pos = ['center', 'middle'];
+ }
+ if (pos[0].constructor == Number) {
+ pLeft += pos[0];
+ } else {
+ switch (pos[0]) {
+ case 'left':
+ pLeft += 0;
+ break;
+ case 'right':
+ pLeft += wnd.width() - this.uiDialog.outerWidth();
+ break;
+ default:
+ case 'center':
+ pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
+ }
+ }
+ if (pos[1].constructor == Number) {
+ pTop += pos[1];
+ } else {
+ switch (pos[1]) {
+ case 'top':
+ pTop += 0;
+ break;
+ case 'bottom':
+ pTop += wnd.height() - this.uiDialog.outerHeight();
+ break;
+ default:
+ case 'middle':
+ pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
+ }
+ }
+
+ // prevent the dialog from being too high (make sure the titlebar
+ // is accessible)
+ pTop = Math.max(pTop, minTop);
+ this.uiDialog.css({top: pTop, left: pLeft});
+ },
+
+ _setData: function(key, value){
+ (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
+ switch (key) {
+ case "buttons":
+ this._createButtons(value);
+ break;
+ case "closeText":
+ this.uiDialogTitlebarCloseText.text(value);
+ break;
+ case "draggable":
+ (value
+ ? this._makeDraggable()
+ : this.uiDialog.draggable('destroy'));
+ break;
+ case "height":
+ this.uiDialog.height(value);
+ break;
+ case "position":
+ this._position(value);
+ break;
+ case "resizable":
+ var uiDialog = this.uiDialog,
+ isResizable = this.uiDialog.is(':data(resizable)');
+
+ // currently resizable, becoming non-resizable
+ (isResizable && !value && uiDialog.resizable('destroy'));
+
+ // currently resizable, changing handles
+ (isResizable && typeof value == 'string' &&
+ uiDialog.resizable('option', 'handles', value));
+
+ // currently non-resizable, becoming resizable
+ (isResizable || this._makeResizable(value));
+
+ break;
+ case "title":
+ $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
+ break;
+ case "width":
+ this.uiDialog.width(value);
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options;
+
+ // reset content sizing
+ this.element.css({
+ height: 0,
+ minHeight: 0,
+ width: 'auto'
+ });
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ var nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css({
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: options.height == 'auto'
+ ? 'auto'
+ : options.height - nonContentHeight
+ });
+ },
+
+ _createShadow: function() {
+ this.shadow = $('<div class="ui-widget-shadow"></div>').css('position', 'absolute').appendTo(document.body);
+ this._refreshShadow();
+ return this.shadow;
+ },
+
+ _refreshShadow: function(dragging) {
+ // IE6 is simply to slow to handle the reflow in a good way, so
+ // resizing only happens on stop, and the shadow is hidden during drag/resize
+ if(dragging && $.browser.msie && $.browser.version < 7) return;
+
+ var offset = this.uiDialog.offset();
+ this.shadow.css({
+ left: offset.left,
+ top: offset.top,
+ width: this.uiDialog.outerWidth(),
+ height: this.uiDialog.outerHeight()
+ });
+ },
+
+ _destroyShadow: function() {
+ this.shadow.remove();
+ this.shadow = null;
+ }
+
+});
+
+$.extend($.ui.dialog, {
+ version: "1.6rc6",
+ defaults: {
+ autoOpen: true,
+ bgiframe: false,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ draggable: true,
+ height: 'auto',
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ shadow: true,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ getter: 'isOpen',
+
+ uuid: 0,
+
+ getTitleId: function($el) {
+ return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ $('a, :input').bind($.ui.dialog.overlay.events, function() {
+ // allow use of the element if inside a dialog and
+ // - there are no modal dialogs
+ // - there are modal dialogs, but we are in front of the topmost modal
+ var allow = false;
+ var $dialog = $(this).parents('.ui-dialog');
+ if ($dialog.length) {
+ var $overlays = $('.ui-dialog-overlay');
+ if ($overlays.length) {
+ var maxZ = parseInt($overlays.css('z-index'), 10);
+ $overlays.each(function() {
+ maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10));
+ });
+ allow = parseInt($dialog.css('z-index'), 10) > maxZ;
+ } else {
+ allow = true;
+ }
+ }
+ return allow;
+ });
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ (dialog.options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = $('<div></div>').appendTo(document.body)
+ .addClass('ui-widget-overlay').css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.instances.splice($.inArray(this.instances, $el), 1);
+
+ if (this.instances.length === 0) {
+ $('a, :input').add([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+ },
+
+ height: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ var offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ var offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Slider 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) {
+
+$.widget("ui.slider", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this._keySliding = false;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass("ui-slider"
+ + " ui-slider-" + this.orientation
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all");
+
+ this.range = $([]);
+
+ if (o.range) {
+
+ if (o.range === true) {
+ this.range = $('<div></div>');
+ if (!o.values) o.values = [this._valueMin(), this._valueMin()];
+ if (o.values.length && o.values.length != 2) {
+ o.values = [o.values[0], o.values[0]];
+ }
+ } else {
+ this.range = $('<div></div>');
+ }
+
+ this.range
+ .appendTo(this.element)
+ .addClass("ui-slider-range"
+ + " ui-widget-header");
+
+ (o.range == "min") && (this.orientation == "horizontal") && this.range.css({ left : 0 });
+ (o.range == "max") && (this.orientation == "horizontal") && this.range.css({ right : 0 });
+ (o.range == "min") && (this.orientation == "vertical") && this.range.css({ bottom : 0 });
+ (o.range == "max") && (this.orientation == "vertical") && this.range.css({ top : 0 });
+
+ }
+
+ if ($(".ui-slider-handle", this.element).length == 0)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+
+ if (o.values && o.values.length) {
+ while ($(".ui-slider-handle", this.element).length < o.values.length)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+ }
+
+ this.handles = $(".ui-slider-handle", this.element)
+ .addClass("ui-state-default"
+ + " ui-corner-all");
+
+ this.handle = this.handles.eq(0);
+
+ this.handles.add(this.range).filter("a")
+ .click(function(event) { event.preventDefault(); })
+ .hover(function() { $(this).addClass('ui-state-hover'); }, function() { $(this).removeClass('ui-state-hover'); })
+ .focus(function() { self.handles.removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); })
+ .blur(function() { $(this).removeClass('ui-state-focus'); });
+
+ this.handles.each(function(i) {
+ $(this).data("index.ui-slider-handle", i);
+ });
+
+ this.handles.keydown(function(event) {
+
+ var index = $(this).data("index.ui-slider-handle");
+
+ if (self.options.disabled)
+ return;
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if (!self._keySliding) {
+ self._keySliding = true;
+ $(this).addClass("ui-state-active");
+ self._start(event);
+ }
+ break;
+ }
+
+ var curVal, newVal, step = self._step();
+ if (self.options.values && self.options.values.length) {
+ curVal = newVal = self.values(index);
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if(curVal == self._valueMax()) return;
+ newVal = curVal + step;
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if(curVal == self._valueMin()) return;
+ newVal = curVal - step;
+ break;
+ }
+
+ self._slide(event, index, newVal);
+
+ }).keyup(function(event) {
+
+ if (self._keySliding) {
+ self._stop(event);
+ self._change(event);
+ self._keySliding = false;
+ $(this).removeClass("ui-state-active");
+ }
+
+ });
+
+ this._refreshValue();
+
+ },
+
+ destroy: function() {
+
+ this.handles.remove();
+
+ this.element
+ .removeClass("ui-slider"
+ + " ui-slider-horizontal"
+ + " ui-slider-vertical"
+ + " ui-slider-disabled"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .removeData("slider")
+ .unbind(".slider");
+
+ this._mouseDestroy();
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (o.disabled)
+ return false;
+
+ this._start(event);
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ var distance = this._valueMax() + 1, closestHandle;
+ var self = this, index;
+ this.handles.each(function(i) {
+ var thisDistance = Math.abs(normValue - self.values(i));
+ if (distance > thisDistance) {
+ distance = thisDistance;
+ closestHandle = $(this);
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0, the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if(o.range && (this.values(0) + this.values(1)) == 0) {
+ closestHandle = $(this.handles[++index]);
+ }
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass("ui-state-active")
+ .focus();
+
+ var offset = closestHandle.offset();
+ var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left + (parseInt(closestHandle.css('marginLeft'),10) || 0),
+ top: event.pageY - offset.top + (parseInt(closestHandle.css('marginTop'),10) || 0)
+ };
+
+ normValue = this._normValueFromMouse(position);
+ this._slide(event, index, normValue);
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ this._slide(event, this._handleIndex, normValue);
+
+ return false;
+
+ },
+
+ _mouseStop: function(event) {
+
+ this.handles.removeClass("ui-state-active");
+ this._stop(event);
+ this._change(event);
+ this._handleIndex = null;
+ this._clickOffset = null;
+
+ return false;
+
+ },
+
+ _detectOrientation: function() {
+ this.orientation = this.options.orientation == 'auto' ? (this.element[0].offsetWidth/this.element[0].offsetHeight > 1 ? 'horizontal' : 'vertical') : this.options.orientation;
+ },
+
+ _normValueFromMouse: function(position) {
+
+ var pixelTotal, pixelMouse;
+ if ('horizontal' == this.orientation) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
+ }
+
+ var percentMouse = (pixelMouse / pixelTotal);
+ if (percentMouse > 1) percentMouse = 1;
+ if (percentMouse < 0) percentMouse = 0;
+ if ('vertical' == this.orientation)
+ percentMouse = 1 - percentMouse;
+
+ var valueTotal = this._valueMax() - this._valueMin(),
+ valueMouse = percentMouse * valueTotal,
+ valueMouseModStep = valueMouse % this.options.step,
+ normValue = this._valueMin() + valueMouse - valueMouseModStep;
+
+ if (valueMouseModStep > (this.options.step / 2))
+ normValue += this.options.step;
+
+ return normValue;
+
+ },
+
+ _start: function(event) {
+ this._trigger("start", event, {
+ value: this.value()
+ });
+ },
+
+ _slide: function(event, index, newVal) {
+
+ var handle = this.handles[index];
+
+ if (this.options.values && this.options.values.length) {
+
+ var otherVal = this.values(index ? 0 : 1);
+
+ if ((index == 0 && newVal >= otherVal) || (index == 1 && newVal <= otherVal))
+ newVal = otherVal;
+
+ if (newVal != this.values(index)) {
+ var newValues = this.values();
+ newValues[index] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: handle,
+ value: newVal,
+ values: newValues
+ });
+ var otherVal = this.values(index ? 0 : 1);
+ if (allowed !== false) {
+ this.values(index, newVal, !( event.type == 'mousedown' && this.options.animate ));
+ }
+ }
+
+ } else {
+
+ if (newVal != this.value()) {
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: handle,
+ value: newVal
+ });
+ if (allowed !== false) {
+ this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
+ }
+
+ }
+
+ }
+
+ },
+
+ _stop: function(event) {
+ this._trigger("stop", event, {
+ value: this.value()
+ });
+ },
+
+ _change: function(event) {
+ this._trigger("change", event, {
+ value: this.value()
+ });
+ },
+
+ value: function(newValue) {
+
+ if (arguments.length) {
+ this._setData("value", newValue);
+ this._change();
+ }
+
+ return this._value();
+
+ },
+
+ values: function(index, newValue, noAnimation) {
+
+ if(!this.options.animate) noAnimation = true;
+
+ if (arguments.length > 1) {
+ this.options.values[index] = newValue;
+ this._refreshValue(!noAnimation);
+ this._change();
+ }
+
+ if (arguments.length) {
+ if (this.options.values && this.options.values.length) {
+ return this._values(index);
+ } else {
+ return this.value();
+ }
+ } else {
+ return this._values();
+ }
+
+ },
+
+ _setData: function(key, value) {
+
+ $.widget.prototype._setData.apply(this, arguments);
+
+ switch (key) {
+ case 'orientation':
+
+ this._detectOrientation();
+
+ this.element
+ .removeClass("ui-slider-horizontal ui-slider-vertical")
+ .addClass("ui-slider-" + this.orientation);
+ this._refreshValue();
+ break;
+ case 'value':
+ this._refreshValue();
+ break;
+ }
+
+ },
+
+ _step: function() {
+ var step = this.options.step;
+ return step;
+ },
+
+ _value: function() {
+
+ var val = this.options.value;
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+
+ },
+
+ _values: function(index) {
+
+ if (arguments.length) {
+ var val = this.options.values[index];
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+ } else {
+ return this.options.values;
+ }
+
+ },
+
+ _valueMin: function() {
+ var valueMin = this.options.min;
+ return valueMin;
+ },
+
+ _valueMax: function() {
+ var valueMax = this.options.max;
+ return valueMax;
+ },
+
+ _refreshValue: function(animate) {
+
+ var oRange = this.options.range, o = this.options, self = this;
+
+ if (this.options.values && this.options.values.length) {
+ var vp0, vp1;
+ this.handles.each(function(i, j) {
+ var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+ if (self.options.range === true) {
+ if (self.orientation == 'horizontal') {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ } else {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ var valPercent = (this.value() - this._valueMin()) / (this._valueMax() - this._valueMin()) * 100;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+
+ (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ left: 0, width: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ left: valPercent + '%', width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ top: (100 - valPercent) + '%', height: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ bottom: valPercent + '%', height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+
+ }
+
+}));
+
+$.extend($.ui.slider, {
+ getter: "value values",
+ version: "1.6rc6",
+ eventPrefix: "slide",
+ defaults: {
+ animate: false,
+ delay: 0,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: 'auto',
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Tabs 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.tabs", {
+
+ _init: function() {
+ // create tabs
+ this._tabify(true);
+ },
+
+ _setData: function(key, value) {
+ if ((/^selected/).test(key))
+ this.select(value);
+ else {
+ this.options[key] = value;
+ this._tabify();
+ }
+ },
+
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '')
+ || this.options.idPrefix + $.data(a);
+ },
+
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
+
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.$tabs.index(tab)
+ };
+ },
+
+ _tabify: function(init) {
+
+ this.list = this.element.is('div') ? this.element.children('ul:first, ol:first').eq(0) : this.element;
+ this.$lis = $('li:has(a[href])', this.list);
+ this.$tabs = this.$lis.map(function() { return $('a', this)[0]; });
+ this.$panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.$tabs.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // inline tab
+ if (fragmentId.test(href))
+ self.$panels = self.$panels.add(self._sanitizeSelector(href));
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.$panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
+ }
+ self.$panels = self.$panels.add($panel);
+ }
+
+ // invalid tab href
+ else
+ o.disabled.push(i + 1);
+ });
+
+ // initialization from scratch
+ if (init) {
+
+ // attach necessary classes for styling
+ if (this.element.is('div')) {
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ }
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.$lis.addClass('ui-state-default ui-corner-top');
+ this.$panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.$tabs.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ else if (o.cookie)
+ o.selected = parseInt(self._cookie(), 10);
+
+ else if (this.$lis.filter('.ui-tabs-selected').length)
+ o.selected = this.$lis.index(this.$lis.filter('.ui-tabs-selected'));
+
+ else
+ o.selected = 0;
+
+ }
+ else if (o.selected === null)
+ o.selected = -1;
+
+ // sanity check
+ o.selected = ((o.selected >= 0 && this.$tabs[o.selected]) || o.selected < 0) ? o.selected : 0; // default to first tab
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.$lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.$lis.index(n); } )
+ )).sort();
+ if ($.inArray(o.selected, o.disabled) != -1)
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+
+ // highlight selected tab
+ this.$panels.addClass('ui-tabs-hide');
+ this.$lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.$tabs.length) { // check for length avoids error when initializing empty list
+ this.$panels.eq(o.selected).removeClass('ui-tabs-hide');
+ var classes = ['ui-tabs-selected ui-state-active'];
+ if (o.deselectable) classes.push('ui-tabs-deselectable');
+ this.$lis.eq(o.selected).addClass(classes.join(' '));
+
+ // seems to be expected behavior that the show callback is fired
+ var onShow = function() {
+ self._trigger('show', null,
+ self._ui(self.$tabs[o.selected], self.$panels[o.selected]));
+ };
+
+ // load if remote tab
+ if ($.data(this.$tabs[o.selected], 'load.tabs'))
+ this.load(o.selected, onShow);
+ // just trigger show event
+ else onShow();
+ }
+
+ // states
+ if (o.event != 'mouseover') {
+ var handleState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) el.toggleClass('ui-state-' + state);
+ };
+ this.$lis.bind('mouseover.tabs mouseout.tabs', function() {
+ handleState('hover', $(this));
+ });
+ // TODO focus/blur don't seem to work with namespace
+ this.$tabs.bind('focus.tabs blur.tabs', function() {
+ handleState('focus', $(this).parents('li:first'));
+ });
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.$lis.add(self.$tabs).unbind('.tabs');
+ self.$lis = self.$tabs = self.$panels = null;
+ });
+
+ }
+ // update selected after add/remove
+ else
+ o.selected = this.$lis.index(this.$lis.filter('.ui-tabs-selected'));
+
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) this._cookie(o.selected, o.cookie);
+
+ // disable tabs
+ for (var i = 0, li; li = this.$lis[i]; i++)
+ $(li)[$.inArray(i, o.disabled) != -1 && !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) this.$tabs.removeData('cache.tabs');
+
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else hideFx = showFx = o.fx;
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if ($.browser.msie && fx.opacity) $el[0].style.removeAttribute('filter');
+ }
+
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, 500, function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide, $show) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ if ($show) showTab(clicked, $show);
+ });
+ } :
+ function(clicked, $hide, $show) {
+ $hide.addClass('ui-tabs-hide');
+ if ($show) showTab(clicked, $show);
+ };
+
+ // Switch a tab...
+ function switchTab(clicked, $li, $hide, $show) {
+ var classes = ['ui-tabs-selected ui-state-active'];
+ if (o.deselectable) classes.push('ui-tabs-deselectable');
+ $li.removeClass('ui-state-default').addClass(classes.join(' '))
+ .siblings().removeClass(classes.join(' ')).addClass('ui-state-default');
+ hideTab(clicked, $hide, $show);
+ }
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.$tabs.unbind('.tabs').bind(o.event + '.tabs', function() {
+
+ var $li = $(this).parents('li:eq(0)'),
+ $hide = self.$panels.filter(':visible'),
+ $show = $(self._sanitizeSelector(this.hash));
+
+ // If tab is already selected and not deselectable or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-state-active') && !o.deselectable)
+ || $li.hasClass('ui-state-disabled')
+ || $(this).hasClass('ui-tabs-loading')
+ || self._trigger('select', null, self._ui(this, $show[0])) === false
+ ) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.$tabs.index(this);
+
+ // if tab may be closed TODO avoid redundant code in this block
+ if (o.deselectable) {
+ if ($li.hasClass('ui-state-active')) {
+ o.selected = -1;
+ if (o.cookie) self._cookie(o.selected, o.cookie);
+ $li.removeClass('ui-tabs-selected ui-state-active ui-tabs-deselectable')
+ .addClass('ui-state-default');
+ self.$panels.stop();
+ hideTab(this, $hide);
+ this.blur();
+ return false;
+ } else if (!$hide.length) {
+ if (o.cookie) self._cookie(o.selected, o.cookie);
+ self.$panels.stop();
+ var a = this;
+ self.load(self.$tabs.index(this), function() {
+ $li.addClass('ui-tabs-selected ui-state-active ui-tabs-deselectable')
+ .removeClass('ui-state-default');
+ showTab(a, $show);
+ });
+ this.blur();
+ return false;
+ }
+ }
+
+ if (o.cookie) self._cookie(o.selected, o.cookie);
+
+ // stop possibly running animations
+ self.$panels.stop();
+
+ // show new tab
+ if ($show.length) {
+ var a = this;
+ self.load(self.$tabs.index(this), $hide.length ?
+ function() {
+ switchTab(a, $li, $hide, $show);
+ } :
+ function() {
+ $li.addClass('ui-tabs-selected ui-state-active').removeClass('ui-state-default');
+ showTab(a, $show);
+ }
+ );
+ } else
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) this.blur();
+
+ return false;
+
+ });
+
+ // disable click if event is configured to something else
+ if (o.event != 'click') this.$tabs.bind('click.tabs', function(){return false;});
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.element
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+
+ this.list.unbind('.tabs')
+ .removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all')
+ .removeData('tabs');
+
+ this.$tabs.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href)
+ this.href = href;
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.$lis.unbind('.tabs').add(this.$panels).each(function() {
+ if ($.data(this, 'destroy.tabs'))
+ $(this).remove();
+ else
+ $(this).removeClass(
+ 'ui-state-default ' +
+ 'ui-corner-top ' +
+ 'ui-tabs-selected ' +
+ 'ui-state-active ' +
+ 'ui-tabs-deselectable ' +
+ 'ui-state-disabled ' +
+ 'ui-tabs-panel ' +
+ 'ui-widget-content ' +
+ 'ui-corner-bottom ' +
+ 'ui-tabs-hide');
+ });
+
+ if (o.cookie)
+ this._cookie(null, o.cookie);
+ },
+
+ add: function(url, label, index) {
+ if (index == undefined)
+ index = this.$tabs.length; // append by default
+
+ var self = this, o = this.options;
+ var $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label));
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ var id = url.indexOf('#') == 0 ? url.replace('#', '') : this._tabId( $('a:first-child', $li)[0] );
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+ }
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+ if (index >= this.$lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.$lis[index]);
+ $panel.insertBefore(this.$panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n });
+
+ this._tabify();
+
+ if (this.$tabs.length == 1) { // after tabify
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ var href = $.data(this.$tabs[0], 'load.tabs');
+ if (href) this.load(0, function() {
+ self._trigger('show', null,
+ self._ui(self.$tabs[0], self.$panels[0]));
+ });
+ }
+
+ // callback
+ this._trigger('add', null, this._ui(this.$tabs[index], this.$panels[index]));
+ },
+
+ remove: function(index) {
+ var o = this.options, $li = this.$lis.eq(index).remove(),
+ $panel = this.$panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.$tabs.length > 1)
+ this.select(index + (index + 1 < this.$tabs.length ? 1 : -1));
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ },
+
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1)
+ return;
+
+ this.$lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.$tabs[index], this.$panels[index]));
+ },
+
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.$lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.$tabs[index], this.$panels[index]));
+ }
+ },
+
+ select: function(index) {
+ if (typeof index == 'string')
+ index = this.$tabs.index(this.$tabs.filter('[href$=' + index + ']'));
+ this.$tabs.eq(index).trigger(this.options.event + '.tabs');
+ },
+
+ load: function(index, callback) { // callback is for internal usage only
+
+ var self = this, o = this.options, $a = this.$tabs.eq(index), a = $a[0],
+ bypassCache = callback == undefined || callback === false, url = $a.data('load.tabs');
+ // TODO bypassCache == false should work
+
+ callback = callback || function() {};
+
+ // no remote or from cache - just finish with callback
+ // TODO in any case: insert cancel running load here..!
+
+ if (!url || !bypassCache && $.data(a, 'cache.tabs')) {
+ callback();
+ return;
+ }
+
+ // load remote from here on
+
+ var inner = function(parent) {
+ var $parent = $(parent), $inner = $parent.find('*:last');
+ return $inner.length && $inner.is(':not(img)') && $inner || $parent;
+ };
+ var cleanup = function() {
+ self.$tabs.filter('.ui-tabs-loading').removeClass('ui-tabs-loading')
+ .each(function() {
+ if (o.spinner)
+ inner(this).parent().html(inner(this).data('label.tabs'));
+ });
+ self.xhr = null;
+ };
+
+ if (o.spinner) {
+ var label = inner(a).html();
+ inner(a).wrapInner('<em></em>')
+ .find('em').data('label.tabs', label).html(o.spinner);
+ }
+
+ var ajaxOptions = $.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+ cleanup();
+
+ if (o.cache)
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.$tabs[index], self.$panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (er) {}
+
+ // This callback is required because the switch has to take
+ // place after loading has completed. Call last in order to
+ // fire load before show callback...
+ callback();
+ }
+ });
+ if (this.xhr) {
+ // terminate pending requests from other tabs and restore tab label
+ this.xhr.abort();
+ cleanup();
+ }
+ $a.addClass('ui-tabs-loading');
+ self.xhr = $.ajax(ajaxOptions);
+ },
+
+ url: function(index, url) {
+ this.$tabs.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ },
+
+ length: function() {
+ return this.$tabs.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.6rc6',
+ getter: 'length',
+ defaults: {
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ deselectable: false,
+ disabled: [],
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ panelTemplate: '<div></div>',
+ spinner: 'Loading…',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ }
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, t = this.options.selected;
+
+ function rotate() {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ t = ++t < self.$tabs.length ? t : 0;
+ self.select(t);
+ }, ms);
+ }
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate); // will not be attached twice
+ this.$tabs.bind(this.options.event + '.tabs', !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ clearTimeout(self.rotation);
+ self.element.unbind('tabsshow', rotate);
+ }
+ } :
+ function(e) {
+ t = self.options.selected;
+ rotate();
+ }
+ );
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.$tabs.unbind(this.options.event + '.tabs', stop);
+ }
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Datepicker 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.6rc6" } });
+
+var PROP_NAME = 'datepicker';
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false // True if right-to-left language, false if left-to-right
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearRange: '-10:+10', // Range of years to display in drop-down,
+ // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'normal', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false // True to show button panel, false to not show it
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ if (input.hasClass(this.markerClassName))
+ return;
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (appendText)
+ input[isRTL ? 'before' : 'after']('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ var trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](trigger);
+ trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(target);
+ return false;
+ });
+ }
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst));
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param dateText string - the initial date to display (in the current format)
+ @param onSelect function - the function(dateText) to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" size="1" style="position: absolute; top: -100px;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ this._dialogInput.val(dateText);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
+ var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ $target.siblings('.' + this._appendClass).remove().end().
+ siblings('.' + this._triggerClass).remove().end().
+ removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ $target.siblings('button.' + this._triggerClass).
+ each(function() { this.disabled = false; }).end().
+ siblings('img.' + this._triggerClass).
+ css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ $target.siblings('button.' + this._triggerClass).
+ each(function() { this.disabled = true; }).end().
+ siblings('img.' + this._triggerClass).
+ css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or
+ @param value any - the new value for the setting (omit if above is an object) */
+ _optionDatepicker: function(target, name, value) {
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ var inst = this._getInst(target);
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker(null);
+ }
+ extendRemove(inst.settings, settings);
+ var date = new Date();
+ extendRemove(inst, {rangeStart: null, // start of range
+ endDay: null, endMonth: null, endYear: null, // end of range
+ selectedDay: date.getDate(), selectedMonth: date.getMonth(),
+ selectedYear: date.getFullYear(), // starting point
+ currentDay: date.getDate(), currentMonth: date.getMonth(),
+ currentYear: date.getFullYear(), // current selection
+ drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date
+ @param endDate Date - the new end date for a range (optional) */
+ _setDateDatepicker: function(target, date, endDate) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date, endDate);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @return Date - the current date or
+ Date[2] - the current dates for a range */
+ _getDateDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker(null, '');
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass +
+ ', td.' + $.datepicker._currentClass, inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ $.datepicker._hideDatepicker(null, '');
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ inst.rangeStart = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
+ $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4});
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim](duration, postProcess);
+ if (duration == '')
+ postProcess();
+ if (inst.input[0].type != 'hidden')
+ inst.input[0].focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var dims = {width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4};
+ var self = this;
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover').
+ css({width: dims.width, height: dims.height})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1) {
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ } else {
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ }
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
+ $(inst.input[0]).focus();
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
+ var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
+ offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj.nextSibling;
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker
+ @param duration string - the duration over which to close the date picker */
+ _hideDatepicker: function(input, duration) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (inst.stayOpen)
+ this._selectDate('#' + inst.id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ inst.stayOpen = false;
+ if (this._datepickerShowing) {
+ duration = (duration != null ? duration : this._get(inst, 'duration'));
+ var showAnim = this._get(inst, 'showAnim');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ };
+ if (duration != '' && $.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
+ duration, postProcess);
+ else
+ inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
+ if (duration == '')
+ this._tidyDialog(inst);
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ this._curInst = null;
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker(null, '');
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input[0].focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ if (inst.stayOpen) {
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ }
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ if (inst.stayOpen) {
+ inst.rangeStart = this._daylightSavingAdjust(
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst.stayOpen = false;
+ inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else if (!inst.stayOpen) {
+ this._hideDatepicker(null, this._get(inst, 'duration'));
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input[0].focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
+ var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
+ var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
+ firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
+ if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
+ checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
+ return $.datepicker.iso8601Week(checkDate);
+ } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
+ firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
+ if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
+ return 1;
+ }
+ }
+ return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
+ var size = origSize;
+ var num = 0;
+ while (size > 0 && iValue < value.length &&
+ value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
+ num = num * 10 + parseInt(value.charAt(iValue++),10);
+ size--;
+ }
+ if (size == origSize)
+ throw 'Missing number at position ' + iValue;
+ return num;
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ var size = 0;
+ for (var j = 0; j < names.length; j++)
+ size = Math.max(size, names[j].length);
+ var name = '';
+ var iInit = iValue;
+ while (size > 0 && iValue < value.length) {
+ name += value.charAt(iValue++);
+ for (var i = 0; i < names.length; i++)
+ if (name == names[i])
+ return i + 1;
+ size--;
+ }
+ throw 'Unknown name at position ' + iInit;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ var doy = date.getDate();
+ for (var m = date.getMonth() - 1; m >= 0; m--)
+ doy += this._getDaysInMonth(date.getFullYear(), m);
+ output += formatNumber('o', doy, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst) {
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.input ? inst.input.val() : null;
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ var date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ date = defaultDate;
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset, getDaysInMonth) {
+ var date = new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate :
+ (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, endDate) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._determineDate(date, new Date());
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var stepBigMonths = this._get(inst, 'stepBigMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>';
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var endDate = inst.endDay ? this._daylightSavingAdjust(
+ new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group ui-datepicker-group-';
+ switch (col) {
+ case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += 'middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = '';
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = '';
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = otherMonth || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="jQuery.datepicker._selectDay(\'#' +
+ inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
+ (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ui-state-active' : '') + // highlight selected day
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += (!inst.inline ? buttonPanel : '') +
+ ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, secondary, monthNames, monthNamesShort) {
+ minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var year = 0;
+ var endYear = 0;
+ if (years.length != 2) {
+ year = drawYear - 10;
+ endYear = drawYear + 10;
+ } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
+ year = drawYear + parseInt(years[0], 10);
+ endYear = drawYear + parseInt(years[1], 10);
+ } else {
+ year = parseInt(years[0], 10);
+ endYear = parseInt(years[1], 10);
+ }
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ if (showMonthAfterYear)
+ html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._daylightSavingAdjust(new Date(year, month, day));
+ // ensure it is within the bounds set
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
+ _getMinMaxDate: function(inst, minMax, checkRange) {
+ var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
+ return (!checkRange || !inst.rangeStart ? date :
+ (!date || inst.rangeStart > date ? inst.rangeStart : date));
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(
+ curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ // during range selection, use minimum of selected date and range start
+ var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
+ new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
+ newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
+ var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.6rc6";
+
+})(jQuery);
+/*
+ * jQuery UI Progressbar 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.progressbar", {
+
+ _init: function() {
+
+ var self = this,
+ options = this.options;
+
+ this.element
+ .addClass("ui-progressbar"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this._valueMin(),
+ "aria-valuemax": this._valueMax(),
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
+
+ this._refreshValue();
+
+ },
+
+ destroy: function() {
+
+ this.element
+ .removeClass("ui-progressbar"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .removeAttr("role")
+ .removeAttr("aria-valuemin")
+ .removeAttr("aria-valuemax")
+ .removeAttr("aria-valuenow")
+ .removeData("progressbar")
+ .unbind(".progressbar");
+
+ this.valueDiv.remove();
+
+ $.widget.prototype.destroy.apply(this, arguments);
+
+ },
+
+ value: function(newValue) {
+ arguments.length && this._setData("value", newValue);
+
+ return this._value();
+ },
+
+ _setData: function(key, value){
+ switch (key) {
+ case 'value':
+ this.options.value = value;
+ this._refreshValue();
+ this._trigger('change', null, {});
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _value: function() {
+ var val = this.options.value;
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+ },
+
+ _valueMin: function() {
+ var valueMin = 0;
+
+ return valueMin;
+ },
+
+ _valueMax: function() {
+ var valueMax = 100;
+
+ return valueMax;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
+ this.valueDiv.width(value + '%');
+ this.element.attr("aria-valuenow", value);
+ }
+
+});
+
+$.extend($.ui.progressbar, {
+ version: "1.6rc6",
+ defaults: {
+ value: 0
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Effects 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;(function($) {
+
+$.effects = $.effects || {}; //Add the 'effects' scope
+
+$.extend($.effects, {
+ version: "1.6rc6",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ //if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent();
+
+ //Cache width,height and float properties of the element, and create a wrapper around it
+ var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
+ element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
+ var wrapper = element.parent();
+
+ //Transfer the positioning of the element to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative'} );
+ } else {
+ var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
+ var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
+ wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+
+ wrapper.css(props);
+ return wrapper;
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ },
+
+ //Base function to animate from one class to another in a seamless transition
+ animateClass: function(value, duration, easing, callback) {
+
+ var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
+ var ea = (typeof easing == "string" ? easing : null);
+
+ return this.each(function() {
+
+ var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
+ if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
+ if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
+
+ //Let's get a style offset
+ var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
+ var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
+
+ // The main function to form the object for animation
+ for(var n in newStyle) {
+ if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
+ && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
+ && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
+ && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
+ && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
+ ) offset[n] = newStyle[n];
+ }
+
+ that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
+ // Change style attribute back to original. For stupid IE, we need to clear the damn object.
+ if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
+ if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
+ if(cb) cb.apply(this, arguments);
+ });
+
+ });
+ }
+});
+
+
+function _normalizeArguments(a, m) {
+
+ var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
+ var speed = a[1] && a[1].constructor != Object ? a[1] : o.duration; //either comes from options.duration or the second argument
+ speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+ var callback = o.callback || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );
+
+ return [a[0], o, speed, callback];
+
+}
+
+//Extend the methods of jQuery
+$.fn.extend({
+
+ //Save old methods
+ _show: $.fn.show,
+ _hide: $.fn.hide,
+ __toggle: $.fn.toggle,
+ _addClass: $.fn.addClass,
+ _removeClass: $.fn.removeClass,
+ _toggleClass: $.fn.toggleClass,
+
+ // New effect methods
+ effect: function(fx, options, speed, callback) {
+ return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
+ },
+
+ show: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._show.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
+ }
+ },
+
+ hide: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._hide.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
+ }
+ },
+
+ toggle: function(){
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function))
+ return this.__toggle.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
+ }
+ },
+
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+ toggleClass: function(classNames,speed,easing,callback) {
+ return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
+ },
+ morph: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ },
+ switchClass: function() {
+ return this.morph.apply(this, arguments);
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+/*
+ * jQuery Color Animations
+ * Copyright 2007 John Resig
+ * Released under the MIT and GPL licenses.
+ */
+
+// We override the animation for all of these color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
+ $.fx.step[attr] = function(fx) {
+ if ( fx.state == 0 ) {
+ fx.start = getColor( fx.elem, attr );
+ fx.end = getRGB( fx.end );
+ }
+
+ fx.elem.style[attr] = "rgb(" + [
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
+ ].join(",") + ")";
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
+/*
+ * jQuery UI Effects Blind 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop")) || 0;
+ offset.left -= parseInt(el.css("marginLeft")) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1]) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var color = o.options.color || "#ffff99"; // Default highlight color
+ var oldColor = el.css("backgroundColor");
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ el.css({backgroundImage: 'none', backgroundColor: color}); // Shift
+
+ // Animation
+ var animation = {backgroundColor: oldColor };
+ if (mode == "hide") animation['opacity'] = 0;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == "hide") el.hide();
+ $.effects.restore(el, props);
+ if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
+ if(o.callback) o.callback.apply(this, arguments);
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var times = o.options.times || 5; // Default # of times
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ if (mode == 'hide') times--;
+ if (el.is(':hidden')) { // Show fadeIn
+ el.css('opacity', 0);
+ el.show(); // Show
+ el.animate({opacity: 1}, duration, o.options.easing);
+ times = times-2;
+ }
+
+ // Animate
+ for (var i = 0; i < times; i++) { // Pulsate
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
+ };
+ if (mode == 'hide') { // Last Pulse
+ el.animate({opacity: 0}, duration, o.options.easing, function(){
+ el.hide(); // Hide
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var percent = parseInt(o.options.percent) || 150; // Set default puff percent
+ options.fade = true; // It's not a puff if it doesn't fade! :)
+ var original = {height: el.height(), width: el.width()}; // Save original
+
+ // Adjust
+ var factor = percent / 100;
+ el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};
+
+ // Animation
+ options.from = el.from;
+ options.percent = (mode == 'hide') ? percent : 100;
+ options.mode = mode;
+
+ // Animate
+ el.effect('scale', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent) || (parseInt(o.options.percent) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Transfer 1.6rc6
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var target = $(o.options.to); // Find Target
+ var position = el.offset();
+ var transfer = $('<div class="ui-effects-transfer"></div>').appendTo(document.body);
+ if(o.options.className) transfer.addClass(o.options.className);
+
+ // Set target css
+ transfer.addClass(o.options.className);
+ transfer.css({
+ top: position.top,
+ left: position.left,
+ height: el.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')),
+ width: el.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth')),
+ position: 'absolute'
+ });
+
+ // Animation
+ position = target.offset();
+ animation = {
+ top: position.top,
+ left: position.left,
+ height: target.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')),
+ width: target.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth'))
+ };
+
+ // Animate
+ transfer.animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove(); // Remove div
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*\r
+ * jQuery UI 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI\r
+ */\r(function(c){var i=c.fn.remove,d=c.browser.mozilla&&(parseFloat(c.browser.version)<1.9);c.ui={version:"1.6rc6",plugin:{add:function(k,l,n){var m=c.ui[k].prototype;for(var j in n){m.plugins[j]=m.plugins[j]||[];m.plugins[j].push([l,n[j]])}},call:function(j,l,k){var n=j.plugins[l];if(!n){return}for(var m=0;m<n.length;m++){if(j.options[n[m][0]]){n[m][1].apply(j.element,k)}}}},contains:function(k,j){return document.compareDocumentPosition?k.compareDocumentPosition(j)&16:k!==j&&k.contains(j)},cssCache:{},css:function(j){if(c.ui.cssCache[j]){return c.ui.cssCache[j]}var k=c('<div class="ui-gen"></div>').addClass(j).css({position:"absolute",top:"-5000px",left:"-5000px",display:"block"}).appendTo("body");c.ui.cssCache[j]=!!((!(/auto|default/).test(k.css("cursor"))||(/^[1-9]/).test(k.css("height"))||(/^[1-9]/).test(k.css("width"))||!(/none/).test(k.css("backgroundImage"))||!(/transparent|rgba\(0, 0, 0, 0\)/).test(k.css("backgroundColor"))));try{c("body").get(0).removeChild(k.get(0))}catch(l){}return c.ui.cssCache[j]},hasScroll:function(m,k){if(c(m).css("overflow")=="hidden"){return false}var j=(k&&k=="left")?"scrollLeft":"scrollTop",l=false;if(m[j]>0){return true}m[j]=1;l=(m[j]>0);m[j]=0;return l},isOverAxis:function(k,j,l){return(k>j)&&(k<(j+l))},isOver:function(o,k,n,m,j,l){return c.ui.isOverAxis(o,n,j)&&c.ui.isOverAxis(k,m,l)},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(d){var f=c.attr,e=c.fn.removeAttr,h="http://www.w3.org/2005/07/aaa",a=/^aria-/,b=/^wairole:/;c.attr=function(k,j,l){var m=l!==undefined;return(j=="role"?(m?f.call(this,k,j,"wairole:"+l):(f.apply(this,arguments)||"").replace(b,"")):(a.test(j)?(m?k.setAttributeNS(h,j.replace(a,"aaa:"),l):f.call(this,k,j.replace(a,"aaa:"))):f.apply(this,arguments)))};c.fn.removeAttr=function(j){return(a.test(j)?this.each(function(){this.removeAttributeNS(h,j.replace(a,""))}):e.call(this,j))}}c.fn.extend({remove:function(){c("*",this).add(this).each(function(){c(this).triggerHandler("remove")});return i.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},scrollParent:function(){var j;if((c.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){j=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(c.curCSS(this,"position",1))&&(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}else{j=this.parents().filter(function(){return(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!j.length?c(document):j}});c.extend(c.expr[":"],{data:function(l,k,j){return !!c.data(l,j[3])},focusable:function(k){var l=k.nodeName.toLowerCase(),j=c.attr(k,"tabindex");return(/input|select|textarea|button|object/.test(l)?!k.disabled:"a"==l||"area"==l?k.href||!isNaN(j):!isNaN(j))&&!c(k)["area"==l?"parents":"closest"](":hidden").length},tabbable:function(k){var j=c.attr(k,"tabindex");return(isNaN(j)||j>=0)&&c(k).is(":focusable")}});function g(m,n,o,l){function k(q){var p=c[m][n][q]||[];return(typeof p=="string"?p.split(/,?\s+/):p)}var j=k("getter");if(l.length==1&&typeof l[0]=="string"){j=j.concat(k("getterSetter"))}return(c.inArray(o,j)!=-1)}c.widget=function(k,j){var l=k.split(".")[0];k=k.split(".")[1];c.fn[k]=function(p){var n=(typeof p=="string"),o=Array.prototype.slice.call(arguments,1);if(n&&p.substring(0,1)=="_"){return this}if(n&&g(l,k,p,o)){var m=c.data(this[0],k);return(m?m[p].apply(m,o):undefined)}return this.each(function(){var q=c.data(this,k);(!q&&!n&&c.data(this,k,new c[l][k](this,p))._init());(q&&n&&c.isFunction(q[p])&&q[p].apply(q,o))})};c[l]=c[l]||{};c[l][k]=function(o,n){var m=this;this.namespace=l;this.widgetName=k;this.widgetEventPrefix=c[l][k].eventPrefix||k;this.widgetBaseClass=l+"-"+k;this.options=c.extend({},c.widget.defaults,c[l][k].defaults,c.metadata&&c.metadata.get(o)[k],n);this.element=c(o).bind("setData."+k,function(q,p,r){if(q.target==o){return m._setData(p,r)}}).bind("getData."+k,function(q,p){if(q.target==o){return m._getData(p)}}).bind("remove",function(){return m.destroy()})};c[l][k].prototype=c.extend({},c.widget.prototype,j);c[l][k].getterSetter="option"};c.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").removeAttr("aria-disabled")},option:function(l,m){var k=l,j=this;if(typeof l=="string"){if(m===undefined){return this._getData(l)}k={};k[l]=m}c.each(k,function(n,o){j._setData(n,o)})},_getData:function(j){return this.options[j]},_setData:function(j,k){this.options[j]=k;if(j=="disabled"){this.element[k?"addClass":"removeClass"](this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").attr("aria-disabled",k)}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(l,m,n){var p=this.options[l],j=(l==this.widgetEventPrefix?l:this.widgetEventPrefix+l);m=c.Event(m);m.type=j;if(m.originalEvent){for(var k=c.event.props.length,o;k;){o=c.event.props[--k];m[o]=m.originalEvent[o]}}this.element.trigger(m,n);return !(c.isFunction(p)&&p.call(this.element[0],m,n)===false||m.isDefaultPrevented())}};c.widget.defaults={disabled:false};c.ui.mouse={_mouseInit:function(){var j=this;this.element.bind("mousedown."+this.widgetName,function(k){return j._mouseDown(k)}).bind("click."+this.widgetName,function(k){if(j._preventClickEvent){j._preventClickEvent=false;return false}});if(c.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(c.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(l){if(l.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(l));this._mouseDownEvent=l;var k=this,m=(l.which==1),j=(typeof this.options.cancel=="string"?c(l.target).parents().add(l.target).filter(this.options.cancel).length:false);if(!m||j||!this._mouseCapture(l)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){k.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(l)&&this._mouseDelayMet(l)){this._mouseStarted=(this._mouseStart(l)!==false);if(!this._mouseStarted){l.preventDefault();return true}}this._mouseMoveDelegate=function(n){return k._mouseMove(n)};this._mouseUpDelegate=function(n){return k._mouseUp(n)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);(c.browser.safari||l.preventDefault());l.originalEvent.mouseHandled=true;return true},_mouseMove:function(j){if(c.browser.msie&&!j.button){return this._mouseUp(j)}if(this._mouseStarted){this._mouseDrag(j);return j.preventDefault()}if(this._mouseDistanceMet(j)&&this._mouseDelayMet(j)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,j)!==false);(this._mouseStarted?this._mouseDrag(j):this._mouseUp(j))}return !this._mouseStarted},_mouseUp:function(j){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=true;this._mouseStop(j)}return false},_mouseDistanceMet:function(j){return(Math.max(Math.abs(this._mouseDownEvent.pageX-j.pageX),Math.abs(this._mouseDownEvent.pageY-j.pageY))>=this.options.distance)},_mouseDelayMet:function(j){return this.mouseDelayMet},_mouseStart:function(j){},_mouseDrag:function(j){},_mouseStop:function(j){},_mouseCapture:function(j){return true}};c.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery);;/*\r
+ * jQuery UI Draggable 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Draggables\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(a){a.widget("ui.draggable",a.extend({},a.ui.mouse,{_init:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.cssNamespace&&this.element.addClass(this.options.cssNamespace+"-draggable"));(this.options.disabled&&this.element.addClass(this.options.cssNamespace+"-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass(this.options.cssNamespace+"-draggable "+this.options.cssNamespace+"-draggable-dragging "+this.options.cssNamespace+"-draggable-disabled");this._mouseDestroy()},_mouseCapture:function(b){var c=this.options;if(this.helper||c.disabled||a(b.target).is("."+this.options.cssNamespace+"-resizable-handle")){return false}this.handle=this._getHandle(b);if(!this.handle){return false}return true},_mouseStart:function(b){var c=this.options;this.helper=this._createHelper(b);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(b);this.originalPageX=b.pageX;this.originalPageY=b.pageY;if(c.cursorAt){this._adjustOffsetFromHelper(c.cursorAt)}if(c.containment){this._setContainment()}this._trigger("start",b);this._cacheHelperProportions();if(a.ui.ddmanager&&!c.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,b)}this.helper.addClass(c.cssNamespace+"-draggable-dragging");this._mouseDrag(b,true);return true},_mouseDrag:function(b,d){this.position=this._generatePosition(b);this.positionAbs=this._convertPositionTo("absolute");if(!d){var c=this._uiHash();this._trigger("drag",b,c);this.position=c.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,b)}return false},_mouseStop:function(c){var d=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){d=a.ui.ddmanager.drop(this,c)}if(this.dropped){d=this.dropped;this.dropped=false}if((this.options.revert=="invalid"&&!d)||(this.options.revert=="valid"&&d)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,d))){var b=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){b._trigger("stop",c);b._clear()})}else{this._trigger("stop",c);this._clear()}return false},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==b.target){c=true}});return c},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c])):(d.helper=="clone"?this.element.clone():this.element);if(!b.parents("body").length){b.appendTo((d.appendTo=="parent"?this.element[0].parentNode:d.appendTo))}if(b[0]!=this.element[0]&&!(/(fixed|absolute)/).test(b.css("position"))){b.css("position","absolute")}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body&&a.browser.mozilla)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.element.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)&&e.containment.constructor!=Array){var c=a(e.containment)[0];if(!c){return}var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}else{if(e.containment.constructor==Array){this.containment=e.containment}}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c)}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.left<this.containment[0]){d=this.containment[0]+this.offset.click.left}if(e.pageY-this.offset.click.top<this.containment[1]){c=this.containment[1]+this.offset.click.top}if(e.pageX-this.offset.click.left>this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:(!(g-this.offset.click.top<this.containment[1])?g-h.grid[1]:g+h.grid[1])):g;var f=this.originalPageX+Math.round((d-this.originalPageX)/h.grid[0])*h.grid[0];d=this.containment?(!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:(!(f-this.offset.click.left<this.containment[0])?f-h.grid[0]:f+h.grid[0])):f}}return{top:(c-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(i?0:b.scrollTop()))),left:(d-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:b.scrollLeft()))}},_clear:function(){this.helper.removeClass(this.options.cssNamespace+"-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval){this.helper.remove()}this.helper=null;this.cancelHelperRemoval=false},_trigger:function(b,c,d){d=d||this._uiHash();a.ui.plugin.call(this,b,[c,d]);if(b=="drag"){this.positionAbs=this._convertPositionTo("absolute")}return a.widget.prototype._trigger.call(this,b,c,d)},plugins:{},_uiHash:function(b){return{helper:this.helper,position:this.position,absolutePosition:this.positionAbs,offset:this.positionAbs}}}));a.extend(a.ui.draggable,{version:"1.6rc6",eventPrefix:"drag",defaults:{appendTo:"parent",axis:false,cancel:":input,option",connectToSortable:false,containment:false,cssNamespace:"ui",cursor:"default",cursorAt:false,delay:0,distance:1,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false}});a.ui.plugin.add("draggable","connectToSortable",{start:function(b,d){var c=a(this).data("draggable"),e=c.options;c.sortables=[];a(e.connectToSortable).each(function(){a(typeof this=="string"?this+"":this).each(function(){if(a.data(this,"sortable")){var f=a.data(this,"sortable");c.sortables.push({instance:f,shouldRevert:f.options.revert});f._refreshItems();f._trigger("activate",b,c)}})})},stop:function(b,d){var c=a(this).data("draggable");a.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert){this.instance.options.revert=true}this.instance._mouseStop(b);this.instance.options.helper=this.instance.options._helper;if(c.options.helper=="original"){this.instance.currentItem.css({top:"auto",left:"auto"})}}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",b,c)}})},drag:function(c,f){var e=a(this).data("draggable"),b=this;var d=function(i){var n=this.offset.click.top,m=this.offset.click.left;var g=this.positionAbs.top,k=this.positionAbs.left;var j=i.height,l=i.width;var p=i.top,h=i.left;return a.ui.isOver(g+n,k+m,p,h,j,l)};a.each(e.sortables,function(g){if(d.call(e,this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(b).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c,true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=e.offset.click.top;this.instance.offset.click.left=e.offset.click.left;this.instance.offset.parent.left-=e.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=e.offset.parent.top-this.instance.offset.parent.top;e._trigger("toSortable",c);e.dropped=this.instance.element;this.instance.fromOutside=e}if(this.instance.currentItem){this.instance._mouseDrag(c)}}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder){this.instance.placeholder.remove()}e._trigger("fromSortable",c);e.dropped=false}}})}});a.ui.plugin.add("draggable","cursor",{start:function(c,d){var b=a("body"),e=a(this).data("draggable").options;if(b.css("cursor")){e._cursor=b.css("cursor")}b.css("cursor",e.cursor)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._cursor){a("body").css("cursor",d._cursor)}}});a.ui.plugin.add("draggable","iframeFix",{start:function(b,c){var d=a(this).data("draggable").options;a(d.iframeFix===true?"iframe":d.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(b,c){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("opacity")){e._opacity=b.css("opacity")}b.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._opacity){a(c.helper).css("opacity",d._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(c,d){var b=a(this).data("draggable");if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){b.overflowOffset=b.scrollParent.offset()}},drag:function(d,e){var c=a(this).data("draggable"),f=c.options,b=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x"){if((c.overflowOffset.top+c.scrollParent[0].offsetHeight)-d.pageY<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop+f.scrollSpeed}else{if(d.pageY-c.overflowOffset.top<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop-f.scrollSpeed}}}if(!f.axis||f.axis!="y"){if((c.overflowOffset.left+c.scrollParent[0].offsetWidth)-d.pageX<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft+f.scrollSpeed}else{if(d.pageX-c.overflowOffset.left<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft-f.scrollSpeed}}}}else{if(!f.axis||f.axis!="x"){if(d.pageY-a(document).scrollTop()<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()-f.scrollSpeed)}else{if(a(window).height()-(d.pageY-a(document).scrollTop())<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()+f.scrollSpeed)}}}if(!f.axis||f.axis!="y"){if(d.pageX-a(document).scrollLeft()<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()-f.scrollSpeed)}else{if(a(window).width()-(d.pageX-a(document).scrollLeft())<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()+f.scrollSpeed)}}}}if(b!==false&&a.ui.ddmanager&&!f.dropBehaviour){a.ui.ddmanager.prepareOffsets(c,d)}}});a.ui.plugin.add("draggable","snap",{start:function(c,d){var b=a(this).data("draggable"),e=b.options;b.snapElements=[];a(e.snap.constructor!=String?(e.snap.items||":data(draggable)"):e.snap).each(function(){var g=a(this);var f=g.offset();if(this!=b.element[0]){b.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:f.top,left:f.left})}})},drag:function(u,p){var g=a(this).data("draggable"),q=g.options;var y=q.snapTolerance;var x=p.absolutePosition.left,w=x+g.helperProportions.width,f=p.absolutePosition.top,e=f+g.helperProportions.height;for(var v=g.snapElements.length-1;v>=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y<x&&x<n+y&&m-y<f&&f<A+y)||(s-y<x&&x<n+y&&m-y<e&&e<A+y)||(s-y<w&&w<n+y&&m-y<f&&f<A+y)||(s-y<w&&w<n+y&&m-y<e&&e<A+y))){if(g.snapElements[v].snapping){(g.options.snap.release&&g.options.snap.release.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=false;continue}if(q.snapMode!="inner"){var c=Math.abs(m-e)<=y;var z=Math.abs(A-f)<=y;var j=Math.abs(s-w)<=y;var k=Math.abs(n-x)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s-g.helperProportions.width}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n}).left-g.margins.left}}var h=(c||z||j||k);if(q.snapMode!="outer"){var c=Math.abs(m-f)<=y;var z=Math.abs(A-e)<=y;var j=Math.abs(s-x)<=y;var k=Math.abs(n-w)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A-g.helperProportions.height,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n-g.helperProportions.width}).left-g.margins.left}}if(!g.snapElements[v].snapping&&(c||z||j||k||h)){(g.options.snap.snap&&g.options.snap.snap.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=(c||z||j||k||h)}}});a.ui.plugin.add("draggable","stack",{start:function(b,c){var e=a(this).data("draggable").options;var d=a.makeArray(a(e.stack.group)).sort(function(g,f){return(parseInt(a(g).css("zIndex"),10)||e.stack.min)-(parseInt(a(f).css("zIndex"),10)||e.stack.min)});a(d).each(function(f){this.style.zIndex=e.stack.min+f});this[0].style.zIndex=e.stack.min+d.length}});a.ui.plugin.add("draggable","zIndex",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("zIndex")){e._zIndex=b.css("zIndex")}b.css("zIndex",e.zIndex)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._zIndex){a(c.helper).css("zIndex",d._zIndex)}}})})(jQuery);;/*\r
+ * jQuery UI Droppable 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Droppables\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ * ui.draggable.js\r
+ */\r(function(a){a.widget("ui.droppable",{_init:function(){var c=this.options,b=c.accept;this.isover=0;this.isout=1;this.options.accept=this.options.accept&&a.isFunction(this.options.accept)?this.options.accept:function(e){return e.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};a.ui.ddmanager.droppables[this.options.scope]=a.ui.ddmanager.droppables[this.options.scope]||[];a.ui.ddmanager.droppables[this.options.scope].push(this);(this.options.cssNamespace&&this.element.addClass(this.options.cssNamespace+"-droppable"))},destroy:function(){var b=a.ui.ddmanager.droppables[this.options.scope];for(var c=0;c<b.length;c++){if(b[c]==this){b.splice(c,1)}}this.element.removeClass(this.options.cssNamespace+"-droppable "+this.options.cssNamespace+"-droppable-disabled").removeData("droppable").unbind(".droppable")},_setData:function(b,c){if(b=="accept"){this.options.accept=c&&a.isFunction(c)?c:function(e){return e.is(accept)}}else{a.widget.prototype._setData.apply(this,arguments)}},_activate:function(c){var b=a.ui.ddmanager.current;if(this.options.activeClass){this.element.addClass(this.options.activeClass)}(b&&this._trigger("activate",c,this.ui(b)))},_deactivate:function(c){var b=a.ui.ddmanager.current;if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}(b&&this._trigger("deactivate",c,this.ui(b)))},_over:function(c){var b=a.ui.ddmanager.current;if(!b||(b.currentItem||b.element)[0]==this.element[0]){return}if(this.options.accept.call(this.element[0],(b.currentItem||b.element))){if(this.options.hoverClass){this.element.addClass(this.options.hoverClass)}this._trigger("over",c,this.ui(b))}},_out:function(c){var b=a.ui.ddmanager.current;if(!b||(b.currentItem||b.element)[0]==this.element[0]){return}if(this.options.accept.call(this.element[0],(b.currentItem||b.element))){if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("out",c,this.ui(b))}},_drop:function(c,d){var b=d||a.ui.ddmanager.current;if(!b||(b.currentItem||b.element)[0]==this.element[0]){return false}var e=false;this.element.find(":data(droppable)").not("."+b.options.cssNamespace+"-draggable-dragging").each(function(){var f=a.data(this,"droppable");if(f.options.greedy&&a.ui.intersect(b,a.extend(f,{offset:f.element.offset()}),f.options.tolerance)){e=true;return false}});if(e){return false}if(this.options.accept.call(this.element[0],(b.currentItem||b.element))){if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("drop",c,this.ui(b));return this.element}return false},ui:function(b){return{draggable:(b.currentItem||b.element),helper:b.helper,position:b.position,absolutePosition:b.positionAbs,offset:b.positionAbs}}});a.extend(a.ui.droppable,{version:"1.6rc6",eventPrefix:"drop",defaults:{accept:"*",activeClass:false,cssNamespace:"ui",greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"}});a.ui.intersect=function(q,j,o){if(!j.offset){return false}var e=(q.positionAbs||q.position.absolute).left,d=e+q.helperProportions.width,n=(q.positionAbs||q.position.absolute).top,m=n+q.helperProportions.height;var g=j.offset.left,c=g+j.proportions.width,p=j.offset.top,k=p+j.proportions.height;switch(o){case"fit":return(g<e&&d<c&&p<n&&m<k);break;case"intersect":return(g<e+(q.helperProportions.width/2)&&d-(q.helperProportions.width/2)<c&&p<n+(q.helperProportions.height/2)&&m-(q.helperProportions.height/2)<k);break;case"pointer":var h=((q.positionAbs||q.position.absolute).left+(q.clickOffset||q.offset.click).left),i=((q.positionAbs||q.position.absolute).top+(q.clickOffset||q.offset.click).top),f=a.ui.isOver(i,h,p,g,j.proportions.height,j.proportions.width);return f;break;case"touch":return((n>=p&&n<=k)||(m>=p&&m<=k)||(n<p&&m>k))&&((e>=g&&e<=c)||(d>=g&&d<=c)||(e<g&&d>c));break;default:return false;break}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(e,g){var b=a.ui.ddmanager.droppables[e.options.scope];var f=g?g.type:null;var h=(e.currentItem||e.element).find(":data(droppable)").andSelf();droppablesLoop:for(var d=0;d<b.length;d++){if(b[d].options.disabled||(e&&!b[d].options.accept.call(b[d].element[0],(e.currentItem||e.element)))){continue}for(var c=0;c<h.length;c++){if(h[c]==b[d].element[0]){b[d].proportions.height=0;continue droppablesLoop}}b[d].visible=b[d].element.css("display")!="none";if(!b[d].visible){continue}b[d].offset=b[d].element.offset();b[d].proportions={width:b[d].element[0].offsetWidth,height:b[d].element[0].offsetHeight};if(f=="mousedown"){b[d]._activate.call(b[d],g)}}},drop:function(b,c){var d=false;a.each(a.ui.ddmanager.droppables[b.options.scope],function(){if(!this.options){return}if(!this.options.disabled&&this.visible&&a.ui.intersect(b,this,this.options.tolerance)){d=this._drop.call(this,c)}if(!this.options.disabled&&this.visible&&this.options.accept.call(this.element[0],(b.currentItem||b.element))){this.isout=1;this.isover=0;this._deactivate.call(this,c)}});return d},drag:function(b,c){if(b.options.refreshPositions){a.ui.ddmanager.prepareOffsets(b,c)}a.each(a.ui.ddmanager.droppables[b.options.scope],function(){if(this.options.disabled||this.greedyChild||!this.visible){return}var e=a.ui.intersect(b,this,this.options.tolerance);var g=!e&&this.isover==1?"isout":(e&&this.isover==0?"isover":null);if(!g){return}var f;if(this.options.greedy){var d=this.element.parents(":data(droppable):eq(0)");if(d.length){f=a.data(d[0],"droppable");f.greedyChild=(g=="isover"?1:0)}}if(f&&g=="isover"){f.isover=0;f.isout=1;f._out.call(f,c)}this[g]=1;this[g=="isout"?"isover":"isout"]=0;this[g=="isover"?"_over":"_out"].call(this,c);if(f&&g=="isout"){f.isout=0;f.isover=1;f._over.call(f,c)}})}}})(jQuery);;/*\r
+ * jQuery UI Resizable 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Resizables\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(b){b.widget("ui.resizable",b.extend({},b.ui.mouse,{_init:function(){var d=this,h=this.options;this.element.addClass("ui-resizable");b.extend(this,{_aspectRatio:!!(h.aspectRatio),aspectRatio:h.aspectRatio,originalElement:this.element,proportionallyResize:h.proportionallyResize?[h.proportionallyResize]:[],_helper:h.helper||h.ghost||h.animate?h.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css("position"))&&b.browser.opera){this.element.css({position:"relative",top:"auto",left:"auto"})}this.element.wrap(b('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent();this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});if(b.browser.safari&&h.preventDefault){this.originalElement.css("resize","none")}this.proportionallyResize.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=h.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var j=this.handles.split(",");this.handles={};for(var e=0;e<j.length;e++){var g=b.trim(j[e]),c="ui-resizable-"+g;var f=b('<div class="ui-resizable-handle '+c+'"></div>');if(/sw|se|ne|nw/.test(g)){f.css({zIndex:++h.zIndex})}if("se"==g){f.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[g]=".ui-resizable-"+g;this.element.append(f)}}this._renderAxis=function(o){o=o||this.element;for(var l in this.handles){if(this.handles[l].constructor==String){this.handles[l]=b(this.handles[l],this.element).show()}if(h.transparent){this.handles[l].css({opacity:0})}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var m=b(this.handles[l],this.element),n=0;n=/sw|ne|nw|se|n|s/.test(l)?m.outerHeight():m.outerWidth();var k=["padding",/ne|nw|n/.test(l)?"Top":/se|sw|s/.test(l)?"Bottom":/^e$/.test(l)?"Right":"Left"].join("");if(!h.transparent){o.css(k,n)}this._proportionallyResize()}if(!b(this.handles[l]).length){continue}}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element);if(h.disableSelection){this._handles.disableSelection()}this._handles.mouseover(function(){if(!d.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}d.axis=i&&i[1]?i[1]:"se"}});if(h.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");d._handles.show()},function(){if(!d.resizing){b(this).addClass("ui-resizable-autohide");d._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var c=function(d){b(d).removeClass("ui-resizable ui-resizable-disabled").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){c(this.element);this.wrapper.parent().append(this.originalElement.css({position:this.wrapper.css("position"),width:this.wrapper.outerWidth(),height:this.wrapper.outerHeight(),top:this.wrapper.css("top"),left:this.wrapper.css("left")})).end().remove()}c(this.originalElement)},_mouseCapture:function(d){var e=false;for(var c in this.handles){if(b(this.handles[c])[0]==d.target){e=true}}return this.options.disabled||!!e},_mouseStart:function(e){var h=this.options,d=this.element.position(),c=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(c.is(".ui-draggable")||(/absolute/).test(c.css("position"))){c.css({position:"absolute",top:d.top,left:d.left})}if(b.browser.opera&&(/relative/).test(c.css("position"))){c.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var i=a(this.helper.css("left")),f=a(this.helper.css("top"));if(h.containment){i+=b(h.containment).scrollLeft()||0;f+=b(h.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:i,top:f};this.size=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalSize=this._helper?{width:c.outerWidth(),height:c.outerHeight()}:{width:c.width(),height:c.height()};this.originalPosition={left:i,top:f};this.sizeDiff={width:c.outerWidth()-c.width(),height:c.outerHeight()-c.height()};this.originalMousePosition={left:e.pageX,top:e.pageY};this.aspectRatio=(typeof h.aspectRatio=="number")?h.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);if(h.preserveCursor){var g=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",g=="auto"?this.axis+"-resize":g)}this._propagate("start",e);return true},_mouseDrag:function(c){var f=this.helper,e=this.options,k={},n=this,h=this.originalMousePosition,l=this.axis;var p=(c.pageX-h.left)||0,m=(c.pageY-h.top)||0;var g=this._change[l];if(!g){return false}var j=g.apply(this,[c,p,m]),i=b.browser.msie&&b.browser.version<7,d=this.sizeDiff;if(this._aspectRatio||c.shiftKey){j=this._updateRatio(j,c)}j=this._respectSize(j,c);this._propagate("resize",c);f.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this.proportionallyResize.length){this._proportionallyResize()}this._updateCache(j);this._trigger("resize",c,this.ui());return false},_mouseStop:function(f){this.resizing=false;var g=this.options,k=this;if(this._helper){var e=this.proportionallyResize,c=e.length&&(/textarea/i).test(e[0].nodeName),d=c&&b.ui.hasScroll(e[0],"left")?0:k.sizeDiff.height,i=c?0:k.sizeDiff.width;var l={width:(k.size.width-i),height:(k.size.height-d)},h=(parseInt(k.element.css("left"),10)+(k.position.left-k.originalPosition.left))||null,j=(parseInt(k.element.css("top"),10)+(k.position.top-k.originalPosition.top))||null;if(!g.animate){this.element.css(b.extend(l,{top:j,left:h}))}if(this._helper&&!g.animate){this._proportionallyResize()}}if(g.preserveCursor){b("body").css("cursor","auto")}this._propagate("stop",f);if(this._helper){this.helper.remove()}return false},_updateCache:function(c){var d=this.options;this.offset=this.helper.offset();if(c.left){this.position.left=c.left}if(c.top){this.position.top=c.top}if(c.height){this.size.height=c.height}if(c.width){this.size.width=c.width}},_updateRatio:function(f,e){var g=this.options,h=this.position,d=this.size,c=this.axis;if(f.height){f.width=(d.height*this.aspectRatio)}else{if(f.width){f.height=(d.width/this.aspectRatio)}}if(c=="sw"){f.left=h.left+(d.width-f.width);f.top=null}if(c=="nw"){f.top=h.top+(d.height-f.height);f.left=h.left+(d.width-f.width)}return f},_respectSize:function(j,e){var r=function(o){return !isNaN(parseInt(o,10))};var h=this.helper,g=this.options,p=this._aspectRatio||e.shiftKey,n=this.axis,s=r(j.width)&&g.maxWidth&&(g.maxWidth<j.width),k=r(j.height)&&g.maxHeight&&(g.maxHeight<j.height),f=r(j.width)&&g.minWidth&&(g.minWidth>j.width),q=r(j.height)&&g.minHeight&&(g.minHeight>j.height);if(f){j.width=g.minWidth}if(q){j.height=g.minHeight}if(s){j.width=g.maxWidth}if(k){j.height=g.maxHeight}var d=this.originalPosition.left+this.originalSize.width,m=this.position.top+this.size.height;var i=/sw|nw|w/.test(n),c=/nw|ne|n/.test(n);if(f&&i){j.left=d-g.minWidth}if(s&&i){j.left=d-g.maxWidth}if(q&&c){j.top=m-g.minHeight}if(k&&c){j.top=m-g.maxHeight}var l=!j.width&&!j.height;if(l&&!j.left&&j.top){j.top=null}else{if(l&&!j.top&&j.left){j.left=null}}return j},_proportionallyResize:function(){var h=this.options;if(!this.proportionallyResize.length){return}var e=this.helper||this.element;for(var d=0;d<this.proportionallyResize.length;d++){var f=this.proportionallyResize[d];if(!this.borderDif){var c=[f.css("borderTopWidth"),f.css("borderRightWidth"),f.css("borderBottomWidth"),f.css("borderLeftWidth")],g=[f.css("paddingTop"),f.css("paddingRight"),f.css("paddingBottom"),f.css("paddingLeft")];this.borderDif=b.map(c,function(j,l){var k=parseInt(j,10)||0,m=parseInt(g[l],10)||0;return k+m})}if(b.browser.msie&&!(!(b(e).is(":hidden")||b(e).parents(":hidden").length))){continue}f.css({height:(e.height()-this.borderDif[0]-this.borderDif[2])||0,width:(e.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var d=this.element,g=this.options;this.elementOffset=d.offset();if(this._helper){this.helper=this.helper||b('<div style="overflow:hidden;"></div>');var c=b.browser.msie&&b.browser.version<7,e=(c?1:0),f=(c?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+f,height:this.element.outerHeight()+f,position:"absolute",left:this.elementOffset.left-e+"px",top:this.elementOffset.top-e+"px",zIndex:++g.zIndex});this.helper.appendTo("body");if(g.disableSelection){this.helper.disableSelection()}}else{this.helper=this.element}},_change:{e:function(e,d,c){return{width:this.originalSize.width+d}},w:function(f,d,c){var h=this.options,e=this.originalSize,g=this.originalPosition;return{left:g.left+d,width:e.width-d}},n:function(f,d,c){var h=this.options,e=this.originalSize,g=this.originalPosition;return{top:g.top+c,height:e.height-c}},s:function(e,d,c){return{height:this.originalSize.height+c}},se:function(e,d,c){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[e,d,c]))},sw:function(e,d,c){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[e,d,c]))},ne:function(e,d,c){return b.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[e,d,c]))},nw:function(e,d,c){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[e,d,c]))}},_propagate:function(d,c){b.ui.plugin.call(this,d,[c,this.ui()]);(d!="resize"&&this._trigger(d,c,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}));b.extend(b.ui.resizable,{version:"1.6rc6",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,disableSelection:true,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,preserveCursor:true,preventDefault:true,proportionallyResize:false,transparent:false,zIndex:1000}});b.ui.plugin.add("resizable","alsoResize",{start:function(d,e){var c=b(this).data("resizable"),f=c.options;_store=function(g){b(g).each(function(){b(this).data("resizable-alsoresize",{width:parseInt(b(this).width(),10),height:parseInt(b(this).height(),10),left:parseInt(b(this).css("left"),10),top:parseInt(b(this).css("top"),10)})})};if(typeof(f.alsoResize)=="object"&&!f.alsoResize.parentNode){if(f.alsoResize.length){f.alsoResize=f.alsoResize[0];_store(f.alsoResize)}else{b.each(f.alsoResize,function(g,h){_store(g)})}}else{_store(f.alsoResize)}},resize:function(e,g){var d=b(this).data("resizable"),h=d.options,f=d.originalSize,j=d.originalPosition;var i={height:(d.size.height-f.height)||0,width:(d.size.width-f.width)||0,top:(d.position.top-j.top)||0,left:(d.position.left-j.left)||0},c=function(k,l){b(k).each(function(){var o=b(this),p=b(this).data("resizable-alsoresize"),n={},m=l&&l.length?l:["width","height","top","left"];b.each(m||["width","height","top","left"],function(q,s){var r=(p[s]||0)+(i[s]||0);if(r&&r>=0){n[s]=r||null}});if(/relative/.test(o.css("position"))&&b.browser.opera){d._revertToRelativePosition=true;o.css({position:"absolute",top:"auto",left:"auto"})}o.css(n)})};if(typeof(h.alsoResize)=="object"&&!h.alsoResize.nodeType){b.each(h.alsoResize,function(k,l){c(k,l)})}else{c(h.alsoResize)}},stop:function(d,e){var c=b(this).data("resizable");if(c._revertToRelativePosition&&b.browser.opera){c._revertToRelativePosition=false;el.css({position:"relative"})}b(this).removeData("resizable-alsoresize-start")}});b.ui.plugin.add("resizable","animate",{stop:function(g,l){var m=b(this).data("resizable"),h=m.options;var f=h.proportionallyResize,c=f&&(/textarea/i).test(f.get(0).nodeName),d=c&&b.ui.hasScroll(f.get(0),"left")?0:m.sizeDiff.height,j=c?0:m.sizeDiff.width;var e={width:(m.size.width-j),height:(m.size.height-d)},i=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,k=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;m.element.animate(b.extend(e,k&&i?{top:k,left:i}:{}),{duration:h.animateDuration,easing:h.animateEasing,step:function(){var n={width:parseInt(m.element.css("width"),10),height:parseInt(m.element.css("height"),10),top:parseInt(m.element.css("top"),10),left:parseInt(m.element.css("left"),10)};if(f){f.css({width:n.width,height:n.height})}m._updateCache(n);m._propagate("resize",g)}})}});b.ui.plugin.add("resizable","containment",{start:function(d,n){var r=b(this).data("resizable"),h=r.options,j=r.element;var e=h.containment,i=(e instanceof b)?e.get(0):(/parent/.test(e))?j.parent().get(0):e;if(!i){return}r.containerElement=b(i);if(/document/.test(e)||e==document){r.containerOffset={left:0,top:0};r.containerPosition={left:0,top:0};r.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var l=b(i),g=[];b(["Top","Right","Left","Bottom"]).each(function(p,o){g[p]=a(l.css("padding"+o))});r.containerOffset=l.offset();r.containerPosition=l.position();r.containerSize={height:(l.innerHeight()-g[3]),width:(l.innerWidth()-g[1])};var m=r.containerOffset,c=r.containerSize.height,k=r.containerSize.width,f=(b.ui.hasScroll(i,"left")?i.scrollWidth:k),q=(b.ui.hasScroll(i)?i.scrollHeight:c);r.parentData={element:i,left:m.left,top:m.top,width:f,height:q}}},resize:function(e,l){var p=b(this).data("resizable"),g=p.options,d=p.containerSize,k=p.containerOffset,i=p.size,j=p.position,m=g._aspectRatio||e.shiftKey,c={top:0,left:0},f=p.containerElement;if(f[0]!=document&&(/static/).test(f.css("position"))){c=k}if(j.left<(p._helper?k.left:0)){p.size.width=p.size.width+(p._helper?(p.position.left-k.left):(p.position.left-c.left));if(m){p.size.height=p.size.width/g.aspectRatio}p.position.left=g.helper?k.left:0}if(j.top<(p._helper?k.top:0)){p.size.height=p.size.height+(p._helper?(p.position.top-k.top):p.position.top);if(m){p.size.width=p.size.height*g.aspectRatio}p.position.top=p._helper?k.top:0}var h=Math.abs((p._helper?p.offset.left-c.left:(p.offset.left-c.left))+p.sizeDiff.width),n=Math.abs((p._helper?p.offset.top-c.top:(p.offset.top-k.top))+p.sizeDiff.height);if(h+p.size.width>=p.parentData.width){p.size.width=p.parentData.width-h;if(m){p.size.height=p.size.width/g.aspectRatio}}if(n+p.size.height>=p.parentData.height){p.size.height=p.parentData.height-n;if(m){p.size.width=p.size.height*g.aspectRatio}}},stop:function(d,l){var n=b(this).data("resizable"),e=n.options,j=n.position,k=n.containerOffset,c=n.containerPosition,f=n.containerElement;var g=b(n.helper),p=g.offset(),m=g.outerWidth()-n.sizeDiff.width,i=g.outerHeight()-n.sizeDiff.height;if(n._helper&&!e.animate&&(/relative/).test(f.css("position"))){b(this).css({left:p.left-c.left-k.left,width:m,height:i})}if(n._helper&&!e.animate&&(/static/).test(f.css("position"))){b(this).css({left:p.left-c.left-k.left,width:m,height:i})}}});b.ui.plugin.add("resizable","ghost",{start:function(e,f){var c=b(this).data("resizable"),g=c.options,h=g.proportionallyResize,d=c.size;c.ghost=c.originalElement.clone();c.ghost.css({opacity:0.25,display:"block",position:"relative",height:d.height,width:d.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof g.ghost=="string"?g.ghost:"");c.ghost.appendTo(c.helper)},resize:function(d,e){var c=b(this).data("resizable"),f=c.options;if(c.ghost){c.ghost.css({position:"relative",height:c.size.height,width:c.size.width})}},stop:function(d,e){var c=b(this).data("resizable"),f=c.options;if(c.ghost&&c.helper){c.helper.get(0).removeChild(c.ghost.get(0))}}});b.ui.plugin.add("resizable","grid",{resize:function(c,k){var m=b(this).data("resizable"),f=m.options,i=m.size,g=m.originalSize,h=m.originalPosition,l=m.axis,j=f._aspectRatio||c.shiftKey;f.grid=typeof f.grid=="number"?[f.grid,f.grid]:f.grid;var e=Math.round((i.width-g.width)/(f.grid[0]||1))*(f.grid[0]||1),d=Math.round((i.height-g.height)/(f.grid[1]||1))*(f.grid[1]||1);if(/^(se|s|e)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d}else{if(/^(ne)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d;m.position.top=h.top-d}else{if(/^(sw)$/.test(l)){m.size.width=g.width+e;m.size.height=g.height+d;m.position.left=h.left-e}else{m.size.width=g.width+e;m.size.height=g.height+d;m.position.top=h.top-d;m.position.left=h.left-e}}}}});var a=function(c){return parseInt(c,10)||0}})(jQuery);;/*\r
+ * jQuery UI Selectable 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Selectables\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(a){a.widget("ui.selectable",a.extend({},a.ui.mouse,{_init:function(){var b=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]);c.each(function(){var d=a(this);var e=d.offset();a.data(this,"selectable-item",{element:this,$element:d,left:e.left,top:e.top,right:e.left+d.outerWidth(),bottom:e.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a(document.createElement("div")).css({border:"1px dotted black"}).addClass("ui-selectable-helper")},destroy:function(){this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy()},_mouseStart:function(d){var b=this;this.opos=[d.pageX,d.pageY];if(this.options.disabled){return}var c=this.options;this.selectees=a(c.filter,this.element[0]);this._trigger("start",d);a("body").append(this.helper);this.helper.css({"z-index":100,position:"absolute",left:d.clientX,top:d.clientY,width:0,height:0});if(c.autoRefresh){this.refresh()}this.selectees.filter(".ui-selected").each(function(){var e=a.data(this,"selectable-item");e.startselected=true;if(!d.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;b._trigger("unselecting",d,{unselecting:e.element})}});a(d.target).parents().andSelf().each(function(){var e=a.data(this,"selectable-item");if(e){e.$element.removeClass("ui-unselecting").addClass("ui-selecting");e.unselecting=false;e.selecting=true;e.selected=true;b._trigger("selecting",d,{selecting:e.element});return false}})},_mouseDrag:function(i){var c=this;this.dragged=true;if(this.options.disabled){return}var e=this.options;var d=this.opos[0],h=this.opos[1],b=i.pageX,g=i.pageY;if(d>b){var f=b;b=d;d=f}if(h>g){var f=g;g=h;h=f}this.helper.css({left:d,top:h,width:b-d,height:g-h});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!j||j.element==c.element[0]){return}var k=false;if(e.tolerance=="touch"){k=(!(j.left>b||j.right<d||j.top>g||j.bottom<h))}else{if(e.tolerance=="fit"){k=(j.left>d&&j.right<b&&j.top>h&&j.bottom<g)}}if(k){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting");j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;c._trigger("selecting",i,{selecting:j.element})}}else{if(j.selecting){if(i.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}c._trigger("unselecting",i,{unselecting:j.element})}}if(j.selected){if(!i.metaKey&&!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;c._trigger("unselecting",i,{unselecting:j.element})}}}});return false},_mouseStop:function(d){var b=this;this.dragged=false;var c=this.options;a(".ui-unselecting",this.element[0]).each(function(){var e=a.data(this,"selectable-item");e.$element.removeClass("ui-unselecting");e.unselecting=false;e.startselected=false;b._trigger("unselected",d,{unselected:e.element})});a(".ui-selecting",this.element[0]).each(function(){var e=a.data(this,"selectable-item");e.$element.removeClass("ui-selecting").addClass("ui-selected");e.selecting=false;e.selected=true;e.startselected=true;b._trigger("selected",d,{selected:e.element})});this._trigger("stop",d);this.helper.remove();return false}}));a.extend(a.ui.selectable,{version:"1.6rc6",defaults:{appendTo:"body",autoRefresh:true,cancel:":input,option",delay:0,distance:0,filter:"*",tolerance:"touch"}})})(jQuery);;/*\r
+ * jQuery UI Sortable 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Sortables\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(a){a.widget("ui.sortable",a.extend({},a.ui.mouse,{_init:function(){var b=this.options;this.containerCache={};(this.options.cssNamespace&&this.element.addClass(this.options.cssNamespace+"-sortable"));this.refresh();this.floating=this.items.length?(/left|right/).test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass(this.options.cssNamespace+"-sortable "+this.options.cssNamespace+"-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--){this.items[b].item.removeData("sortable-item")}},_mouseCapture:function(e,f){if(this.reverting){return false}if(this.options.disabled||this.options.type=="static"){return false}this._refreshItems(e);var d=null,c=this,b=a(e.target).parents().each(function(){if(a.data(this,"sortable-item")==c){d=a(this);return false}});if(a.data(e.target,"sortable-item")==c){d=a(e.target)}if(!d){return false}if(this.options.handle&&!f){var g=false;a(this.options.handle,d).find("*").andSelf().each(function(){if(this==e.target){g=true}});if(!g){return false}}this.currentItem=d;this._removeCurrentsFromItems();return true},_mouseStart:function(e,f,b){var g=this.options,c=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(e);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:e.pageX-this.offset.left,top:e.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(e);this.originalPageX=e.pageX;this.originalPageY=e.pageY;if(g.cursorAt){this._adjustOffsetFromHelper(g.cursorAt)}this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide()}this._createPlaceholder();if(g.containment){this._setContainment()}if(g.cursor){if(a("body").css("cursor")){this._storedCursor=a("body").css("cursor")}a("body").css("cursor",g.cursor)}if(g.opacity){if(this.helper.css("opacity")){this._storedOpacity=this.helper.css("opacity")}this.helper.css("opacity",g.opacity)}if(g.zIndex){if(this.helper.css("zIndex")){this._storedZIndex=this.helper.css("zIndex")}this.helper.css("zIndex",g.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){this.overflowOffset=this.scrollParent.offset()}this._trigger("start",e,this._uiHash());if(!this._preserveHelperProportions){this._cacheHelperProportions()}if(!b){for(var d=this.containers.length-1;d>=0;d--){this.containers[d]._trigger("activate",e,c._uiHash(this))}}if(a.ui.ddmanager){a.ui.ddmanager.current=this}if(a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,e)}this.dragging=true;this.helper.addClass(g.cssNamespace+"-sortable-helper");this._mouseDrag(e);return true},_mouseDrag:function(f){this.position=this._generatePosition(f);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs}if(this.options.scroll){var g=this.options,b=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-f.pageY<g.scrollSensitivity){this.scrollParent[0].scrollTop=b=this.scrollParent[0].scrollTop+g.scrollSpeed}else{if(f.pageY-this.overflowOffset.top<g.scrollSensitivity){this.scrollParent[0].scrollTop=b=this.scrollParent[0].scrollTop-g.scrollSpeed}}if((this.overflowOffset.left+this.scrollParent[0].offsetWidth)-f.pageX<g.scrollSensitivity){this.scrollParent[0].scrollLeft=b=this.scrollParent[0].scrollLeft+g.scrollSpeed}else{if(f.pageX-this.overflowOffset.left<g.scrollSensitivity){this.scrollParent[0].scrollLeft=b=this.scrollParent[0].scrollLeft-g.scrollSpeed}}}else{if(f.pageY-a(document).scrollTop()<g.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()-g.scrollSpeed)}else{if(a(window).height()-(f.pageY-a(document).scrollTop())<g.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()+g.scrollSpeed)}}if(f.pageX-a(document).scrollLeft()<g.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()-g.scrollSpeed)}else{if(a(window).width()-(f.pageX-a(document).scrollLeft())<g.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()+g.scrollSpeed)}}}if(b!==false&&a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,f)}}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}for(var d=this.items.length-1;d>=0;d--){var e=this.items[d],c=e.item[0],h=this._intersectsWithPointer(e);if(!h){continue}if(c!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=c&&!a.ui.contains(this.placeholder[0],c)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],c):true)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e)){this.options.sortIndicator.call(this,f,e)}else{break}this._trigger("change",f,this._uiHash());break}}this._contactContainers(f);if(a.ui.ddmanager){a.ui.ddmanager.drag(this,f)}this._trigger("sort",f,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,d){if(!c){return}if(a.ui.ddmanager&&!this.options.dropBehaviour){a.ui.ddmanager.drop(this,c)}if(this.options.revert){var b=this;var e=b.placeholder.offset();b.reverting=true;a(this.helper).animate({left:e.left-this.offset.parent.left-b.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-b.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){b._clear(c)})}else{this._clear(c,d)}return false},cancel:function(){var b=this;if(this.dragging){this._mouseUp();if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass(this.options.cssNamespace+"-sortable-helper")}else{this.currentItem.show()}for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,b._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,b._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder[0].parentNode){this.placeholder[0].parentNode.removeChild(this.placeholder[0])}if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode){this.helper.remove()}a.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){a(this.domPosition.prev).after(this.currentItem)}else{a(this.domPosition.parent).prepend(this.currentItem)}return true},serialize:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};a(b).each(function(){var e=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||(/(.+)[-=_](.+)/));if(e){c.push((d.key||e[1]+"[]")+"="+(d.key&&d.expression?e[1]:e[2]))}});return c.join("&")},toArray:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};b.each(function(){c.push(a(d.item||this).attr(d.attribute||"id")||"")});return c},_intersectsWith:function(m){var e=this.positionAbs.left,d=e+this.helperProportions.width,k=this.positionAbs.top,j=k+this.helperProportions.height;var f=m.left,c=f+m.width,n=m.top,i=n+m.height;var o=this.offset.click.top,h=this.offset.click.left;var g=(k+o)>n&&(k+o)<i&&(e+h)>f&&(e+h)<c;if(this.options.tolerance=="pointer"||this.options.forcePointerForContainers||(this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>m[this.floating?"width":"height"])){return g}else{return(f<e+(this.helperProportions.width/2)&&d-(this.helperProportions.width/2)<c&&n<k+(this.helperProportions.height/2)&&j-(this.helperProportions.height/2)<i)}},_intersectsWithPointer:function(d){var e=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,d.top,d.height),c=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,d.left,d.width),g=e&&c,b=this._getDragVerticalDirection(),f=this._getDragHorizontalDirection();if(!g){return false}return this.floating?(((f&&f=="right")||b=="down")?2:1):(b&&(b=="down"?2:1))},_intersectsWithSides:function(e){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,e.top+(e.height/2),e.height),d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,e.left+(e.width/2),e.width),b=this._getDragVerticalDirection(),f=this._getDragHorizontalDirection();if(this.floating&&f){return((f=="right"&&d)||(f=="left"&&!d))}else{return b&&((b=="down"&&c)||(b=="up"&&!c))}},_getDragVerticalDirection:function(){var b=this.positionAbs.top-this.lastPositionAbs.top;return b!=0&&(b>0?"down":"up")},_getDragHorizontalDirection:function(){var b=this.positionAbs.left-this.lastPositionAbs.left;return b!=0&&(b>0?"right":"left")},refresh:function(b){this._refreshItems(b);this.refreshPositions()},_getItemsAsjQuery:function(b){var l=this;var g=[];var e=[];if(this.options.connectWith&&b){var h=this.options.connectWith.constructor==String?[this.options.connectWith]:this.options.connectWith;for(var d=h.length-1;d>=0;d--){var k=a(h[d]);for(var c=k.length-1;c>=0;c--){var f=a.data(k[c],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element):a(f.options.items,f.element).not("."+f.options.cssNamespace+"-sortable-helper"),f])}}}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not("."+this.options.cssNamespace+"-sortable-helper"),this]);for(var d=e.length-1;d>=0;d--){e[d][0].each(function(){g.push(this)})}return a(g)},_removeCurrentsFromItems:function(){var d=this.currentItem.find(":data(sortable-item)");for(var c=0;c<this.items.length;c++){for(var b=0;b<d.length;b++){if(d[b]==this.items[c].item[0]){this.items.splice(c,1)}}}},_refreshItems:function(b){this.items=[];this.containers=[this];var h=this.items;var o=this;var f=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],b,{item:this.currentItem}):a(this.options.items,this.element),this]];if(this.options.connectWith){for(var e=this.options.connectWith.length-1;e>=0;e--){var l=a(this.options.connectWith[e]);for(var d=l.length-1;d>=0;d--){var g=a.data(l[d],"sortable");if(g&&g!=this&&!g.options.disabled){f.push([a.isFunction(g.options.items)?g.options.items.call(g.element[0],b,{item:this.currentItem}):a(g.options.items,g.element),g]);this.containers.push(g)}}}}for(var e=f.length-1;e>=0;e--){var k=f[e][1];var c=f[e][0];for(var d=0,m=c.length;d<m;d++){var n=a(c[d]);n.data("sortable-item",k);h.push({item:n,instance:k,width:0,height:0,left:0,top:0})}}},refreshPositions:function(b){if(this.offsetParent&&this.helper){this.offset.parent=this._getParentOffset()}for(var d=this.items.length-1;d>=0;d--){var e=this.items[d];if(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0]){continue}var c=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!b){if(this.options.accurateIntersection){e.width=c.outerWidth();e.height=c.outerHeight()}else{e.width=c[0].offsetWidth;e.height=c[0].offsetHeight}}var f=c.offset();e.left=f.left;e.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var d=this.containers.length-1;d>=0;d--){var f=this.containers[d].element.offset();this.containers[d].containerCache.left=f.left;this.containers[d].containerCache.top=f.top;this.containers[d].containerCache.width=this.containers[d].element.outerWidth();this.containers[d].containerCache.height=this.containers[d].element.outerHeight()}}},_createPlaceholder:function(d){var b=d||this,e=b.options;if(!e.placeholder||e.placeholder.constructor==String){var c=e.placeholder;e.placeholder={element:function(){var f=a(document.createElement(b.currentItem[0].nodeName)).addClass(c||b.currentItem[0].className+" "+b.options.cssNamespace+"-sortable-placeholder").removeClass(b.options.cssNamespace+"-sortable-helper")[0];if(!c){f.style.visibility="hidden"}return f},update:function(f,g){if(c&&!e.forcePlaceholderSize){return}if(!g.height()){g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10))}if(!g.width()){g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=a(e.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);e.placeholder.update(b,b.placeholder)},_contactContainers:function(d){for(var c=this.containers.length-1;c>=0;c--){if(this._intersectsWith(this.containers[c].containerCache)){if(!this.containers[c].containerCache.over){if(this.currentContainer!=this.containers[c]){var h=10000;var g=null;var e=this.positionAbs[this.containers[c].floating?"left":"top"];for(var b=this.items.length-1;b>=0;b--){if(!a.ui.contains(this.containers[c].element[0],this.items[b].item[0])){continue}var f=this.items[b][this.containers[c].floating?"left":"top"];if(Math.abs(f-e)<h){h=Math.abs(f-e);g=this.items[b]}}if(!g&&!this.options.dropOnEmpty){continue}this.currentContainer=this.containers[c];g?this.options.sortIndicator.call(this,d,g,null,true):this.options.sortIndicator.call(this,d,null,this.containers[c].element,true);this._trigger("change",d,this._uiHash());this.containers[c]._trigger("change",d,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder)}this.containers[c]._trigger("over",d,this._uiHash(this));this.containers[c].containerCache.over=1}}else{if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",d,this._uiHash(this));this.containers[c].containerCache.over=0}}}},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c,this.currentItem])):(d.helper=="clone"?this.currentItem.clone():this.currentItem);if(!b.parents("body").length){a(d.appendTo!="parent"?d.appendTo:this.currentItem[0].parentNode)[0].appendChild(b[0])}if(b[0]==this.currentItem[0]){this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}}if(b[0].style.width==""||d.forceHelperSize){b.width(this.currentItem.width())}if(b[0].style.height==""||d.forceHelperSize){b.height(this.currentItem.height())}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body&&a.browser.mozilla)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.currentItem.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.currentItem.css("marginLeft"),10)||0),top:(parseInt(this.currentItem.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)){var c=a(e.containment)[0];var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c)}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.left<this.containment[0]){d=this.containment[0]+this.offset.click.left}if(e.pageY-this.offset.click.top<this.containment[1]){c=this.containment[1]+this.offset.click.top}if(e.pageX-this.offset.click.left>this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:(!(g-this.offset.click.top<this.containment[1])?g-h.grid[1]:g+h.grid[1])):g;var f=this.originalPageX+Math.round((d-this.originalPageX)/h.grid[0])*h.grid[0];d=this.containment?(!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:(!(f-this.offset.click.left<this.containment[0])?f-h.grid[0]:f+h.grid[0])):f}}return{top:(c-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(i?0:b.scrollTop()))),left:(d-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:b.scrollLeft()))}},_rearrange:function(g,f,c,e){c?c[0].appendChild(this.placeholder[0]):f.item[0].parentNode.insertBefore(this.placeholder[0],(this.direction=="down"?f.item[0]:f.item[0].nextSibling));this.counter=this.counter?++this.counter:1;var d=this,b=this.counter;window.setTimeout(function(){if(b==d.counter){d.refreshPositions(!e)}},0)},_clear:function(d,e){this.reverting=false;var f=[],b=this;if(!this._noFinalSort){this.placeholder.before(this.currentItem)}this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var c in this._storedCSS){if(this._storedCSS[c]=="auto"||this._storedCSS[c]=="static"){this._storedCSS[c]=""}}this.currentItem.css(this._storedCSS).removeClass(this.options.cssNamespace+"-sortable-helper")}else{this.currentItem.show()}if(this.fromOutside&&!e){f.push(function(g){this._trigger("receive",g,this._uiHash(this.fromOutside))})}if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not("."+this.options.cssNamespace+"-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!e){f.push(function(g){this._trigger("update",g,this._uiHash())})}if(!a.ui.contains(this.element[0],this.currentItem[0])){if(!e){f.push(function(g){this._trigger("remove",g,this._uiHash())})}for(var c=this.containers.length-1;c>=0;c--){if(a.ui.contains(this.containers[c].element[0],this.currentItem[0])&&!e){f.push((function(g){return function(h){g._trigger("receive",h,this._uiHash(this))}}).call(this,this.containers[c]));f.push((function(g){return function(h){g._trigger("update",h,this._uiHash(this))}}).call(this,this.containers[c]))}}}for(var c=this.containers.length-1;c>=0;c--){if(!e){f.push((function(g){return function(h){g._trigger("deactivate",h,this._uiHash(this))}}).call(this,this.containers[c]))}if(this.containers[c].containerCache.over){f.push((function(g){return function(h){g._trigger("out",h,this._uiHash(this))}}).call(this,this.containers[c]));this.containers[c].containerCache.over=0}}if(this._storedCursor){a("body").css("cursor",this._storedCursor)}if(this._storedOpacity){this.helper.css("opacity",this._storedCursor)}if(this._storedZIndex){this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex)}this.dragging=false;if(this.cancelHelperRemoval){if(!e){this._trigger("beforeStop",d,this._uiHash());for(var c=0;c<f.length;c++){f[c].call(this,d)}this._trigger("stop",d,this._uiHash())}return false}if(!e){this._trigger("beforeStop",d,this._uiHash())}this.placeholder[0].parentNode.removeChild(this.placeholder[0]);if(this.helper[0]!=this.currentItem[0]){this.helper.remove()}this.helper=null;if(!e){for(var c=0;c<f.length;c++){f[c].call(this,d)}this._trigger("stop",d,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){if(a.widget.prototype._trigger.apply(this,arguments)===false){this.cancel()}},_uiHash:function(c){var b=c||this;return{helper:b.helper,placeholder:b.placeholder||a([]),position:b.position,absolutePosition:b.positionAbs,offset:b.positionAbs,item:b.currentItem,sender:c?c.element:null}}}));a.extend(a.ui.sortable,{getter:"serialize toArray",version:"1.6rc6",defaults:{accurateIntersection:true,appendTo:"parent",cancel:":input,option",connectWith:false,cssNamespace:"ui",delay:0,distance:1,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,handle:false,helper:"original",items:"> *",placeholder:false,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,sortIndicator:a.ui.sortable.prototype._rearrange,tolerance:"intersect",zIndex:1000}})})(jQuery);;/*\r
+ * jQuery UI Accordion 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Accordion\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(a){a.widget("ui.accordion",{_init:function(){var d=this.options,b=this;this.running=0;if(d.navigation){var c=this.element.find("a").filter(d.navigationFilter);if(c.length){if(c.filter(d.header).length){this.active=c}else{this.active=c.parent().parent().prev();c.addClass("ui-accordion-content-active")}}}this.element.addClass("ui-accordion ui-widget ui-helper-reset");this.headers=this.element.find(d.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){a(this).removeClass("ui-state-hover")});this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");this.active=this._findActive(this.active||d.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass("ui-accordion-content-active");a("<span/>").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.find(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);if(a.browser.msie){this.element.find("a").css("zoom","1")}this.resize();this.element.attr("role","tablist");this.headers.attr("role","tab").bind("keydown",function(e){return b._keydown(e)}).next().attr("role","tabpanel");this.headers.not(this.active||"").attr("aria-expanded","false").attr("tabIndex","-1").next().hide();if(!this.active.length){this.headers.eq(0).attr("tabIndex","0")}else{this.active.attr("aria-expanded","true").attr("tabIndex","0")}if(!a.browser.safari){this.headers.find("a").attr("tabIndex","-1")}if(d.event){this.element.bind((d.event)+".accordion",function(e){return b._clickHandler.call(b,e)})}},destroy:function(){this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role").unbind(".accordion").removeData("accordion");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");this.headers.find("a").removeAttr("tabindex");this.headers.children(".ui-icon").remove();this.headers.next().removeClass("ui-accordion-content ui-accordion-content-active")},_keydown:function(e){var g=this.options,f=a.ui.keyCode;if(g.disabled||e.altKey||e.ctrlKey){return}var d=this.headers.length;var b=this.headers.index(e.target);var c=false;switch(e.keyCode){case f.RIGHT:case f.DOWN:c=this.headers[(b+1)%d];break;case f.LEFT:case f.UP:c=this.headers[(b-1+d)%d];break;case f.SPACE:case f.ENTER:return this._clickHandler({target:e.target})}if(c){a(e.target).attr("tabIndex","-1");a(c).attr("tabIndex","0");c.focus();return false}return true},resize:function(){var e=this.options,d;if(e.fillSpace){if(a.browser.msie){var b=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}d=this.element.parent().height();if(a.browser.msie){this.element.parent().css("overflow",b)}this.headers.each(function(){d-=a(this).outerHeight()});var c=0;this.headers.next().each(function(){c=Math.max(c,a(this).innerHeight()-a(this).height())}).height(d-c).css("overflow","auto")}else{if(e.autoHeight){d=0;this.headers.next().each(function(){d=Math.max(d,a(this).outerHeight())}).height(d)}}},activate:function(b){this._clickHandler({target:this._findActive(b)[0]})},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(f){var h=this.options;if(h.disabled){return false}if(!f.target&&!h.alwaysOpen){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(h.icons.headerSelected).addClass(h.icons.header);this.active.next().addClass("ui-accordion-content-active");var c=this.active.next(),g={options:h,newHeader:a([]),oldHeader:h.active,newContent:a([]),oldContent:c},b=(this.active=a([]));this._toggle(b,c,g);return false}var d=a(f.target);d=a(d.parents(h.header)[0]||d);var e=d[0]==this.active[0];if(this.running||(h.alwaysOpen&&e)){return false}if(!d.is(h.header)){return}this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(h.icons.headerSelected).addClass(h.icons.header);this.active.next().addClass("ui-accordion-content-active");if(!e){d.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").find(".ui-icon").removeClass(h.icons.header).addClass(h.icons.headerSelected);d.next().addClass("ui-accordion-content-active")}var b=d.next(),c=this.active.next(),g={options:h,newHeader:e&&!h.alwaysOpen?a([]):d,oldHeader:this.active,newContent:e&&!h.alwaysOpen?a([]):b.find("> *"),oldContent:c.find("> *")},i=this.headers.index(this.active[0])>this.headers.index(d[0]);this.active=e?a([]):d;this._toggle(b,c,g,e,i);return false},_toggle:function(b,i,g,j,k){var d=this.options,m=this;this.toShow=b;this.toHide=i;this.data=g;var c=function(){if(!m){return}return m._completed.apply(m,arguments)};this._trigger("changestart",null,this.data);this.running=i.size()===0?b.size():i.size();if(d.animated){var f={};if(!d.alwaysOpen&&j){f={toShow:a([]),toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}else{f={toShow:b,toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}if(!d.proxied){d.proxied=d.animated}if(!d.proxiedDuration){d.proxiedDuration=d.duration}d.animated=a.isFunction(d.proxied)?d.proxied(f):d.proxied;d.duration=a.isFunction(d.proxiedDuration)?d.proxiedDuration(f):d.proxiedDuration;var l=a.ui.accordion.animations,e=d.duration,h=d.animated;if(!l[h]){l[h]=function(n){this.slide(n,{easing:h,duration:e||700})}}l[h](f)}else{if(!d.alwaysOpen&&j){b.toggle()}else{i.hide();b.show()}c(true)}i.prev().attr("aria-expanded","false").attr("tabIndex","-1");b.prev().attr("aria-expanded","true").attr("tabIndex","0").focus()},_completed:function(b){var c=this.options;this.running=b?0:--this.running;if(this.running){return}if(c.clearStyle){this.toShow.add(this.toHide).css({height:"",overflow:""})}this._trigger("change",null,this.data)}});a.extend(a.ui.accordion,{version:"1.6rc6",defaults:{active:null,autoHeight:true,alwaysOpen:true,animated:"slide",clearStyle:false,event:"click",fillSpace:false,header:"a",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase()}},animations:{slide:function(j,h){j=a.extend({easing:"swing",duration:300},j,h);if(!j.toHide.size()){j.toShow.animate({height:"show"},j);return}var b=j.toHide.height(),i=j.toShow.height(),c=i/b,d=j.toShow.css("overflow"),e={},g={},f=["height","paddingTop","paddingBottom"];a.each(f,function(k,l){g[l]="hide";e[l]=parseFloat(j.toShow.css(l))});j.toShow.css({height:0,overflow:"hidden"}).show();j.toHide.filter(":hidden").each(j.complete).end().filter(":visible").animate(g,{step:function(l,m){if(!j.toShow[0]){return}var k=m.start!=m.end?(m.now-m.start)/(m.end-m.start):0,n=k*e[m.prop];if(a.browser.msie||a.browser.opera){n=Math.ceil(n)}j.toShow[0].style[m.prop]=n+"px"},duration:j.duration,easing:j.easing,complete:function(){if(!j.autoHeight){j.toShow.css("height","auto")}j.toShow.css({overflow:d});j.complete()}})},bounceslide:function(b){this.slide(b,{easing:b.down?"easeOutBounce":"swing",duration:b.down?1000:200})},easeslide:function(b){this.slide(b,{easing:"easeinout",duration:700})}}})})(jQuery);;/*\r
+ * jQuery UI Dialog 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Dialog\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ * ui.draggable.js\r
+ * ui.resizable.js\r
+ */\r(function(b){var a={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"};b.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr("title");var k=this,l=this.options,i=l.title||this.originalTitle||" ",d=b.ui.dialog.getTitleId(this.element),j=(this.uiDialog=b("<div/>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+l.dialogClass).css({position:"absolute",overflow:"hidden",zIndex:l.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(m){(l.closeOnEscape&&m.keyCode&&m.keyCode==b.ui.keyCode.ESCAPE&&k.close(m))}).attr({role:"dialog","aria-labelledby":d}).mousedown(function(m){k.moveToTop(m)}),f=this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j),e=(this.uiDialogTitlebar=b("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j),h=b('<a href="#"/>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).mousedown(function(m){m.stopPropagation()}).click(function(m){k.close(m);return false}).appendTo(e),g=(this.uiDialogTitlebarCloseText=b("<span/>")).addClass("ui-icon ui-icon-closethick").text(l.closeText).appendTo(h),c=b("<span/>").addClass("ui-dialog-title").attr("id",d).html(i).prependTo(e);e.find("*").add(e).disableSelection();(l.draggable&&b.fn.draggable&&this._makeDraggable());(l.resizable&&b.fn.resizable&&this._makeResizable());this._createButtons(l.buttons);this._isOpen=false;(l.bgiframe&&b.fn.bgiframe&&j.bgiframe());(l.autoOpen&&this.open())},destroy:function(){(this.overlay&&this.overlay.destroy());(this.shadow&&this._destroyShadow());this.uiDialog.hide();this.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");this.uiDialog.remove();(this.originalTitle&&this.element.attr("title",this.originalTitle))},close:function(c){if(false===this._trigger("beforeclose",c)){return}(this.overlay&&this.overlay.destroy());(this.shadow&&this._destroyShadow());this.uiDialog.hide(this.options.hide).unbind("keypress.ui-dialog");this._trigger("close",c);b.ui.dialog.overlay.resize();this._isOpen=false},isOpen:function(){return this._isOpen},moveToTop:function(g,f){if((this.options.modal&&!g)||(!this.options.stack&&!this.options.modal)){return this._trigger("focus",f)}var e=this.options.zIndex,d=this.options;b(".ui-dialog:visible").each(function(){e=Math.max(e,parseInt(b(this).css("z-index"),10)||d.zIndex)});(this.overlay&&this.overlay.$el.css("z-index",++e));(this.shadow&&this.shadow.css("z-index",++e));var c={scrollTop:this.element.attr("scrollTop"),scrollLeft:this.element.attr("scrollLeft")};this.uiDialog.css("z-index",++e);this.element.attr(c);this._trigger("focus",f)},open:function(e){if(this._isOpen){return}var d=this.options,c=this.uiDialog;this.overlay=d.modal?new b.ui.dialog.overlay(this):null;(c.next().length&&c.appendTo("body"));this._size();this._position(d.position);c.show(d.show);this.moveToTop(true,e);(d.modal&&c.bind("keypress.ui-dialog",function(h){if(h.keyCode!=b.ui.keyCode.TAB){return}var g=b(":tabbable",this),i=g.filter(":first")[0],f=g.filter(":last")[0];if(h.target==f&&!h.shiftKey){setTimeout(function(){i.focus()},1)}else{if(h.target==i&&h.shiftKey){setTimeout(function(){f.focus()},1)}}}));b([]).add(c.find(".ui-dialog-content :tabbable:first")).add(c.find(".ui-dialog-buttonpane :tabbable:first")).add(c.find(".ui-dialog-titlebar :tabbable:first")).filter(":first").focus();if(d.shadow){this._createShadow()}this._trigger("open",e);this._isOpen=true},_createButtons:function(f){var e=this,c=false,d=b("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");this.uiDialog.find(".ui-dialog-buttonpane").remove();(typeof f=="object"&&f!==null&&b.each(f,function(){return !(c=true)}));if(c){b.each(f,function(g,h){b('<button type="button"></button>').addClass("ui-state-default ui-corner-all").text(g).click(function(){h.apply(e.element[0],arguments)}).hover(function(){b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){b(this).addClass("ui-state-focus")}).blur(function(){b(this).removeClass("ui-state-focus")}).appendTo(d)});d.appendTo(this.uiDialog)}},_makeDraggable:function(){var c=this,d=this.options;this.uiDialog.draggable({cancel:".ui-dialog-content",helper:d.dragHelper,handle:".ui-dialog-titlebar",containment:"document",start:function(){(d.dragStart&&d.dragStart.apply(c.element[0],arguments));if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.hide()}},drag:function(){(d.drag&&d.drag.apply(c.element[0],arguments));c._refreshShadow(1)},stop:function(){(d.dragStop&&d.dragStop.apply(c.element[0],arguments));b.ui.dialog.overlay.resize();if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.show()}c._refreshShadow()}})},_makeResizable:function(f){f=(f===undefined?this.options.resizable:f);var c=this,e=this.options,d=typeof f=="string"?f:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",alsoResize:this.element,helper:e.resizeHelper,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:e.minHeight,start:function(){(e.resizeStart&&e.resizeStart.apply(c.element[0],arguments));if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.hide()}},resize:function(){(e.resize&&e.resize.apply(c.element[0],arguments));c._refreshShadow(1)},handles:d,stop:function(){(e.resizeStop&&e.resizeStop.apply(c.element[0],arguments));b.ui.dialog.overlay.resize();if(b.browser.msie&&b.browser.version<7&&c.shadow){c.shadow.show()}c._refreshShadow()}}).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_position:function(h){var d=b(window),e=b(document),f=e.scrollTop(),c=e.scrollLeft(),g=f;if(b.inArray(h,["center","top","right","bottom","left"])>=0){h=[h=="right"||h=="left"?h:"center",h=="top"||h=="bottom"?h:"middle"]}if(h.constructor!=Array){h=["center","middle"]}if(h[0].constructor==Number){c+=h[0]}else{switch(h[0]){case"left":c+=0;break;case"right":c+=d.width()-this.uiDialog.outerWidth();break;default:case"center":c+=(d.width()-this.uiDialog.outerWidth())/2}}if(h[1].constructor==Number){f+=h[1]}else{switch(h[1]){case"top":f+=0;break;case"bottom":f+=d.height()-this.uiDialog.outerHeight();break;default:case"middle":f+=(d.height()-this.uiDialog.outerHeight())/2}}f=Math.max(f,g);this.uiDialog.css({top:f,left:c})},_setData:function(d,e){(a[d]&&this.uiDialog.data(a[d],e));switch(d){case"buttons":this._createButtons(e);break;case"closeText":this.uiDialogTitlebarCloseText.text(e);break;case"draggable":(e?this._makeDraggable():this.uiDialog.draggable("destroy"));break;case"height":this.uiDialog.height(e);break;case"position":this._position(e);break;case"resizable":var c=this.uiDialog,f=this.uiDialog.is(":data(resizable)");(f&&!e&&c.resizable("destroy"));(f&&typeof e=="string"&&c.resizable("option","handles",e));(f||this._makeResizable(e));break;case"title":b(".ui-dialog-title",this.uiDialogTitlebar).html(e||" ");break;case"width":this.uiDialog.width(e);break}b.widget.prototype._setData.apply(this,arguments)},_size:function(){var d=this.options;this.element.css({height:0,minHeight:0,width:"auto"});var c=this.uiDialog.css({height:"auto",width:d.width}).height();this.element.css({minHeight:Math.max(d.minHeight-c,0),height:d.height=="auto"?"auto":d.height-c})},_createShadow:function(){this.shadow=b('<div class="ui-widget-shadow"></div>').css("position","absolute").appendTo(document.body);this._refreshShadow();return this.shadow},_refreshShadow:function(c){if(c&&b.browser.msie&&b.browser.version<7){return}var d=this.uiDialog.offset();this.shadow.css({left:d.left,top:d.top,width:this.uiDialog.outerWidth(),height:this.uiDialog.outerHeight()})},_destroyShadow:function(){this.shadow.remove();this.shadow=null}});b.extend(b.ui.dialog,{version:"1.6rc6",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:"close",draggable:true,height:"auto",minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,shadow:true,stack:true,title:"",width:300,zIndex:1000},getter:"isOpen",uuid:0,getTitleId:function(c){return"ui-dialog-title-"+(c.attr("id")||++this.uuid)},overlay:function(c){this.$el=b.ui.dialog.overlay.create(c)}});b.extend(b.ui.dialog.overlay,{instances:[],events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(c){return c+".dialog-overlay"}).join(" "),create:function(d){if(this.instances.length===0){setTimeout(function(){b("a, :input").bind(b.ui.dialog.overlay.events,function(){var f=false;var h=b(this).parents(".ui-dialog");if(h.length){var e=b(".ui-dialog-overlay");if(e.length){var g=parseInt(e.css("z-index"),10);e.each(function(){g=Math.max(g,parseInt(b(this).css("z-index"),10))});f=parseInt(h.css("z-index"),10)>g}else{f=true}}return f})},1);b(document).bind("keydown.dialog-overlay",function(e){(d.options.closeOnEscape&&e.keyCode&&e.keyCode==b.ui.keyCode.ESCAPE&&d.close(e))});b(window).bind("resize.dialog-overlay",b.ui.dialog.overlay.resize)}var c=b("<div></div>").appendTo(document.body).addClass("ui-widget-overlay").css({width:this.width(),height:this.height()});(d.options.bgiframe&&b.fn.bgiframe&&c.bgiframe());this.instances.push(c);return c},destroy:function(c){this.instances.splice(b.inArray(this.instances,c),1);if(this.instances.length===0){b("a, :input").add([document,window]).unbind(".dialog-overlay")}c.remove()},height:function(){if(b.browser.msie&&b.browser.version<7){var d=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var c=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(d<c){return b(window).height()+"px"}else{return d+"px"}}else{return b(document).height()+"px"}},width:function(){if(b.browser.msie&&b.browser.version<7){var c=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);var d=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(c<d){return b(window).width()+"px"}else{return c+"px"}}else{return b(document).width()+"px"}},resize:function(){var c=b([]);b.each(b.ui.dialog.overlay.instances,function(){c=c.add(this)});c.css({width:0,height:0}).css({width:b.ui.dialog.overlay.width(),height:b.ui.dialog.overlay.height()})}});b.extend(b.ui.dialog.overlay.prototype,{destroy:function(){b.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);;/*\r
+ * jQuery UI Slider 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Slider\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(a){a.widget("ui.slider",a.extend({},a.ui.mouse,{_init:function(){var b=this,c=this.options;this._keySliding=false;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");this.range=a([]);if(c.range){if(c.range===true){this.range=a("<div></div>");if(!c.values){c.values=[this._valueMin(),this._valueMin()]}if(c.values.length&&c.values.length!=2){c.values=[c.values[0],c.values[0]]}}else{this.range=a("<div></div>")}this.range.appendTo(this.element).addClass("ui-slider-range ui-widget-header");(c.range=="min")&&(this.orientation=="horizontal")&&this.range.css({left:0});(c.range=="max")&&(this.orientation=="horizontal")&&this.range.css({right:0});(c.range=="min")&&(this.orientation=="vertical")&&this.range.css({bottom:0});(c.range=="max")&&(this.orientation=="vertical")&&this.range.css({top:0})}if(a(".ui-slider-handle",this.element).length==0){a('<a href="#"></a>').appendTo(this.element).addClass("ui-slider-handle")}if(c.values&&c.values.length){while(a(".ui-slider-handle",this.element).length<c.values.length){a('<a href="#"></a>').appendTo(this.element).addClass("ui-slider-handle")}}this.handles=a(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(d){d.preventDefault()}).hover(function(){a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){b.handles.removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(d){a(this).data("index.ui-slider-handle",d)});this.handles.keydown(function(h){var e=a(this).data("index.ui-slider-handle");if(b.options.disabled){return}switch(h.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(!b._keySliding){b._keySliding=true;a(this).addClass("ui-state-active");b._start(h)}break}var f,d,g=b._step();if(b.options.values&&b.options.values.length){f=d=b.values(e)}else{f=d=b.value()}switch(h.keyCode){case a.ui.keyCode.HOME:d=b._valueMin();break;case a.ui.keyCode.END:d=b._valueMax();break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(f==b._valueMax()){return}d=f+g;break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(f==b._valueMin()){return}d=f-g;break}b._slide(h,e,d)}).keyup(function(d){if(b._keySliding){b._stop(d);b._change(d);b._keySliding=false;a(this).removeClass("ui-state-active")}});this._refreshValue()},destroy:function(){this.handles.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy()},_mouseCapture:function(d){var e=this.options;if(e.disabled){return false}this._start(d);this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();var h={x:d.pageX,y:d.pageY};var j=this._normValueFromMouse(h);var c=this._valueMax()+1,f;var k=this,i;this.handles.each(function(l){var m=Math.abs(j-k.values(l));if(c>m){c=m;f=a(this);i=l}});if(e.range&&(this.values(0)+this.values(1))==0){f=a(this.handles[++i])}k._handleIndex=i;f.addClass("ui-state-active").focus();var g=f.offset();var b=!a(d.target).parents().andSelf().is(".ui-slider-handle");this._clickOffset=b?{left:0,top:0}:{left:d.pageX-g.left+(parseInt(f.css("marginLeft"),10)||0),top:d.pageY-g.top+(parseInt(f.css("marginTop"),10)||0)};j=this._normValueFromMouse(h);this._slide(d,i,j);return true},_mouseStart:function(b){return true},_mouseDrag:function(d){var b={x:d.pageX,y:d.pageY};var c=this._normValueFromMouse(b);this._slide(d,this._handleIndex,c);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._stop(b);this._change(b);this._handleIndex=null;this._clickOffset=null;return false},_detectOrientation:function(){this.orientation=this.options.orientation=="auto"?(this.element[0].offsetWidth/this.element[0].offsetHeight>1?"horizontal":"vertical"):this.options.orientation},_normValueFromMouse:function(d){var c,h;if("horizontal"==this.orientation){c=this.elementSize.width;h=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;h=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}var f=(h/c);if(f>1){f=1}if(f<0){f=0}if("vertical"==this.orientation){f=1-f}var e=this._valueMax()-this._valueMin(),i=f*e,b=i%this.options.step,g=this._valueMin()+i-b;if(b>(this.options.step/2)){g+=this.options.step}return g},_start:function(b){this._trigger("start",b,{value:this.value()})},_slide:function(f,e,d){var g=this.handles[e];if(this.options.values&&this.options.values.length){var b=this.values(e?0:1);if((e==0&&d>=b)||(e==1&&d<=b)){d=b}if(d!=this.values(e)){var c=this.values();c[e]=d;var h=this._trigger("slide",f,{handle:g,value:d,values:c});var b=this.values(e?0:1);if(h!==false){this.values(e,d,!(f.type=="mousedown"&&this.options.animate))}}}else{if(d!=this.value()){var h=this._trigger("slide",f,{handle:g,value:d});if(h!==false){this._setData("value",d,(f.type=="mousedown"&&this.options.animate))}}}},_stop:function(b){this._trigger("stop",b,{value:this.value()})},_change:function(b){this._trigger("change",b,{value:this.value()})},value:function(b){if(arguments.length){this._setData("value",b);this._change()}return this._value()},values:function(c,d,b){if(!this.options.animate){b=true}if(arguments.length>1){this.options.values[c]=d;this._refreshValue(!b);this._change()}if(arguments.length){if(this.options.values&&this.options.values.length){return this._values(c)}else{return this.value()}}else{return this._values()}},_setData:function(b,c){a.widget.prototype._setData.apply(this,arguments);switch(b){case"orientation":this._detectOrientation();this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case"value":this._refreshValue();break}},_step:function(){var b=this.options.step;return b},_value:function(){var b=this.options.value;if(b<this._valueMin()){b=this._valueMin()}if(b>this._valueMax()){b=this._valueMax()}return b},_values:function(b){if(arguments.length){var c=this.options.values[b];if(c<this._valueMin()){c=this._valueMin()}if(c>this._valueMax()){c=this._valueMax()}return c}else{return this.options.values}},_valueMin:function(){var b=this.options.min;return b},_valueMax:function(){var b=this.options.max;return b},_refreshValue:function(e){var h=this.options.range,g=this.options,d=this;if(this.options.values&&this.options.values.length){var c,i;this.handles.each(function(n,l){var m=(d.values(n)-d._valueMin())/(d._valueMax()-d._valueMin())*100;var k={};k[d.orientation=="horizontal"?"left":"bottom"]=m+"%";a(this).stop(1,1)[e?"animate":"css"](k,g.animate);if(d.options.range===true){if(d.orientation=="horizontal"){(n==0)&&d.range.stop(1,1)[e?"animate":"css"]({left:m+"%"},g.animate);(n==1)&&d.range[e?"animate":"css"]({width:(m-lastValPercent)+"%"},{queue:false,duration:g.animate})}else{(n==0)&&d.range.stop(1,1)[e?"animate":"css"]({bottom:(m)+"%"},g.animate);(n==1)&&d.range[e?"animate":"css"]({height:(m-lastValPercent)+"%"},{queue:false,duration:g.animate})}}lastValPercent=m})}else{var f=(this.value()-this._valueMin())/(this._valueMax()-this._valueMin())*100;var b={};b[d.orientation=="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](b,g.animate);(h=="min")&&(this.orientation=="horizontal")&&this.range.stop(1,1)[e?"animate":"css"]({left:0,width:f+"%"},g.animate);(h=="max")&&(this.orientation=="horizontal")&&this.range[e?"animate":"css"]({left:f+"%",width:(100-f)+"%"},{queue:false,duration:g.animate});(h=="min")&&(this.orientation=="vertical")&&this.range.stop(1,1)[e?"animate":"css"]({top:(100-f)+"%",height:f+"%"},g.animate);(h=="max")&&(this.orientation=="vertical")&&this.range[e?"animate":"css"]({bottom:f+"%",height:(100-f)+"%"},{queue:false,duration:g.animate})}}}));a.extend(a.ui.slider,{getter:"value values",version:"1.6rc6",eventPrefix:"slide",defaults:{animate:false,delay:0,distance:0,max:100,min:0,orientation:"auto",range:false,step:1,value:0,values:null}})})(jQuery);;/*\r
+ * jQuery UI Tabs 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Tabs\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(a){a.widget("ui.tabs",{_init:function(){this._tabify(true)},_setData:function(b,c){if((/^selected/).test(b)){this.select(c)}else{this.options[b]=c;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^A-Za-z0-9\-_:\.]/g,"")||this.options.idPrefix+a.data(b)},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+a.data(this.list[0]));return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(c,b){return{tab:c,panel:b,index:this.$tabs.index(c)}},_tabify:function(q){this.list=this.element.is("div")?this.element.children("ul:first, ol:first").eq(0):this.element;this.$lis=a("li:has(a[href])",this.list);this.$tabs=this.$lis.map(function(){return a("a",this)[0]});this.$panels=a([]);var r=this,d=this.options;var c=/^#.+/;this.$tabs.each(function(t,o){var s=a(o).attr("href");if(c.test(s)){r.$panels=r.$panels.add(r._sanitizeSelector(s))}else{if(s!="#"){a.data(o,"href.tabs",s);a.data(o,"load.tabs",s.replace(/#.*$/,""));var v=r._tabId(o);o.href="#"+v;var u=a("#"+v);if(!u.length){u=a(d.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(r.$panels[t-1]||r.list);u.data("destroy.tabs",true)}r.$panels=r.$panels.add(u)}else{d.disabled.push(t+1)}}});if(q){if(this.element.is("div")){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all")}this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.$lis.addClass("ui-state-default ui-corner-top");this.$panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(d.selected===undefined){if(location.hash){this.$tabs.each(function(s,o){if(o.hash==location.hash){d.selected=s;return false}})}else{if(d.cookie){d.selected=parseInt(r._cookie(),10)}else{if(this.$lis.filter(".ui-tabs-selected").length){d.selected=this.$lis.index(this.$lis.filter(".ui-tabs-selected"))}else{d.selected=0}}}}else{if(d.selected===null){d.selected=-1}}d.selected=((d.selected>=0&&this.$tabs[d.selected])||d.selected<0)?d.selected:0;d.disabled=a.unique(d.disabled.concat(a.map(this.$lis.filter(".ui-state-disabled"),function(s,o){return r.$lis.index(s)}))).sort();if(a.inArray(d.selected,d.disabled)!=-1){d.disabled.splice(a.inArray(d.selected,d.disabled),1)}this.$panels.addClass("ui-tabs-hide");this.$lis.removeClass("ui-tabs-selected ui-state-active");if(d.selected>=0&&this.$tabs.length){this.$panels.eq(d.selected).removeClass("ui-tabs-hide");var f=["ui-tabs-selected ui-state-active"];if(d.deselectable){f.push("ui-tabs-deselectable")}this.$lis.eq(d.selected).addClass(f.join(" "));var k=function(){r._trigger("show",null,r._ui(r.$tabs[d.selected],r.$panels[d.selected]))};if(a.data(this.$tabs[d.selected],"load.tabs")){this.load(d.selected,k)}else{k()}}if(d.event!="mouseover"){var l=function(o,i){if(i.is(":not(.ui-state-disabled)")){i.toggleClass("ui-state-"+o)}};this.$lis.bind("mouseover.tabs mouseout.tabs",function(){l("hover",a(this))});this.$tabs.bind("focus.tabs blur.tabs",function(){l("focus",a(this).parents("li:first"))})}a(window).bind("unload",function(){r.$lis.add(r.$tabs).unbind(".tabs");r.$lis=r.$tabs=r.$panels=null})}else{d.selected=this.$lis.index(this.$lis.filter(".ui-tabs-selected"))}if(d.cookie){this._cookie(d.selected,d.cookie)}for(var h=0,p;p=this.$lis[h];h++){a(p)[a.inArray(h,d.disabled)!=-1&&!a(p).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled")}if(d.cache===false){this.$tabs.removeData("cache.tabs")}var b,j;if(d.fx){if(a.isArray(d.fx)){b=d.fx[0];j=d.fx[1]}else{b=j=d.fx}}function e(i,o){i.css({display:""});if(a.browser.msie&&o.opacity){i[0].style.removeAttribute("filter")}}var m=j?function(i,o){o.hide().removeClass("ui-tabs-hide").animate(j,500,function(){e(o,j);r._trigger("show",null,r._ui(i,o[0]))})}:function(i,o){o.removeClass("ui-tabs-hide");r._trigger("show",null,r._ui(i,o[0]))};var n=b?function(o,i,s){i.animate(b,b.duration||"normal",function(){i.addClass("ui-tabs-hide");e(i,b);if(s){m(o,s)}})}:function(o,i,s){i.addClass("ui-tabs-hide");if(s){m(o,s)}};function g(s,u,i,t){var o=["ui-tabs-selected ui-state-active"];if(d.deselectable){o.push("ui-tabs-deselectable")}u.removeClass("ui-state-default").addClass(o.join(" ")).siblings().removeClass(o.join(" ")).addClass("ui-state-default");n(s,i,t)}this.$tabs.unbind(".tabs").bind(d.event+".tabs",function(){var t=a(this).parents("li:eq(0)"),i=r.$panels.filter(":visible"),s=a(r._sanitizeSelector(this.hash));if((t.hasClass("ui-state-active")&&!d.deselectable)||t.hasClass("ui-state-disabled")||a(this).hasClass("ui-tabs-loading")||r._trigger("select",null,r._ui(this,s[0]))===false){this.blur();return false}d.selected=r.$tabs.index(this);if(d.deselectable){if(t.hasClass("ui-state-active")){d.selected=-1;if(d.cookie){r._cookie(d.selected,d.cookie)}t.removeClass("ui-tabs-selected ui-state-active ui-tabs-deselectable").addClass("ui-state-default");r.$panels.stop();n(this,i);this.blur();return false}else{if(!i.length){if(d.cookie){r._cookie(d.selected,d.cookie)}r.$panels.stop();var o=this;r.load(r.$tabs.index(this),function(){t.addClass("ui-tabs-selected ui-state-active ui-tabs-deselectable").removeClass("ui-state-default");m(o,s)});this.blur();return false}}}if(d.cookie){r._cookie(d.selected,d.cookie)}r.$panels.stop();if(s.length){var o=this;r.load(r.$tabs.index(this),i.length?function(){g(o,t,i,s)}:function(){t.addClass("ui-tabs-selected ui-state-active").removeClass("ui-state-default");m(o,s)})}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(a.browser.msie){this.blur()}return false});if(d.event!="click"){this.$tabs.bind("click.tabs",function(){return false})}},destroy:function(){var b=this.options;this.element.removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all");this.list.unbind(".tabs").removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").removeData("tabs");this.$tabs.each(function(){var c=a.data(this,"href.tabs");if(c){this.href=c}var d=a(this).unbind(".tabs");a.each(["href","load","cache"],function(e,f){d.removeData(f+".tabs")})});this.$lis.unbind(".tabs").add(this.$panels).each(function(){if(a.data(this,"destroy.tabs")){a(this).remove()}else{a(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-tabs-deselectable ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")}});if(b.cookie){this._cookie(null,b.cookie)}},add:function(c,h,f){if(f==undefined){f=this.$tabs.length}var i=this,e=this.options;var g=a(e.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,h));g.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var d=c.indexOf("#")==0?c.replace("#",""):this._tabId(a("a:first-child",g)[0]);var j=a("#"+d);if(!j.length){j=a(e.panelTemplate).attr("id",d).data("destroy.tabs",true)}j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(f>=this.$lis.length){g.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{g.insertBefore(this.$lis[f]);j.insertBefore(this.$panels[f])}e.disabled=a.map(e.disabled,function(l,k){return l>=f?++l:l});this._tabify();if(this.$tabs.length==1){g.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");var b=a.data(this.$tabs[0],"load.tabs");if(b){this.load(0,function(){i._trigger("show",null,i._ui(i.$tabs[0],i.$panels[0]))})}}this._trigger("add",null,this._ui(this.$tabs[f],this.$panels[f]))},remove:function(b){var d=this.options,e=this.$lis.eq(b).remove(),c=this.$panels.eq(b).remove();if(e.hasClass("ui-tabs-selected")&&this.$tabs.length>1){this.select(b+(b+1<this.$tabs.length?1:-1))}d.disabled=a.map(a.grep(d.disabled,function(g,f){return g!=b}),function(g,f){return g>=b?--g:g});this._tabify();this._trigger("remove",null,this._ui(e.find("a")[0],c[0]))},enable:function(b){var c=this.options;if(a.inArray(b,c.disabled)==-1){return}this.$lis.eq(b).removeClass("ui-state-disabled");c.disabled=a.grep(c.disabled,function(e,d){return e!=b});this._trigger("enable",null,this._ui(this.$tabs[b],this.$panels[b]))},disable:function(c){var b=this,d=this.options;if(c!=d.selected){this.$lis.eq(c).addClass("ui-state-disabled");d.disabled.push(c);d.disabled.sort();this._trigger("disable",null,this._ui(this.$tabs[c],this.$panels[c]))}},select:function(b){if(typeof b=="string"){b=this.$tabs.index(this.$tabs.filter("[href$="+b+"]"))}this.$tabs.eq(b).trigger(this.options.event+".tabs")},load:function(g,k){var l=this,d=this.options,e=this.$tabs.eq(g),j=e[0],h=k==undefined||k===false,b=e.data("load.tabs");k=k||function(){};if(!b||!h&&a.data(j,"cache.tabs")){k();return}var m=function(n){var o=a(n),p=o.find("*:last");return p.length&&p.is(":not(img)")&&p||o};var c=function(){l.$tabs.filter(".ui-tabs-loading").removeClass("ui-tabs-loading").each(function(){if(d.spinner){m(this).parent().html(m(this).data("label.tabs"))}});l.xhr=null};if(d.spinner){var i=m(j).html();m(j).wrapInner("<em></em>").find("em").data("label.tabs",i).html(d.spinner)}var f=a.extend({},d.ajaxOptions,{url:b,success:function(o,n){a(l._sanitizeSelector(j.hash)).html(o);c();if(d.cache){a.data(j,"cache.tabs",true)}l._trigger("load",null,l._ui(l.$tabs[g],l.$panels[g]));try{d.ajaxOptions.success(o,n)}catch(p){}k()}});if(this.xhr){this.xhr.abort();c()}e.addClass("ui-tabs-loading");l.xhr=a.ajax(f)},url:function(c,b){this.$tabs.eq(c).removeData("cache.tabs").data("load.tabs",b)},length:function(){return this.$tabs.length}});a.extend(a.ui.tabs,{version:"1.6rc6",getter:"length",defaults:{ajaxOptions:null,cache:false,cookie:null,deselectable:false,disabled:[],event:"click",fx:null,idPrefix:"ui-tabs-",panelTemplate:"<div></div>",spinner:"Loading…",tabTemplate:'<li><a href="#{href}"><span>#{label}</span></a></li>'}});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(d,f){var b=this,e=this.options.selected;function c(){clearTimeout(b.rotation);b.rotation=setTimeout(function(){e=++e<b.$tabs.length?e:0;b.select(e)},d)}if(d){this.element.bind("tabsshow",c);this.$tabs.bind(this.options.event+".tabs",!f?function(g){if(g.clientX){clearTimeout(b.rotation);b.element.unbind("tabsshow",c)}}:function(g){e=b.options.selected;c()});c()}else{clearTimeout(b.rotation);this.element.unbind("tabsshow",c);this.$tabs.unbind(this.options.event+".tabs",stop)}}})})(jQuery);;/*\r
+ * jQuery UI Datepicker 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Datepicker\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function($){$.extend($.ui,{datepicker:{version:"1.6rc6"}});var PROP_NAME="datepicker";function Datepicker(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass="ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],dateFormat:"mm/dd/yy",firstDay:0,isRTL:false};this._defaults={showOn:"focus",showAnim:"show",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,showMonthAfterYear:false,yearRange:"-10:+10",showOtherMonths:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"normal",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false};$.extend(this._defaults,this.regional[""]);this.dpDiv=$('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>')}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",log:function(){if(this.debug){console.log.apply("",arguments)}},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){target.id="dp"+(++this.uuid)}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([:\[\]\.])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(target,inst){var input=$(target);if(input.hasClass(this.markerClassName)){return}var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(appendText){input[isRTL?"before":"after"]('<span class="'+this._appendClass+'">'+appendText+"</span>")}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");var trigger=$(this._get(inst,"buttonImageOnly")?$("<img/>").addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('<button type="button"></button>').addClass(this._triggerClass).html(buttonImage==""?buttonText:$("<img/>").attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?"before":"after"](trigger);trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==target){$.datepicker._hideDatepicker()}else{$.datepicker._showDatepicker(target)}return false})}input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst)},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName)){return}divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst));this._updateDatepicker(inst);this._updateAlternate(inst)},_dialogDatepicker:function(input,dateText,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){var id="dp"+(++this.uuid);this._dialogInput=$('<input type="text" id="'+id+'" size="1" style="position: absolute; top: -100px;"/>');this._dialogInput.keydown(this._doKeyDown);$("body").append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst)}extendRemove(inst.settings,settings||{});this._dialogInput.val(dateText);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth;var browserHeight=window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY]}this._dialogInput.css("left",this._pos[0]+"px").css("top",this._pos[1]+"px");inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI){$.blockUI(this.dpDiv)}$.data(this._dialogInput[0],PROP_NAME,inst);return this},_destroyDatepicker:function(target){var $target=$(target);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=="input"){$target.siblings("."+this._appendClass).remove().end().siblings("."+this._triggerClass).remove().end().removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress)}else{if(nodeName=="div"||nodeName=="span"){$target.removeClass(this.markerClassName).empty()}}},_enableDatepicker:function(target){var $target=$(target);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=false;$target.siblings("button."+this._triggerClass).each(function(){this.disabled=false}).end().siblings("img."+this._triggerClass).css({opacity:"1.0",cursor:""})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().removeClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)})},_disableDatepicker:function(target){var $target=$(target);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=true;$target.siblings("button."+this._triggerClass).each(function(){this.disabled=true}).end().siblings("img."+this._triggerClass).css({opacity:"0.5",cursor:"default"})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().addClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)});this._disabledInputs[this._disabledInputs.length]=target},_isDisabledDatepicker:function(target){if(!target){return false}for(var i=0;i<this._disabledInputs.length;i++){if(this._disabledInputs[i]==target){return true}}return false},_getInst:function(target){try{return $.data(target,PROP_NAME)}catch(err){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(target,name,value){var settings=name||{};if(typeof name=="string"){settings={};settings[name]=value}var inst=this._getInst(target);if(inst){if(this._curInst==inst){this._hideDatepicker(null)}extendRemove(inst.settings,settings);var date=new Date();extendRemove(inst,{rangeStart:null,endDay:null,endMonth:null,endYear:null,selectedDay:date.getDate(),selectedMonth:date.getMonth(),selectedYear:date.getFullYear(),currentDay:date.getDate(),currentMonth:date.getMonth(),currentYear:date.getFullYear(),drawMonth:date.getMonth(),drawYear:date.getFullYear()});this._updateDatepicker(inst)}},_changeDatepicker:function(target,name,value){this._optionDatepicker(target,name,value)},_refreshDatepicker:function(target){var inst=this._getInst(target);if(inst){this._updateDatepicker(inst)}},_setDateDatepicker:function(target,date,endDate){var inst=this._getInst(target);if(inst){this._setDate(inst,date,endDate);this._updateDatepicker(inst);this._updateAlternate(inst)}},_getDateDatepicker:function(target){var inst=this._getInst(target);if(inst&&!inst.inline){this._setDateFromField(inst)}return(inst?this._getDate(inst):null)},_doKeyDown:function(event){var inst=$.datepicker._getInst(event.target);var handled=true;var isRTL=inst.dpDiv.is(".ui-datepicker-rtl");inst._keyEvent=true;if($.datepicker._datepickerShowing){switch(event.keyCode){case 9:$.datepicker._hideDatepicker(null,"");break;case 13:var sel=$("td."+$.datepicker._dayOverClass+", td."+$.datepicker._currentClass,inst.dpDiv);if(sel[0]){$.datepicker._selectDay(event.target,inst.selectedMonth,inst.selectedYear,sel[0])}else{$.datepicker._hideDatepicker(null,$.datepicker._get(inst,"duration"))}return false;break;case 27:$.datepicker._hideDatepicker(null,$.datepicker._get(inst,"duration"));break;case 33:$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M");break;case 34:$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M");break;case 35:if(event.ctrlKey||event.metaKey){$.datepicker._clearDate(event.target)}handled=event.ctrlKey||event.metaKey;break;case 36:if(event.ctrlKey||event.metaKey){$.datepicker._gotoToday(event.target)}handled=event.ctrlKey||event.metaKey;break;case 37:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?+1:-1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M")}break;case 38:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,-7,"D")}handled=event.ctrlKey||event.metaKey;break;case 39:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?-1:+1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M")}break;case 40:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,+7,"D")}handled=event.ctrlKey||event.metaKey;break;default:handled=false}}else{if(event.keyCode==36&&event.ctrlKey){$.datepicker._showDatepicker(this)}else{handled=false}}if(handled){event.preventDefault();event.stopPropagation()}},_doKeyPress:function(event){var inst=$.datepicker._getInst(event.target);if($.datepicker._get(inst,"constrainInput")){var chars=$.datepicker._possibleChars($.datepicker._get(inst,"dateFormat"));var chr=String.fromCharCode(event.charCode==undefined?event.keyCode:event.charCode);return event.ctrlKey||(chr<" "||!chars||chars.indexOf(chr)>-1)}},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return}var inst=$.datepicker._getInst(input);var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));$.datepicker._hideDatepicker(null,"");$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.rangeStart=null;inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim")||"show";var duration=$.datepicker._get(inst,"duration");var postProcess=function(){$.datepicker._datepickerShowing=true;if($.browser.msie&&parseInt($.browser.version,10)<7){$("iframe.ui-datepicker-cover").css({width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4})}};if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim](duration,postProcess)}if(duration==""){postProcess()}if(inst.input[0].type!="hidden"){inst.input[0].focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var dims={width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4};var self=this;inst.dpDiv.empty().append(this._generateHTML(inst)).find("iframe.ui-datepicker-cover").css({width:dims.width,height:dims.height}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){$(this).removeClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).removeClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).removeClass("ui-datepicker-next-hover")}}).bind("mouseover",function(){if(!self._isDisabledDatepicker(inst.inline?inst.dpDiv.parent()[0]:inst.input[0])){$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");$(this).addClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).addClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).addClass("ui-datepicker-next-hover")}}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;if(cols>1){inst.dpDiv.addClass("ui-datepicker-multi-"+cols).css("width",(width*cols)+"em")}else{inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("")}inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst.input&&inst.input[0].type!="hidden"&&inst==$.datepicker._curInst){$(inst.input[0]).focus()}},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=(window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth)+$(document).scrollLeft();var viewHeight=(window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight)+$(document).scrollTop();offset.left-=(this._get(inst,"isRTL")?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0;offset.top-=(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(offset.top+dpHeight+inputHeight*2-viewHeight):0;return offset},_findPos:function(obj){while(obj&&(obj.type=="hidden"||obj.nodeType!=1)){obj=obj.nextSibling}var position=$(obj).offset();return[position.left,position.top]},_hideDatepicker:function(input,duration){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return}if(inst.stayOpen){this._selectDate("#"+inst.id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))}inst.stayOpen=false;if(this._datepickerShowing){duration=(duration!=null?duration:this._get(inst,"duration"));var showAnim=this._get(inst,"showAnim");var postProcess=function(){$.datepicker._tidyDialog(inst)};if(duration!=""&&$.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(duration==""?"hide":(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide")))](duration,postProcess)}if(duration==""){this._tidyDialog(inst)}var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}this._curInst=null},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(event){if(!$.datepicker._curInst){return}var $target=$(event.target);if(($target.parents("#"+$.datepicker._mainDivId).length==0)&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker(null,"")}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return}this._adjustInstDate(inst,offset+(period=="M"?this._get(inst,"showCurrentAtPos"):0),period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear&&!$.browser.msie){inst.input[0].focus()}inst._selectingMonthYear=!inst._selectingMonthYear},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return}var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;if(inst.stayOpen){inst.endDay=inst.endMonth=inst.endYear=null}this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));if(inst.stayOpen){inst.rangeStart=this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay));this._updateDatepicker(inst)}},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);inst.stayOpen=false;inst.endDay=inst.endMonth=inst.endYear=inst.rangeStart=null;this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{if(!inst.stayOpen){this._hideDatepicker(null,this._get(inst,"duration"));this._lastInput=inst.input[0];if(typeof(inst.input[0])!="object"){inst.input[0].focus()}this._lastInput=null}}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat")||this._get(inst,"dateFormat");var date=this._getDate(inst);dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getFullYear(),date.getMonth(),date.getDate());var firstMon=new Date(checkDate.getFullYear(),1-1,4);var firstDay=firstMon.getDay()||7;firstMon.setDate(firstMon.getDate()+1-firstDay);if(firstDay<4&&checkDate<firstMon){checkDate.setDate(checkDate.getDate()-3);return $.datepicker.iso8601Week(checkDate)}else{if(checkDate>new Date(checkDate.getFullYear(),12-1,28)){firstDay=new Date(checkDate.getFullYear()+1,1-1,4).getDay()||7;if(firstDay>4&&(checkDate.getDay()||7)<firstDay-3){return 1}}}return Math.floor(((checkDate-firstMon)/86400000)/7)+1},parseDate:function(format,value,settings){if(format==null||value==null){throw"Invalid arguments"}value=(typeof value=="object"?value.toString():value+"");if(value==""){return null}var shortYearCutoff=(settings?settings.shortYearCutoff:null)||this._defaults.shortYearCutoff;var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var year=-1;var month=-1;var day=-1;var doy=-1;var literal=false;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var getNumber=function(match){lookAhead(match);var origSize=(match=="@"?14:(match=="y"?4:(match=="o"?3:2)));var size=origSize;var num=0;while(size>0&&iValue<value.length&&value.charAt(iValue)>="0"&&value.charAt(iValue)<="9"){num=num*10+parseInt(value.charAt(iValue++),10);size--}if(size==origSize){throw"Missing number at position "+iValue}return num};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);var size=0;for(var j=0;j<names.length;j++){size=Math.max(size,names[j].length)}var name="";var iInit=iValue;while(size>0&&iValue<value.length){name+=value.charAt(iValue++);for(var i=0;i<names.length;i++){if(name==names[i]){return i+1}}size--}throw"Unknown name at position "+iInit};var checkLiteral=function(){if(value.charAt(iValue)!=format.charAt(iFormat)){throw"Unexpected literal at position "+iValue}iValue++};var iValue=0;for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{checkLiteral()}}else{switch(format.charAt(iFormat)){case"d":day=getNumber("d");break;case"D":getName("D",dayNamesShort,dayNames);break;case"o":doy=getNumber("o");break;case"m":month=getNumber("m");break;case"M":month=getName("M",monthNamesShort,monthNames);break;case"y":year=getNumber("y");break;case"@":var date=new Date(getNumber("@"));year=date.getFullYear();month=date.getMonth()+1;day=date.getDate();break;case"'":if(lookAhead("'")){checkLiteral()}else{literal=true}break;default:checkLiteral()}}}if(year==-1){year=new Date().getFullYear()}else{if(year<100){year+=new Date().getFullYear()-new Date().getFullYear()%100+(year<=shortYearCutoff?0:-100)}}if(doy>-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TIMESTAMP:"@",W3C:"yy-mm-dd",formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var formatNumber=function(match,value,len){var num=""+value;if(lookAhead(match)){while(num.length<len){num="0"+num}}return num};var formatName=function(match,value,shortNames,longNames){return(lookAhead(match)?longNames[value]:shortNames[value])};var output="";var literal=false;if(date){for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{output+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":output+=formatNumber("d",date.getDate(),2);break;case"D":output+=formatName("D",date.getDay(),dayNamesShort,dayNames);break;case"o":var doy=date.getDate();for(var m=date.getMonth()-1;m>=0;m--){doy+=this._getDaysInMonth(date.getFullYear(),m)}output+=formatNumber("o",doy,3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{chars+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":case"m":case"y":case"@":chars+="0123456789";break;case"D":case"M":return null;case"'":if(lookAhead("'")){chars+="'"}else{literal=true}break;default:chars+=format.charAt(iFormat)}}}return chars},_get:function(inst,name){return inst.settings[name]!==undefined?inst.settings[name]:this._defaults[name]},_setDateFromField:function(inst){var dateFormat=this._get(inst,"dateFormat");var dates=inst.input?inst.input.val():null;inst.endDay=inst.endMonth=inst.endYear=null;var date=defaultDate=this._getDefaultDate(inst);var settings=this._getFormatConfig(inst);try{date=this.parseDate(dateFormat,dates,settings)||defaultDate}catch(event){this.log(event);date=defaultDate}inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();inst.currentDay=(dates?date.getDate():0);inst.currentMonth=(dates?date.getMonth():0);inst.currentYear=(dates?date.getFullYear():0);this._adjustInstDate(inst)},_getDefaultDate:function(inst){var date=this._determineDate(this._get(inst,"defaultDate"),new Date());var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&date<minDate?minDate:date);date=(maxDate&&date>maxDate?maxDate:date);return date},_determineDate:function(date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date};var offsetString=function(offset,getDaysInMonth){var date=new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};date=(date==null?defaultDate:(typeof date=="string"?offsetString(date,this._getDaysInMonth):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):date)));date=(date&&date.toString()=="Invalid Date"?defaultDate:date);if(date){date.setHours(0);date.setMinutes(0);date.setSeconds(0);date.setMilliseconds(0)}return this._daylightSavingAdjust(date)},_daylightSavingAdjust:function(date){if(!date){return null}date.setHours(date.getHours()>12?date.getHours()+2:0);return date},_setDate:function(inst,date,endDate){var clear=!(date);var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;date=this._determineDate(date,new Date());inst.selectedDay=inst.currentDay=date.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=date.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=date.getFullYear();if(origMonth!=inst.selectedMonth||origYear!=inst.selectedYear){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,"isRTL");var showButtonPanel=this._get(inst,"showButtonPanel");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var stepBigMonths=this._get(inst,"stepBigMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-numMonths[1]+1,maxDate.getDate()));maxDraw=(minDate&&maxDraw<minDate?minDate:maxDraw);while(this._daylightSavingAdjust(new Date(drawYear,drawMonth,1))>maxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?'<a class="ui-datepicker-prev ui-corner-all" onclick="jQuery.datepicker._adjustDate(\'#'+inst.id+"', -"+stepMonths+", 'M');\" title=\""+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>"));var nextText=this._get(inst,"nextText");nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,this._daylightSavingAdjust(new Date(drawYear,drawMonth+stepMonths,1)),this._getFormatConfig(inst)));var next=(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?'<a class="ui-datepicker-next ui-corner-all" onclick="jQuery.datepicker._adjustDate(\'#'+inst.id+"', +"+stepMonths+", 'M');\" title=\""+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>"));var currentText=this._get(inst,"currentText");var gotoDate=(this._get(inst,"gotoCurrent")&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var controls='<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="jQuery.datepicker._hideDatepicker();">'+this._get(inst,"closeText")+"</button>";var buttonPanel=(showButtonPanel)?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(isRTL?controls:"")+(this._isInRange(inst,gotoDate)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="jQuery.datepicker._gotoToday(\'#'+inst.id+"');\">"+currentText+"</button>":"")+(isRTL?"":controls)+"</div>":"";var firstDay=parseInt(this._get(inst,"firstDay"),10);firstDay=(isNaN(firstDay)?0:firstDay);var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var monthNamesShort=this._get(inst,"monthNamesShort");var beforeShowDay=this._get(inst,"beforeShowDay");var showOtherMonths=this._get(inst,"showOtherMonths");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var endDate=inst.endDay?this._daylightSavingAdjust(new Date(inst.endYear,inst.endMonth,inst.endDay)):currentDate;var defaultDate=this._getDefaultDate(inst);var html="";for(var row=0;row<numMonths[0];row++){var group="";for(var col=0;col<numMonths[1];col++){var selectedDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,inst.selectedDay));var cornerClass=" ui-corner-all";var calender="";if(isMultiMonth){calender+='<div class="ui-datepicker-group ui-datepicker-group-';switch(col){case 0:calender+="first";cornerClass=" ui-corner-"+(isRTL?"right":"left");break;case numMonths[1]-1:calender+="last";cornerClass=" ui-corner-"+(isRTL?"left":"right");break;default:calender+="middle";cornerClass="";break}calender+='">'}calender+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+cornerClass+'">'+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):"")+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):"")+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,row>0||col>0,monthNames,monthNamesShort)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var thead="";for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+="<th"+((dow+firstDay+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+dayNames[day]+'">'+dayNamesMin[day]+"</span></th>"}calender+=thead+"</tr></thead><tbody>";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow<numRows;dRow++){calender+="<tr>";var tbody="";for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=otherMonth||!daySettings[0]||(minDate&&printDate<minDate)||(maxDate&&printDate>maxDate);tbody+='<td class="'+((dow+firstDay+6)%7>=5?" ui-datepicker-week-end":"")+(otherMonth?" ui-datepicker-other-month":"")+((printDate.getTime()==selectedDate.getTime()&&drawMonth==inst.selectedMonth&&inst._keyEvent)||(defaultDate.getTime()==printDate.getTime()&&defaultDate.getTime()==selectedDate.getTime())?" "+this._dayOverClass:"")+(unselectable?" "+this._unselectableClass+" ui-state-disabled":"")+(otherMonth&&!showOtherMonths?"":" "+daySettings[1]+(printDate.getTime()>=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?"":" onclick=\"jQuery.datepicker._selectDay('#"+inst.id+"',"+drawMonth+","+drawYear+', this);return false;"')+">"+(otherMonth?(showOtherMonths?printDate.getDate():" "):(unselectable?'<span class="ui-state-default">'+printDate.getDate()+"</span>":'<a class="ui-state-default'+(printDate.getTime()==today.getTime()?" ui-state-highlight":"")+(printDate.getTime()>=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" ui-state-active":"")+'" href="#">'+printDate.getDate()+"</a>"))+"</td>";printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate)}calender+=tbody+"</tr>"}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}calender+="</tbody></table>"+(isMultiMonth?"</div>":"");group+=calender}html+=group}html+=(!inst.inline?buttonPanel:"")+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");inst._keyEvent=false;return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,secondary,monthNames,monthNamesShort){minDate=(inst.rangeStart&&minDate&&selectedDate<minDate?selectedDate:minDate);var changeMonth=this._get(inst,"changeMonth");var changeYear=this._get(inst,"changeYear");var showMonthAfterYear=this._get(inst,"showMonthAfterYear");var html='<div class="ui-datepicker-title">';var monthHtml="";if(secondary||!changeMonth){monthHtml+='<span class="ui-datepicker-month">'+monthNames[drawMonth]+"</span> "}else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='<select class="ui-datepicker-month" onchange="jQuery.datepicker._selectMonthYear(\'#'+inst.id+"', this, 'M');\" onclick=\"jQuery.datepicker._clickMonthYear('#"+inst.id+"');\">";for(var month=0;month<12;month++){if((!inMinYear||month>=minDate.getMonth())&&(!inMaxYear||month<=maxDate.getMonth())){monthHtml+='<option value="'+month+'"'+(month==drawMonth?' selected="selected"':"")+">"+monthNamesShort[month]+"</option>"}}monthHtml+="</select>"}if(!showMonthAfterYear){html+=monthHtml+((secondary||changeMonth||changeYear)&&(!(changeMonth&&changeYear))?" ":"")}if(secondary||!changeYear){html+='<span class="ui-datepicker-year">'+drawYear+"</span>"}else{var years=this._get(inst,"yearRange").split(":");var year=0;var endYear=0;if(years.length!=2){year=drawYear-10;endYear=drawYear+10}else{if(years[0].charAt(0)=="+"||years[0].charAt(0)=="-"){year=drawYear+parseInt(years[0],10);endYear=drawYear+parseInt(years[1],10)}else{year=parseInt(years[0],10);endYear=parseInt(years[1],10)}}year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);html+='<select class="ui-datepicker-year" onchange="jQuery.datepicker._selectMonthYear(\'#'+inst.id+"', this, 'Y');\" onclick=\"jQuery.datepicker._clickMonthYear('#"+inst.id+"');\">";for(;year<=endYear;year++){html+='<option value="'+year+'"'+(year==drawYear?' selected="selected"':"")+">"+year+"</option>"}html+="</select>"}if(showMonthAfterYear){html+=(secondary||changeMonth||changeYear?" ":"")+monthHtml}html+="</div>";return html},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=this._daylightSavingAdjust(new Date(year,month,day));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&date<minDate?minDate:date);date=(maxDate&&date>maxDate?maxDate:date);inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax,checkRange){var date=this._determineDate(this._get(inst,minMax+"Date"),null);return(!checkRange||!inst.rangeStart?date:(!date||inst.rangeStart>date?inst.rangeStart:date))},_getDaysInMonth:function(year,month){return 32-new Date(year,month,32).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[1]),1));if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var newMinDate=(!inst.rangeStart?null:this._daylightSavingAdjust(new Date(inst.selectedYear,inst.selectedMonth,inst.selectedDay)));newMinDate=(newMinDate&&inst.rangeStart<newMinDate?inst.rangeStart:newMinDate);var minDate=newMinDate||this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");return((!minDate||date>=minDate)&&(!maxDate||date<=maxDate))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.6rc6"})(jQuery);;/*\r
+ * jQuery UI Progressbar 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Progressbar\r
+ *\r
+ * Depends:\r
+ * ui.core.js\r
+ */\r(function(a){a.widget("ui.progressbar",{_init:function(){var b=this,c=this.options;this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this._valueMin(),"aria-valuemax":this._valueMax(),"aria-valuenow":this._value()});this.valueDiv=a('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow").removeData("progressbar").unbind(".progressbar");this.valueDiv.remove();a.widget.prototype.destroy.apply(this,arguments)},value:function(b){arguments.length&&this._setData("value",b);return this._value()},_setData:function(b,c){switch(b){case"value":this.options.value=c;this._refreshValue();this._trigger("change",null,{});break}a.widget.prototype._setData.apply(this,arguments)},_value:function(){var b=this.options.value;if(b<this._valueMin()){b=this._valueMin()}if(b>this._valueMax()){b=this._valueMax()}return b},_valueMin:function(){var b=0;return b},_valueMax:function(){var b=100;return b},_refreshValue:function(){var b=this.value();this.valueDiv[b==this._valueMax()?"addClass":"removeClass"]("ui-corner-right");this.valueDiv.width(b+"%");this.element.attr("aria-valuenow",b)}});a.extend(a.ui.progressbar,{version:"1.6rc6",defaults:{value:0}})})(jQuery);;/*\r
+ * jQuery UI Effects 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/\r
+ */\r(function(d){d.effects=d.effects||{};d.extend(d.effects,{version:"1.6rc6",save:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.data("ec.storage."+h[f],g[0].style[h[f]])}}},restore:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.css(h[f],g.data("ec.storage."+h[f]))}}},setMode:function(f,g){if(g=="toggle"){g=f.is(":hidden")?"show":"hide"}return g},getBaseline:function(g,h){var i,f;switch(g[0]){case"top":i=0;break;case"middle":i=0.5;break;case"bottom":i=1;break;default:i=g[0]/h.height}switch(g[1]){case"left":f=0;break;case"center":f=0.5;break;case"right":f=1;break;default:f=g[1]/h.width}return{x:f,y:i}},createWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent()}var g={width:f.outerWidth(true),height:f.outerHeight(true),"float":f.css("float")};f.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');var j=f.parent();if(f.css("position")=="static"){j.css({position:"relative"});f.css({position:"relative"})}else{var i=f.css("top");if(isNaN(parseInt(i,10))){i="auto"}var h=f.css("left");if(isNaN(parseInt(h,10))){h="auto"}j.css({position:f.css("position"),top:i,left:h,zIndex:f.css("z-index")}).show();f.css({position:"relative",top:0,left:0})}j.css(g);return j},removeWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent().replaceWith(f)}return f},setTransition:function(g,i,f,h){h=h||{};d.each(i,function(k,j){unit=g.cssUnit(j);if(unit[0]>0){h[j]=unit[0]*f+unit[1]}});return h},animateClass:function(h,i,k,j){var f=(typeof k=="function"?k:(j?j:null));var g=(typeof k=="string"?k:null);return this.each(function(){var q={};var o=d(this);var p=o.attr("style")||"";if(typeof p=="object"){p=p.cssText}if(h.toggle){o.hasClass(h.toggle)?h.remove=h.toggle:h.add=h.toggle}var l=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.addClass(h.add)}if(h.remove){o.removeClass(h.remove)}var m=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.removeClass(h.add)}if(h.remove){o.addClass(h.remove)}for(var r in m){if(typeof m[r]!="function"&&m[r]&&r.indexOf("Moz")==-1&&r.indexOf("length")==-1&&m[r]!=l[r]&&(r.match(/color/i)||(!r.match(/color/i)&&!isNaN(parseInt(m[r],10))))&&(l.position!="static"||(l.position=="static"&&!r.match(/left|top|bottom|right/)))){q[r]=m[r]}}o.animate(q,i,g,function(){if(typeof d(this).attr("style")=="object"){d(this).attr("style")["cssText"]="";d(this).attr("style")["cssText"]=p}else{d(this).attr("style",p)}if(h.add){d(this).addClass(h.add)}if(h.remove){d(this).removeClass(h.remove)}if(f){f.apply(this,arguments)}})})}});function c(g,f){var i=g[1]&&g[1].constructor==Object?g[1]:{};if(f){i.mode=f}var h=g[1]&&g[1].constructor!=Object?g[1]:i.duration;h=d.fx.off?0:typeof h==="number"?h:d.fx.speeds[h]||d.fx.speeds._default;var j=i.callback||(d.isFunction(g[2])&&g[2])||(d.isFunction(g[3])&&g[3]);return[g[0],i,h,j]}d.fn.extend({_show:d.fn.show,_hide:d.fn.hide,__toggle:d.fn.toggle,_addClass:d.fn.addClass,_removeClass:d.fn.removeClass,_toggleClass:d.fn.toggleClass,effect:function(g,f,h,i){return d.effects[g]?d.effects[g].call(this,{method:g,options:f||{},duration:h,callback:i}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._show.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"show"))}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._hide.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"hide"))}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||(arguments[0].constructor==Function)){return this.__toggle.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"toggle"))}},addClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{add:g},f,i,h]):this._addClass(g)},removeClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{remove:g},f,i,h]):this._removeClass(g)},toggleClass:function(g,f,i,h){return((typeof f!=="boolean")&&f)?d.effects.animateClass.apply(this,[{toggle:g},f,i,h]):this._toggleClass(g,f)},morph:function(f,h,g,j,i){return d.effects.animateClass.apply(this,[{add:h,remove:f},g,j,i])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(f){var g=this.css(f),h=[];d.each(["em","px","%","pt"],function(j,k){if(g.indexOf(k)>0){h=[parseFloat(g),k]}});return h}});d.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(g,f){d.fx.step[f]=function(h){if(h.state==0){h.start=e(h.elem,f);h.end=b(h.end)}h.elem.style[f]="rgb("+[Math.max(Math.min(parseInt((h.pos*(h.end[0]-h.start[0]))+h.start[0],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[1]-h.start[1]))+h.start[1],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[2]-h.start[2]))+h.start[2],10),255),0)].join(",")+")"}});function b(g){var f;if(g&&g.constructor==Array&&g.length==3){return g}if(f=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(g)){return[parseInt(f[1],10),parseInt(f[2],10),parseInt(f[3],10)]}if(f=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(g)){return[parseFloat(f[1])*2.55,parseFloat(f[2])*2.55,parseFloat(f[3])*2.55]}if(f=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(g)){return[parseInt(f[1],16),parseInt(f[2],16),parseInt(f[3],16)]}if(f=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(g)){return[parseInt(f[1]+f[1],16),parseInt(f[2]+f[2],16),parseInt(f[3]+f[3],16)]}if(f=/rgba\(0, 0, 0, 0\)/.exec(g)){return a.transparent}return a[d.trim(g).toLowerCase()]}function e(h,f){var g;do{g=d.curCSS(h,f);if(g!=""&&g!="transparent"||d.nodeName(h,"body")){break}f="backgroundColor"}while(h=h.parentNode);return b(g)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};d.easing.jswing=d.easing.swing;d.extend(d.easing,{def:"easeOutQuad",swing:function(g,h,f,j,i){return d.easing[d.easing.def](g,h,f,j,i)},easeInQuad:function(g,h,f,j,i){return j*(h/=i)*h+f},easeOutQuad:function(g,h,f,j,i){return -j*(h/=i)*(h-2)+f},easeInOutQuad:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h+f}return -j/2*((--h)*(h-2)-1)+f},easeInCubic:function(g,h,f,j,i){return j*(h/=i)*h*h+f},easeOutCubic:function(g,h,f,j,i){return j*((h=h/i-1)*h*h+1)+f},easeInOutCubic:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h+f}return j/2*((h-=2)*h*h+2)+f},easeInQuart:function(g,h,f,j,i){return j*(h/=i)*h*h*h+f},easeOutQuart:function(g,h,f,j,i){return -j*((h=h/i-1)*h*h*h-1)+f},easeInOutQuart:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h+f}return -j/2*((h-=2)*h*h*h-2)+f},easeInQuint:function(g,h,f,j,i){return j*(h/=i)*h*h*h*h+f},easeOutQuint:function(g,h,f,j,i){return j*((h=h/i-1)*h*h*h*h+1)+f},easeInOutQuint:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h*h+f}return j/2*((h-=2)*h*h*h*h+2)+f},easeInSine:function(g,h,f,j,i){return -j*Math.cos(h/i*(Math.PI/2))+j+f},easeOutSine:function(g,h,f,j,i){return j*Math.sin(h/i*(Math.PI/2))+f},easeInOutSine:function(g,h,f,j,i){return -j/2*(Math.cos(Math.PI*h/i)-1)+f},easeInExpo:function(g,h,f,j,i){return(h==0)?f:j*Math.pow(2,10*(h/i-1))+f},easeOutExpo:function(g,h,f,j,i){return(h==i)?f+j:j*(-Math.pow(2,-10*h/i)+1)+f},easeInOutExpo:function(g,h,f,j,i){if(h==0){return f}if(h==i){return f+j}if((h/=i/2)<1){return j/2*Math.pow(2,10*(h-1))+f}return j/2*(-Math.pow(2,-10*--h)+2)+f},easeInCirc:function(g,h,f,j,i){return -j*(Math.sqrt(1-(h/=i)*h)-1)+f},easeOutCirc:function(g,h,f,j,i){return j*Math.sqrt(1-(h=h/i-1)*h)+f},easeInOutCirc:function(g,h,f,j,i){if((h/=i/2)<1){return -j/2*(Math.sqrt(1-h*h)-1)+f}return j/2*(Math.sqrt(1-(h-=2)*h)+1)+f},easeInElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return -(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f},easeOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return h*Math.pow(2,-10*i)*Math.sin((i*l-j)*(2*Math.PI)/k)+m+f},easeInOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l/2)==2){return f+m}if(!k){k=l*(0.3*1.5)}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}if(i<1){return -0.5*(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f}return h*Math.pow(2,-10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k)*0.5+m+f},easeInBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*(h/=j)*h*((i+1)*h-i)+f},easeOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*((h=h/j-1)*h*((i+1)*h+i)+1)+f},easeInOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}if((h/=j/2)<1){return k/2*(h*h*(((i*=(1.525))+1)*h-i))+f}return k/2*((h-=2)*h*(((i*=(1.525))+1)*h+i)+2)+f},easeInBounce:function(g,h,f,j,i){return j-d.easing.easeOutBounce(g,i-h,0,j,i)+f},easeOutBounce:function(g,h,f,j,i){if((h/=i)<(1/2.75)){return j*(7.5625*h*h)+f}else{if(h<(2/2.75)){return j*(7.5625*(h-=(1.5/2.75))*h+0.75)+f}else{if(h<(2.5/2.75)){return j*(7.5625*(h-=(2.25/2.75))*h+0.9375)+f}else{return j*(7.5625*(h-=(2.625/2.75))*h+0.984375)+f}}}},easeInOutBounce:function(g,h,f,j,i){if(h<i/2){return d.easing.easeInBounce(g,h*2,0,j,i)*0.5+f}return d.easing.easeOutBounce(g,h*2-i,0,j,i)*0.5+j*0.5+f}})})(jQuery);;/*\r
+ * jQuery UI Effects Blind 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Blind\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.blind=function(b){return this.queue(function(){var d=a(this),c=["position","top","left"];var h=a.effects.setMode(d,b.options.mode||"hide");var g=b.options.direction||"vertical";a.effects.save(d,c);d.show();var j=a.effects.createWrapper(d).css({overflow:"hidden"});var e=(g=="vertical")?"height":"width";var i=(g=="vertical")?j.height():j.width();if(h=="show"){j.css(e,0)}var f={};f[e]=h=="show"?i:0;j.animate(f,b.duration,b.options.easing,function(){if(h=="hide"){d.hide()}a.effects.restore(d,c);a.effects.removeWrapper(d);if(b.callback){b.callback.apply(d[0],arguments)}d.dequeue()})})}})(jQuery);;/*\r
+ * jQuery UI Effects Bounce 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Bounce\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.bounce=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"up";var c=b.options.distance||20;var d=b.options.times||5;var g=b.duration||250;if(/show|hide/.test(k)){l.push("opacity")}a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var c=b.options.distance||(f=="top"?e.outerHeight({margin:true})/3:e.outerWidth({margin:true})/3);if(k=="show"){e.css("opacity",0).css(f,p=="pos"?-c:c)}if(k=="hide"){c=c/(d*2)}if(k!="hide"){d--}if(k=="show"){var h={opacity:1};h[f]=(p=="pos"?"+=":"-=")+c;e.animate(h,g/2,b.options.easing);c=c/2;d--}for(var j=0;j<d;j++){var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing);c=(k=="hide")?c*2:c/2}if(k=="hide"){var h={opacity:0};h[f]=(p=="pos"?"-=":"+=")+c;e.animate(h,g/2,b.options.easing,function(){e.hide();a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}else{var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);;/*\r
+ * jQuery UI Effects Clip 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Clip\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.clip=function(b){return this.queue(function(){var f=a(this),j=["position","top","left","height","width"];var i=a.effects.setMode(f,b.options.mode||"hide");var k=b.options.direction||"vertical";a.effects.save(f,j);f.show();var c=a.effects.createWrapper(f).css({overflow:"hidden"});var e=f[0].tagName=="IMG"?c:f;var g={size:(k=="vertical")?"height":"width",position:(k=="vertical")?"top":"left"};var d=(k=="vertical")?e.height():e.width();if(i=="show"){e.css(g.size,0);e.css(g.position,d/2)}var h={};h[g.size]=i=="show"?d:0;h[g.position]=i=="show"?0:d/2;e.animate(h,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){f.hide()}a.effects.restore(f,j);a.effects.removeWrapper(f);if(b.callback){b.callback.apply(f[0],arguments)}f.dequeue()}})})}})(jQuery);;/*\r
+ * jQuery UI Effects Drop 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Drop\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.drop=function(b){return this.queue(function(){var e=a(this),d=["position","top","left","opacity"];var i=a.effects.setMode(e,b.options.mode||"hide");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e);var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true})/2:e.outerWidth({margin:true})/2);if(i=="show"){e.css("opacity",0).css(f,c=="pos"?-j:j)}var g={opacity:i=="show"?1:0};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*\r
+ * jQuery UI Effects Explode 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Explode\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.explode=function(b){return this.queue(function(){var k=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;var e=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;b.options.mode=b.options.mode=="toggle"?(a(this).is(":visible")?"hide":"show"):b.options.mode;var h=a(this).show().css("visibility","hidden");var l=h.offset();l.top-=parseInt(h.css("marginTop"))||0;l.left-=parseInt(h.css("marginLeft"))||0;var g=h.outerWidth(true);var c=h.outerHeight(true);for(var f=0;f<k;f++){for(var d=0;d<e;d++){h.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-d*(g/e),top:-f*(c/k)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/e,height:c/k,left:l.left+d*(g/e)+(b.options.mode=="show"?(d-Math.floor(e/2))*(g/e):0),top:l.top+f*(c/k)+(b.options.mode=="show"?(f-Math.floor(k/2))*(c/k):0),opacity:b.options.mode=="show"?0:1}).animate({left:l.left+d*(g/e)+(b.options.mode=="show"?0:(d-Math.floor(e/2))*(g/e)),top:l.top+f*(c/k)+(b.options.mode=="show"?0:(f-Math.floor(k/2))*(c/k)),opacity:b.options.mode=="show"?1:0},b.duration||500)}}setTimeout(function(){b.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();if(b.callback){b.callback.apply(h[0])}h.dequeue();a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*\r
+ * jQuery UI Effects Fold 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Fold\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.fold=function(b){return this.queue(function(){var e=a(this),k=["position","top","left"];var h=a.effects.setMode(e,b.options.mode||"hide");var o=b.options.size||15;var n=!(!b.options.horizFirst);var g=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(e,k);e.show();var d=a.effects.createWrapper(e).css({overflow:"hidden"});var i=((h=="show")!=n);var f=i?["width","height"]:["height","width"];var c=i?[d.width(),d.height()]:[d.height(),d.width()];var j=/([0-9]+)%/.exec(o);if(j){o=parseInt(j[1])/100*c[h=="hide"?0:1]}if(h=="show"){d.css(n?{height:0,width:o}:{height:o,width:0})}var m={},l={};m[f[0]]=h=="show"?c[0]:o;l[f[1]]=h=="show"?c[1]:0;d.animate(m,g,b.options.easing).animate(l,g,b.options.easing,function(){if(h=="hide"){e.hide()}a.effects.restore(e,k);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);;/*\r
+ * jQuery UI Effects Highlight 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Highlight\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.highlight=function(b){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"];var h=a.effects.setMode(e,b.options.mode||"show");var c=b.options.color||"#ffff99";var g=e.css("backgroundColor");a.effects.save(e,d);e.show();e.css({backgroundImage:"none",backgroundColor:c});var f={backgroundColor:g};if(h=="hide"){f.opacity=0}e.animate(f,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(h=="hide"){e.hide()}a.effects.restore(e,d);if(h=="show"&&a.browser.msie){this.style.removeAttribute("filter")}if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*\r
+ * jQuery UI Effects Pulsate 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Pulsate\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.pulsate=function(b){return this.queue(function(){var d=a(this);var g=a.effects.setMode(d,b.options.mode||"show");var f=b.options.times||5;var e=b.duration?b.duration/2:a.fx.speeds._default/2;if(g=="hide"){f--}if(d.is(":hidden")){d.css("opacity",0);d.show();d.animate({opacity:1},e,b.options.easing);f=f-2}for(var c=0;c<f;c++){d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing)}if(g=="hide"){d.animate({opacity:0},e,b.options.easing,function(){d.hide();if(b.callback){b.callback.apply(this,arguments)}})}else{d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing,function(){if(b.callback){b.callback.apply(this,arguments)}})}d.queue("fx",function(){d.dequeue()});d.dequeue()})}})(jQuery);;/*\r
+ * jQuery UI Effects Scale 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Scale\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.puff=function(b){return this.queue(function(){var f=a(this);var c=a.extend(true,{},b.options);var h=a.effects.setMode(f,b.options.mode||"hide");var g=parseInt(b.options.percent)||150;c.fade=true;var e={height:f.height(),width:f.width()};var d=g/100;f.from=(h=="hide")?e:{height:e.height*d,width:e.width*d};c.from=f.from;c.percent=(h=="hide")?g:100;c.mode=h;f.effect("scale",c,b.duration,b.callback);f.dequeue()})};a.effects.scale=function(b){return this.queue(function(){var g=a(this);var d=a.extend(true,{},b.options);var j=a.effects.setMode(g,b.options.mode||"effect");var h=parseInt(b.options.percent)||(parseInt(b.options.percent)==0?0:(j=="hide"?0:100));var i=b.options.direction||"both";var c=b.options.origin;if(j!="effect"){d.origin=c||["middle","center"];d.restore=true}var f={height:g.height(),width:g.width()};g.from=b.options.from||(j=="show"?{height:0,width:0}:f);var e={y:i!="horizontal"?(h/100):1,x:i!="vertical"?(h/100):1};g.to={height:f.height*e.y,width:f.width*e.x};if(b.options.fade){if(j=="show"){g.from.opacity=0;g.to.opacity=1}if(j=="hide"){g.from.opacity=1;g.to.opacity=0}}d.from=g.from;d.to=g.to;d.mode=j;g.effect("size",d,b.duration,b.callback);g.dequeue()})};a.effects.size=function(b){return this.queue(function(){var c=a(this),n=["position","top","left","width","height","overflow","opacity"];var m=["position","top","left","overflow","opacity"];var j=["width","height","overflow"];var p=["fontSize"];var k=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"];var f=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"];var g=a.effects.setMode(c,b.options.mode||"effect");var i=b.options.restore||false;var e=b.options.scale||"both";var o=b.options.origin;var d={height:c.height(),width:c.width()};c.from=b.options.from||d;c.to=b.options.to||d;if(o){var h=a.effects.getBaseline(o,d);c.from.top=(d.height-c.from.height)*h.y;c.from.left=(d.width-c.from.width)*h.x;c.to.top=(d.height-c.to.height)*h.y;c.to.left=(d.width-c.to.width)*h.x}var l={from:{y:c.from.height/d.height,x:c.from.width/d.width},to:{y:c.to.height/d.height,x:c.to.width/d.width}};if(e=="box"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(k);c.from=a.effects.setTransition(c,k,l.from.y,c.from);c.to=a.effects.setTransition(c,k,l.to.y,c.to)}if(l.from.x!=l.to.x){n=n.concat(f);c.from=a.effects.setTransition(c,f,l.from.x,c.from);c.to=a.effects.setTransition(c,f,l.to.x,c.to)}}if(e=="content"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(p);c.from=a.effects.setTransition(c,p,l.from.y,c.from);c.to=a.effects.setTransition(c,p,l.to.y,c.to)}}a.effects.save(c,i?n:m);c.show();a.effects.createWrapper(c);c.css("overflow","hidden").css(c.from);if(e=="content"||e=="both"){k=k.concat(["marginTop","marginBottom"]).concat(p);f=f.concat(["marginLeft","marginRight"]);j=n.concat(k).concat(f);c.find("*[width]").each(function(){child=a(this);if(i){a.effects.save(child,j)}var q={height:child.height(),width:child.width()};child.from={height:q.height*l.from.y,width:q.width*l.from.x};child.to={height:q.height*l.to.y,width:q.width*l.to.x};if(l.from.y!=l.to.y){child.from=a.effects.setTransition(child,k,l.from.y,child.from);child.to=a.effects.setTransition(child,k,l.to.y,child.to)}if(l.from.x!=l.to.x){child.from=a.effects.setTransition(child,f,l.from.x,child.from);child.to=a.effects.setTransition(child,f,l.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){if(i){a.effects.restore(child,j)}})})}c.animate(c.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(g=="hide"){c.hide()}a.effects.restore(c,i?n:m);a.effects.removeWrapper(c);if(b.callback){b.callback.apply(this,arguments)}c.dequeue()}})})}})(jQuery);;/*\r
+ * jQuery UI Effects Shake 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Shake\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.shake=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"left";var c=b.options.distance||20;var d=b.options.times||3;var g=b.duration||b.options.duration||140;a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var h={},o={},m={};h[f]=(p=="pos"?"-=":"+=")+c;o[f]=(p=="pos"?"+=":"-=")+c*2;m[f]=(p=="pos"?"-=":"+=")+c*2;e.animate(h,g,b.options.easing);for(var j=1;j<d;j++){e.animate(o,g,b.options.easing).animate(m,g,b.options.easing)}e.animate(o,g,b.options.easing).animate(h,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}});e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);;/*\r
+ * jQuery UI Effects Slide 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Slide\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.slide=function(b){return this.queue(function(){var e=a(this),d=["position","top","left"];var i=a.effects.setMode(e,b.options.mode||"show");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e).css({overflow:"hidden"});var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true}):e.outerWidth({margin:true}));if(i=="show"){e.css(f,c=="pos"?-j:j)}var g={};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*\r
+ * jQuery UI Effects Transfer 1.6rc6\r
+ *\r
+ * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)\r
+ * Dual licensed under the MIT (MIT-LICENSE.txt)\r
+ * and GPL (GPL-LICENSE.txt) licenses.\r
+ *\r
+ * http://docs.jquery.com/UI/Effects/Transfer\r
+ *\r
+ * Depends:\r
+ * effects.core.js\r
+ */\r(function(a){a.effects.transfer=function(b){return this.queue(function(){var e=a(this);var g=a.effects.setMode(e,b.options.mode||"effect");var f=a(b.options.to);var c=e.offset();var d=a('<div class="ui-effects-transfer"></div>').appendTo(document.body);if(b.options.className){d.addClass(b.options.className)}d.addClass(b.options.className);d.css({top:c.top,left:c.left,height:e.outerHeight()-parseInt(d.css("borderTopWidth"))-parseInt(d.css("borderBottomWidth")),width:e.outerWidth()-parseInt(d.css("borderLeftWidth"))-parseInt(d.css("borderRightWidth")),position:"absolute"});c=f.offset();animation={top:c.top,left:c.left,height:f.outerHeight()-parseInt(d.css("borderTopWidth"))-parseInt(d.css("borderBottomWidth")),width:f.outerWidth()-parseInt(d.css("borderLeftWidth"))-parseInt(d.css("borderRightWidth"))};d.animate(animation,b.duration,b.options.easing,function(){d.remove();if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);;
\ No newline at end of file
--- /dev/null
+/**\r
+ * jQuery.timers - Timer abstractions for jQuery\r
+ * Written by Blair Mitchelmore (blair DOT mitchelmore AT gmail DOT com)\r
+ * Licensed under the WTFPL (http://sam.zoy.org/wtfpl/).\r
+ * Date: 2008/08/26\r
+ *\r
+ * @author Blair Mitchelmore\r
+ * @version 1.0.0\r
+ *\r
+ **/\r
+\r
+jQuery.fn.extend({\r
+ everyTime: function(interval, label, fn, times, belay) {\r
+ return this.each(function() {\r
+ jQuery.timer.add(this, interval, label, fn, times, belay);\r
+ });\r
+ },\r
+ oneTime: function(interval, label, fn) {\r
+ return this.each(function() {\r
+ jQuery.timer.add(this, interval, label, fn, 1);\r
+ });\r
+ },\r
+ stopTime: function(label, fn) {\r
+ return this.each(function() {\r
+ jQuery.timer.remove(this, label, fn);\r
+ });\r
+ }\r
+});\r
+\r
+jQuery.extend({\r
+ timer: {\r
+ guid: 1,\r
+ global: {},\r
+ regex: /^([0-9]+)\s*(.*s)?$/,\r
+ powers: {\r
+ // Yeah this is major overkill...\r
+ 'ms': 1,\r
+ 'cs': 10,\r
+ 'ds': 100,\r
+ 's': 1000,\r
+ 'das': 10000,\r
+ 'hs': 100000,\r
+ 'ks': 1000000\r
+ },\r
+ timeParse: function(value) {\r
+ if (value == undefined || value == null)\r
+ return null;\r
+ var result = this.regex.exec(jQuery.trim(value.toString()));\r
+ if (result[2]) {\r
+ var num = parseInt(result[1], 10);\r
+ var mult = this.powers[result[2]] || 1;\r
+ return num * mult;\r
+ } else {\r
+ return value;\r
+ }\r
+ },\r
+ add: function(element, interval, label, fn, times, belay) {\r
+ var counter = 0;\r
+ \r
+ if (jQuery.isFunction(label)) {\r
+ if (!times) \r
+ times = fn;\r
+ fn = label;\r
+ label = interval;\r
+ }\r
+ \r
+ interval = jQuery.timer.timeParse(interval);\r
+\r
+ if (typeof interval != 'number' || isNaN(interval) || interval <= 0)\r
+ return;\r
+\r
+ if (times && times.constructor != Number) {\r
+ belay = !!times;\r
+ times = 0;\r
+ }\r
+ \r
+ times = times || 0;\r
+ belay = belay || false;\r
+ \r
+ if (!element.$timers) \r
+ element.$timers = {};\r
+ \r
+ if (!element.$timers[label])\r
+ element.$timers[label] = {};\r
+ \r
+ fn.$timerID = fn.$timerID || this.guid++;\r
+ \r
+ var handler = function() {\r
+ if (belay && this.inProgress) \r
+ return;\r
+ this.inProgress = true;\r
+ if ((++counter > times && times !== 0) || fn.call(element, counter) === false)\r
+ jQuery.timer.remove(element, label, fn);\r
+ this.inProgress = false;\r
+ };\r
+ \r
+ handler.$timerID = fn.$timerID;\r
+ \r
+ if (!element.$timers[label][fn.$timerID]) \r
+ element.$timers[label][fn.$timerID] = window.setInterval(handler,interval);\r
+ \r
+ if ( !this.global[label] )\r
+ this.global[label] = [];\r
+ this.global[label].push( element );\r
+ \r
+ },\r
+ remove: function(element, label, fn) {\r
+ var timers = element.$timers, ret;\r
+ \r
+ if ( timers ) {\r
+ \r
+ if (!label) {\r
+ for ( label in timers )\r
+ this.remove(element, label, fn);\r
+ } else if ( timers[label] ) {\r
+ if ( fn ) {\r
+ if ( fn.$timerID ) {\r
+ window.clearInterval(timers[label][fn.$timerID]);\r
+ delete timers[label][fn.$timerID];\r
+ }\r
+ } else {\r
+ for ( var fn in timers[label] ) {\r
+ window.clearInterval(timers[label][fn]);\r
+ delete timers[label][fn];\r
+ }\r
+ }\r
+ \r
+ for ( ret in timers[label] ) break;\r
+ if ( !ret ) {\r
+ ret = null;\r
+ delete timers[label];\r
+ }\r
+ }\r
+ \r
+ for ( ret in timers ) break;\r
+ if ( !ret ) \r
+ element.$timers = null;\r
+ }\r
+ }\r
+ }\r
+});\r
+\r
+if (jQuery.browser.msie)\r
+ jQuery(window).one("unload", function() {\r
+ var global = jQuery.timer.global;\r
+ for ( var label in global ) {\r
+ var els = global[label], i = els.length;\r
+ while ( --i )\r
+ jQuery.timer.remove(els[i], label);\r
+ }\r
+ });\r
--- /dev/null
+//-----------------------------------------------
+// Barcode Magic JavaScript
+// Authors: Brandon W. King
+// Feb. 2009
+//-----------------------------------------------
+
+//---------------------------------------
+// BCMagic Core Processing AJAX Callback
+//---------------------------------------
+var bcmagic_process_callback = function(data, textStatus) {
+ if (textStatus != 'success')
+ {
+ bcmagic_message('AJAX Status: '+textStatus);
+ return;
+ }
+
+ for (key in data)
+ {
+ if (key == 'mode')
+ {
+ if (data['mode'] == 'clear')
+ {
+ bcmagic_status('','');
+ }
+ else if (data['mode'] == 'redirect')
+ {
+ if ('url' in data)
+ {
+ bcmagic_redirect(data['url']);
+ }
+ else
+ {
+ bcmagic_status('Error', 'No redirect URL provided by server');
+ }
+ }
+ else {
+ bcmagic_message('Message recieved!');
+ bcmagic_status(data['mode'], data['status']);
+ }
+
+ }
+ if (key == 'msg')
+ {
+ bcmagic_message(data['msg']);
+ }
+ }
+}
+
+var bcmagic_callback = function(data, textStatus)
+{
+ if (textStatus != 'success')
+ bcmagic_message('Failed!');
+ else
+ bcmagic_message('Success!');
+}
+
+var bcmagic_process = function(){
+ var magic = $("#id_magic");
+ var text = magic.attr('value');
+ magic.attr('value', '');
+
+ // Show what we have captured
+ bcmagic_message('Sent command to server');
+ $.post('/bcmagic/magic/', {'text': text}, bcmagic_process_callback, 'json');
+}
+
+var bcmagic_keyhandler = function(e) {
+ //Process upon enter key as input.
+ if (e.which == 13)
+ bcmagic_process();
+}
+
+//---------------------------------------
+// Utility Functions
+//---------------------------------------
+var bcmagic_message = function(text)
+{
+ // Show message
+ $("#bcm_msg").html(text);
+
+ // clear message after 3000ms
+ setTimeout(function() {
+ $("#bcm_msg").html('');
+ }, 3000);
+}
+
+var bcmagic_status = function(state, text)
+{
+ var msg = $('#bcm_status');
+ if (state.length > 0 || text.length > 0)
+ msg.html('<b>'+state+':</b> '+text);
+ else
+ msg.html('');
+}
+
+
+var bcmagic_redirect = function(url)
+{
+ bcmagic_message('Redirecting to:' + url);
+ window.location = url;
+}
+
+//---------------------------------------
+// Main Ready Function
+//---------------------------------------
+$(document).ready(function() {
+
+ // Grab initial focus on magic text input
+ $("#id_magic").focus();
+
+ // Set some initial text
+ //$("#id_magic").attr('value','Moo cow!');
+
+ // Trigger when enterkey is pressed
+ $("#id_magic").keypress(bcmagic_keyhandler)
+});
\ No newline at end of file
--- /dev/null
+
+
+var select_menu = function(item){
+ var choices = {'freezer': 0,
+ 'container': 1,
+ 'samples': 2};
+ $('#accordion').accordion('activate', choices[item]);
+}
+
+$(document).ready(function(){
+ $('#accordion').accordion({
+ header: "h3"
+ //fillSpace: true
+ });
+});
\ No newline at end of file
--- /dev/null
+/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion li {display: inline;}
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
+.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file
--- /dev/null
+@import "ui.base.css";
+@import "ui.theme.css";
--- /dev/null
+@import url("ui.core.css");
+
+@import url("ui.accordion.css");
+@import url("ui.datepicker.css");
+@import url("ui.dialog.css");
+@import url("ui.progressbar.css");
+@import url("ui.resizable.css");
+@import url("ui.slider.css");
+@import url("ui.tabs.css");
--- /dev/null
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
\ No newline at end of file
--- /dev/null
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:left; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}
\ No newline at end of file
--- /dev/null
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: relative; padding: .2em; width: 300px; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
\ No newline at end of file
--- /dev/null
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null
+/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
--- /dev/null
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: 1%; display: block; border: 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file
--- /dev/null
+/* Tabs
+----------------------------------*/
+.ui-tabs {padding: .2em;}
+.ui-tabs .ui-tabs-nav { padding: .2em .2em 0 .2em; position: relative; }
+.ui-tabs .ui-tabs-nav li { float: left; border-bottom: 0 !important; margin: 0 .2em -1px 0; padding: 0; list-style: none; }
+.ui-tabs .ui-tabs-nav li a { display:block; text-decoration: none; padding: .5em 1em; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: .1em; border-bottom: 0; }
+.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border: 0; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
\ No newline at end of file
--- /dev/null
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://ui.jquery.com/themeroller/?tr=&ffDefault=Lucida%20Grande,%20Lucida%20Sans,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=5px&bgColorHeader=5c9ccc&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=55&borderColorHeader=4297d7&fcHeader=ffffff&iconColorHeader=d8e7f3&bgColorContent=fcfdfd&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=a6c9e2&fcContent=222222&iconColorContent=469bdd&bgColorDefault=dfeffc&bgTextureDefault=02_glass.png&bgImgOpacityDefault=85&borderColorDefault=c5dbec&fcDefault=2e6e9e&iconColorDefault=6da8d5&bgColorHover=d0e5f5&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=79b7e7&fcHover=1d5987&iconColorHover=217bc0&bgColorActive=f5f8f9&bgTextureActive=06_inset_hard.png&bgImgOpacityActive=100&borderColorActive=79b7e7&fcActive=e17009&iconColorActive=f9bd01&bgColorHighlight=fbec88&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=55&borderColorHighlight=fad42e&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1em; }
+.ui-widget-header { border: 1px solid #4297d7; background: #5c9ccc url(images/ui-bg_gloss-wave_55_5c9ccc_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+.ui-widget-content { border: 1px solid #a6c9e2; background: #fcfdfd url(images/ui-bg_inset-hard_100_fcfdfd_1x100.png) 50% bottom repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #c5dbec; background: #dfeffc url(images/ui-bg_glass_85_dfeffc_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #2e6e9e; outline: none; }
+.ui-state-default a { color: #2e6e9e; text-decoration: none; outline: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #79b7e7; background: #d0e5f5 url(images/ui-bg_glass_75_d0e5f5_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1d5987; outline: none; }
+.ui-state-hover a { color: #1d5987; text-decoration: none; outline: none; }
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #79b7e7; background: #f5f8f9 url(images/ui-bg_inset-hard_100_f5f8f9_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #e17009; outline: none; }
+.ui-state-active a { color: #e17009; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fad42e; background: #fbec88 url(images/ui-bg_flat_55_fbec88_40x100.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_469bdd_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_469bdd_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_d8e7f3_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_6da8d5_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_217bc0_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_f9bd01_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; }
+.ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; }
+.ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
+.ui-corner-top { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
+.ui-corner-right { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
+.ui-corner-left { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; }
+.ui-corner-all { -moz-border-radius: 5px; -webkit-border-radius: 5px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }
\ No newline at end of file